diff options
Diffstat (limited to 'ebus-datastore/ebus/web_static')
99 files changed, 36962 insertions, 0 deletions
diff --git a/ebus-datastore/ebus/web_static/control.html b/ebus-datastore/ebus/web_static/control.html new file mode 100644 index 0000000..db9e7b8 --- /dev/null +++ b/ebus-datastore/ebus/web_static/control.html @@ -0,0 +1,52 @@ +<html> +<head> + <title>Control Panel</title> + <script src="lib/d3-v2.6.1/d3.js" type="text/javascript"></script> + <script src="lib/d3-v2.6.1/d3.time.js" type="text/javascript"></script> + <script src="src/d3.plot.js" type="text/javascript"></script> + <script src="src/d3.control.js" type="text/javascript"></script> + <style> + path { + stroke: steelblue; + stroke-width: 2; + fill: none; + } + line { + stroke: black; + } + div.popup { + position: absolute; + border: 2px solid gray; + background-color: #fefefe; + } + div.popup .plot { + margin: 5px; + } + </style> +</head> +<body> + <div id="image"></div> + <script type="text/javascript"> + var mapping = { + /* id : { options } */ + "heizkesselWert":{ + type:"text", + sensor:"heizkreisregler10.betriebsdatenRegler1.kesselTemperatur", + range:7*60*60*24*1000 /*7 days*/}, + "tempkollektorWert":{ + type:"text", + sensor:"heizkreisregler9.solarDaten.tempKollektor", + range:7*60*60*24*1000}, + "temperatur_oel":{ + type:"text", + sensor:"feuerungsautomat1.betriebsdatenRegler1.boilerTemperatur", + range:7*60*60*24*1000}, + "temperatur_holz":{ + type:"text", + sensor:"feuerungsautomat1.betriebsdatenRegler1.boilerTemperatur", + range:7*60*60*24*1000}, + }; + var control = d3.control(d3.select("#image"), "draw.svg", mapping); +</script> +</body> +</html> diff --git a/ebus-datastore/ebus/web_static/css/stylesheet.css b/ebus-datastore/ebus/web_static/css/stylesheet.css new file mode 100644 index 0000000..f114bc7 --- /dev/null +++ b/ebus-datastore/ebus/web_static/css/stylesheet.css @@ -0,0 +1,22 @@ +body { + font-family:sans; + text-align:center; +} + +#ebusgraph { + margin:auto; + width:100%; + height: 60%; +} + +#overview { + width: 100%; + margin:auto; + height:100px; +} + +#options { + width:800px; + margin:auto; + text-align:left; +} diff --git a/ebus-datastore/ebus/web_static/draw.svg b/ebus-datastore/ebus/web_static/draw.svg new file mode 100644 index 0000000..e3c46b5 --- /dev/null +++ b/ebus-datastore/ebus/web_static/draw.svg @@ -0,0 +1,1073 @@ +<?xml version="1.0" encoding="UTF-8" standalone="no"?> +<!-- Created with Inkscape (http://www.inkscape.org/) --> + +<svg + xmlns:dc="http://purl.org/dc/elements/1.1/" + xmlns:cc="http://creativecommons.org/ns#" + xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" + xmlns:svg="http://www.w3.org/2000/svg" + xmlns="http://www.w3.org/2000/svg" + xmlns:xlink="http://www.w3.org/1999/xlink" + xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd" + xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape" + width="744.09448" + height="353" + id="svg2" + version="1.1" + inkscape:version="0.48.1 r9760" + sodipodi:docname="draw.svg"> + <defs + id="defs4"> + <linearGradient + y2="713.54688" + x2="122.41663" + y1="743.14014" + x1="78.645653" + gradientTransform="matrix(-0.345461,-1.103135,0.825546,-0.25853,-265.0855,1483.115)" + gradientUnits="userSpaceOnUse" + id="linearGradient9276" + xlink:href="#linearGradient14625" + inkscape:collect="always" /> + <linearGradient + y2="1102.4946" + x2="94.621376" + y1="1126.6776" + x1="82.560005" + gradientTransform="matrix(1.100206,-1.253837,0.450605,0.395393,-311.0192,864.0529)" + gradientUnits="userSpaceOnUse" + id="linearGradient9274" + xlink:href="#linearGradient14630" + inkscape:collect="always" /> + <linearGradient + y2="1102.4946" + x2="94.621376" + y1="1126.6776" + x1="82.560005" + gradientTransform="matrix(-1.29476,-1.051738,-0.377976,0.465313,867.8056,-33.65123)" + gradientUnits="userSpaceOnUse" + id="linearGradient4573" + xlink:href="#linearGradient14630" + inkscape:collect="always" /> + <linearGradient + y2="563.04645" + x2="-928.93262" + y1="563.04645" + x1="-960.98315" + gradientTransform="matrix(-0.517458,-0.406703,0.362432,-0.746852,-331.7413,418.2)" + gradientUnits="userSpaceOnUse" + id="linearGradient4570" + xlink:href="#linearGradient26051" + inkscape:collect="always" /> + <linearGradient + y2="1102.4946" + x2="94.621376" + y1="1126.6776" + x1="82.560005" + gradientTransform="matrix(1.668101,0,0,0.599484,24.8374,-275.556)" + gradientUnits="userSpaceOnUse" + id="linearGradient4551" + xlink:href="#linearGradient14630" + inkscape:collect="always" /> + <linearGradient + y2="733.95215" + x2="142.51085" + y1="789.25323" + x1="96.398148" + gradientTransform="matrix(1.155963,0,0,0.86508,22.4424,-276.1547)" + gradientUnits="userSpaceOnUse" + id="linearGradient4548" + xlink:href="#linearGradient14625" + inkscape:collect="always" /> + <linearGradient + y2="1102.4946" + x2="94.621376" + y1="1126.6776" + x1="82.560005" + gradientTransform="matrix(1.553052,0.608761,-0.218777,0.558138,242.0222,-319.1418)" + gradientUnits="userSpaceOnUse" + id="linearGradient4545" + xlink:href="#linearGradient14630" + inkscape:collect="always" /> + <linearGradient + y2="1102.4946" + x2="94.621376" + y1="1126.6776" + x1="82.560005" + gradientTransform="matrix(1.170077,-1.188899,0.427268,0.420504,-456.6731,35.74577)" + gradientUnits="userSpaceOnUse" + id="linearGradient4542" + xlink:href="#linearGradient14630" + inkscape:collect="always" /> + <linearGradient + y2="1102.4946" + x2="94.621376" + y1="1126.6776" + x1="82.560005" + gradientTransform="matrix(0.690893,-1.518297,0.545648,0.248294,-495.0386,283.926)" + gradientUnits="userSpaceOnUse" + id="linearGradient4539" + xlink:href="#linearGradient14630" + inkscape:collect="always" /> + <linearGradient + y2="1102.4946" + x2="94.621376" + y1="1126.6776" + x1="82.560005" + gradientTransform="matrix(-0.702859,-1.512796,0.543671,-0.252595,-290.3977,830.24)" + gradientUnits="userSpaceOnUse" + id="linearGradient4536" + xlink:href="#linearGradient14630" + inkscape:collect="always" /> + <linearGradient + y2="1102.4946" + x2="94.621376" + y1="1126.6776" + x1="82.560005" + gradientTransform="matrix(0.256408,-1.648277,-0.592361,-9.214863e-2,850.9957,668.483)" + gradientUnits="userSpaceOnUse" + id="linearGradient4533" + xlink:href="#linearGradient14630" + inkscape:collect="always" /> + <linearGradient + y2="1102.4946" + x2="94.621376" + y1="1126.6776" + x1="82.560005" + gradientTransform="matrix(-0.748755,-1.490612,-0.535699,0.269089,944.8252,255.494)" + gradientUnits="userSpaceOnUse" + id="linearGradient4530" + xlink:href="#linearGradient14630" + inkscape:collect="always" /> + <linearGradient + y2="562.81714" + x2="-929.41113" + y1="562.81714" + x1="-961.27472" + gradientTransform="matrix(0.576903,-0.258281,0.261301,1.000143,490.2561,-420.3848)" + gradientUnits="userSpaceOnUse" + id="linearGradient4527" + xlink:href="#linearGradient26051" + inkscape:collect="always" /> + <linearGradient + y2="562.93964" + x2="-929.15558" + y1="562.93964" + x1="-961.11877" + gradientTransform="matrix(0.425108,-0.530506,0.575376,0.686628,219.5326,-461.4463)" + gradientUnits="userSpaceOnUse" + id="linearGradient4524" + xlink:href="#linearGradient26051" + inkscape:collect="always" /> + <linearGradient + y2="562.77002" + x2="-929.5094" + y1="562.77002" + x1="-961.33478" + gradientTransform="matrix(-1.958315e-2,-0.862393,1.179924,-2.524823e-2,-445.9464,-360.5484)" + gradientUnits="userSpaceOnUse" + id="linearGradient4521" + xlink:href="#linearGradient26051" + inkscape:collect="always" /> + <linearGradient + y2="562.9942" + x2="-929.04175" + y1="562.9942" + x1="-961.0495" + gradientTransform="matrix(-0.580197,-0.421526,0.406452,-0.774216,-466.2694,461.466)" + gradientUnits="userSpaceOnUse" + id="linearGradient4518" + xlink:href="#linearGradient26051" + inkscape:collect="always" /> + <linearGradient + y2="832.44" + x2="163.65744" + y1="927.5675" + x1="230.94295" + gradientTransform="matrix(1.318507,0,0,0.758434,23.0411,-277.3522)" + gradientUnits="userSpaceOnUse" + id="linearGradient4493" + xlink:href="#linearGradient14630" + inkscape:collect="always" /> + <linearGradient + y2="853.09821" + x2="153.33653" + y1="931.4588" + x1="124.57172" + gradientTransform="matrix(1.331709,0,0,0.750915,22.7417,-276.1547)" + gradientUnits="userSpaceOnUse" + id="linearGradient4489" + xlink:href="#linearGradient13377" + inkscape:collect="always" /> + <linearGradient + gradientTransform="translate(-385.82338,59.419123)" + gradientUnits="userSpaceOnUse" + y2="76.294113" + x2="507.62845" + y1="347.09793" + x1="494.24271" + id="linearGradient3563" + xlink:href="#linearGradient3557" + inkscape:collect="always" /> + <linearGradient + id="linearGradient14625"> + <stop + style="stop-color:#ffffff;stop-opacity:1.0000000;" + offset="0.0000000" + id="stop14626" /> + <stop + style="stop-color:#ffffff;stop-opacity:0;" + offset="1" + id="stop14627" /> + </linearGradient> + <linearGradient + id="linearGradient26051"> + <stop + style="stop-color:#ffffff;stop-opacity:0.44927537;" + offset="0.0000000" + id="stop26052" /> + <stop + style="stop-color:#ffffff;stop-opacity:0;" + offset="1" + id="stop26053" /> + </linearGradient> + <linearGradient + id="linearGradient17250"> + <stop + style="stop-color:#dc0000;stop-opacity:1.0000000;" + offset="0.0000000" + id="stop17251" /> + <stop + style="stop-color:#ffb200;stop-opacity:1.0000000;" + offset="1.0000000" + id="stop17252" /> + </linearGradient> + <linearGradient + inkscape:collect="always" + id="linearGradient14630"> + <stop + style="stop-color:#ffffff;stop-opacity:1;" + offset="0" + id="stop14631" /> + <stop + style="stop-color:#ffffff;stop-opacity:0;" + offset="1" + id="stop14632" /> + </linearGradient> + <linearGradient + inkscape:collect="always" + id="linearGradient13377"> + <stop + style="stop-color:#fdffff;stop-opacity:1;" + offset="0" + id="stop13378" /> + <stop + style="stop-color:#fdffff;stop-opacity:0;" + offset="1" + id="stop13379" /> + </linearGradient> + <linearGradient + id="linearGradient29186"> + <stop + style="stop-color:#ffffff;stop-opacity:1.0000000;" + offset="0.0000000" + id="stop29187" /> + <stop + style="stop-color:#ffffff;stop-opacity:0;" + offset="1" + id="stop29188" /> + </linearGradient> + <linearGradient + id="linearGradient3557" + inkscape:collect="always"> + <stop + id="stop3559" + offset="0" + style="stop-color:black;stop-opacity:1;" /> + <stop + id="stop3561" + offset="1" + style="stop-color:black;stop-opacity:0;" /> + </linearGradient> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient17250" + id="linearGradient3121" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.939411,0,0,1.446184,1125.509,-315.4759)" + x1="-1006.61" + y1="448.68289" + x2="-953.87994" + y2="299.88538" /> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient29186" + id="linearGradient3123" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.805965,0,0,1.240749,18.001,-263.9643)" + x1="9.6549549" + y1="256.78357" + x2="323.10443" + y2="500.80176" /> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient17250" + id="linearGradient3125" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.701579,0,0,1.93643,1125.509,-315.4759)" + x1="-1308.2009" + y1="330.19891" + x2="-1335.0436" + y2="272.82257" /> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient14625" + id="linearGradient3127" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(1.155963,0,0,0.86508,22.7417,-276.1547)" + x1="78.645653" + y1="743.14014" + x2="122.41663" + y2="713.54688" /> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient26051" + id="linearGradient3129" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.606945,0,0,1.647595,0.392598,-250.4193)" + x1="468.40564" + y1="232.90141" + x2="502.45129" + y2="232.90141" /> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient17250" + id="linearGradient3131" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.926747,0,0,1.465945,1125.509,-315.4759)" + x1="-916.89685" + y1="438.47348" + x2="-857.95917" + y2="362.15622" /> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient14625" + id="linearGradient3133" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.7951,0,0,1.257703,24.0962,-278.8637)" + x1="501.40482" + y1="384.39618" + x2="317.13544" + y2="485.78278" /> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient26051" + id="linearGradient3135" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.602527,0,0,1.659677,0.392598,-252.4511)" + x1="533.78339" + y1="294.8653" + x2="572.40991" + y2="294.8653" /> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient17250" + id="linearGradient3137" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.796212,0,0,1.70628,1125.509,-315.4759)" + x1="-1131.0251" + y1="404.58243" + x2="-1102.728" + y2="306.75836" /> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient26051" + id="linearGradient3139" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.544121,0,0,1.837828,0.392598,-250.4193)" + x1="349.43204" + y1="179.97382" + x2="390.31766" + y2="179.97382" /> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient14625" + id="linearGradient3141" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.683108,0,0,1.463898,22.7417,-283.6045)" + x1="198.88322" + y1="246.21246" + x2="342.54471" + y2="403.09412" /> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient14625" + id="linearGradient3143" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.601918,0,0,1.661356,26.29964,-269.4538)" + x1="110.44791" + y1="244.048" + x2="239.46423" + y2="376.90421" /> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient17250-4" + id="linearGradient3121-9" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.939411,0,0,1.446184,1125.509,-315.4759)" + x1="-1006.61" + y1="448.68289" + x2="-953.87994" + y2="299.88538" /> + <linearGradient + id="linearGradient17250-4"> + <stop + style="stop-color:#dc0000;stop-opacity:1.0000000;" + offset="0.0000000" + id="stop17251-7" /> + <stop + style="stop-color:#ffb200;stop-opacity:1.0000000;" + offset="1.0000000" + id="stop17252-8" /> + </linearGradient> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient29186-5" + id="linearGradient3123-4" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.805965,0,0,1.240749,18.001,-263.9643)" + x1="9.6549549" + y1="256.78357" + x2="323.10443" + y2="500.80176" /> + <linearGradient + id="linearGradient29186-5"> + <stop + style="stop-color:#ffffff;stop-opacity:1.0000000;" + offset="0.0000000" + id="stop29187-0" /> + <stop + style="stop-color:#ffffff;stop-opacity:0;" + offset="1" + id="stop29188-3" /> + </linearGradient> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient17250-4" + id="linearGradient3125-6" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.701579,0,0,1.93643,1125.509,-315.4759)" + x1="-1308.2009" + y1="330.19891" + x2="-1335.0436" + y2="272.82257" /> + <linearGradient + id="linearGradient3985"> + <stop + style="stop-color:#dc0000;stop-opacity:1.0000000;" + offset="0.0000000" + id="stop3987" /> + <stop + style="stop-color:#ffb200;stop-opacity:1.0000000;" + offset="1.0000000" + id="stop3989" /> + </linearGradient> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient14625-0" + id="linearGradient3127-1" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(1.155963,0,0,0.86508,22.7417,-276.1547)" + x1="78.645653" + y1="743.14014" + x2="122.41663" + y2="713.54688" /> + <linearGradient + id="linearGradient14625-0"> + <stop + style="stop-color:#ffffff;stop-opacity:1.0000000;" + offset="0.0000000" + id="stop14626-6" /> + <stop + style="stop-color:#ffffff;stop-opacity:0;" + offset="1" + id="stop14627-3" /> + </linearGradient> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient26051-0" + id="linearGradient3129-2" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.606945,0,0,1.647595,0.392598,-250.4193)" + x1="468.40564" + y1="232.90141" + x2="502.45129" + y2="232.90141" /> + <linearGradient + id="linearGradient26051-0"> + <stop + style="stop-color:#ffffff;stop-opacity:0.44927537;" + offset="0.0000000" + id="stop26052-6" /> + <stop + style="stop-color:#ffffff;stop-opacity:0;" + offset="1" + id="stop26053-1" /> + </linearGradient> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient17250-4" + id="linearGradient3131-5" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.926747,0,0,1.465945,1125.509,-315.4759)" + x1="-916.89685" + y1="438.47348" + x2="-857.95917" + y2="362.15622" /> + <linearGradient + id="linearGradient4000"> + <stop + style="stop-color:#dc0000;stop-opacity:1.0000000;" + offset="0.0000000" + id="stop4002" /> + <stop + style="stop-color:#ffb200;stop-opacity:1.0000000;" + offset="1.0000000" + id="stop4004" /> + </linearGradient> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient14625-0" + id="linearGradient3133-5" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.7951,0,0,1.257703,24.0962,-278.8637)" + x1="501.40482" + y1="384.39618" + x2="317.13544" + y2="485.78278" /> + <linearGradient + id="linearGradient4007"> + <stop + style="stop-color:#ffffff;stop-opacity:1.0000000;" + offset="0.0000000" + id="stop4009" /> + <stop + style="stop-color:#ffffff;stop-opacity:0;" + offset="1" + id="stop4011" /> + </linearGradient> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient26051-0" + id="linearGradient3135-4" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.602527,0,0,1.659677,0.392598,-252.4511)" + x1="533.78339" + y1="294.8653" + x2="572.40991" + y2="294.8653" /> + <linearGradient + id="linearGradient4014"> + <stop + style="stop-color:#ffffff;stop-opacity:0.44927537;" + offset="0.0000000" + id="stop4016" /> + <stop + style="stop-color:#ffffff;stop-opacity:0;" + offset="1" + id="stop4018" /> + </linearGradient> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient17250-4" + id="linearGradient3137-7" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.796212,0,0,1.70628,1125.509,-315.4759)" + x1="-1131.0251" + y1="404.58243" + x2="-1102.728" + y2="306.75836" /> + <linearGradient + id="linearGradient4021"> + <stop + style="stop-color:#dc0000;stop-opacity:1.0000000;" + offset="0.0000000" + id="stop4023" /> + <stop + style="stop-color:#ffb200;stop-opacity:1.0000000;" + offset="1.0000000" + id="stop4025" /> + </linearGradient> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient26051-0" + id="linearGradient3139-6" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.544121,0,0,1.837828,0.392598,-250.4193)" + x1="349.43204" + y1="179.97382" + x2="390.31766" + y2="179.97382" /> + <linearGradient + id="linearGradient4028"> + <stop + style="stop-color:#ffffff;stop-opacity:0.44927537;" + offset="0.0000000" + id="stop4030" /> + <stop + style="stop-color:#ffffff;stop-opacity:0;" + offset="1" + id="stop4032" /> + </linearGradient> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient14625-0" + id="linearGradient3141-5" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.683108,0,0,1.463898,22.7417,-283.6045)" + x1="198.88322" + y1="246.21246" + x2="342.54471" + y2="403.09412" /> + <linearGradient + id="linearGradient4035"> + <stop + style="stop-color:#ffffff;stop-opacity:1.0000000;" + offset="0.0000000" + id="stop4037" /> + <stop + style="stop-color:#ffffff;stop-opacity:0;" + offset="1" + id="stop4039" /> + </linearGradient> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient14625-0" + id="linearGradient3143-6" + gradientUnits="userSpaceOnUse" + gradientTransform="matrix(0.601918,0,0,1.661356,26.29964,-269.4538)" + x1="110.44791" + y1="244.048" + x2="239.46423" + y2="376.90421" /> + <linearGradient + id="linearGradient4042"> + <stop + style="stop-color:#ffffff;stop-opacity:1.0000000;" + offset="0.0000000" + id="stop4044" /> + <stop + style="stop-color:#ffffff;stop-opacity:0;" + offset="1" + id="stop4046" /> + </linearGradient> + </defs> + <sodipodi:namedview + id="base" + pagecolor="#ffffff" + bordercolor="#666666" + borderopacity="1.0" + inkscape:pageopacity="0.0" + inkscape:pageshadow="2" + inkscape:zoom="0.98994949" + inkscape:cx="331.61151" + inkscape:cy="140.47805" + inkscape:document-units="px" + inkscape:current-layer="layer1" + showgrid="false" + inkscape:window-width="1436" + inkscape:window-height="862" + inkscape:window-x="0" + inkscape:window-y="18" + inkscape:window-maximized="0" /> + <metadata + id="metadata7"> + <rdf:RDF> + <cc:Work + rdf:about=""> + <dc:format>image/svg+xml</dc:format> + <dc:type + rdf:resource="http://purl.org/dc/dcmitype/StillImage" /> + <dc:title /> + </cc:Work> + </rdf:RDF> + </metadata> + <g + inkscape:label="Ebene 1" + inkscape:groupmode="layer" + id="layer1" + transform="translate(0,-699.36011)"> + <g + id="g3954" + transform="translate(320,-11.428544)"> + <rect + y="905.71466" + x="17.752008" + height="131.31982" + width="77.781746" + id="rect2985" + style="opacity:0.98000004;fill:#ffffff;fill-opacity:1;stroke:#000000" /> + <text + sodipodi:linespacing="125%" + id="text2987" + y="903.1358" + x="14.663156" + style="font-size:18.44056702px;font-style:italic;font-variant:normal;font-weight:bold;font-stretch:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Linux Biolinum Slanted O;-inkscape-font-specification:Linux Biolinum Slanted O Bold Italic" + xml:space="preserve"><tspan + y="903.1358" + x="14.663156" + id="tspan2989" + sodipodi:role="line">Heizkessel</tspan></text> + <text + sodipodi:linespacing="125%" + id="text2993" + y="1035.0605" + x="26.89003" + style="font-size:20.3476944px;font-style:italic;font-variant:normal;font-weight:bold;font-stretch:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Linux Biolinum Slanted O;-inkscape-font-specification:Linux Biolinum Slanted O Bold Italic" + xml:space="preserve"><tspan + style="display:inline" + x="26.89003" + y="1035.0605" + id="tspan2995" + sodipodi:role="line"><tspan + id="heizkesselWert" + style="font-weight:normal;-inkscape-font-specification:Linux Biolinum Slanted O Italic">XXX</tspan> °C</tspan></text> + </g> + <path + style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" + d="m 539.01386,766.31511 -15.01382,0 0,237.83069 -119.00004,0" + id="path3058" + inkscape:connector-curvature="0" + sodipodi:nodetypes="cccc" /> + <g + id="g3095" + transform="translate(-190.71428,-8.5714271)"> + <rect + y="902.85754" + x="329.81479" + height="131.31982" + width="77.781746" + id="rect2985-1" + style="opacity:0.98000004;fill:#ffffff;fill-opacity:1;stroke:#000000" /> + <text + sodipodi:linespacing="125%" + id="text2987-9" + y="898.08942" + x="325.99301" + style="font-size:18.44056702px;font-style:italic;font-variant:normal;font-weight:bold;font-stretch:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Linux Biolinum Slanted O;-inkscape-font-specification:Linux Biolinum Slanted O Bold Italic" + xml:space="preserve"><tspan + y="898.08942" + x="325.99301" + id="tspan2989-47" + sodipodi:role="line">Holz</tspan></text> + <path + transform="matrix(1.0481376,0,0,0.60942325,296.73303,720.89972)" + d="m 97.984795,362.11163 c 0,26.77881 -13.341691,48.48733 -29.7995,48.48733 -16.457809,0 -29.799499,-21.70852 -29.799499,-48.48733 0,-26.77881 13.34169,-48.48732 29.799499,-48.48732 16.457809,0 29.7995,21.70851 29.7995,48.48732 z" + sodipodi:ry="48.487324" + sodipodi:rx="29.7995" + sodipodi:cy="362.11163" + sodipodi:cx="68.185295" + id="path3046-8" + style="opacity:0.98000004;fill:#ffffff;fill-opacity:1;stroke:#000000;stroke-width:1.58299994;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:3.166, 1.583;stroke-dashoffset:0" + sodipodi:type="arc" /> + <text + sodipodi:linespacing="125%" + id="text3048" + y="946.48315" + x="346.35474" + style="font-size:18.9864254px;font-style:italic;font-variant:normal;font-weight:bold;font-stretch:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Linux Biolinum Slanted O;-inkscape-font-specification:Linux Biolinum Slanted O Bold Italic" + xml:space="preserve"><tspan + y="946.48315" + x="346.35474" + id="tspan3050" + sodipodi:role="line"><tspan + id="temperatur_holz" + style="font-weight:normal;-inkscape-font-specification:Linux Biolinum Slanted O Italic">XX</tspan> °C</tspan></text> + <g + id="layer1-5" + inkscape:label="Layer 1" + transform="matrix(0.22131573,0,0,0.22131573,260.27179,946.67008)"> + <g + transform="translate(243.44676,29.294424)" + id="g9278"> + <path + inkscape:connector-curvature="0" + d="m 135.30628,265.02207 c 19.34779,57.177 49.95772,87.4982 104.82457,90.9635 60.35355,19.3477 116.37549,-20.2141 100.49298,-82.3003 -7.21932,13.2835 -11.83968,20.5029 -24.25693,24.2569 4.90915,-34.364 -26.5671,-40.1394 -11.26214,-77.1024 10.68461,-22.813 17.03761,-50.824 -1.73263,-73.63705 -7.79687,25.98955 -17.32637,43.31595 -36.38539,62.37495 2.02141,-31.765 18.77023,-57.46582 8.66318,-87.4982 1.44387,-20.21411 -31.76502,-19.63656 -32.05379,-81.433972 -21.08042,26.56712 -30.03238,47.069994 -26.85588,87.498202 -7.79688,32.63133 -26.85587,44.47107 -23.3906,79.70137 -2.88773,-19.6366 -4.90914,-36.6742 -0.86633,-51.11285 -2.31018,-17.90391 -4.62037,-33.20889 -22.52428,-45.9149 5.48669,22.23552 11.83969,55.73318 -6.93055,64.10755 -5.19791,10.6846 -31.18748,47.3588 -2.59896,104.8246 -8.37441,-4.9091 -16.74884,-6.353 -25.12325,-14.7274 z" + id="path15991" + style="fill:url(#linearGradient3121);fill-opacity:1;fill-rule:evenodd;stroke:#ffff00;stroke-width:2.1563108;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50381679" /> + <path + inkscape:connector-curvature="0" + d="m 237.3145,53.086958 c -14.99272,19.6852 -21.35119,44.824274 -19.43988,69.336882 1.42824,11.98691 -4.94471,23.14648 -9.48162,33.85446 -8.34272,15.96187 -15.88957,33.39387 -13.60832,51.83627 -0.65803,10.6267 -5.37917,-0.0876 -4.88201,-5.4325 -2.26101,-15.0353 -3.22798,-30.6271 -0.14386,-45.52138 -1.55449,-14.49363 -5.22591,-30.20475 -17.19431,-39.72998 3.55402,17.20403 8.17212,36.5942 -0.40625,53.03126 -3.07779,5.5067 -9.96235,7.0124 -11.40127,13.6249 -14.44272,25.3005 -15.53094,56.8434 -4.56582,83.6283 2.28194,6.1006 5.25844,11.9243 7.84209,17.903 -8.0473,-4.5949 -16.87846,-7.7132 -24.65625,-12.75 10.77369,31.5464 31.25961,62.5809 63.599,74.8578 12.71752,5.4142 26.58607,6.4191 40.02243,8.5564 29.45045,9.1939 65.99724,3.1529 85.42735,-22.475 11.41608,-14.8269 14.58747,-34.8363 10.70122,-52.9079 -5.14255,10.4007 -14.05368,18.83 -25.5625,21.5 2.648,-13.3531 -1.38352,-26.7154 -8.28212,-38.1368 -7.44722,-12.1869 -9.19816,-27.5924 -3.25495,-40.7594 9.01742,-19.7648 15.83315,-43.6826 5.33139,-64.25316 -3.24996,-9.49614 -5.5378,-3.66685 -7.18432,3.05922 -6.86632,21.12134 -20.73135,39.08884 -36.4225,54.49634 1.08657,-21.5478 8.60459,-41.9354 11.79956,-63.11733 1.82434,-10.79074 -0.2714,-21.61899 -2.53052,-32.06873 -1.53783,-11.74214 -13.77556,-17.76553 -18.93886,-27.820728 -9.20134,-13.3735 -12.2617,-29.995394 -12.79893,-45.961924 -1.32292,1.75 -2.64583,3.5 -3.96875,5.25 z" + id="path29198" + style="fill:url(#linearGradient3123);fill-opacity:1;fill-rule:evenodd;stroke:none" /> + <path + inkscape:connector-curvature="0" + d="m 234.06662,347.32237 c -45.91489,-48.5139 -53.71176,-82.3003 -23.3906,-114.3541 34.0752,-60.6423 25.70078,-98.76034 0.86632,-135.145718 23.3906,80.567618 -27.72221,132.546718 -44.18226,155.937318 -9.81827,-30.3211 -1.44387,-43.3159 12.12847,-80.5676 -26.56712,28.8773 -42.73841,63.8188 -32.92012,97.0277 17.90392,49.9577 60.06476,60.9311 87.49819,77.1024 z" + id="path15990" + style="fill:url(#linearGradient3125);fill-opacity:1;fill-rule:evenodd;stroke:#ffff00;stroke-width:2.1563108;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50381679" /> + <path + inkscape:connector-curvature="0" + d="m 289.78874,164.02436 c -6.15481,-17.90098 -1.13221,-21.73459 4.25922,-29.55503 5.56163,-2.16613 3.85697,-9.71866 6.89186,-26.53845 4.59515,18.77349 16.93135,27.30949 -11.15108,56.09348 z" + id="path15994" + style="fill:#ffd700;fill-opacity:1;fill-rule:evenodd;stroke:#ffff00;stroke-width:2.1563108;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50381679" /> + <path + inkscape:connector-curvature="0" + d="m 137.41874,341.68107 26.98534,-14.8972 22.07902,17.6818 -5.38874,9.1479 -13.84243,5.939 -29.83319,-17.8715 z" + id="path24159" + style="fill:url(#linearGradient3127);fill-opacity:1;fill-rule:evenodd;stroke:none" /> + <path + inkscape:connector-curvature="0" + d="m 296.70508,104.9869 c -1.8714,7.98026 -1.0254,16.77505 -4.5,24.21875 -8.14108,6.21937 -11.69097,17.77603 -8.12116,27.5835 1.10834,8.21993 3.67934,9.63805 8.23707,2.13192 9.73188,-10.01426 18.83749,-24.36261 13.29618,-38.71175 -2.50026,-7.31882 -4.68961,-14.74903 -7.47459,-21.972418 -0.47917,2.249998 -0.95833,4.499998 -1.4375,6.749998 z" + id="path28563" + style="fill:url(#linearGradient3129);fill-opacity:1;fill-rule:evenodd;stroke:none" /> + <path + inkscape:connector-curvature="0" + d="m 329.36169,273.68527 c 15.88251,-15.305 12.70601,-21.9468 11.26214,-32.9201 -4.62036,-5.1979 1.15509,-12.1285 6.93055,-31.1875 -14.72742,17.0376 -32.0538,19.3478 -18.19269,64.1076 z" + id="path15993" + style="fill:#ffd700;fill-opacity:1;fill-rule:evenodd;stroke:#ffff00;stroke-width:2.1563108;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50381679" /> + <path + inkscape:connector-curvature="0" + d="m 254.85827,347.32237 c 17.90392,-10.1071 22.81305,-41.8721 25.12325,-77.1024 4.33159,-34.0752 12.99478,-68.1504 70.17182,-73.6371 -23.39062,18.7703 -42.44962,41.8721 -33.78644,84.8993 -2.31018,62.6637 -48.80262,60.3535 -61.50863,65.8402 z" + id="path15992" + style="fill:url(#linearGradient3131);fill-opacity:1;fill-rule:evenodd;stroke:#ffff00;stroke-width:2.1563108;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50381679" /> + <path + inkscape:connector-curvature="0" + d="m 343.565,191.60497 c -24.38123,3.4569 -49.51237,18.1046 -56.66827,42.9832 -11.48365,31.097 -5.13799,66.4903 -20.80048,96.3606 -5.94812,2.585 -4.49399,13.6743 2.85181,11.5046 21.51646,-3.9012 41.93765,-18.849 47.38887,-40.7861 5.2576,-15.2337 2.27636,-31.3498 1.71705,-46.9973 0.71542,-22.6934 13.85513,-43.1578 31.10477,-57.1587 3.01956,-4.349 -2.01656,-5.8119 -5.59375,-5.9063 z" + id="path26056" + style="fill:url(#linearGradient3133);fill-opacity:1;fill-rule:evenodd;stroke:none" /> + <path + inkscape:connector-curvature="0" + d="m 343.86133,203.48637 c -9.82497,10.4001 -24.0785,20.1331 -23.73462,36.1235 -0.72619,11.4565 3.35351,22.3796 5.89087,33.3765 8.52867,-8.1385 18.22308,-18.74 15.09898,-31.5746 -0.0222,-5.6554 -4.28458,-10.6025 -0.93838,-16.1128 3.2139,-8.7256 6.57589,-17.4081 8.80815,-26.4688 -1.70833,1.5521 -3.41667,3.1042 -5.125,4.6562 z" + id="path28562" + style="fill:url(#linearGradient3135);fill-opacity:1;fill-rule:evenodd;stroke:none" /> + <path + inkscape:connector-curvature="0" + d="m 223.6708,323.93177 c -2.31019,-27.7222 -5.48669,-47.6476 29.45484,-72.7708 59.19844,-41.2945 30.03238,-65.2627 -6.93055,-108.28985 10.97337,42.73835 -6.64178,76.81355 -21.65798,99.62665 -9.81827,14.1499 -43.89347,43.0272 -0.86631,81.434 z" + id="path15989" + style="fill:url(#linearGradient3137);fill-opacity:1;fill-rule:evenodd;stroke:#ffff00;stroke-width:2.1563108;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50381679" /> + <path + inkscape:connector-curvature="0" + d="m 201.08933,120.58171 c 15.98844,-18.41045 11.88217,-25.988498 9.27078,-38.664238 -5.5549,-5.843464 0.13128,-14.122384 4.68167,-36.476504 -14.55919,20.37399 -33.34836,23.76285 -13.95245,75.140742 z" + id="path15995" + style="fill:#ffd700;fill-opacity:1;fill-rule:evenodd;stroke:#ffff00;stroke-width:2.1563108;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50381679" /> + <path + inkscape:connector-curvature="0" + d="m 211.20508,41.518148 c -9.30969,12.17423 -23.42746,23.40799 -22.6875,40.281254 -0.10028,14.02936 5.4291,27.118428 9.5625,40.281248 8.44026,-9.6347 17.42012,-21.86984 13.66358,-35.446138 0.0257,-5.37156 -3.737,-9.541874 -3.84544,-14.615204 2.05688,-11.97534 6.31265,-23.54307 7.99436,-35.62616 -1.5625,1.70833 -3.125,3.41667 -4.6875,5.125 z" + id="path28564" + style="fill:url(#linearGradient3139);fill-opacity:1;fill-rule:evenodd;stroke:none" /> + <path + inkscape:connector-curvature="0" + d="m 245.30425,135.70802 c 6.40508,29.13536 -0.19164,59.82845 -14.93562,85.42475 -9.15363,17.5973 -27.2009,31.0743 -28.92062,52.011 -2.7585,18.2445 10.38732,33.4514 22.56898,45.241 4.96184,6.239 0.70889,-8.5105 1.38422,-11.9632 -1.97971,-17.9487 1.09873,-38.0878 15.5825,-50.3998 16.12514,-15.6874 39.12358,-26.5619 46.8475,-49.1093 5.22432,-19.9129 -8.69668,-37.76184 -20.83869,-51.90179 -7.32268,-8.88533 -15.04301,-17.40614 -22.71952,-25.99016 0.34375,2.22917 0.6875,4.45833 1.03125,6.6875 z" + id="path26055" + style="fill:url(#linearGradient3141);fill-opacity:1;fill-rule:evenodd;stroke:none" /> + <path + inkscape:connector-curvature="0" + d="m 216.20594,109.85866 c 0.63387,13.77775 4.55106,27.42117 2.75732,41.32831 -1.5823,32.4669 -15.84784,62.9987 -35.54194,88.4141 -3.65343,5.1912 -7.54448,10.2093 -11.30913,15.3201 -5.03417,-16.7728 -2.76155,-34.8581 4.01864,-50.7747 3.57049,-8.5047 6.07648,-17.3319 7.38761,-26.47531 -18.82095,17.16941 -32.10356,40.57371 -36.78125,65.62501 -3.79164,23.1694 4.35914,46.9902 19.73048,64.403 19.32727,22.8014 47.11664,35.6135 74.05077,47.0657 -15.26216,-21.468 -36.50831,-40.8391 -41.02033,-67.9622 -3.09495,-15.7494 3.10673,-31.5567 13.44976,-43.3319 11.83939,-16.266 19.21325,-35.6153 23.59367,-55.1462 5.68892,-25.43627 1.12856,-52.93969 -12.7731,-74.99716 -3.43037,-2.50771 -9.55995,-15.684492 -7.5625,-3.46875 z" + id="path26054" + style="fill:url(#linearGradient3143);fill-opacity:1;fill-rule:evenodd;stroke:none" /> + </g> + </g> + </g> + <g + id="g3084" + transform="translate(389.28571,-8.5714286)"> + <text + sodipodi:linespacing="125%" + id="text2987-8" + y="743.71051" + x="206.36427" + style="font-size:18.44056702px;font-style:italic;font-variant:normal;font-weight:bold;font-stretch:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Linux Biolinum Slanted O;-inkscape-font-specification:Linux Biolinum Slanted O Bold Italic" + xml:space="preserve"><tspan + y="743.71051" + x="206.36427" + id="tspan2989-4" + sodipodi:role="line">Kollektor: <tspan + id="tempkollektorWert" + style="font-weight:normal;-inkscape-font-specification:Linux Biolinum Slanted O Italic">XXX</tspan> °C</tspan></text> + <path + inkscape:connector-curvature="0" + id="path3138" + d="m 306.76606,791.91313 -12.1917,-15.84216 9.87347,17.80337 -9.97137,-17.3258 7.41242,18.96052 -7.5731,-18.50027 4.81909,19.77933 -5.03968,-19.34459 2.13976,20.24516 -2.41633,-19.84371 -0.57774,20.34973 0.25013,-19.98872 -3.28494,20.09116 2.91214,-19.77704 -5.93352,19.47405 5.52217,-19.21242 -8.47622,18.50944 8.03367,-18.30497 -10.86765,17.21451 10.40181,-17.07085 -13.06517,15.6124 12.58432,-15.53212 -15.02951,13.73169 14.54226,-13.71621 -16.72567,11.60593 16.2407,-11.65553 -18.12335,9.27305 17.64932,-9.38685 -19.19762,6.77471 18.74299,-6.95068 -19.92931,4.15547 19.50219,-4.39047 -20.30536,1.46208 19.91337,-1.75191 -20.31906,-1.2574 19.9692,0.91791 -19.97017,-3.95445 19.66868,3.57136 -19.26491,-6.58093 19.01717,6.16107 -18.21587,-9.08997 18.0263,8.64084 -16.84175,-11.43681 16.71374,10.96642 -15.16711,-13.57955 15.10294,13.09629 -13.2218,-15.47996 13.22261,14.99246 -11.04055,-17.10413 11.10634,16.62109 -8.66229,-18.42308 8.79186,17.95312 -6.12944,-19.41327 6.32051,18.96477 -3.48722,-20.05703 3.73635,19.638 -0.78276,-20.34287 1.08553,19.96079 1.93566,-20.2657 -1.58468,19.92738 4.61955,-19.82688 -4.22659,19.53836 7.22099,-19.03425 -6.79309,18.80068 9.69358,-17.90195 -9.23837,17.72749 11.99319,-16.45019 -11.51878,16.33797 14.07878,-14.70488 -13.59365,14.65689 15.91313,-12.69715 -15.42593,12.71426 17.46351,-10.46286 -16.98293,10.54474 18.70224,-8.04184 -18.23688,8.18705 19.60725,-5.47732 -19.16538,5.68326 20.16236,-2.81506 -19.75189,3.07806 20.35767,-0.10256 -19.98591,0.41793 20.18969,2.61176 -19.86329,-2.24967 19.66144,5.27949 -19.38622,-4.87711 18.78234,7.85299 -18.56319,-7.41752 17.56804,10.28636 -17.4089,-9.82557 16.04025,12.53617 -15.94394,-12.05828 14.22622,14.56227 -14.19447,-14.07581 z" + inkscape:transform-center-y="-1.2124102" + inkscape:transform-center-x="0.98497389" + style="opacity:0.98000004;fill:#ffff00;fill-opacity:1;stroke:#ffff00;stroke-width:0.82573485;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:1.65146976, 0.82573488;stroke-dashoffset:0" /> + <g + transform="translate(338.59482,84.506185)" + id="g3254"> + <path + sodipodi:nodetypes="ssssscssccsssssssssssscsssssccssssssscsscsssssssssscccccsssc" + inkscape:connector-curvature="0" + id="path3262" + d="m -141.64871,731.31997 c -22.71912,-19.44593 -41.57543,-35.35622 -41.90292,-35.35622 -0.32748,0 -1.38939,-0.93725 -2.35979,-2.08277 -0.9704,-1.14552 -7.90154,-7.32971 -15.40255,-13.74263 -7.501,-6.41292 -13.63819,-11.94371 -13.63819,-12.29064 0,-0.88187 32.94299,-40.77529 33.63762,-40.7346 0.31135,0.0182 2.09744,1.36979 3.96908,3.00344 3.28207,2.86475 3.35476,3.04536 2.04582,5.08275 -1.35586,2.11043 -1.3229,2.14175 34.24589,32.54236 17.1942,14.70863 2.10006,2.23702 49.76002,42.17705 3.337624,3.54064 12.833354,11.65568 13.638778,11.65568 0.374084,0 1.368139,-0.635 2.209022,-1.41111 1.415168,-1.30616 1.790534,-1.19664 5.047204,1.4725 1.935081,1.58598 3.518332,3.2382 3.518332,3.6716 0,0.60316 -27.142705,34.25352 -32.452888,40.2337 -0.798338,0.89908 -9.597358,-6.21682 -42.315428,-34.22111 z m 55.643272,1.80366 c 3.369577,-4.09088 6.031292,-7.52437 5.914922,-7.62997 -0.116371,-0.1056 -3.134056,-2.6544 -6.705963,-5.66399 -3.571906,-3.00959 -7.468532,-6.32401 -8.659167,-7.36537 -18.785954,-16.43073 -83.388544,-71.25434 -83.964104,-71.25434 -0.428,0 -3.79888,3.63115 -7.49085,8.06923 l -6.71267,8.06923 2.99805,2.74906 c 6.28446,5.76252 25.34774,22.23643 27.19665,23.50251 1.06397,0.72858 7.73348,6.34831 14.82114,12.48828 45.0405,39.01819 54.37458,46.69552 55.42343,45.58612 0.578623,-0.61204 3.808977,-4.45988 7.178562,-8.55076 z m -6.845773,-7.63839 -5.621765,-4.84248 -1.594264,2.23206 c -2.83332,3.96681 -9.24307,2.0621 -9.24307,-2.74664 0,-1.96694 1.60967,-4.36691 3.25883,-4.85882 0.60173,-0.17948 -3.00265,-3.81087 -8.00973,-8.06975 -5.00708,-4.25888 -9.10377,-7.19989 -9.10377,-6.53558 0,3.85753 -6.76833,5.48036 -9.04303,2.16822 -1.84953,-2.69305 -1.69925,-3.94115 0.77882,-6.46847 l 2.1268,-2.16906 -8.81055,-7.52721 c -8.35729,-7.13998 -8.84757,-7.42514 -9.53022,-5.54308 -0.8623,2.37734 -2.17164,3.32697 -4.61231,3.34516 -4.31354,0.0322 -6.32588,-6.65891 -2.76722,-9.20103 1.16504,-0.83225 1.58826,-1.65868 1.0824,-2.11364 -0.45686,-0.41089 -3.72549,-3.24889 -7.26362,-6.30667 -6.03575,-5.21631 -6.4753,-5.4429 -7.11851,-3.66958 -0.37705,1.03952 -1.65513,2.34058 -2.84017,2.89126 -4.9528,2.30149 -9.04335,-5.04194 -4.84885,-8.70476 1.6688,-1.45726 1.60964,-1.57837 -2.69206,-5.51089 -4.33567,-3.96356 -4.37391,-4.0434 -2.68305,-5.60092 1.67653,-1.54433 2.77013,-0.6785 48.36917,38.2949 25.65962,21.93122 47.175072,40.37583 47.812101,40.98803 0.963913,0.92633 0.96529,1.42821 0.0078,2.99122 -0.632534,1.03298 -1.348578,1.86061 -1.591208,1.83918 -0.24263,-0.0215 -2.970934,-2.21808 -6.062915,-4.88145 z m -36.808149,23.46605 c -0.29434,-0.48572 -0.12251,-0.88313 0.38185,-0.88313 0.50437,0 0.91703,0.39741 0.91703,0.88313 0,0.48572 -0.17183,0.88312 -0.38185,0.88312 -0.21002,0 -0.62268,-0.3974 -0.91703,-0.88312 z" + style="fill:#cacaca" /> + <path + sodipodi:nodetypes="ccscscscssscccssscsccssscsscccccscssssssscsssscccsssssssscssscsssss" + inkscape:connector-curvature="0" + id="path3260" + d="m -141.70294,730.79802 c -19.70363,-14.08884 -39.13144,-33.87071 -55.75597,-47.91474 -6.52563,-5.49424 -13.14755,-11.1008 -14.71536,-12.45902 l -2.85057,-2.46949 16.61467,-20.21663 c 9.13806,-11.11914 16.69487,-20.32309 16.79289,-20.45321 0.098,-0.13012 1.7884,1.2608 3.7564,3.09094 l 3.57817,3.32752 -9.94372,11.87508 c -5.46905,6.53129 -9.94372,11.95688 -9.94372,12.05686 0,0.1 5.57145,4.93405 12.381,10.74237 6.80956,5.80833 13.49072,11.60947 14.84703,12.89144 26.78141,21.10707 22.69793,19.28577 46.45645,39.59158 l 26.492029,22.6407 9.697878,-11.84664 c 5.333839,-6.51565 10.005573,-11.84664 10.381649,-11.84664 0.376067,0 2.105823,1.29157 3.843891,2.87016 l 3.160128,2.87016 -16.400307,19.85766 c -9.020177,10.92171 -16.709328,19.94057 -17.087018,20.04191 -0.37767,0.10135 -18.96517,-15.49116 -41.30552,-34.65001 z m 56.268003,14.46643 c 8.061849,-9.79926 14.937938,-18.28594 15.280192,-18.85928 0.352246,-0.59009 -0.262676,-1.89033 -1.417082,-2.99639 l -2.039355,-1.95396 -9.745494,11.7612 c -5.360025,6.46867 -10.222295,11.71497 -10.805048,11.65847 -0.582753,-0.0565 -16.544136,-13.36963 -35.469746,-29.58471 -18.94546,-13.73014 -37.5743,-32.11549 -53.48048,-45.78046 l -13.62042,-11.67063 9.94399,-12.04378 9.944,-12.04379 -2.19523,-2.23168 c -1.43393,-1.45773 -2.41119,-1.89629 -2.81795,-1.26459 -0.3425,0.53189 -7.40344,9.19475 -15.69099,19.25079 -8.28755,10.05604 -14.71698,18.59076 -14.28763,18.96604 0.42936,0.37529 5.65143,4.84671 11.60461,9.9365 5.95318,5.08979 18.03271,15.42525 26.84342,22.96768 56.51704,48.38165 72.22034,61.70544 72.72547,61.70544 0.3134,0 7.165885,-8.01758 15.227743,-17.81685 z m -7.855917,-20.58612 c -2.857526,-2.64073 -5.445508,-4.81682 -5.751064,-4.83576 -0.305565,-0.0189 -0.798575,0.95304 -1.095582,2.15994 -0.61291,2.49054 -4.28466,3.8934 -6.49261,2.48061 -0.75973,-0.48613 -1.76306,-1.97694 -2.22962,-3.31291 -0.73489,-2.1043 -0.53626,-2.70279 1.48574,-4.4766 l 2.33403,-2.04754 -8.8211,-7.57633 -8.8211,-7.57634 -1.12922,2.19802 c -2.56146,4.98588 -9.24388,3.01172 -8.70422,-2.57147 0.16368,-1.69349 0.94934,-3.02345 2.1421,-3.62616 1.7596,-0.88914 1.26079,-1.48573 -7.57677,-9.06202 -7.2849,-6.24522 -9.46038,-7.71108 -9.46038,-6.37449 0,2.27319 -3.71861,4.74263 -6.01994,3.9977 -3.90318,-1.26344 -4.44878,-7.77734 -0.76774,-9.1661 1.62055,-0.6114 0.97197,-1.42003 -5.92672,-7.38933 l -7.74641,-6.7028 -0.95129,2.57037 c -0.80454,2.17381 -1.42577,2.57036 -4.02676,2.57036 -4.95501,0 -6.78966,-5.7403 -2.70668,-8.46874 l 2.16155,-1.44445 -4.32634,-3.58926 c -4.4612,-3.70114 -5.1153,-5.04226 -3.23534,-6.63349 0.99717,-0.84403 17.71344,13.13391 94.466073,78.99136 2.027856,1.74 2.280608,2.35424 1.409323,3.42494 -1.653165,2.03152 -2.643601,1.60452 -8.20993,-3.53951 z" + style="fill:#084af1" /> + <path + sodipodi:nodetypes="ccscscscssscccssscsccssscsscccccscssssssscsssscccsssssssscssscsssssssssssssssssssssss" + inkscape:connector-curvature="0" + id="path3258" + d="m -141.70294,730.79802 c -19.70363,-14.08884 -39.13144,-33.87071 -55.75597,-47.91474 -6.52563,-5.49424 -13.14755,-11.1008 -14.71536,-12.45902 l -2.85057,-2.46949 16.61467,-20.21663 c 9.13806,-11.11914 16.69487,-20.32309 16.79289,-20.45321 0.098,-0.13012 1.7884,1.2608 3.7564,3.09094 l 3.57817,3.32752 -9.94372,11.87508 c -5.46905,6.53129 -9.94372,11.95688 -9.94372,12.05686 0,0.1 5.57145,4.93405 12.381,10.74237 6.80956,5.80833 13.49072,11.60947 14.84703,12.89144 26.78141,21.10707 22.69793,19.28577 46.45645,39.59158 l 26.492029,22.6407 9.697878,-11.84664 c 5.333839,-6.51565 10.005573,-11.84664 10.381649,-11.84664 0.376067,0 2.105823,1.29157 3.843891,2.87016 l 3.160128,2.87016 -16.400307,19.85766 c -9.020177,10.92171 -16.709328,19.94057 -17.087018,20.04191 -0.37767,0.10135 -18.96517,-15.49116 -41.30552,-34.65001 z m 56.268003,14.46643 c 8.061849,-9.79926 14.937938,-18.28594 15.280192,-18.85928 0.352246,-0.59009 -0.262676,-1.89033 -1.417082,-2.99639 l -2.039355,-1.95396 -9.745494,11.7612 c -5.360025,6.46867 -10.222295,11.71497 -10.805048,11.65847 -0.582753,-0.0565 -16.544136,-13.36963 -35.469746,-29.58471 -18.94546,-13.73014 -37.5743,-32.11549 -53.48048,-45.78046 l -13.62042,-11.67063 9.94399,-12.04378 9.944,-12.04379 -2.19523,-2.23168 c -1.43393,-1.45773 -2.41119,-1.89629 -2.81795,-1.26459 -0.3425,0.53189 -7.40344,9.19475 -15.69099,19.25079 -8.28755,10.05604 -14.71698,18.59076 -14.28763,18.96604 0.42936,0.37529 5.65143,4.84671 11.60461,9.9365 5.95318,5.08979 18.03271,15.42525 26.84342,22.96768 56.51704,48.38165 72.22034,61.70544 72.72547,61.70544 0.3134,0 7.165885,-8.01758 15.227743,-17.81685 z m -7.855917,-20.58612 c -2.857526,-2.64073 -5.445508,-4.81682 -5.751064,-4.83576 -0.305565,-0.0189 -0.798575,0.95304 -1.095582,2.15994 -0.61291,2.49054 -4.28466,3.8934 -6.49261,2.48061 -0.75973,-0.48613 -1.76306,-1.97694 -2.22962,-3.31291 -0.73489,-2.1043 -0.53626,-2.70279 1.48574,-4.4766 l 2.33403,-2.04754 -8.8211,-7.57633 -8.8211,-7.57634 -1.12922,2.19802 c -2.56146,4.98588 -9.24388,3.01172 -8.70422,-2.57147 0.16368,-1.69349 0.94934,-3.02345 2.1421,-3.62616 1.7596,-0.88914 1.26079,-1.48573 -7.57677,-9.06202 -7.2849,-6.24522 -9.46038,-7.71108 -9.46038,-6.37449 0,2.27319 -3.71861,4.74263 -6.01994,3.9977 -3.90318,-1.26344 -4.44878,-7.77734 -0.76774,-9.1661 1.62055,-0.6114 0.97197,-1.42003 -5.92672,-7.38933 l -7.74641,-6.7028 -0.95129,2.57037 c -0.80454,2.17381 -1.42577,2.57036 -4.02676,2.57036 -4.95501,0 -6.78966,-5.7403 -2.70668,-8.46874 l 2.16155,-1.44445 -4.32634,-3.58926 c -4.4612,-3.70114 -5.1153,-5.04226 -3.23534,-6.63349 0.99717,-0.84403 17.71344,13.13391 94.466073,78.99136 2.027856,1.74 2.280608,2.35424 1.409323,3.42494 -1.653165,2.03152 -2.643601,1.60452 -8.20993,-3.53951 z m -9.126616,-2.61999 c 1.39088,-1.70921 0.31669,-4.89958 -1.64967,-4.89958 -2.4706,0 -3.81387,2.18896 -2.67505,4.35918 1.11901,2.13243 2.85289,2.34909 4.32472,0.5404 z m -23.84179,-20.4156 c 1.86378,-1.90082 0.27164,-5.01365 -2.36745,-4.62868 -2.17675,0.31754 -2.94808,2.86824 -1.43108,4.73243 1.33185,1.63667 2.11294,1.61534 3.79853,-0.10375 z m -23.31618,-22.45838 c 0,-1.72542 -0.49612,-2.26649 -2.27066,-2.47637 -2.43692,-0.28822 -3.69168,1.44456 -2.78705,3.84883 0.32712,0.8694 1.34869,1.27403 2.78705,1.10391 1.77454,-0.20988 2.27066,-0.75094 2.27066,-2.47637 z m -20.78446,-16.77148 c 0.7387,-2.3737 -0.11655,-3.54041 -2.59529,-3.54041 -2.47874,0 -3.334,1.16671 -2.5953,3.54041 0.3432,1.1028 1.31077,1.75835 2.5953,1.75835 1.28452,0 2.25209,-0.65555 2.59529,-1.75835 z" + style="fill:#686868" /> + <path + inkscape:connector-curvature="0" + id="path3256" + d="m -93.290854,724.21682 c -5.650575,-4.88726 -6.093301,-5.11007 -6.531783,-3.28723 -0.258703,1.07545 -1.424043,2.44028 -2.589643,3.03294 -2.87198,1.46029 -5.50687,-0.32662 -5.86645,-3.97847 -0.21233,-2.15635 0.18365,-2.95556 1.92559,-3.88638 2.1918,-1.17123 2.1882,-1.17583 -7.2792,-9.29207 l -9.47209,-8.12026 -1.11907,2.39248 c -0.7513,1.60623 -1.91675,2.48601 -3.54631,2.67708 -4.93352,0.57846 -6.72744,-4.44693 -2.7317,-7.65245 l 2.18856,-1.75573 -9.30755,-8.03849 c -8.79076,-7.59217 -9.34738,-7.92868 -10.02494,-6.06065 -1.42821,3.93754 -5.85089,4.60031 -8.033,1.20381 -1.61808,-2.51858 -0.57089,-5.46204 2.333,-6.55761 1.51187,-0.57039 0.67241,-1.56294 -6.27773,-7.42256 l -8.02298,-6.76412 -1.5594,2.61518 c -1.97838,3.31784 -5.29108,3.52331 -7.26516,0.45061 -1.6479,-2.56499 -0.99967,-5.4643 1.39502,-6.23945 2.48539,-0.80452 2.14176,-1.52638 -2.71475,-5.70283 -3.85706,-3.31696 -4.2459,-3.94533 -3.13961,-5.07361 1.1063,-1.12828 6.98696,3.60455 47.48165,38.21383 25.42043,21.72589 46.789541,40.04177 47.486916,40.70196 1.113318,1.05396 1.113318,1.35805 0,2.49349 -1.113326,1.13543 -2.00716,0.65379 -7.32937,-3.94947 z m -9.126616,-2.15848 c 1.39088,-1.70921 0.31669,-4.89958 -1.64967,-4.89958 -2.4706,0 -3.81387,2.18896 -2.67505,4.35918 1.11901,2.13243 2.85289,2.34909 4.32472,0.5404 z m -23.84179,-20.4156 c 1.86378,-1.90082 0.27164,-5.01365 -2.36745,-4.62868 -2.17675,0.31754 -2.94808,2.86824 -1.43108,4.73243 1.33185,1.63667 2.11294,1.61534 3.79853,-0.10375 z m -23.31618,-22.45838 c 0,-1.72542 -0.49612,-2.26649 -2.27066,-2.47637 -2.43692,-0.28822 -3.69168,1.44456 -2.78705,3.84883 0.32712,0.8694 1.34869,1.27403 2.78705,1.10391 1.77454,-0.20988 2.27066,-0.75094 2.27066,-2.47637 z m -20.78446,-16.77148 c 0.7387,-2.3737 -0.11655,-3.54041 -2.59529,-3.54041 -2.47874,0 -3.334,1.16671 -2.5953,3.54041 0.3432,1.1028 1.31077,1.75835 2.5953,1.75835 1.28452,0 2.25209,-0.65555 2.59529,-1.75835 z" + style="fill:#050606" /> + </g> + </g> + <g + id="g3950"> + <path + sodipodi:nodetypes="cccc" + inkscape:connector-curvature="0" + id="path3058-1" + d="m 577.72122,796.48048 -25.7281,0 0,219.97352 -144.00005,0" + style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" /> + <path + inkscape:connector-curvature="0" + d="m 538.17131,877.50741 14.36578,-14.36577 14.27031,14.27032 m -0.0571,-0.78216 c 0,7.90271 -6.40642,14.30913 -14.30914,14.30913 -7.90272,0 -14.30914,-6.40642 -14.30914,-14.30913 0,-7.90272 6.40642,-14.30914 14.30914,-14.30914 7.90272,0 14.30914,6.40642 14.30914,14.30914 z" + style="fill:#ffffff;stroke:#000000;stroke-width:1.88988566;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" + id="path3947" + sodipodi:nodetypes="cccsssss" /> + </g> + <g + id="g3095-9" + transform="translate(-300.74096,-9.7303817)"> + <rect + y="902.85754" + x="329.81479" + height="131.31982" + width="77.781746" + id="rect2985-1-3" + style="opacity:0.98000004;fill:#ffffff;fill-opacity:1;stroke:#000000" /> + <text + sodipodi:linespacing="125%" + id="text2987-9-7" + y="898.08942" + x="325.99301" + style="font-size:18.44056702px;font-style:italic;font-variant:normal;font-weight:bold;font-stretch:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Linux Biolinum Slanted O;-inkscape-font-specification:Linux Biolinum Slanted O Bold Italic" + xml:space="preserve"><tspan + y="898.08942" + x="325.99301" + id="tspan2989-47-4" + sodipodi:role="line">Öl</tspan></text> + <path + transform="matrix(1.0481376,0,0,0.60942325,296.73303,720.89972)" + d="m 97.984795,362.11163 c 0,26.77881 -13.341691,48.48733 -29.7995,48.48733 -16.457809,0 -29.799499,-21.70852 -29.799499,-48.48733 0,-26.77881 13.34169,-48.48732 29.799499,-48.48732 16.457809,0 29.7995,21.70851 29.7995,48.48732 z" + sodipodi:ry="48.487324" + sodipodi:rx="29.7995" + sodipodi:cy="362.11163" + sodipodi:cx="68.185295" + id="path3046-8-5" + style="opacity:0.98000004;fill:#ffffff;fill-opacity:1;stroke:#000000;stroke-width:1.58299994;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:3.166, 1.583;stroke-dashoffset:0" + sodipodi:type="arc" /> + <text + sodipodi:linespacing="125%" + id="text3048-2" + y="946.48315" + x="346.35474" + style="font-size:18.9864254px;font-style:italic;font-variant:normal;font-weight:bold;font-stretch:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Linux Biolinum Slanted O;-inkscape-font-specification:Linux Biolinum Slanted O Bold Italic" + xml:space="preserve"><tspan + y="946.48315" + x="346.35474" + id="tspan3050-5" + sodipodi:role="line"><tspan + id="temperatur_oel" + style="font-weight:normal;-inkscape-font-specification:Linux Biolinum Slanted O Italic">XX</tspan> °C</tspan></text> + <g + id="layer1-5-7" + inkscape:label="Layer 1" + transform="matrix(0.22131573,0,0,0.22131573,260.27179,946.67008)"> + <g + transform="translate(243.44676,29.294424)" + id="g9278-4"> + <path + inkscape:connector-curvature="0" + d="m 135.30628,265.02207 c 19.34779,57.177 49.95772,87.4982 104.82457,90.9635 60.35355,19.3477 116.37549,-20.2141 100.49298,-82.3003 -7.21932,13.2835 -11.83968,20.5029 -24.25693,24.2569 4.90915,-34.364 -26.5671,-40.1394 -11.26214,-77.1024 10.68461,-22.813 17.03761,-50.824 -1.73263,-73.63705 -7.79687,25.98955 -17.32637,43.31595 -36.38539,62.37495 2.02141,-31.765 18.77023,-57.46582 8.66318,-87.4982 1.44387,-20.21411 -31.76502,-19.63656 -32.05379,-81.433972 -21.08042,26.56712 -30.03238,47.069994 -26.85588,87.498202 -7.79688,32.63133 -26.85587,44.47107 -23.3906,79.70137 -2.88773,-19.6366 -4.90914,-36.6742 -0.86633,-51.11285 -2.31018,-17.90391 -4.62037,-33.20889 -22.52428,-45.9149 5.48669,22.23552 11.83969,55.73318 -6.93055,64.10755 -5.19791,10.6846 -31.18748,47.3588 -2.59896,104.8246 -8.37441,-4.9091 -16.74884,-6.353 -25.12325,-14.7274 z" + id="path15991-4" + style="fill:url(#linearGradient3121-9);fill-opacity:1;fill-rule:evenodd;stroke:#ffff00;stroke-width:2.1563108;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50381679" /> + <path + inkscape:connector-curvature="0" + d="m 237.3145,53.086958 c -14.99272,19.6852 -21.35119,44.824274 -19.43988,69.336882 1.42824,11.98691 -4.94471,23.14648 -9.48162,33.85446 -8.34272,15.96187 -15.88957,33.39387 -13.60832,51.83627 -0.65803,10.6267 -5.37917,-0.0876 -4.88201,-5.4325 -2.26101,-15.0353 -3.22798,-30.6271 -0.14386,-45.52138 -1.55449,-14.49363 -5.22591,-30.20475 -17.19431,-39.72998 3.55402,17.20403 8.17212,36.5942 -0.40625,53.03126 -3.07779,5.5067 -9.96235,7.0124 -11.40127,13.6249 -14.44272,25.3005 -15.53094,56.8434 -4.56582,83.6283 2.28194,6.1006 5.25844,11.9243 7.84209,17.903 -8.0473,-4.5949 -16.87846,-7.7132 -24.65625,-12.75 10.77369,31.5464 31.25961,62.5809 63.599,74.8578 12.71752,5.4142 26.58607,6.4191 40.02243,8.5564 29.45045,9.1939 65.99724,3.1529 85.42735,-22.475 11.41608,-14.8269 14.58747,-34.8363 10.70122,-52.9079 -5.14255,10.4007 -14.05368,18.83 -25.5625,21.5 2.648,-13.3531 -1.38352,-26.7154 -8.28212,-38.1368 -7.44722,-12.1869 -9.19816,-27.5924 -3.25495,-40.7594 9.01742,-19.7648 15.83315,-43.6826 5.33139,-64.25316 -3.24996,-9.49614 -5.5378,-3.66685 -7.18432,3.05922 -6.86632,21.12134 -20.73135,39.08884 -36.4225,54.49634 1.08657,-21.5478 8.60459,-41.9354 11.79956,-63.11733 1.82434,-10.79074 -0.2714,-21.61899 -2.53052,-32.06873 -1.53783,-11.74214 -13.77556,-17.76553 -18.93886,-27.820728 -9.20134,-13.3735 -12.2617,-29.995394 -12.79893,-45.961924 -1.32292,1.75 -2.64583,3.5 -3.96875,5.25 z" + id="path29198-3" + style="fill:url(#linearGradient3123-4);fill-opacity:1;fill-rule:evenodd;stroke:none" /> + <path + inkscape:connector-curvature="0" + d="m 234.06662,347.32237 c -45.91489,-48.5139 -53.71176,-82.3003 -23.3906,-114.3541 34.0752,-60.6423 25.70078,-98.76034 0.86632,-135.145718 23.3906,80.567618 -27.72221,132.546718 -44.18226,155.937318 -9.81827,-30.3211 -1.44387,-43.3159 12.12847,-80.5676 -26.56712,28.8773 -42.73841,63.8188 -32.92012,97.0277 17.90392,49.9577 60.06476,60.9311 87.49819,77.1024 z" + id="path15990-0" + style="fill:url(#linearGradient3125-6);fill-opacity:1;fill-rule:evenodd;stroke:#ffff00;stroke-width:2.1563108;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50381679" /> + <path + inkscape:connector-curvature="0" + d="m 289.78874,164.02436 c -6.15481,-17.90098 -1.13221,-21.73459 4.25922,-29.55503 5.56163,-2.16613 3.85697,-9.71866 6.89186,-26.53845 4.59515,18.77349 16.93135,27.30949 -11.15108,56.09348 z" + id="path15994-7" + style="fill:#ffd700;fill-opacity:1;fill-rule:evenodd;stroke:#ffff00;stroke-width:2.1563108;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50381679" /> + <path + inkscape:connector-curvature="0" + d="m 137.41874,341.68107 26.98534,-14.8972 22.07902,17.6818 -5.38874,9.1479 -13.84243,5.939 -29.83319,-17.8715 z" + id="path24159-8" + style="fill:url(#linearGradient3127-1);fill-opacity:1;fill-rule:evenodd;stroke:none" /> + <path + inkscape:connector-curvature="0" + d="m 296.70508,104.9869 c -1.8714,7.98026 -1.0254,16.77505 -4.5,24.21875 -8.14108,6.21937 -11.69097,17.77603 -8.12116,27.5835 1.10834,8.21993 3.67934,9.63805 8.23707,2.13192 9.73188,-10.01426 18.83749,-24.36261 13.29618,-38.71175 -2.50026,-7.31882 -4.68961,-14.74903 -7.47459,-21.972418 -0.47917,2.249998 -0.95833,4.499998 -1.4375,6.749998 z" + id="path28563-6" + style="fill:url(#linearGradient3129-2);fill-opacity:1;fill-rule:evenodd;stroke:none" /> + <path + inkscape:connector-curvature="0" + d="m 329.36169,273.68527 c 15.88251,-15.305 12.70601,-21.9468 11.26214,-32.9201 -4.62036,-5.1979 1.15509,-12.1285 6.93055,-31.1875 -14.72742,17.0376 -32.0538,19.3478 -18.19269,64.1076 z" + id="path15993-8" + style="fill:#ffd700;fill-opacity:1;fill-rule:evenodd;stroke:#ffff00;stroke-width:2.1563108;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50381679" /> + <path + inkscape:connector-curvature="0" + d="m 254.85827,347.32237 c 17.90392,-10.1071 22.81305,-41.8721 25.12325,-77.1024 4.33159,-34.0752 12.99478,-68.1504 70.17182,-73.6371 -23.39062,18.7703 -42.44962,41.8721 -33.78644,84.8993 -2.31018,62.6637 -48.80262,60.3535 -61.50863,65.8402 z" + id="path15992-8" + style="fill:url(#linearGradient3131-5);fill-opacity:1;fill-rule:evenodd;stroke:#ffff00;stroke-width:2.1563108;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50381679" /> + <path + inkscape:connector-curvature="0" + d="m 343.565,191.60497 c -24.38123,3.4569 -49.51237,18.1046 -56.66827,42.9832 -11.48365,31.097 -5.13799,66.4903 -20.80048,96.3606 -5.94812,2.585 -4.49399,13.6743 2.85181,11.5046 21.51646,-3.9012 41.93765,-18.849 47.38887,-40.7861 5.2576,-15.2337 2.27636,-31.3498 1.71705,-46.9973 0.71542,-22.6934 13.85513,-43.1578 31.10477,-57.1587 3.01956,-4.349 -2.01656,-5.8119 -5.59375,-5.9063 z" + id="path26056-4" + style="fill:url(#linearGradient3133-5);fill-opacity:1;fill-rule:evenodd;stroke:none" /> + <path + inkscape:connector-curvature="0" + d="m 343.86133,203.48637 c -9.82497,10.4001 -24.0785,20.1331 -23.73462,36.1235 -0.72619,11.4565 3.35351,22.3796 5.89087,33.3765 8.52867,-8.1385 18.22308,-18.74 15.09898,-31.5746 -0.0222,-5.6554 -4.28458,-10.6025 -0.93838,-16.1128 3.2139,-8.7256 6.57589,-17.4081 8.80815,-26.4688 -1.70833,1.5521 -3.41667,3.1042 -5.125,4.6562 z" + id="path28562-3" + style="fill:url(#linearGradient3135-4);fill-opacity:1;fill-rule:evenodd;stroke:none" /> + <path + inkscape:connector-curvature="0" + d="m 223.6708,323.93177 c -2.31019,-27.7222 -5.48669,-47.6476 29.45484,-72.7708 59.19844,-41.2945 30.03238,-65.2627 -6.93055,-108.28985 10.97337,42.73835 -6.64178,76.81355 -21.65798,99.62665 -9.81827,14.1499 -43.89347,43.0272 -0.86631,81.434 z" + id="path15989-1" + style="fill:url(#linearGradient3137-7);fill-opacity:1;fill-rule:evenodd;stroke:#ffff00;stroke-width:2.1563108;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50381679" /> + <path + inkscape:connector-curvature="0" + d="m 201.08933,120.58171 c 15.98844,-18.41045 11.88217,-25.988498 9.27078,-38.664238 -5.5549,-5.843464 0.13128,-14.122384 4.68167,-36.476504 -14.55919,20.37399 -33.34836,23.76285 -13.95245,75.140742 z" + id="path15995-4" + style="fill:#ffd700;fill-opacity:1;fill-rule:evenodd;stroke:#ffff00;stroke-width:2.1563108;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50381679" /> + <path + inkscape:connector-curvature="0" + d="m 211.20508,41.518148 c -9.30969,12.17423 -23.42746,23.40799 -22.6875,40.281254 -0.10028,14.02936 5.4291,27.118428 9.5625,40.281248 8.44026,-9.6347 17.42012,-21.86984 13.66358,-35.446138 0.0257,-5.37156 -3.737,-9.541874 -3.84544,-14.615204 2.05688,-11.97534 6.31265,-23.54307 7.99436,-35.62616 -1.5625,1.70833 -3.125,3.41667 -4.6875,5.125 z" + id="path28564-9" + style="fill:url(#linearGradient3139-6);fill-opacity:1;fill-rule:evenodd;stroke:none" /> + <path + inkscape:connector-curvature="0" + d="m 245.30425,135.70802 c 6.40508,29.13536 -0.19164,59.82845 -14.93562,85.42475 -9.15363,17.5973 -27.2009,31.0743 -28.92062,52.011 -2.7585,18.2445 10.38732,33.4514 22.56898,45.241 4.96184,6.239 0.70889,-8.5105 1.38422,-11.9632 -1.97971,-17.9487 1.09873,-38.0878 15.5825,-50.3998 16.12514,-15.6874 39.12358,-26.5619 46.8475,-49.1093 5.22432,-19.9129 -8.69668,-37.76184 -20.83869,-51.90179 -7.32268,-8.88533 -15.04301,-17.40614 -22.71952,-25.99016 0.34375,2.22917 0.6875,4.45833 1.03125,6.6875 z" + id="path26055-2" + style="fill:url(#linearGradient3141-5);fill-opacity:1;fill-rule:evenodd;stroke:none" /> + <path + inkscape:connector-curvature="0" + d="m 216.20594,109.85866 c 0.63387,13.77775 4.55106,27.42117 2.75732,41.32831 -1.5823,32.4669 -15.84784,62.9987 -35.54194,88.4141 -3.65343,5.1912 -7.54448,10.2093 -11.30913,15.3201 -5.03417,-16.7728 -2.76155,-34.8581 4.01864,-50.7747 3.57049,-8.5047 6.07648,-17.3319 7.38761,-26.47531 -18.82095,17.16941 -32.10356,40.57371 -36.78125,65.62501 -3.79164,23.1694 4.35914,46.9902 19.73048,64.403 19.32727,22.8014 47.11664,35.6135 74.05077,47.0657 -15.26216,-21.468 -36.50831,-40.8391 -41.02033,-67.9622 -3.09495,-15.7494 3.10673,-31.5567 13.44976,-43.3319 11.83939,-16.266 19.21325,-35.6153 23.59367,-55.1462 5.68892,-25.43627 1.12856,-52.93969 -12.7731,-74.99716 -3.43037,-2.50771 -9.55995,-15.684492 -7.5625,-3.46875 z" + id="path26054-0" + style="fill:url(#linearGradient3143-6);fill-opacity:1;fill-rule:evenodd;stroke:none" /> + </g> + </g> + </g> + <path + id="path4228" + transform="translate(0,699.36011)" + style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" + d="m 194.28571,203.71429 0,-56.38525 m 152.85715,107.81382 -29.28572,0 0,-107.85715 -242.85714,0 0,47.85715 m 127.14286,9.28571 0,-49.32532 m 145,108.61104 -35,0 0,-108.57143 -230.714289,0 0,44.28571" + inkscape:connector-curvature="0" + sodipodi:nodetypes="cccccccccccccc" /> + </g> +</svg> diff --git a/ebus-datastore/ebus/web_static/index.html b/ebus-datastore/ebus/web_static/index.html new file mode 100644 index 0000000..04ecc15 --- /dev/null +++ b/ebus-datastore/ebus/web_static/index.html @@ -0,0 +1,16 @@ +<html> + <head> + <link rel="stylesheet" type="text/css" href="static/css/stylesheet.css" /> + <script src="static/lib/jquery-1.6.2/jquery-1.6.2.min.js"></script> + <script src="static/lib/flot-0.7/jquery.flot.js"></script> + <script src="static/lib/flot-0.7/jquery.flot.selection.js"></script> + <script src="static/src/ebus.js"></script> + </head> + <body> + <div id="ebusgraph"></div> + <div id="options"> + <div id="sensorpicker"></div> + </div> + <div id="overview"></div> + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/d3-v2.6.1/d3.js b/ebus-datastore/ebus/web_static/lib/d3-v2.6.1/d3.js new file mode 100644 index 0000000..d71f57d --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/d3-v2.6.1/d3.js @@ -0,0 +1,4676 @@ +(function(){if (!Date.now) Date.now = function() { + return +new Date; +}; +try { + document.createElement("div").style.setProperty("opacity", 0, ""); +} catch (error) { + var d3_style_prototype = CSSStyleDeclaration.prototype, + d3_style_setProperty = d3_style_prototype.setProperty; + d3_style_prototype.setProperty = function(name, value, priority) { + d3_style_setProperty.call(this, name, value + "", priority); + }; +} +d3 = {version: "2.6.1"}; // semver +var d3_array = d3_arraySlice; // conversion for NodeLists + +function d3_arrayCopy(pseudoarray) { + var i = -1, n = pseudoarray.length, array = []; + while (++i < n) array.push(pseudoarray[i]); + return array; +} + +function d3_arraySlice(pseudoarray) { + return Array.prototype.slice.call(pseudoarray); +} + +try { + d3_array(document.documentElement.childNodes)[0].nodeType; +} catch(e) { + d3_array = d3_arrayCopy; +} + +var d3_arraySubclass = [].__proto__? + +// Until ECMAScript supports array subclassing, prototype injection works well. +function(array, prototype) { + array.__proto__ = prototype; +}: + +// And if your browser doesn't support __proto__, we'll use direct extension. +function(array, prototype) { + for (var property in prototype) array[property] = prototype[property]; +}; +function d3_this() { + return this; +} +d3.functor = function(v) { + return typeof v === "function" ? v : function() { return v; }; +}; +// Copies a variable number of methods from source to target. +d3.rebind = function(target, source) { + var i = 1, n = arguments.length, method; + while (++i < n) target[method = arguments[i]] = d3_rebind(target, source, source[method]); + return target; +}; + +// Method is assumed to be a standard D3 getter-setter: +// If passed with no arguments, gets the value. +// If passed with arguments, sets the value and returns the target. +function d3_rebind(target, source, method) { + return function() { + var value = method.apply(source, arguments); + return arguments.length ? target : value; + }; +} +d3.ascending = function(a, b) { + return a < b ? -1 : a > b ? 1 : a >= b ? 0 : NaN; +}; +d3.descending = function(a, b) { + return b < a ? -1 : b > a ? 1 : b >= a ? 0 : NaN; +}; +d3.mean = function(array, f) { + var n = array.length, + a, + m = 0, + i = -1, + j = 0; + if (arguments.length === 1) { + while (++i < n) if (d3_number(a = array[i])) m += (a - m) / ++j; + } else { + while (++i < n) if (d3_number(a = f.call(array, array[i], i))) m += (a - m) / ++j; + } + return j ? m : undefined; +}; +d3.median = function(array, f) { + if (arguments.length > 1) array = array.map(f); + array = array.filter(d3_number); + return array.length ? d3.quantile(array.sort(d3.ascending), .5) : undefined; +}; +d3.min = function(array, f) { + var i = -1, + n = array.length, + a, + b; + if (arguments.length === 1) { + while (++i < n && ((a = array[i]) == null || a != a)) a = undefined; + while (++i < n) if ((b = array[i]) != null && a > b) a = b; + } else { + while (++i < n && ((a = f.call(array, array[i], i)) == null || a != a)) a = undefined; + while (++i < n) if ((b = f.call(array, array[i], i)) != null && a > b) a = b; + } + return a; +}; +d3.max = function(array, f) { + var i = -1, + n = array.length, + a, + b; + if (arguments.length === 1) { + while (++i < n && ((a = array[i]) == null || a != a)) a = undefined; + while (++i < n) if ((b = array[i]) != null && b > a) a = b; + } else { + while (++i < n && ((a = f.call(array, array[i], i)) == null || a != a)) a = undefined; + while (++i < n) if ((b = f.call(array, array[i], i)) != null && b > a) a = b; + } + return a; +}; +d3.extent = function(array, f) { + var i = -1, + n = array.length, + a, + b, + c; + if (arguments.length === 1) { + while (++i < n && ((a = c = array[i]) == null || a != a)) a = c = undefined; + while (++i < n) if ((b = array[i]) != null) { + if (a > b) a = b; + if (c < b) c = b; + } + } else { + while (++i < n && ((a = c = f.call(array, array[i], i)) == null || a != a)) a = undefined; + while (++i < n) if ((b = f.call(array, array[i], i)) != null) { + if (a > b) a = b; + if (c < b) c = b; + } + } + return [a, c]; +}; +d3.random = { + normal: function(mean, deviation) { + if (arguments.length < 2) deviation = 1; + if (arguments.length < 1) mean = 0; + return function() { + var x, y, r; + do { + x = Math.random() * 2 - 1; + y = Math.random() * 2 - 1; + r = x * x + y * y; + } while (!r || r > 1); + return mean + deviation * x * Math.sqrt(-2 * Math.log(r) / r); + }; + } +}; +function d3_number(x) { + return x != null && !isNaN(x); +} +d3.sum = function(array, f) { + var s = 0, + n = array.length, + a, + i = -1; + + if (arguments.length === 1) { + while (++i < n) if (!isNaN(a = +array[i])) s += a; + } else { + while (++i < n) if (!isNaN(a = +f.call(array, array[i], i))) s += a; + } + + return s; +}; +// R-7 per <http://en.wikipedia.org/wiki/Quantile> +d3.quantile = function(values, p) { + var H = (values.length - 1) * p + 1, + h = Math.floor(H), + v = values[h - 1], + e = H - h; + return e ? v + e * (values[h] - v) : v; +}; +d3.transpose = function(matrix) { + return d3.zip.apply(d3, matrix); +}; +d3.zip = function() { + if (!(n = arguments.length)) return []; + for (var i = -1, m = d3.min(arguments, d3_zipLength), zips = new Array(m); ++i < m;) { + for (var j = -1, n, zip = zips[i] = new Array(n); ++j < n;) { + zip[j] = arguments[j][i]; + } + } + return zips; +}; + +function d3_zipLength(d) { + return d.length; +} +// Locate the insertion point for x in a to maintain sorted order. The +// arguments lo and hi may be used to specify a subset of the array which should +// be considered; by default the entire array is used. If x is already present +// in a, the insertion point will be before (to the left of) any existing +// entries. The return value is suitable for use as the first argument to +// `array.splice` assuming that a is already sorted. +// +// The returned insertion point i partitions the array a into two halves so that +// all v < x for v in a[lo:i] for the left side and all v >= x for v in a[i:hi] +// for the right side. +d3.bisectLeft = function(a, x, lo, hi) { + if (arguments.length < 3) lo = 0; + if (arguments.length < 4) hi = a.length; + while (lo < hi) { + var mid = (lo + hi) >> 1; + if (a[mid] < x) lo = mid + 1; + else hi = mid; + } + return lo; +}; + +// Similar to bisectLeft, but returns an insertion point which comes after (to +// the right of) any existing entries of x in a. +// +// The returned insertion point i partitions the array into two halves so that +// all v <= x for v in a[lo:i] for the left side and all v > x for v in a[i:hi] +// for the right side. +d3.bisect = +d3.bisectRight = function(a, x, lo, hi) { + if (arguments.length < 3) lo = 0; + if (arguments.length < 4) hi = a.length; + while (lo < hi) { + var mid = (lo + hi) >> 1; + if (x < a[mid]) hi = mid; + else lo = mid + 1; + } + return lo; +}; +d3.first = function(array, f) { + var i = 0, + n = array.length, + a = array[0], + b; + if (arguments.length === 1) f = d3.ascending; + while (++i < n) { + if (f.call(array, a, b = array[i]) > 0) { + a = b; + } + } + return a; +}; +d3.last = function(array, f) { + var i = 0, + n = array.length, + a = array[0], + b; + if (arguments.length === 1) f = d3.ascending; + while (++i < n) { + if (f.call(array, a, b = array[i]) <= 0) { + a = b; + } + } + return a; +}; +d3.nest = function() { + var nest = {}, + keys = [], + sortKeys = [], + sortValues, + rollup; + + function map(array, depth) { + if (depth >= keys.length) return rollup + ? rollup.call(nest, array) : (sortValues + ? array.sort(sortValues) + : array); + + var i = -1, + n = array.length, + key = keys[depth++], + keyValue, + object, + o = {}; + + while (++i < n) { + if ((keyValue = key(object = array[i])) in o) { + o[keyValue].push(object); + } else { + o[keyValue] = [object]; + } + } + + for (keyValue in o) { + o[keyValue] = map(o[keyValue], depth); + } + + return o; + } + + function entries(map, depth) { + if (depth >= keys.length) return map; + + var a = [], + sortKey = sortKeys[depth++], + key; + + for (key in map) { + a.push({key: key, values: entries(map[key], depth)}); + } + + if (sortKey) a.sort(function(a, b) { + return sortKey(a.key, b.key); + }); + + return a; + } + + nest.map = function(array) { + return map(array, 0); + }; + + nest.entries = function(array) { + return entries(map(array, 0), 0); + }; + + nest.key = function(d) { + keys.push(d); + return nest; + }; + + // Specifies the order for the most-recently specified key. + // Note: only applies to entries. Map keys are unordered! + nest.sortKeys = function(order) { + sortKeys[keys.length - 1] = order; + return nest; + }; + + // Specifies the order for leaf values. + // Applies to both maps and entries array. + nest.sortValues = function(order) { + sortValues = order; + return nest; + }; + + nest.rollup = function(f) { + rollup = f; + return nest; + }; + + return nest; +}; +d3.keys = function(map) { + var keys = []; + for (var key in map) keys.push(key); + return keys; +}; +d3.values = function(map) { + var values = []; + for (var key in map) values.push(map[key]); + return values; +}; +d3.entries = function(map) { + var entries = []; + for (var key in map) entries.push({key: key, value: map[key]}); + return entries; +}; +d3.permute = function(array, indexes) { + var permutes = [], + i = -1, + n = indexes.length; + while (++i < n) permutes[i] = array[indexes[i]]; + return permutes; +}; +d3.merge = function(arrays) { + return Array.prototype.concat.apply([], arrays); +}; +d3.split = function(array, f) { + var arrays = [], + values = [], + value, + i = -1, + n = array.length; + if (arguments.length < 2) f = d3_splitter; + while (++i < n) { + if (f.call(values, value = array[i], i)) { + values = []; + } else { + if (!values.length) arrays.push(values); + values.push(value); + } + } + return arrays; +}; + +function d3_splitter(d) { + return d == null; +} +function d3_collapse(s) { + return s.replace(/(^\s+)|(\s+$)/g, "").replace(/\s+/g, " "); +} +/** + * @param {number} start + * @param {number=} stop + * @param {number=} step + */ +d3.range = function(start, stop, step) { + if (arguments.length < 3) { + step = 1; + if (arguments.length < 2) { + stop = start; + start = 0; + } + } + if ((stop - start) / step == Infinity) throw new Error("infinite range"); + var range = [], + i = -1, + j; + if (step < 0) while ((j = start + step * ++i) > stop) range.push(j); + else while ((j = start + step * ++i) < stop) range.push(j); + return range; +}; +d3.requote = function(s) { + return s.replace(d3_requote_re, "\\$&"); +}; + +var d3_requote_re = /[\\\^\$\*\+\?\|\[\]\(\)\.\{\}]/g; +d3.round = function(x, n) { + return n + ? Math.round(x * Math.pow(10, n)) * Math.pow(10, -n) + : Math.round(x); +}; +d3.xhr = function(url, mime, callback) { + var req = new XMLHttpRequest; + if (arguments.length < 3) callback = mime; + else if (mime && req.overrideMimeType) req.overrideMimeType(mime); + req.open("GET", url, true); + req.onreadystatechange = function() { + if (req.readyState === 4) callback(req.status < 300 ? req : null); + }; + req.send(null); +}; +d3.text = function(url, mime, callback) { + function ready(req) { + callback(req && req.responseText); + } + if (arguments.length < 3) { + callback = mime; + mime = null; + } + d3.xhr(url, mime, ready); +}; +d3.json = function(url, callback) { + d3.text(url, "application/json", function(text) { + callback(text ? JSON.parse(text) : null); + }); +}; +d3.html = function(url, callback) { + d3.text(url, "text/html", function(text) { + if (text != null) { // Treat empty string as valid HTML. + var range = document.createRange(); + range.selectNode(document.body); + text = range.createContextualFragment(text); + } + callback(text); + }); +}; +d3.xml = function(url, mime, callback) { + function ready(req) { + callback(req && req.responseXML); + } + if (arguments.length < 3) { + callback = mime; + mime = null; + } + d3.xhr(url, mime, ready); +}; +var d3_nsPrefix = { + svg: "http://www.w3.org/2000/svg", + xhtml: "http://www.w3.org/1999/xhtml", + xlink: "http://www.w3.org/1999/xlink", + xml: "http://www.w3.org/XML/1998/namespace", + xmlns: "http://www.w3.org/2000/xmlns/" +}; + +d3.ns = { + prefix: d3_nsPrefix, + qualify: function(name) { + var i = name.indexOf(":"); + return i < 0 ? (name in d3_nsPrefix + ? {space: d3_nsPrefix[name], local: name} : name) + : {space: d3_nsPrefix[name.substring(0, i)], local: name.substring(i + 1)}; + } +}; +d3.dispatch = function() { + var dispatch = new d3_dispatch(), + i = -1, + n = arguments.length; + while (++i < n) dispatch[arguments[i]] = d3_dispatch_event(); + return dispatch; +}; + +function d3_dispatch() {} + +d3_dispatch.prototype.on = function(type, listener) { + var i = type.indexOf("."), + name = ""; + + // Extract optional namespace, e.g., "click.foo" + if (i > 0) { + name = type.substring(i + 1); + type = type.substring(0, i); + } + + return arguments.length < 2 + ? this[type].on(name) + : (this[type].on(name, listener), this); +}; + +function d3_dispatch_event() { + var listeners = [], + listenerByName = {}; + + function dispatch() { + var z = listeners, // defensive reference + i = -1, + n = z.length, + l; + while (++i < n) if (l = z[i].on) l.apply(this, arguments); + } + + dispatch.on = function(name, listener) { + var l, i; + + // return the current listener, if any + if (arguments.length < 2) return (l = listenerByName[name]) && l.on; + + // remove the old listener, if any (with copy-on-write) + if (l = listenerByName[name]) { + l.on = null; + listeners = listeners.slice(0, i = listeners.indexOf(l)).concat(listeners.slice(i + 1)); + delete listenerByName[name]; + } + + // add the new listener, if any + if (listener) { + listeners.push(listenerByName[name] = {on: listener}); + } + + return dispatch; + }; + + return dispatch; +}; +// TODO align +d3.format = function(specifier) { + var match = d3_format_re.exec(specifier), + fill = match[1] || " ", + sign = match[3] || "", + zfill = match[5], + width = +match[6], + comma = match[7], + precision = match[8], + type = match[9], + scale = 1, + suffix = "", + integer = false; + + if (precision) precision = +precision.substring(1); + + if (zfill) { + fill = "0"; // TODO align = "="; + if (comma) width -= Math.floor((width - 1) / 4); + } + + switch (type) { + case "n": comma = true; type = "g"; break; + case "%": scale = 100; suffix = "%"; type = "f"; break; + case "p": scale = 100; suffix = "%"; type = "r"; break; + case "d": integer = true; precision = 0; break; + case "s": scale = -1; type = "r"; break; + } + + // If no precision is specified for r, fallback to general notation. + if (type == "r" && !precision) type = "g"; + + type = d3_format_types[type] || d3_format_typeDefault; + + return function(value) { + + // Return the empty string for floats formatted as ints. + if (integer && (value % 1)) return ""; + + // Convert negative to positive, and record the sign prefix. + var negative = (value < 0) && (value = -value) ? "\u2212" : sign; + + // Apply the scale, computing it from the value's exponent for si format. + if (scale < 0) { + var prefix = d3.formatPrefix(value, precision); + value *= prefix.scale; + suffix = prefix.symbol; + } else { + value *= scale; + } + + // Convert to the desired precision. + value = type(value, precision); + + // If the fill character is 0, the sign and group is applied after the fill. + if (zfill) { + var length = value.length + negative.length; + if (length < width) value = new Array(width - length + 1).join(fill) + value; + if (comma) value = d3_format_group(value); + value = negative + value; + } + + // Otherwise (e.g., space-filling), the sign and group is applied before. + else { + if (comma) value = d3_format_group(value); + value = negative + value; + var length = value.length; + if (length < width) value = new Array(width - length + 1).join(fill) + value; + } + + return value + suffix; + }; +}; + +// [[fill]align][sign][#][0][width][,][.precision][type] +var d3_format_re = /(?:([^{])?([<>=^]))?([+\- ])?(#)?(0)?([0-9]+)?(,)?(\.[0-9]+)?([a-zA-Z%])?/; + +var d3_format_types = { + g: function(x, p) { return x.toPrecision(p); }, + e: function(x, p) { return x.toExponential(p); }, + f: function(x, p) { return x.toFixed(p); }, + r: function(x, p) { return d3.round(x, p = d3_format_precision(x, p)).toFixed(Math.max(0, Math.min(20, p))); } +}; + +function d3_format_precision(x, p) { + return p - (x ? 1 + Math.floor(Math.log(x + Math.pow(10, 1 + Math.floor(Math.log(x) / Math.LN10) - p)) / Math.LN10) : 1); +} + +function d3_format_typeDefault(x) { + return x + ""; +} + +// Apply comma grouping for thousands. +function d3_format_group(value) { + var i = value.lastIndexOf("."), + f = i >= 0 ? value.substring(i) : (i = value.length, ""), + t = []; + while (i > 0) t.push(value.substring(i -= 3, i + 3)); + return t.reverse().join(",") + f; +} +var d3_formatPrefixes = ["y","z","a","f","p","n","μ","m","","k","M","G","T","P","E","Z","Y"].map(d3_formatPrefix); + +d3.formatPrefix = function(value, precision) { + var i = 0; + if (value) { + if (value < 0) value *= -1; + if (precision) value = d3.round(value, d3_format_precision(value, precision)); + i = 1 + Math.floor(1e-12 + Math.log(value) / Math.LN10); + i = Math.max(-24, Math.min(24, Math.floor((i <= 0 ? i + 1 : i - 1) / 3) * 3)); + } + return d3_formatPrefixes[8 + i / 3]; +}; + +function d3_formatPrefix(d, i) { + return { + scale: Math.pow(10, (8 - i) * 3), + symbol: d + }; +} + +/* + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * - Redistributions of source code must retain the above copyright notice, this + * list of conditions and the following disclaimer. + * + * - Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * - Neither the name of the author nor the names of contributors may be used to + * endorse or promote products derived from this software without specific + * prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +var d3_ease_quad = d3_ease_poly(2), + d3_ease_cubic = d3_ease_poly(3); + +var d3_ease = { + linear: function() { return d3_ease_linear; }, + poly: d3_ease_poly, + quad: function() { return d3_ease_quad; }, + cubic: function() { return d3_ease_cubic; }, + sin: function() { return d3_ease_sin; }, + exp: function() { return d3_ease_exp; }, + circle: function() { return d3_ease_circle; }, + elastic: d3_ease_elastic, + back: d3_ease_back, + bounce: function() { return d3_ease_bounce; } +}; + +var d3_ease_mode = { + "in": function(f) { return f; }, + "out": d3_ease_reverse, + "in-out": d3_ease_reflect, + "out-in": function(f) { return d3_ease_reflect(d3_ease_reverse(f)); } +}; + +d3.ease = function(name) { + var i = name.indexOf("-"), + t = i >= 0 ? name.substring(0, i) : name, + m = i >= 0 ? name.substring(i + 1) : "in"; + return d3_ease_clamp(d3_ease_mode[m](d3_ease[t].apply(null, Array.prototype.slice.call(arguments, 1)))); +}; + +function d3_ease_clamp(f) { + return function(t) { + return t <= 0 ? 0 : t >= 1 ? 1 : f(t); + }; +} + +function d3_ease_reverse(f) { + return function(t) { + return 1 - f(1 - t); + }; +} + +function d3_ease_reflect(f) { + return function(t) { + return .5 * (t < .5 ? f(2 * t) : (2 - f(2 - 2 * t))); + }; +} + +function d3_ease_linear(t) { + return t; +} + +function d3_ease_poly(e) { + return function(t) { + return Math.pow(t, e); + } +} + +function d3_ease_sin(t) { + return 1 - Math.cos(t * Math.PI / 2); +} + +function d3_ease_exp(t) { + return Math.pow(2, 10 * (t - 1)); +} + +function d3_ease_circle(t) { + return 1 - Math.sqrt(1 - t * t); +} + +function d3_ease_elastic(a, p) { + var s; + if (arguments.length < 2) p = 0.45; + if (arguments.length < 1) { a = 1; s = p / 4; } + else s = p / (2 * Math.PI) * Math.asin(1 / a); + return function(t) { + return 1 + a * Math.pow(2, 10 * -t) * Math.sin((t - s) * 2 * Math.PI / p); + }; +} + +function d3_ease_back(s) { + if (!s) s = 1.70158; + return function(t) { + return t * t * ((s + 1) * t - s); + }; +} + +function d3_ease_bounce(t) { + return t < 1 / 2.75 ? 7.5625 * t * t + : t < 2 / 2.75 ? 7.5625 * (t -= 1.5 / 2.75) * t + .75 + : t < 2.5 / 2.75 ? 7.5625 * (t -= 2.25 / 2.75) * t + .9375 + : 7.5625 * (t -= 2.625 / 2.75) * t + .984375; +} +d3.event = null; + +function d3_eventCancel() { + d3.event.stopPropagation(); + d3.event.preventDefault(); +} +d3.interpolate = function(a, b) { + var i = d3.interpolators.length, f; + while (--i >= 0 && !(f = d3.interpolators[i](a, b))); + return f; +}; + +d3.interpolateNumber = function(a, b) { + b -= a; + return function(t) { return a + b * t; }; +}; + +d3.interpolateRound = function(a, b) { + b -= a; + return function(t) { return Math.round(a + b * t); }; +}; + +d3.interpolateString = function(a, b) { + var m, // current match + i, // current index + j, // current index (for coallescing) + s0 = 0, // start index of current string prefix + s1 = 0, // end index of current string prefix + s = [], // string constants and placeholders + q = [], // number interpolators + n, // q.length + o; + + // Reset our regular expression! + d3_interpolate_number.lastIndex = 0; + + // Find all numbers in b. + for (i = 0; m = d3_interpolate_number.exec(b); ++i) { + if (m.index) s.push(b.substring(s0, s1 = m.index)); + q.push({i: s.length, x: m[0]}); + s.push(null); + s0 = d3_interpolate_number.lastIndex; + } + if (s0 < b.length) s.push(b.substring(s0)); + + // Find all numbers in a. + for (i = 0, n = q.length; (m = d3_interpolate_number.exec(a)) && i < n; ++i) { + o = q[i]; + if (o.x == m[0]) { // The numbers match, so coallesce. + if (o.i) { + if (s[o.i + 1] == null) { // This match is followed by another number. + s[o.i - 1] += o.x; + s.splice(o.i, 1); + for (j = i + 1; j < n; ++j) q[j].i--; + } else { // This match is followed by a string, so coallesce twice. + s[o.i - 1] += o.x + s[o.i + 1]; + s.splice(o.i, 2); + for (j = i + 1; j < n; ++j) q[j].i -= 2; + } + } else { + if (s[o.i + 1] == null) { // This match is followed by another number. + s[o.i] = o.x; + } else { // This match is followed by a string, so coallesce twice. + s[o.i] = o.x + s[o.i + 1]; + s.splice(o.i + 1, 1); + for (j = i + 1; j < n; ++j) q[j].i--; + } + } + q.splice(i, 1); + n--; + i--; + } else { + o.x = d3.interpolateNumber(parseFloat(m[0]), parseFloat(o.x)); + } + } + + // Remove any numbers in b not found in a. + while (i < n) { + o = q.pop(); + if (s[o.i + 1] == null) { // This match is followed by another number. + s[o.i] = o.x; + } else { // This match is followed by a string, so coallesce twice. + s[o.i] = o.x + s[o.i + 1]; + s.splice(o.i + 1, 1); + } + n--; + } + + // Special optimization for only a single match. + if (s.length === 1) { + return s[0] == null ? q[0].x : function() { return b; }; + } + + // Otherwise, interpolate each of the numbers and rejoin the string. + return function(t) { + for (i = 0; i < n; ++i) s[(o = q[i]).i] = o.x(t); + return s.join(""); + }; +}; + +d3.interpolateTransform = function(a, b) { + return d3.interpolateString(d3.transform(a) + "", d3.transform(b) + ""); +}; + +d3.interpolateRgb = function(a, b) { + a = d3.rgb(a); + b = d3.rgb(b); + var ar = a.r, + ag = a.g, + ab = a.b, + br = b.r - ar, + bg = b.g - ag, + bb = b.b - ab; + return function(t) { + return "#" + + d3_rgb_hex(Math.round(ar + br * t)) + + d3_rgb_hex(Math.round(ag + bg * t)) + + d3_rgb_hex(Math.round(ab + bb * t)); + }; +}; + +// interpolates HSL space, but outputs RGB string (for compatibility) +d3.interpolateHsl = function(a, b) { + a = d3.hsl(a); + b = d3.hsl(b); + var h0 = a.h, + s0 = a.s, + l0 = a.l, + h1 = b.h - h0, + s1 = b.s - s0, + l1 = b.l - l0; + return function(t) { + return d3_hsl_rgb(h0 + h1 * t, s0 + s1 * t, l0 + l1 * t).toString(); + }; +}; + +d3.interpolateArray = function(a, b) { + var x = [], + c = [], + na = a.length, + nb = b.length, + n0 = Math.min(a.length, b.length), + i; + for (i = 0; i < n0; ++i) x.push(d3.interpolate(a[i], b[i])); + for (; i < na; ++i) c[i] = a[i]; + for (; i < nb; ++i) c[i] = b[i]; + return function(t) { + for (i = 0; i < n0; ++i) c[i] = x[i](t); + return c; + }; +}; + +d3.interpolateObject = function(a, b) { + var i = {}, + c = {}, + k; + for (k in a) { + if (k in b) { + i[k] = d3_interpolateByName(k)(a[k], b[k]); + } else { + c[k] = a[k]; + } + } + for (k in b) { + if (!(k in a)) { + c[k] = b[k]; + } + } + return function(t) { + for (k in i) c[k] = i[k](t); + return c; + }; +} + +var d3_interpolate_number = /[-+]?(?:\d*\.?\d+)(?:[eE][-+]?\d+)?/g; + +function d3_interpolateByName(n) { + return n == "transform" + ? d3.interpolateTransform + : d3.interpolate; +} + +d3.interpolators = [ + d3.interpolateObject, + function(a, b) { return (b instanceof Array) && d3.interpolateArray(a, b); }, + function(a, b) { return (typeof a === "string" || typeof b === "string") && d3.interpolateString(a + "", b + ""); }, + function(a, b) { return (typeof b === "string" ? b in d3_rgb_names || /^(#|rgb\(|hsl\()/.test(b) : b instanceof d3_Rgb || b instanceof d3_Hsl) && d3.interpolateRgb(a, b); }, + function(a, b) { return !isNaN(a = +a) && !isNaN(b = +b) && d3.interpolateNumber(a, b); } +]; +function d3_uninterpolateNumber(a, b) { + b = b - (a = +a) ? 1 / (b - a) : 0; + return function(x) { return (x - a) * b; }; +} + +function d3_uninterpolateClamp(a, b) { + b = b - (a = +a) ? 1 / (b - a) : 0; + return function(x) { return Math.max(0, Math.min(1, (x - a) * b)); }; +} +d3.rgb = function(r, g, b) { + return arguments.length === 1 + ? (r instanceof d3_Rgb ? d3_rgb(r.r, r.g, r.b) + : d3_rgb_parse("" + r, d3_rgb, d3_hsl_rgb)) + : d3_rgb(~~r, ~~g, ~~b); +}; + +function d3_rgb(r, g, b) { + return new d3_Rgb(r, g, b); +} + +function d3_Rgb(r, g, b) { + this.r = r; + this.g = g; + this.b = b; +} + +d3_Rgb.prototype.brighter = function(k) { + k = Math.pow(0.7, arguments.length ? k : 1); + var r = this.r, + g = this.g, + b = this.b, + i = 30; + if (!r && !g && !b) return d3_rgb(i, i, i); + if (r && r < i) r = i; + if (g && g < i) g = i; + if (b && b < i) b = i; + return d3_rgb( + Math.min(255, Math.floor(r / k)), + Math.min(255, Math.floor(g / k)), + Math.min(255, Math.floor(b / k))); +}; + +d3_Rgb.prototype.darker = function(k) { + k = Math.pow(0.7, arguments.length ? k : 1); + return d3_rgb( + Math.floor(k * this.r), + Math.floor(k * this.g), + Math.floor(k * this.b)); +}; + +d3_Rgb.prototype.hsl = function() { + return d3_rgb_hsl(this.r, this.g, this.b); +}; + +d3_Rgb.prototype.toString = function() { + return "#" + d3_rgb_hex(this.r) + d3_rgb_hex(this.g) + d3_rgb_hex(this.b); +}; + +function d3_rgb_hex(v) { + return v < 0x10 + ? "0" + Math.max(0, v).toString(16) + : Math.min(255, v).toString(16); +} + +function d3_rgb_parse(format, rgb, hsl) { + var r = 0, // red channel; int in [0, 255] + g = 0, // green channel; int in [0, 255] + b = 0, // blue channel; int in [0, 255] + m1, // CSS color specification match + m2, // CSS color specification type (e.g., rgb) + name; + + /* Handle hsl, rgb. */ + m1 = /([a-z]+)\((.*)\)/i.exec(format); + if (m1) { + m2 = m1[2].split(","); + switch (m1[1]) { + case "hsl": { + return hsl( + parseFloat(m2[0]), // degrees + parseFloat(m2[1]) / 100, // percentage + parseFloat(m2[2]) / 100 // percentage + ); + } + case "rgb": { + return rgb( + d3_rgb_parseNumber(m2[0]), + d3_rgb_parseNumber(m2[1]), + d3_rgb_parseNumber(m2[2]) + ); + } + } + } + + /* Named colors. */ + if (name = d3_rgb_names[format]) return rgb(name.r, name.g, name.b); + + /* Hexadecimal colors: #rgb and #rrggbb. */ + if (format != null && format.charAt(0) === "#") { + if (format.length === 4) { + r = format.charAt(1); r += r; + g = format.charAt(2); g += g; + b = format.charAt(3); b += b; + } else if (format.length === 7) { + r = format.substring(1, 3); + g = format.substring(3, 5); + b = format.substring(5, 7); + } + r = parseInt(r, 16); + g = parseInt(g, 16); + b = parseInt(b, 16); + } + + return rgb(r, g, b); +} + +function d3_rgb_hsl(r, g, b) { + var min = Math.min(r /= 255, g /= 255, b /= 255), + max = Math.max(r, g, b), + d = max - min, + h, + s, + l = (max + min) / 2; + if (d) { + s = l < .5 ? d / (max + min) : d / (2 - max - min); + if (r == max) h = (g - b) / d + (g < b ? 6 : 0); + else if (g == max) h = (b - r) / d + 2; + else h = (r - g) / d + 4; + h *= 60; + } else { + s = h = 0; + } + return d3_hsl(h, s, l); +} + +function d3_rgb_parseNumber(c) { // either integer or percentage + var f = parseFloat(c); + return c.charAt(c.length - 1) === "%" ? Math.round(f * 2.55) : f; +} + +var d3_rgb_names = { + aliceblue: "#f0f8ff", + antiquewhite: "#faebd7", + aqua: "#00ffff", + aquamarine: "#7fffd4", + azure: "#f0ffff", + beige: "#f5f5dc", + bisque: "#ffe4c4", + black: "#000000", + blanchedalmond: "#ffebcd", + blue: "#0000ff", + blueviolet: "#8a2be2", + brown: "#a52a2a", + burlywood: "#deb887", + cadetblue: "#5f9ea0", + chartreuse: "#7fff00", + chocolate: "#d2691e", + coral: "#ff7f50", + cornflowerblue: "#6495ed", + cornsilk: "#fff8dc", + crimson: "#dc143c", + cyan: "#00ffff", + darkblue: "#00008b", + darkcyan: "#008b8b", + darkgoldenrod: "#b8860b", + darkgray: "#a9a9a9", + darkgreen: "#006400", + darkgrey: "#a9a9a9", + darkkhaki: "#bdb76b", + darkmagenta: "#8b008b", + darkolivegreen: "#556b2f", + darkorange: "#ff8c00", + darkorchid: "#9932cc", + darkred: "#8b0000", + darksalmon: "#e9967a", + darkseagreen: "#8fbc8f", + darkslateblue: "#483d8b", + darkslategray: "#2f4f4f", + darkslategrey: "#2f4f4f", + darkturquoise: "#00ced1", + darkviolet: "#9400d3", + deeppink: "#ff1493", + deepskyblue: "#00bfff", + dimgray: "#696969", + dimgrey: "#696969", + dodgerblue: "#1e90ff", + firebrick: "#b22222", + floralwhite: "#fffaf0", + forestgreen: "#228b22", + fuchsia: "#ff00ff", + gainsboro: "#dcdcdc", + ghostwhite: "#f8f8ff", + gold: "#ffd700", + goldenrod: "#daa520", + gray: "#808080", + green: "#008000", + greenyellow: "#adff2f", + grey: "#808080", + honeydew: "#f0fff0", + hotpink: "#ff69b4", + indianred: "#cd5c5c", + indigo: "#4b0082", + ivory: "#fffff0", + khaki: "#f0e68c", + lavender: "#e6e6fa", + lavenderblush: "#fff0f5", + lawngreen: "#7cfc00", + lemonchiffon: "#fffacd", + lightblue: "#add8e6", + lightcoral: "#f08080", + lightcyan: "#e0ffff", + lightgoldenrodyellow: "#fafad2", + lightgray: "#d3d3d3", + lightgreen: "#90ee90", + lightgrey: "#d3d3d3", + lightpink: "#ffb6c1", + lightsalmon: "#ffa07a", + lightseagreen: "#20b2aa", + lightskyblue: "#87cefa", + lightslategray: "#778899", + lightslategrey: "#778899", + lightsteelblue: "#b0c4de", + lightyellow: "#ffffe0", + lime: "#00ff00", + limegreen: "#32cd32", + linen: "#faf0e6", + magenta: "#ff00ff", + maroon: "#800000", + mediumaquamarine: "#66cdaa", + mediumblue: "#0000cd", + mediumorchid: "#ba55d3", + mediumpurple: "#9370db", + mediumseagreen: "#3cb371", + mediumslateblue: "#7b68ee", + mediumspringgreen: "#00fa9a", + mediumturquoise: "#48d1cc", + mediumvioletred: "#c71585", + midnightblue: "#191970", + mintcream: "#f5fffa", + mistyrose: "#ffe4e1", + moccasin: "#ffe4b5", + navajowhite: "#ffdead", + navy: "#000080", + oldlace: "#fdf5e6", + olive: "#808000", + olivedrab: "#6b8e23", + orange: "#ffa500", + orangered: "#ff4500", + orchid: "#da70d6", + palegoldenrod: "#eee8aa", + palegreen: "#98fb98", + paleturquoise: "#afeeee", + palevioletred: "#db7093", + papayawhip: "#ffefd5", + peachpuff: "#ffdab9", + peru: "#cd853f", + pink: "#ffc0cb", + plum: "#dda0dd", + powderblue: "#b0e0e6", + purple: "#800080", + red: "#ff0000", + rosybrown: "#bc8f8f", + royalblue: "#4169e1", + saddlebrown: "#8b4513", + salmon: "#fa8072", + sandybrown: "#f4a460", + seagreen: "#2e8b57", + seashell: "#fff5ee", + sienna: "#a0522d", + silver: "#c0c0c0", + skyblue: "#87ceeb", + slateblue: "#6a5acd", + slategray: "#708090", + slategrey: "#708090", + snow: "#fffafa", + springgreen: "#00ff7f", + steelblue: "#4682b4", + tan: "#d2b48c", + teal: "#008080", + thistle: "#d8bfd8", + tomato: "#ff6347", + turquoise: "#40e0d0", + violet: "#ee82ee", + wheat: "#f5deb3", + white: "#ffffff", + whitesmoke: "#f5f5f5", + yellow: "#ffff00", + yellowgreen: "#9acd32" +}; + +for (var d3_rgb_name in d3_rgb_names) { + d3_rgb_names[d3_rgb_name] = d3_rgb_parse( + d3_rgb_names[d3_rgb_name], + d3_rgb, + d3_hsl_rgb); +} +d3.hsl = function(h, s, l) { + return arguments.length === 1 + ? (h instanceof d3_Hsl ? d3_hsl(h.h, h.s, h.l) + : d3_rgb_parse("" + h, d3_rgb_hsl, d3_hsl)) + : d3_hsl(+h, +s, +l); +}; + +function d3_hsl(h, s, l) { + return new d3_Hsl(h, s, l); +} + +function d3_Hsl(h, s, l) { + this.h = h; + this.s = s; + this.l = l; +} + +d3_Hsl.prototype.brighter = function(k) { + k = Math.pow(0.7, arguments.length ? k : 1); + return d3_hsl(this.h, this.s, this.l / k); +}; + +d3_Hsl.prototype.darker = function(k) { + k = Math.pow(0.7, arguments.length ? k : 1); + return d3_hsl(this.h, this.s, k * this.l); +}; + +d3_Hsl.prototype.rgb = function() { + return d3_hsl_rgb(this.h, this.s, this.l); +}; + +d3_Hsl.prototype.toString = function() { + return this.rgb().toString(); +}; + +function d3_hsl_rgb(h, s, l) { + var m1, + m2; + + /* Some simple corrections for h, s and l. */ + h = h % 360; if (h < 0) h += 360; + s = s < 0 ? 0 : s > 1 ? 1 : s; + l = l < 0 ? 0 : l > 1 ? 1 : l; + + /* From FvD 13.37, CSS Color Module Level 3 */ + m2 = l <= .5 ? l * (1 + s) : l + s - l * s; + m1 = 2 * l - m2; + + function v(h) { + if (h > 360) h -= 360; + else if (h < 0) h += 360; + if (h < 60) return m1 + (m2 - m1) * h / 60; + if (h < 180) return m2; + if (h < 240) return m1 + (m2 - m1) * (240 - h) / 60; + return m1; + } + + function vv(h) { + return Math.round(v(h) * 255); + } + + return d3_rgb(vv(h + 120), vv(h), vv(h - 120)); +} +function d3_selection(groups) { + d3_arraySubclass(groups, d3_selectionPrototype); + return groups; +} + +var d3_select = function(s, n) { return n.querySelector(s); }, + d3_selectAll = function(s, n) { return n.querySelectorAll(s); }; + +// Prefer Sizzle, if available. +if (typeof Sizzle === "function") { + d3_select = function(s, n) { return Sizzle(s, n)[0]; }; + d3_selectAll = function(s, n) { return Sizzle.uniqueSort(Sizzle(s, n)); }; +} + +var d3_selectionPrototype = []; + +d3.selection = function() { + return d3_selectionRoot; +}; + +d3.selection.prototype = d3_selectionPrototype; +d3_selectionPrototype.select = function(selector) { + var subgroups = [], + subgroup, + subnode, + group, + node; + + if (typeof selector !== "function") selector = d3_selection_selector(selector); + + for (var j = -1, m = this.length; ++j < m;) { + subgroups.push(subgroup = []); + subgroup.parentNode = (group = this[j]).parentNode; + for (var i = -1, n = group.length; ++i < n;) { + if (node = group[i]) { + subgroup.push(subnode = selector.call(node, node.__data__, i)); + if (subnode && "__data__" in node) subnode.__data__ = node.__data__; + } else { + subgroup.push(null); + } + } + } + + return d3_selection(subgroups); +}; + +function d3_selection_selector(selector) { + return function() { + return d3_select(selector, this); + }; +} +d3_selectionPrototype.selectAll = function(selector) { + var subgroups = [], + subgroup, + node; + + if (typeof selector !== "function") selector = d3_selection_selectorAll(selector); + + for (var j = -1, m = this.length; ++j < m;) { + for (var group = this[j], i = -1, n = group.length; ++i < n;) { + if (node = group[i]) { + subgroups.push(subgroup = d3_array(selector.call(node, node.__data__, i))); + subgroup.parentNode = node; + } + } + } + + return d3_selection(subgroups); +}; + +function d3_selection_selectorAll(selector) { + return function() { + return d3_selectAll(selector, this); + }; +} +d3_selectionPrototype.attr = function(name, value) { + name = d3.ns.qualify(name); + + // If no value is specified, return the first value. + if (arguments.length < 2) { + var node = this.node(); + return name.local + ? node.getAttributeNS(name.space, name.local) + : node.getAttribute(name); + } + + function attrNull() { + this.removeAttribute(name); + } + + function attrNullNS() { + this.removeAttributeNS(name.space, name.local); + } + + function attrConstant() { + this.setAttribute(name, value); + } + + function attrConstantNS() { + this.setAttributeNS(name.space, name.local, value); + } + + function attrFunction() { + var x = value.apply(this, arguments); + if (x == null) this.removeAttribute(name); + else this.setAttribute(name, x); + } + + function attrFunctionNS() { + var x = value.apply(this, arguments); + if (x == null) this.removeAttributeNS(name.space, name.local); + else this.setAttributeNS(name.space, name.local, x); + } + + return this.each(value == null + ? (name.local ? attrNullNS : attrNull) : (typeof value === "function" + ? (name.local ? attrFunctionNS : attrFunction) + : (name.local ? attrConstantNS : attrConstant))); +}; +d3_selectionPrototype.classed = function(name, value) { + var names = name.split(d3_selection_classedWhitespace), + n = names.length, + i = -1; + if (arguments.length > 1) { + while (++i < n) d3_selection_classed.call(this, names[i], value); + return this; + } else { + while (++i < n) if (!d3_selection_classed.call(this, names[i])) return false; + return true; + } +}; + +var d3_selection_classedWhitespace = /\s+/g; + +function d3_selection_classed(name, value) { + var re = new RegExp("(^|\\s+)" + d3.requote(name) + "(\\s+|$)", "g"); + + // If no value is specified, return the first value. + if (arguments.length < 2) { + var node = this.node(); + if (c = node.classList) return c.contains(name); + var c = node.className; + re.lastIndex = 0; + return re.test(c.baseVal != null ? c.baseVal : c); + } + + function classedAdd() { + if (c = this.classList) return c.add(name); + var c = this.className, + cb = c.baseVal != null, + cv = cb ? c.baseVal : c; + re.lastIndex = 0; + if (!re.test(cv)) { + cv = d3_collapse(cv + " " + name); + if (cb) c.baseVal = cv; + else this.className = cv; + } + } + + function classedRemove() { + if (c = this.classList) return c.remove(name); + var c = this.className, + cb = c.baseVal != null, + cv = cb ? c.baseVal : c; + cv = d3_collapse(cv.replace(re, " ")); + if (cb) c.baseVal = cv; + else this.className = cv; + } + + function classedFunction() { + (value.apply(this, arguments) + ? classedAdd + : classedRemove).call(this); + } + + return this.each(typeof value === "function" + ? classedFunction : value + ? classedAdd + : classedRemove); +} +d3_selectionPrototype.style = function(name, value, priority) { + if (arguments.length < 3) priority = ""; + + // If no value is specified, return the first value. + if (arguments.length < 2) return window + .getComputedStyle(this.node(), null) + .getPropertyValue(name); + + function styleNull() { + this.style.removeProperty(name); + } + + function styleConstant() { + this.style.setProperty(name, value, priority); + } + + function styleFunction() { + var x = value.apply(this, arguments); + if (x == null) this.style.removeProperty(name); + else this.style.setProperty(name, x, priority); + } + + return this.each(value == null + ? styleNull : (typeof value === "function" + ? styleFunction : styleConstant)); +}; +d3_selectionPrototype.property = function(name, value) { + + // If no value is specified, return the first value. + if (arguments.length < 2) return this.node()[name]; + + function propertyNull() { + delete this[name]; + } + + function propertyConstant() { + this[name] = value; + } + + function propertyFunction() { + var x = value.apply(this, arguments); + if (x == null) delete this[name]; + else this[name] = x; + } + + return this.each(value == null + ? propertyNull : (typeof value === "function" + ? propertyFunction : propertyConstant)); +}; +d3_selectionPrototype.text = function(value) { + return arguments.length < 1 ? this.node().textContent + : (this.each(typeof value === "function" + ? function() { this.textContent = value.apply(this, arguments); } + : function() { this.textContent = value; })); +}; +d3_selectionPrototype.html = function(value) { + return arguments.length < 1 ? this.node().innerHTML + : (this.each(typeof value === "function" + ? function() { this.innerHTML = value.apply(this, arguments); } + : function() { this.innerHTML = value; })); +}; +// TODO append(node)? +// TODO append(function)? +d3_selectionPrototype.append = function(name) { + name = d3.ns.qualify(name); + + function append() { + return this.appendChild(document.createElementNS(this.namespaceURI, name)); + } + + function appendNS() { + return this.appendChild(document.createElementNS(name.space, name.local)); + } + + return this.select(name.local ? appendNS : append); +}; +// TODO insert(node, function)? +// TODO insert(function, string)? +// TODO insert(function, function)? +d3_selectionPrototype.insert = function(name, before) { + name = d3.ns.qualify(name); + + function insert() { + return this.insertBefore( + document.createElementNS(this.namespaceURI, name), + d3_select(before, this)); + } + + function insertNS() { + return this.insertBefore( + document.createElementNS(name.space, name.local), + d3_select(before, this)); + } + + return this.select(name.local ? insertNS : insert); +}; +// TODO remove(selector)? +// TODO remove(node)? +// TODO remove(function)? +d3_selectionPrototype.remove = function() { + return this.each(function() { + var parent = this.parentNode; + if (parent) parent.removeChild(this); + }); +}; +// TODO data(null) for clearing data? +d3_selectionPrototype.data = function(data, join) { + var enter = [], + update = [], + exit = []; + + function bind(group, groupData) { + var i, + n = group.length, + m = groupData.length, + n0 = Math.min(n, m), + n1 = Math.max(n, m), + updateNodes = [], + enterNodes = [], + exitNodes = [], + node, + nodeData; + + if (join) { + var nodeByKey = {}, + keys = [], + key, + j = groupData.length; + + for (i = -1; ++i < n;) { + key = join.call(node = group[i], node.__data__, i); + if (key in nodeByKey) { + exitNodes[j++] = node; // duplicate key + } else { + nodeByKey[key] = node; + } + keys.push(key); + } + + for (i = -1; ++i < m;) { + node = nodeByKey[key = join.call(groupData, nodeData = groupData[i], i)]; + if (node) { + node.__data__ = nodeData; + updateNodes[i] = node; + enterNodes[i] = exitNodes[i] = null; + } else { + enterNodes[i] = d3_selection_dataNode(nodeData); + updateNodes[i] = exitNodes[i] = null; + } + delete nodeByKey[key]; + } + + for (i = -1; ++i < n;) { + if (keys[i] in nodeByKey) { + exitNodes[i] = group[i]; + } + } + } else { + for (i = -1; ++i < n0;) { + node = group[i]; + nodeData = groupData[i]; + if (node) { + node.__data__ = nodeData; + updateNodes[i] = node; + enterNodes[i] = exitNodes[i] = null; + } else { + enterNodes[i] = d3_selection_dataNode(nodeData); + updateNodes[i] = exitNodes[i] = null; + } + } + for (; i < m; ++i) { + enterNodes[i] = d3_selection_dataNode(groupData[i]); + updateNodes[i] = exitNodes[i] = null; + } + for (; i < n1; ++i) { + exitNodes[i] = group[i]; + enterNodes[i] = updateNodes[i] = null; + } + } + + enterNodes.update + = updateNodes; + + enterNodes.parentNode + = updateNodes.parentNode + = exitNodes.parentNode + = group.parentNode; + + enter.push(enterNodes); + update.push(updateNodes); + exit.push(exitNodes); + } + + var i = -1, + n = this.length, + group; + if (typeof data === "function") { + while (++i < n) { + bind(group = this[i], data.call(group, group.parentNode.__data__, i)); + } + } else { + while (++i < n) { + bind(group = this[i], data); + } + } + + var selection = d3_selection(update); + selection.enter = function() { return d3_selection_enter(enter); }; + selection.exit = function() { return d3_selection(exit); }; + return selection; +}; + +function d3_selection_dataNode(data) { + return {__data__: data}; +} +// TODO preserve null elements to maintain index? +d3_selectionPrototype.filter = function(filter) { + var subgroups = [], + subgroup, + group, + node; + + for (var j = 0, m = this.length; j < m; j++) { + subgroups.push(subgroup = []); + subgroup.parentNode = (group = this[j]).parentNode; + for (var i = 0, n = group.length; i < n; i++) { + if ((node = group[i]) && filter.call(node, node.__data__, i)) { + subgroup.push(node); + } + } + } + + return d3_selection(subgroups); +}; +d3_selectionPrototype.map = function(map) { + return this.each(function() { + this.__data__ = map.apply(this, arguments); + }); +}; +d3_selectionPrototype.sort = function(comparator) { + comparator = d3_selection_sortComparator.apply(this, arguments); + for (var j = 0, m = this.length; j < m; j++) { + for (var group = this[j].sort(comparator), i = 1, n = group.length, prev = group[0]; i < n; i++) { + var node = group[i]; + if (node) { + if (prev) prev.parentNode.insertBefore(node, prev.nextSibling); + prev = node; + } + } + } + return this; +}; + +function d3_selection_sortComparator(comparator) { + if (!arguments.length) comparator = d3.ascending; + return function(a, b) { + return comparator(a && a.__data__, b && b.__data__); + }; +} +// type can be namespaced, e.g., "click.foo" +// listener can be null for removal +d3_selectionPrototype.on = function(type, listener, capture) { + if (arguments.length < 3) capture = false; + + // parse the type specifier + var name = "__on" + type, i = type.indexOf("."); + if (i > 0) type = type.substring(0, i); + + // if called with only one argument, return the current listener + if (arguments.length < 2) return (i = this.node()[name]) && i._; + + // remove the old event listener, and add the new event listener + return this.each(function(d, i) { + var node = this; + + if (node[name]) node.removeEventListener(type, node[name], capture); + if (listener) node.addEventListener(type, node[name] = l, capture); + + // wrapped event listener that preserves i + function l(e) { + var o = d3.event; // Events can be reentrant (e.g., focus). + d3.event = e; + try { + listener.call(node, node.__data__, i); + } finally { + d3.event = o; + } + } + + // stash the unwrapped listener for retrieval + l._ = listener; + }); +}; +d3_selectionPrototype.each = function(callback) { + for (var j = -1, m = this.length; ++j < m;) { + for (var group = this[j], i = -1, n = group.length; ++i < n;) { + var node = group[i]; + if (node) callback.call(node, node.__data__, i, j); + } + } + return this; +}; +// +// Note: assigning to the arguments array simultaneously changes the value of +// the corresponding argument! +// +// TODO The `this` argument probably shouldn't be the first argument to the +// callback, anyway, since it's redundant. However, that will require a major +// version bump due to backwards compatibility, so I'm not changing it right +// away. +// +d3_selectionPrototype.call = function(callback) { + callback.apply(this, (arguments[0] = this, arguments)); + return this; +}; +d3_selectionPrototype.empty = function() { + return !this.node(); +}; +d3_selectionPrototype.node = function(callback) { + for (var j = 0, m = this.length; j < m; j++) { + for (var group = this[j], i = 0, n = group.length; i < n; i++) { + var node = group[i]; + if (node) return node; + } + } + return null; +}; +d3_selectionPrototype.transition = function() { + var subgroups = [], + subgroup, + node; + + for (var j = -1, m = this.length; ++j < m;) { + subgroups.push(subgroup = []); + for (var group = this[j], i = -1, n = group.length; ++i < n;) { + subgroup.push((node = group[i]) ? {node: node, delay: 0, duration: 250} : null); + } + } + + return d3_transition(subgroups, d3_transitionInheritId || ++d3_transitionId, Date.now()); +}; +var d3_selectionRoot = d3_selection([[document]]); + +d3_selectionRoot[0].parentNode = document.documentElement; + +// TODO fast singleton implementation! +// TODO select(function) +d3.select = function(selector) { + return typeof selector === "string" + ? d3_selectionRoot.select(selector) + : d3_selection([[selector]]); // assume node +}; + +// TODO selectAll(function) +d3.selectAll = function(selector) { + return typeof selector === "string" + ? d3_selectionRoot.selectAll(selector) + : d3_selection([d3_array(selector)]); // assume node[] +}; +function d3_selection_enter(selection) { + d3_arraySubclass(selection, d3_selection_enterPrototype); + return selection; +} + +var d3_selection_enterPrototype = []; + +d3_selection_enterPrototype.append = d3_selectionPrototype.append; +d3_selection_enterPrototype.insert = d3_selectionPrototype.insert; +d3_selection_enterPrototype.empty = d3_selectionPrototype.empty; +d3_selection_enterPrototype.node = d3_selectionPrototype.node; +d3_selection_enterPrototype.select = function(selector) { + var subgroups = [], + subgroup, + subnode, + upgroup, + group, + node; + + for (var j = -1, m = this.length; ++j < m;) { + upgroup = (group = this[j]).update; + subgroups.push(subgroup = []); + subgroup.parentNode = group.parentNode; + for (var i = -1, n = group.length; ++i < n;) { + if (node = group[i]) { + subgroup.push(upgroup[i] = subnode = selector.call(group.parentNode, node.__data__, i)); + subnode.__data__ = node.__data__; + } else { + subgroup.push(null); + } + } + } + + return d3_selection(subgroups); +}; +function d3_transition(groups, id, time) { + d3_arraySubclass(groups, d3_transitionPrototype); + + var tweens = {}, + event = d3.dispatch("start", "end"), + ease = d3_transitionEase; + + groups.id = id; + + groups.time = time; + + groups.tween = function(name, tween) { + if (arguments.length < 2) return tweens[name]; + if (tween == null) delete tweens[name]; + else tweens[name] = tween; + return groups; + }; + + groups.ease = function(value) { + if (!arguments.length) return ease; + ease = typeof value === "function" ? value : d3.ease.apply(d3, arguments); + return groups; + }; + + groups.each = function(type, listener) { + if (arguments.length < 2) return d3_transition_each.call(groups, type); + event.on(type, listener); + return groups; + }; + + d3.timer(function(elapsed) { + groups.each(function(d, i, j) { + var tweened = [], + node = this, + delay = groups[j][i].delay, + duration = groups[j][i].duration, + lock = node.__transition__ || (node.__transition__ = {active: 0, count: 0}); + + ++lock.count; + + delay <= elapsed ? start(elapsed) : d3.timer(start, delay, time); + + function start(elapsed) { + if (lock.active > id) return stop(); + lock.active = id; + + for (var tween in tweens) { + if (tween = tweens[tween].call(node, d, i)) { + tweened.push(tween); + } + } + + event.start.call(node, d, i); + if (!tick(elapsed)) d3.timer(tick, 0, time); + return 1; + } + + function tick(elapsed) { + if (lock.active !== id) return stop(); + + var t = (elapsed - delay) / duration, + e = ease(t), + n = tweened.length; + + while (n > 0) { + tweened[--n].call(node, e); + } + + if (t >= 1) { + stop(); + d3_transitionInheritId = id; + event.end.call(node, d, i); + d3_transitionInheritId = 0; + return 1; + } + } + + function stop() { + if (!--lock.count) delete node.__transition__; + return 1; + } + }); + return 1; + }, 0, time); + + return groups; +} + +var d3_transitionRemove = {}; + +function d3_transitionNull(d, i, a) { + return a != "" && d3_transitionRemove; +} + +function d3_transitionTween(name, b) { + var interpolate = d3_interpolateByName(name); + + function transitionFunction(d, i, a) { + var v = b.call(this, d, i); + return v == null + ? a != "" && d3_transitionRemove + : a != v && interpolate(a, v); + } + + function transitionString(d, i, a) { + return a != b && interpolate(a, b); + } + + return typeof b === "function" ? transitionFunction + : b == null ? d3_transitionNull + : (b += "", transitionString); +} + +var d3_transitionPrototype = [], + d3_transitionId = 0, + d3_transitionInheritId = 0, + d3_transitionEase = d3.ease("cubic-in-out"); + +d3_transitionPrototype.call = d3_selectionPrototype.call; + +d3.transition = function() { + return d3_selectionRoot.transition(); +}; + +d3.transition.prototype = d3_transitionPrototype; +d3_transitionPrototype.select = function(selector) { + var subgroups = [], + subgroup, + subnode, + node; + + if (typeof selector !== "function") selector = d3_selection_selector(selector); + + for (var j = -1, m = this.length; ++j < m;) { + subgroups.push(subgroup = []); + for (var group = this[j], i = -1, n = group.length; ++i < n;) { + if ((node = group[i]) && (subnode = selector.call(node.node, node.node.__data__, i))) { + if ("__data__" in node.node) subnode.__data__ = node.node.__data__; + subgroup.push({node: subnode, delay: node.delay, duration: node.duration}); + } else { + subgroup.push(null); + } + } + } + + return d3_transition(subgroups, this.id, this.time).ease(this.ease()); +}; +d3_transitionPrototype.selectAll = function(selector) { + var subgroups = [], + subgroup, + subnodes, + node; + + if (typeof selector !== "function") selector = d3_selection_selectorAll(selector); + + for (var j = -1, m = this.length; ++j < m;) { + for (var group = this[j], i = -1, n = group.length; ++i < n;) { + if (node = group[i]) { + subnodes = selector.call(node.node, node.node.__data__, i); + subgroups.push(subgroup = []); + for (var k = -1, o = subnodes.length; ++k < o;) { + subgroup.push({node: subnodes[k], delay: node.delay, duration: node.duration}); + } + } + } + } + + return d3_transition(subgroups, this.id, this.time).ease(this.ease()); +}; +d3_transitionPrototype.attr = function(name, value) { + return this.attrTween(name, d3_transitionTween(name, value)); +}; + +d3_transitionPrototype.attrTween = function(nameNS, tween) { + var name = d3.ns.qualify(nameNS); + + function attrTween(d, i) { + var f = tween.call(this, d, i, this.getAttribute(name)); + return f === d3_transitionRemove + ? (this.removeAttribute(name), null) + : f && function(t) { this.setAttribute(name, f(t)); }; + } + + function attrTweenNS(d, i) { + var f = tween.call(this, d, i, this.getAttributeNS(name.space, name.local)); + return f === d3_transitionRemove + ? (this.removeAttributeNS(name.space, name.local), null) + : f && function(t) { this.setAttributeNS(name.space, name.local, f(t)); }; + } + + return this.tween("attr." + nameNS, name.local ? attrTweenNS : attrTween); +}; +d3_transitionPrototype.style = function(name, value, priority) { + if (arguments.length < 3) priority = ""; + return this.styleTween(name, d3_transitionTween(name, value), priority); +}; + +d3_transitionPrototype.styleTween = function(name, tween, priority) { + if (arguments.length < 3) priority = ""; + return this.tween("style." + name, function(d, i) { + var f = tween.call(this, d, i, window.getComputedStyle(this, null).getPropertyValue(name)); + return f === d3_transitionRemove + ? (this.style.removeProperty(name), null) + : f && function(t) { this.style.setProperty(name, f(t), priority); }; + }); +}; +d3_transitionPrototype.text = function(value) { + return this.tween("text", function(d, i) { + this.textContent = typeof value === "function" + ? value.call(this, d, i) + : value; + }); +}; +d3_transitionPrototype.remove = function() { + return this.each("end", function() { + var p; + if (!this.__transition__ && (p = this.parentNode)) p.removeChild(this); + }); +}; +d3_transitionPrototype.delay = function(value) { + var groups = this; + return groups.each(typeof value === "function" + ? function(d, i, j) { groups[j][i].delay = +value.apply(this, arguments); } + : (value = +value, function(d, i, j) { groups[j][i].delay = value; })); +}; +d3_transitionPrototype.duration = function(value) { + var groups = this; + return groups.each(typeof value === "function" + ? function(d, i, j) { groups[j][i].duration = +value.apply(this, arguments); } + : (value = +value, function(d, i, j) { groups[j][i].duration = value; })); +}; +function d3_transition_each(callback) { + for (var j = 0, m = this.length; j < m; j++) { + for (var group = this[j], i = 0, n = group.length; i < n; i++) { + var node = group[i]; + if (node) callback.call(node = node.node, node.__data__, i, j); + } + } + return this; +} +d3_transitionPrototype.transition = function() { + return this.select(d3_this); +}; +var d3_timer_queue = null, + d3_timer_interval, // is an interval (or frame) active? + d3_timer_timeout; // is a timeout active? + +// The timer will continue to fire until callback returns true. +d3.timer = function(callback, delay, then) { + var found = false, + t0, + t1 = d3_timer_queue; + + if (arguments.length < 3) { + if (arguments.length < 2) delay = 0; + else if (!isFinite(delay)) return; + then = Date.now(); + } + + // See if the callback's already in the queue. + while (t1) { + if (t1.callback === callback) { + t1.then = then; + t1.delay = delay; + found = true; + break; + } + t0 = t1; + t1 = t1.next; + } + + // Otherwise, add the callback to the queue. + if (!found) d3_timer_queue = { + callback: callback, + then: then, + delay: delay, + next: d3_timer_queue + }; + + // Start animatin'! + if (!d3_timer_interval) { + d3_timer_timeout = clearTimeout(d3_timer_timeout); + d3_timer_interval = 1; + d3_timer_frame(d3_timer_step); + } +} + +function d3_timer_step() { + var elapsed, + now = Date.now(), + t1 = d3_timer_queue; + + while (t1) { + elapsed = now - t1.then; + if (elapsed >= t1.delay) t1.flush = t1.callback(elapsed); + t1 = t1.next; + } + + var delay = d3_timer_flush() - now; + if (delay > 24) { + if (isFinite(delay)) { + clearTimeout(d3_timer_timeout); + d3_timer_timeout = setTimeout(d3_timer_step, delay); + } + d3_timer_interval = 0; + } else { + d3_timer_interval = 1; + d3_timer_frame(d3_timer_step); + } +} + +d3.timer.flush = function() { + var elapsed, + now = Date.now(), + t1 = d3_timer_queue; + + while (t1) { + elapsed = now - t1.then; + if (!t1.delay) t1.flush = t1.callback(elapsed); + t1 = t1.next; + } + + d3_timer_flush(); +}; + +// Flush after callbacks, to avoid concurrent queue modification. +function d3_timer_flush() { + var t0 = null, + t1 = d3_timer_queue, + then = Infinity; + while (t1) { + if (t1.flush) { + t1 = t0 ? t0.next = t1.next : d3_timer_queue = t1.next; + } else { + then = Math.min(then, t1.then + t1.delay); + t1 = (t0 = t1).next; + } + } + return then; +} + +var d3_timer_frame = window.requestAnimationFrame + || window.webkitRequestAnimationFrame + || window.mozRequestAnimationFrame + || window.oRequestAnimationFrame + || window.msRequestAnimationFrame + || function(callback) { setTimeout(callback, 17); }; +d3.transform = function(string) { + d3_transformG.setAttribute("transform", string); + var t = d3_transformG.transform.baseVal.consolidate(); + return new d3_transform(t ? t.matrix : d3_transformIdentity); +}; + +// Compute x-scale and normalize the first row. +// Compute shear and make second row orthogonal to first. +// Compute y-scale and normalize the second row. +// Finally, compute the rotation. +function d3_transform(m) { + var r0 = [m.a, m.b], + r1 = [m.c, m.d], + kx = d3_transformNormalize(r0), + kz = d3_transformDot(r0, r1), + ky = d3_transformNormalize(d3_transformCombine(r1, r0, -kz)) || 0; + if (r0[0] * r1[1] < r1[0] * r0[1]) { + r0[0] *= -1; + r0[1] *= -1; + kx *= -1; + kz *= -1; + } + this.rotate = (kx ? Math.atan2(r0[1], r0[0]) : Math.atan2(-r1[0], r1[1])) * d3_transformDegrees; + this.translate = [m.e, m.f]; + this.scale = [kx, ky]; + this.skew = ky ? Math.atan2(kz, ky) * d3_transformDegrees : 0; +}; + +d3_transform.prototype.toString = function() { + return "translate(" + this.translate + + ")rotate(" + this.rotate + + ")skewX(" + this.skew + + ")scale(" + this.scale + + ")"; +}; + +function d3_transformDot(a, b) { + return a[0] * b[0] + a[1] * b[1]; +} + +function d3_transformNormalize(a) { + var k = Math.sqrt(d3_transformDot(a, a)); + if (k) { + a[0] /= k; + a[1] /= k; + } + return k; +} + +function d3_transformCombine(a, b, k) { + a[0] += k * b[0]; + a[1] += k * b[1]; + return a; +} + +var d3_transformG = document.createElementNS(d3.ns.prefix.svg, "g"), + d3_transformIdentity = {a: 1, b: 0, c: 0, d: 1, e: 0, f: 0}, + d3_transformDegrees = 180 / Math.PI; +function d3_noop() {} +d3.scale = {}; + +function d3_scaleExtent(domain) { + var start = domain[0], stop = domain[domain.length - 1]; + return start < stop ? [start, stop] : [stop, start]; +} + +function d3_scaleRange(scale) { + return scale.rangeExtent ? scale.rangeExtent() : d3_scaleExtent(scale.range()); +} +function d3_scale_nice(domain, nice) { + var i0 = 0, + i1 = domain.length - 1, + x0 = domain[i0], + x1 = domain[i1], + dx; + + if (x1 < x0) { + dx = i0; i0 = i1; i1 = dx; + dx = x0; x0 = x1; x1 = dx; + } + + if (dx = x1 - x0) { + nice = nice(dx); + domain[i0] = nice.floor(x0); + domain[i1] = nice.ceil(x1); + } + + return domain; +} + +function d3_scale_niceDefault() { + return Math; +} +d3.scale.linear = function() { + return d3_scale_linear([0, 1], [0, 1], d3.interpolate, false); +}; + +function d3_scale_linear(domain, range, interpolate, clamp) { + var output, + input; + + function rescale() { + var linear = domain.length == 2 ? d3_scale_bilinear : d3_scale_polylinear, + uninterpolate = clamp ? d3_uninterpolateClamp : d3_uninterpolateNumber; + output = linear(domain, range, uninterpolate, interpolate); + input = linear(range, domain, uninterpolate, d3.interpolate); + return scale; + } + + function scale(x) { + return output(x); + } + + // Note: requires range is coercible to number! + scale.invert = function(y) { + return input(y); + }; + + scale.domain = function(x) { + if (!arguments.length) return domain; + domain = x.map(Number); + return rescale(); + }; + + scale.range = function(x) { + if (!arguments.length) return range; + range = x; + return rescale(); + }; + + scale.rangeRound = function(x) { + return scale.range(x).interpolate(d3.interpolateRound); + }; + + scale.clamp = function(x) { + if (!arguments.length) return clamp; + clamp = x; + return rescale(); + }; + + scale.interpolate = function(x) { + if (!arguments.length) return interpolate; + interpolate = x; + return rescale(); + }; + + scale.ticks = function(m) { + return d3_scale_linearTicks(domain, m); + }; + + scale.tickFormat = function(m) { + return d3_scale_linearTickFormat(domain, m); + }; + + scale.nice = function() { + d3_scale_nice(domain, d3_scale_linearNice); + return rescale(); + }; + + scale.copy = function() { + return d3_scale_linear(domain, range, interpolate, clamp); + }; + + return rescale(); +}; + +function d3_scale_linearRebind(scale, linear) { + return d3.rebind(scale, linear, "range", "rangeRound", "interpolate", "clamp"); +} + +function d3_scale_linearNice(dx) { + dx = Math.pow(10, Math.round(Math.log(dx) / Math.LN10) - 1); + return { + floor: function(x) { return Math.floor(x / dx) * dx; }, + ceil: function(x) { return Math.ceil(x / dx) * dx; } + }; +} + +// TODO Dates? Ugh. +function d3_scale_linearTickRange(domain, m) { + var extent = d3_scaleExtent(domain), + span = extent[1] - extent[0], + step = Math.pow(10, Math.floor(Math.log(span / m) / Math.LN10)), + err = m / span * step; + + // Filter ticks to get closer to the desired count. + if (err <= .15) step *= 10; + else if (err <= .35) step *= 5; + else if (err <= .75) step *= 2; + + // Round start and stop values to step interval. + extent[0] = Math.ceil(extent[0] / step) * step; + extent[1] = Math.floor(extent[1] / step) * step + step * .5; // inclusive + extent[2] = step; + return extent; +} + +function d3_scale_linearTicks(domain, m) { + return d3.range.apply(d3, d3_scale_linearTickRange(domain, m)); +} + +function d3_scale_linearTickFormat(domain, m) { + return d3.format(",." + Math.max(0, -Math.floor(Math.log(d3_scale_linearTickRange(domain, m)[2]) / Math.LN10 + .01)) + "f"); +} +function d3_scale_bilinear(domain, range, uninterpolate, interpolate) { + var u = uninterpolate(domain[0], domain[1]), + i = interpolate(range[0], range[1]); + return function(x) { + return i(u(x)); + }; +} +function d3_scale_polylinear(domain, range, uninterpolate, interpolate) { + var u = [], + i = [], + j = 0, + n = domain.length; + + while (++j < n) { + u.push(uninterpolate(domain[j - 1], domain[j])); + i.push(interpolate(range[j - 1], range[j])); + } + + return function(x) { + var j = d3.bisect(domain, x, 1, domain.length - 1) - 1; + return i[j](u[j](x)); + }; +} +d3.scale.log = function() { + return d3_scale_log(d3.scale.linear(), d3_scale_logp); +}; + +function d3_scale_log(linear, log) { + var pow = log.pow; + + function scale(x) { + return linear(log(x)); + } + + scale.invert = function(x) { + return pow(linear.invert(x)); + }; + + scale.domain = function(x) { + if (!arguments.length) return linear.domain().map(pow); + log = x[0] < 0 ? d3_scale_logn : d3_scale_logp; + pow = log.pow; + linear.domain(x.map(log)); + return scale; + }; + + scale.nice = function() { + linear.domain(d3_scale_nice(linear.domain(), d3_scale_niceDefault)); + return scale; + }; + + scale.ticks = function() { + var extent = d3_scaleExtent(linear.domain()), + ticks = []; + if (extent.every(isFinite)) { + var i = Math.floor(extent[0]), + j = Math.ceil(extent[1]), + u = pow(extent[0]), + v = pow(extent[1]); + if (log === d3_scale_logn) { + ticks.push(pow(i)); + for (; i++ < j;) for (var k = 9; k > 0; k--) ticks.push(pow(i) * k); + } else { + for (; i < j; i++) for (var k = 1; k < 10; k++) ticks.push(pow(i) * k); + ticks.push(pow(i)); + } + for (i = 0; ticks[i] < u; i++) {} // strip small values + for (j = ticks.length; ticks[j - 1] > v; j--) {} // strip big values + ticks = ticks.slice(i, j); + } + return ticks; + }; + + scale.tickFormat = function(n, format) { + if (arguments.length < 2) format = d3_scale_logFormat; + if (arguments.length < 1) return format; + var k = n / scale.ticks().length, + f = log === d3_scale_logn ? (e = -1e-12, Math.floor) : (e = 1e-12, Math.ceil), + e; + return function(d) { + return d / pow(f(log(d) + e)) < k ? format(d) : ""; + }; + }; + + scale.copy = function() { + return d3_scale_log(linear.copy(), log); + }; + + return d3_scale_linearRebind(scale, linear); +}; + +var d3_scale_logFormat = d3.format(".0e"); + +function d3_scale_logp(x) { + return Math.log(x) / Math.LN10; +} + +function d3_scale_logn(x) { + return -Math.log(-x) / Math.LN10; +} + +d3_scale_logp.pow = function(x) { + return Math.pow(10, x); +}; + +d3_scale_logn.pow = function(x) { + return -Math.pow(10, -x); +}; +d3.scale.pow = function() { + return d3_scale_pow(d3.scale.linear(), 1); +}; + +function d3_scale_pow(linear, exponent) { + var powp = d3_scale_powPow(exponent), + powb = d3_scale_powPow(1 / exponent); + + function scale(x) { + return linear(powp(x)); + } + + scale.invert = function(x) { + return powb(linear.invert(x)); + }; + + scale.domain = function(x) { + if (!arguments.length) return linear.domain().map(powb); + linear.domain(x.map(powp)); + return scale; + }; + + scale.ticks = function(m) { + return d3_scale_linearTicks(scale.domain(), m); + }; + + scale.tickFormat = function(m) { + return d3_scale_linearTickFormat(scale.domain(), m); + }; + + scale.nice = function() { + return scale.domain(d3_scale_nice(scale.domain(), d3_scale_linearNice)); + }; + + scale.exponent = function(x) { + if (!arguments.length) return exponent; + var domain = scale.domain(); + powp = d3_scale_powPow(exponent = x); + powb = d3_scale_powPow(1 / exponent); + return scale.domain(domain); + }; + + scale.copy = function() { + return d3_scale_pow(linear.copy(), exponent); + }; + + return d3_scale_linearRebind(scale, linear); +}; + +function d3_scale_powPow(e) { + return function(x) { + return x < 0 ? -Math.pow(-x, e) : Math.pow(x, e); + }; +} +d3.scale.sqrt = function() { + return d3.scale.pow().exponent(.5); +}; +d3.scale.ordinal = function() { + return d3_scale_ordinal([], {t: "range", x: []}); +}; + +function d3_scale_ordinal(domain, ranger) { + var index, + range, + rangeBand; + + function scale(x) { + return range[((index[x] || (index[x] = domain.push(x))) - 1) % range.length]; + } + + function steps(start, step) { + return d3.range(domain.length).map(function(i) { return start + step * i; }); + } + + scale.domain = function(x) { + if (!arguments.length) return domain; + domain = []; + index = {}; + var i = -1, n = x.length, xi; + while (++i < n) if (!index[xi = x[i]]) index[xi] = domain.push(xi); + return scale[ranger.t](ranger.x, ranger.p); + }; + + scale.range = function(x) { + if (!arguments.length) return range; + range = x; + rangeBand = 0; + ranger = {t: "range", x: x}; + return scale; + }; + + scale.rangePoints = function(x, padding) { + if (arguments.length < 2) padding = 0; + var start = x[0], + stop = x[1], + step = (stop - start) / (domain.length - 1 + padding); + range = steps(domain.length < 2 ? (start + stop) / 2 : start + step * padding / 2, step); + rangeBand = 0; + ranger = {t: "rangePoints", x: x, p: padding}; + return scale; + }; + + scale.rangeBands = function(x, padding) { + if (arguments.length < 2) padding = 0; + var start = x[0], + stop = x[1], + step = (stop - start) / (domain.length + padding); + range = steps(start + step * padding, step); + rangeBand = step * (1 - padding); + ranger = {t: "rangeBands", x: x, p: padding}; + return scale; + }; + + scale.rangeRoundBands = function(x, padding) { + if (arguments.length < 2) padding = 0; + var start = x[0], + stop = x[1], + step = Math.floor((stop - start) / (domain.length + padding)); + range = steps(start + Math.round((stop - start - (domain.length - padding) * step) / 2), step); + rangeBand = Math.round(step * (1 - padding)); + ranger = {t: "rangeRoundBands", x: x, p: padding}; + return scale; + }; + + scale.rangeBand = function() { + return rangeBand; + }; + + scale.rangeExtent = function() { + return ranger.x; + }; + + scale.copy = function() { + return d3_scale_ordinal(domain, ranger); + }; + + return scale.domain(domain); +}; +/* + * This product includes color specifications and designs developed by Cynthia + * Brewer (http://colorbrewer.org/). See lib/colorbrewer for more information. + */ + +d3.scale.category10 = function() { + return d3.scale.ordinal().range(d3_category10); +}; + +d3.scale.category20 = function() { + return d3.scale.ordinal().range(d3_category20); +}; + +d3.scale.category20b = function() { + return d3.scale.ordinal().range(d3_category20b); +}; + +d3.scale.category20c = function() { + return d3.scale.ordinal().range(d3_category20c); +}; + +var d3_category10 = [ + "#1f77b4", "#ff7f0e", "#2ca02c", "#d62728", "#9467bd", + "#8c564b", "#e377c2", "#7f7f7f", "#bcbd22", "#17becf" +]; + +var d3_category20 = [ + "#1f77b4", "#aec7e8", + "#ff7f0e", "#ffbb78", + "#2ca02c", "#98df8a", + "#d62728", "#ff9896", + "#9467bd", "#c5b0d5", + "#8c564b", "#c49c94", + "#e377c2", "#f7b6d2", + "#7f7f7f", "#c7c7c7", + "#bcbd22", "#dbdb8d", + "#17becf", "#9edae5" +]; + +var d3_category20b = [ + "#393b79", "#5254a3", "#6b6ecf", "#9c9ede", + "#637939", "#8ca252", "#b5cf6b", "#cedb9c", + "#8c6d31", "#bd9e39", "#e7ba52", "#e7cb94", + "#843c39", "#ad494a", "#d6616b", "#e7969c", + "#7b4173", "#a55194", "#ce6dbd", "#de9ed6" +]; + +var d3_category20c = [ + "#3182bd", "#6baed6", "#9ecae1", "#c6dbef", + "#e6550d", "#fd8d3c", "#fdae6b", "#fdd0a2", + "#31a354", "#74c476", "#a1d99b", "#c7e9c0", + "#756bb1", "#9e9ac8", "#bcbddc", "#dadaeb", + "#636363", "#969696", "#bdbdbd", "#d9d9d9" +]; +d3.scale.quantile = function() { + return d3_scale_quantile([], []); +}; + +function d3_scale_quantile(domain, range) { + var thresholds; + + function rescale() { + var k = 0, + n = domain.length, + q = range.length; + thresholds = []; + while (++k < q) thresholds[k - 1] = d3.quantile(domain, k / q); + return scale; + } + + function scale(x) { + if (isNaN(x = +x)) return NaN; + return range[d3.bisect(thresholds, x)]; + } + + scale.domain = function(x) { + if (!arguments.length) return domain; + domain = x.filter(function(d) { return !isNaN(d); }).sort(d3.ascending); + return rescale(); + }; + + scale.range = function(x) { + if (!arguments.length) return range; + range = x; + return rescale(); + }; + + scale.quantiles = function() { + return thresholds; + }; + + scale.copy = function() { + return d3_scale_quantile(domain, range); // copy on write! + }; + + return rescale(); +}; +d3.scale.quantize = function() { + return d3_scale_quantize(0, 1, [0, 1]); +}; + +function d3_scale_quantize(x0, x1, range) { + var kx, i; + + function scale(x) { + return range[Math.max(0, Math.min(i, Math.floor(kx * (x - x0))))]; + } + + function rescale() { + kx = range.length / (x1 - x0); + i = range.length - 1; + return scale; + } + + scale.domain = function(x) { + if (!arguments.length) return [x0, x1]; + x0 = +x[0]; + x1 = +x[x.length - 1]; + return rescale(); + }; + + scale.range = function(x) { + if (!arguments.length) return range; + range = x; + return rescale(); + }; + + scale.copy = function() { + return d3_scale_quantize(x0, x1, range); // copy on write + }; + + return rescale(); +}; +d3.svg = {}; +d3.svg.arc = function() { + var innerRadius = d3_svg_arcInnerRadius, + outerRadius = d3_svg_arcOuterRadius, + startAngle = d3_svg_arcStartAngle, + endAngle = d3_svg_arcEndAngle; + + function arc() { + var r0 = innerRadius.apply(this, arguments), + r1 = outerRadius.apply(this, arguments), + a0 = startAngle.apply(this, arguments) + d3_svg_arcOffset, + a1 = endAngle.apply(this, arguments) + d3_svg_arcOffset, + da = (a1 < a0 && (da = a0, a0 = a1, a1 = da), a1 - a0), + df = da < Math.PI ? "0" : "1", + c0 = Math.cos(a0), + s0 = Math.sin(a0), + c1 = Math.cos(a1), + s1 = Math.sin(a1); + return da >= d3_svg_arcMax + ? (r0 + ? "M0," + r1 + + "A" + r1 + "," + r1 + " 0 1,1 0," + (-r1) + + "A" + r1 + "," + r1 + " 0 1,1 0," + r1 + + "M0," + r0 + + "A" + r0 + "," + r0 + " 0 1,0 0," + (-r0) + + "A" + r0 + "," + r0 + " 0 1,0 0," + r0 + + "Z" + : "M0," + r1 + + "A" + r1 + "," + r1 + " 0 1,1 0," + (-r1) + + "A" + r1 + "," + r1 + " 0 1,1 0," + r1 + + "Z") + : (r0 + ? "M" + r1 * c0 + "," + r1 * s0 + + "A" + r1 + "," + r1 + " 0 " + df + ",1 " + r1 * c1 + "," + r1 * s1 + + "L" + r0 * c1 + "," + r0 * s1 + + "A" + r0 + "," + r0 + " 0 " + df + ",0 " + r0 * c0 + "," + r0 * s0 + + "Z" + : "M" + r1 * c0 + "," + r1 * s0 + + "A" + r1 + "," + r1 + " 0 " + df + ",1 " + r1 * c1 + "," + r1 * s1 + + "L0,0" + + "Z"); + } + + arc.innerRadius = function(v) { + if (!arguments.length) return innerRadius; + innerRadius = d3.functor(v); + return arc; + }; + + arc.outerRadius = function(v) { + if (!arguments.length) return outerRadius; + outerRadius = d3.functor(v); + return arc; + }; + + arc.startAngle = function(v) { + if (!arguments.length) return startAngle; + startAngle = d3.functor(v); + return arc; + }; + + arc.endAngle = function(v) { + if (!arguments.length) return endAngle; + endAngle = d3.functor(v); + return arc; + }; + + arc.centroid = function() { + var r = (innerRadius.apply(this, arguments) + + outerRadius.apply(this, arguments)) / 2, + a = (startAngle.apply(this, arguments) + + endAngle.apply(this, arguments)) / 2 + d3_svg_arcOffset; + return [Math.cos(a) * r, Math.sin(a) * r]; + }; + + return arc; +}; + +var d3_svg_arcOffset = -Math.PI / 2, + d3_svg_arcMax = 2 * Math.PI - 1e-6; + +function d3_svg_arcInnerRadius(d) { + return d.innerRadius; +} + +function d3_svg_arcOuterRadius(d) { + return d.outerRadius; +} + +function d3_svg_arcStartAngle(d) { + return d.startAngle; +} + +function d3_svg_arcEndAngle(d) { + return d.endAngle; +} +function d3_svg_line(projection) { + var x = d3_svg_lineX, + y = d3_svg_lineY, + interpolate = "linear", + interpolator = d3_svg_lineInterpolators[interpolate], + tension = .7; + + function line(d) { + return d.length < 1 ? null : "M" + interpolator(projection(d3_svg_linePoints(this, d, x, y)), tension); + } + + line.x = function(v) { + if (!arguments.length) return x; + x = v; + return line; + }; + + line.y = function(v) { + if (!arguments.length) return y; + y = v; + return line; + }; + + line.interpolate = function(v) { + if (!arguments.length) return interpolate; + interpolator = d3_svg_lineInterpolators[interpolate = v]; + return line; + }; + + line.tension = function(v) { + if (!arguments.length) return tension; + tension = v; + return line; + }; + + return line; +} + +d3.svg.line = function() { + return d3_svg_line(Object); +}; + +// Converts the specified array of data into an array of points +// (x-y tuples), by evaluating the specified `x` and `y` functions on each +// data point. The `this` context of the evaluated functions is the specified +// "self" object; each function is passed the current datum and index. +function d3_svg_linePoints(self, d, x, y) { + var points = [], + i = -1, + n = d.length, + fx = typeof x === "function", + fy = typeof y === "function", + value; + if (fx && fy) { + while (++i < n) points.push([ + x.call(self, value = d[i], i), + y.call(self, value, i) + ]); + } else if (fx) { + while (++i < n) points.push([x.call(self, d[i], i), y]); + } else if (fy) { + while (++i < n) points.push([x, y.call(self, d[i], i)]); + } else { + while (++i < n) points.push([x, y]); + } + return points; +} + +// The default `x` property, which references d[0]. +function d3_svg_lineX(d) { + return d[0]; +} + +// The default `y` property, which references d[1]. +function d3_svg_lineY(d) { + return d[1]; +} + +// The various interpolators supported by the `line` class. +var d3_svg_lineInterpolators = { + "linear": d3_svg_lineLinear, + "step-before": d3_svg_lineStepBefore, + "step-after": d3_svg_lineStepAfter, + "basis": d3_svg_lineBasis, + "basis-open": d3_svg_lineBasisOpen, + "basis-closed": d3_svg_lineBasisClosed, + "bundle": d3_svg_lineBundle, + "cardinal": d3_svg_lineCardinal, + "cardinal-open": d3_svg_lineCardinalOpen, + "cardinal-closed": d3_svg_lineCardinalClosed, + "monotone": d3_svg_lineMonotone +}; + +// Linear interpolation; generates "L" commands. +function d3_svg_lineLinear(points) { + var i = 0, + n = points.length, + p = points[0], + path = [p[0], ",", p[1]]; + while (++i < n) path.push("L", (p = points[i])[0], ",", p[1]); + return path.join(""); +} + +// Step interpolation; generates "H" and "V" commands. +function d3_svg_lineStepBefore(points) { + var i = 0, + n = points.length, + p = points[0], + path = [p[0], ",", p[1]]; + while (++i < n) path.push("V", (p = points[i])[1], "H", p[0]); + return path.join(""); +} + +// Step interpolation; generates "H" and "V" commands. +function d3_svg_lineStepAfter(points) { + var i = 0, + n = points.length, + p = points[0], + path = [p[0], ",", p[1]]; + while (++i < n) path.push("H", (p = points[i])[0], "V", p[1]); + return path.join(""); +} + +// Open cardinal spline interpolation; generates "C" commands. +function d3_svg_lineCardinalOpen(points, tension) { + return points.length < 4 + ? d3_svg_lineLinear(points) + : points[1] + d3_svg_lineHermite(points.slice(1, points.length - 1), + d3_svg_lineCardinalTangents(points, tension)); +} + +// Closed cardinal spline interpolation; generates "C" commands. +function d3_svg_lineCardinalClosed(points, tension) { + return points.length < 3 + ? d3_svg_lineLinear(points) + : points[0] + d3_svg_lineHermite((points.push(points[0]), points), + d3_svg_lineCardinalTangents([points[points.length - 2]] + .concat(points, [points[1]]), tension)); +} + +// Cardinal spline interpolation; generates "C" commands. +function d3_svg_lineCardinal(points, tension, closed) { + return points.length < 3 + ? d3_svg_lineLinear(points) + : points[0] + d3_svg_lineHermite(points, + d3_svg_lineCardinalTangents(points, tension)); +} + +// Hermite spline construction; generates "C" commands. +function d3_svg_lineHermite(points, tangents) { + if (tangents.length < 1 + || (points.length != tangents.length + && points.length != tangents.length + 2)) { + return d3_svg_lineLinear(points); + } + + var quad = points.length != tangents.length, + path = "", + p0 = points[0], + p = points[1], + t0 = tangents[0], + t = t0, + pi = 1; + + if (quad) { + path += "Q" + (p[0] - t0[0] * 2 / 3) + "," + (p[1] - t0[1] * 2 / 3) + + "," + p[0] + "," + p[1]; + p0 = points[1]; + pi = 2; + } + + if (tangents.length > 1) { + t = tangents[1]; + p = points[pi]; + pi++; + path += "C" + (p0[0] + t0[0]) + "," + (p0[1] + t0[1]) + + "," + (p[0] - t[0]) + "," + (p[1] - t[1]) + + "," + p[0] + "," + p[1]; + for (var i = 2; i < tangents.length; i++, pi++) { + p = points[pi]; + t = tangents[i]; + path += "S" + (p[0] - t[0]) + "," + (p[1] - t[1]) + + "," + p[0] + "," + p[1]; + } + } + + if (quad) { + var lp = points[pi]; + path += "Q" + (p[0] + t[0] * 2 / 3) + "," + (p[1] + t[1] * 2 / 3) + + "," + lp[0] + "," + lp[1]; + } + + return path; +} + +// Generates tangents for a cardinal spline. +function d3_svg_lineCardinalTangents(points, tension) { + var tangents = [], + a = (1 - tension) / 2, + p0, + p1 = points[0], + p2 = points[1], + i = 1, + n = points.length; + while (++i < n) { + p0 = p1; + p1 = p2; + p2 = points[i]; + tangents.push([a * (p2[0] - p0[0]), a * (p2[1] - p0[1])]); + } + return tangents; +} + +// B-spline interpolation; generates "C" commands. +function d3_svg_lineBasis(points) { + if (points.length < 3) return d3_svg_lineLinear(points); + var i = 1, + n = points.length, + pi = points[0], + x0 = pi[0], + y0 = pi[1], + px = [x0, x0, x0, (pi = points[1])[0]], + py = [y0, y0, y0, pi[1]], + path = [x0, ",", y0]; + d3_svg_lineBasisBezier(path, px, py); + while (++i < n) { + pi = points[i]; + px.shift(); px.push(pi[0]); + py.shift(); py.push(pi[1]); + d3_svg_lineBasisBezier(path, px, py); + } + i = -1; + while (++i < 2) { + px.shift(); px.push(pi[0]); + py.shift(); py.push(pi[1]); + d3_svg_lineBasisBezier(path, px, py); + } + return path.join(""); +} + +// Open B-spline interpolation; generates "C" commands. +function d3_svg_lineBasisOpen(points) { + if (points.length < 4) return d3_svg_lineLinear(points); + var path = [], + i = -1, + n = points.length, + pi, + px = [0], + py = [0]; + while (++i < 3) { + pi = points[i]; + px.push(pi[0]); + py.push(pi[1]); + } + path.push(d3_svg_lineDot4(d3_svg_lineBasisBezier3, px) + + "," + d3_svg_lineDot4(d3_svg_lineBasisBezier3, py)); + --i; while (++i < n) { + pi = points[i]; + px.shift(); px.push(pi[0]); + py.shift(); py.push(pi[1]); + d3_svg_lineBasisBezier(path, px, py); + } + return path.join(""); +} + +// Closed B-spline interpolation; generates "C" commands. +function d3_svg_lineBasisClosed(points) { + var path, + i = -1, + n = points.length, + m = n + 4, + pi, + px = [], + py = []; + while (++i < 4) { + pi = points[i % n]; + px.push(pi[0]); + py.push(pi[1]); + } + path = [ + d3_svg_lineDot4(d3_svg_lineBasisBezier3, px), ",", + d3_svg_lineDot4(d3_svg_lineBasisBezier3, py) + ]; + --i; while (++i < m) { + pi = points[i % n]; + px.shift(); px.push(pi[0]); + py.shift(); py.push(pi[1]); + d3_svg_lineBasisBezier(path, px, py); + } + return path.join(""); +} + +function d3_svg_lineBundle(points, tension) { + var n = points.length - 1, + x0 = points[0][0], + y0 = points[0][1], + dx = points[n][0] - x0, + dy = points[n][1] - y0, + i = -1, + p, + t; + while (++i <= n) { + p = points[i]; + t = i / n; + p[0] = tension * p[0] + (1 - tension) * (x0 + t * dx); + p[1] = tension * p[1] + (1 - tension) * (y0 + t * dy); + } + return d3_svg_lineBasis(points); +} + +// Returns the dot product of the given four-element vectors. +function d3_svg_lineDot4(a, b) { + return a[0] * b[0] + a[1] * b[1] + a[2] * b[2] + a[3] * b[3]; +} + +// Matrix to transform basis (b-spline) control points to bezier +// control points. Derived from FvD 11.2.8. +var d3_svg_lineBasisBezier1 = [0, 2/3, 1/3, 0], + d3_svg_lineBasisBezier2 = [0, 1/3, 2/3, 0], + d3_svg_lineBasisBezier3 = [0, 1/6, 2/3, 1/6]; + +// Pushes a "C" Bézier curve onto the specified path array, given the +// two specified four-element arrays which define the control points. +function d3_svg_lineBasisBezier(path, x, y) { + path.push( + "C", d3_svg_lineDot4(d3_svg_lineBasisBezier1, x), + ",", d3_svg_lineDot4(d3_svg_lineBasisBezier1, y), + ",", d3_svg_lineDot4(d3_svg_lineBasisBezier2, x), + ",", d3_svg_lineDot4(d3_svg_lineBasisBezier2, y), + ",", d3_svg_lineDot4(d3_svg_lineBasisBezier3, x), + ",", d3_svg_lineDot4(d3_svg_lineBasisBezier3, y)); +} + +// Computes the slope from points p0 to p1. +function d3_svg_lineSlope(p0, p1) { + return (p1[1] - p0[1]) / (p1[0] - p0[0]); +} + +// Compute three-point differences for the given points. +// http://en.wikipedia.org/wiki/Cubic_Hermite_spline#Finite_difference +function d3_svg_lineFiniteDifferences(points) { + var i = 0, + j = points.length - 1, + m = [], + p0 = points[0], + p1 = points[1], + d = m[0] = d3_svg_lineSlope(p0, p1); + while (++i < j) { + m[i] = d + (d = d3_svg_lineSlope(p0 = p1, p1 = points[i + 1])); + } + m[i] = d; + return m; +} + +// Interpolates the given points using Fritsch-Carlson Monotone cubic Hermite +// interpolation. Returns an array of tangent vectors. For details, see +// http://en.wikipedia.org/wiki/Monotone_cubic_interpolation +function d3_svg_lineMonotoneTangents(points) { + var tangents = [], + d, + a, + b, + s, + m = d3_svg_lineFiniteDifferences(points), + i = -1, + j = points.length - 1; + + // The first two steps are done by computing finite-differences: + // 1. Compute the slopes of the secant lines between successive points. + // 2. Initialize the tangents at every point as the average of the secants. + + // Then, for each segment… + while (++i < j) { + d = d3_svg_lineSlope(points[i], points[i + 1]); + + // 3. If two successive yk = y{k + 1} are equal (i.e., d is zero), then set + // mk = m{k + 1} = 0 as the spline connecting these points must be flat to + // preserve monotonicity. Ignore step 4 and 5 for those k. + + if (Math.abs(d) < 1e-6) { + m[i] = m[i + 1] = 0; + } else { + // 4. Let ak = mk / dk and bk = m{k + 1} / dk. + a = m[i] / d; + b = m[i + 1] / d; + + // 5. Prevent overshoot and ensure monotonicity by restricting the + // magnitude of vector <ak, bk> to a circle of radius 3. + s = a * a + b * b; + if (s > 9) { + s = d * 3 / Math.sqrt(s); + m[i] = s * a; + m[i + 1] = s * b; + } + } + } + + // Compute the normalized tangent vector from the slopes. Note that if x is + // not monotonic, it's possible that the slope will be infinite, so we protect + // against NaN by setting the coordinate to zero. + i = -1; while (++i <= j) { + s = (points[Math.min(j, i + 1)][0] - points[Math.max(0, i - 1)][0]) + / (6 * (1 + m[i] * m[i])); + tangents.push([s || 0, m[i] * s || 0]); + } + + return tangents; +} + +function d3_svg_lineMonotone(points) { + return points.length < 3 + ? d3_svg_lineLinear(points) + : points[0] + + d3_svg_lineHermite(points, d3_svg_lineMonotoneTangents(points)); +} +d3.svg.line.radial = function() { + var line = d3_svg_line(d3_svg_lineRadial); + line.radius = line.x, delete line.x; + line.angle = line.y, delete line.y; + return line; +}; + +function d3_svg_lineRadial(points) { + var point, + i = -1, + n = points.length, + r, + a; + while (++i < n) { + point = points[i]; + r = point[0]; + a = point[1] + d3_svg_arcOffset; + point[0] = r * Math.cos(a); + point[1] = r * Math.sin(a); + } + return points; +} +function d3_svg_area(projection) { + var x0 = d3_svg_lineX, + x1 = d3_svg_lineX, + y0 = 0, + y1 = d3_svg_lineY, + interpolate, + i0, + i1, + tension = .7; + + function area(d) { + if (d.length < 1) return null; + var points0 = d3_svg_linePoints(this, d, x0, y0), + points1 = d3_svg_linePoints(this, d, x0 === x1 ? d3_svg_areaX(points0) : x1, y0 === y1 ? d3_svg_areaY(points0) : y1); + return "M" + i0(projection(points1), tension) + + "L" + i1(projection(points0.reverse()), tension) + + "Z"; + } + + area.x = function(x) { + if (!arguments.length) return x1; + x0 = x1 = x; + return area; + }; + + area.x0 = function(x) { + if (!arguments.length) return x0; + x0 = x; + return area; + }; + + area.x1 = function(x) { + if (!arguments.length) return x1; + x1 = x; + return area; + }; + + area.y = function(y) { + if (!arguments.length) return y1; + y0 = y1 = y; + return area; + }; + + area.y0 = function(y) { + if (!arguments.length) return y0; + y0 = y; + return area; + }; + + area.y1 = function(y) { + if (!arguments.length) return y1; + y1 = y; + return area; + }; + + area.interpolate = function(x) { + if (!arguments.length) return interpolate; + i0 = d3_svg_lineInterpolators[interpolate = x]; + i1 = i0.reverse || i0; + return area; + }; + + area.tension = function(x) { + if (!arguments.length) return tension; + tension = x; + return area; + }; + + return area.interpolate("linear"); +} + +d3_svg_lineStepBefore.reverse = d3_svg_lineStepAfter; +d3_svg_lineStepAfter.reverse = d3_svg_lineStepBefore; + +d3.svg.area = function() { + return d3_svg_area(Object); +}; + +function d3_svg_areaX(points) { + return function(d, i) { + return points[i][0]; + }; +} + +function d3_svg_areaY(points) { + return function(d, i) { + return points[i][1]; + }; +} +d3.svg.area.radial = function() { + var area = d3_svg_area(d3_svg_lineRadial); + area.radius = area.x, delete area.x; + area.innerRadius = area.x0, delete area.x0; + area.outerRadius = area.x1, delete area.x1; + area.angle = area.y, delete area.y; + area.startAngle = area.y0, delete area.y0; + area.endAngle = area.y1, delete area.y1; + return area; +}; +d3.svg.chord = function() { + var source = d3_svg_chordSource, + target = d3_svg_chordTarget, + radius = d3_svg_chordRadius, + startAngle = d3_svg_arcStartAngle, + endAngle = d3_svg_arcEndAngle; + + // TODO Allow control point to be customized. + + function chord(d, i) { + var s = subgroup(this, source, d, i), + t = subgroup(this, target, d, i); + return "M" + s.p0 + + arc(s.r, s.p1) + (equals(s, t) + ? curve(s.r, s.p1, s.r, s.p0) + : curve(s.r, s.p1, t.r, t.p0) + + arc(t.r, t.p1) + + curve(t.r, t.p1, s.r, s.p0)) + + "Z"; + } + + function subgroup(self, f, d, i) { + var subgroup = f.call(self, d, i), + r = radius.call(self, subgroup, i), + a0 = startAngle.call(self, subgroup, i) + d3_svg_arcOffset, + a1 = endAngle.call(self, subgroup, i) + d3_svg_arcOffset; + return { + r: r, + a0: a0, + a1: a1, + p0: [r * Math.cos(a0), r * Math.sin(a0)], + p1: [r * Math.cos(a1), r * Math.sin(a1)] + }; + } + + function equals(a, b) { + return a.a0 == b.a0 && a.a1 == b.a1; + } + + function arc(r, p) { + return "A" + r + "," + r + " 0 0,1 " + p; + } + + function curve(r0, p0, r1, p1) { + return "Q 0,0 " + p1; + } + + chord.radius = function(v) { + if (!arguments.length) return radius; + radius = d3.functor(v); + return chord; + }; + + chord.source = function(v) { + if (!arguments.length) return source; + source = d3.functor(v); + return chord; + }; + + chord.target = function(v) { + if (!arguments.length) return target; + target = d3.functor(v); + return chord; + }; + + chord.startAngle = function(v) { + if (!arguments.length) return startAngle; + startAngle = d3.functor(v); + return chord; + }; + + chord.endAngle = function(v) { + if (!arguments.length) return endAngle; + endAngle = d3.functor(v); + return chord; + }; + + return chord; +}; + +function d3_svg_chordSource(d) { + return d.source; +} + +function d3_svg_chordTarget(d) { + return d.target; +} + +function d3_svg_chordRadius(d) { + return d.radius; +} + +function d3_svg_chordStartAngle(d) { + return d.startAngle; +} + +function d3_svg_chordEndAngle(d) { + return d.endAngle; +} +d3.svg.diagonal = function() { + var source = d3_svg_chordSource, + target = d3_svg_chordTarget, + projection = d3_svg_diagonalProjection; + + function diagonal(d, i) { + var p0 = source.call(this, d, i), + p3 = target.call(this, d, i), + m = (p0.y + p3.y) / 2, + p = [p0, {x: p0.x, y: m}, {x: p3.x, y: m}, p3]; + p = p.map(projection); + return "M" + p[0] + "C" + p[1] + " " + p[2] + " " + p[3]; + } + + diagonal.source = function(x) { + if (!arguments.length) return source; + source = d3.functor(x); + return diagonal; + }; + + diagonal.target = function(x) { + if (!arguments.length) return target; + target = d3.functor(x); + return diagonal; + }; + + diagonal.projection = function(x) { + if (!arguments.length) return projection; + projection = x; + return diagonal; + }; + + return diagonal; +}; + +function d3_svg_diagonalProjection(d) { + return [d.x, d.y]; +} +d3.svg.diagonal.radial = function() { + var diagonal = d3.svg.diagonal(), + projection = d3_svg_diagonalProjection, + projection_ = diagonal.projection; + + diagonal.projection = function(x) { + return arguments.length + ? projection_(d3_svg_diagonalRadialProjection(projection = x)) + : projection; + }; + + return diagonal; +}; + +function d3_svg_diagonalRadialProjection(projection) { + return function() { + var d = projection.apply(this, arguments), + r = d[0], + a = d[1] + d3_svg_arcOffset; + return [r * Math.cos(a), r * Math.sin(a)]; + }; +} +d3.svg.mouse = function(container) { + return d3_svg_mousePoint(container, d3.event); +}; + +// https://bugs.webkit.org/show_bug.cgi?id=44083 +var d3_mouse_bug44083 = /WebKit/.test(navigator.userAgent) ? -1 : 0; + +function d3_svg_mousePoint(container, e) { + var point = (container.ownerSVGElement || container).createSVGPoint(); + if ((d3_mouse_bug44083 < 0) && (window.scrollX || window.scrollY)) { + var svg = d3.select(document.body) + .append("svg") + .style("position", "absolute") + .style("top", 0) + .style("left", 0); + var ctm = svg[0][0].getScreenCTM(); + d3_mouse_bug44083 = !(ctm.f || ctm.e); + svg.remove(); + } + if (d3_mouse_bug44083) { + point.x = e.pageX; + point.y = e.pageY; + } else { + point.x = e.clientX; + point.y = e.clientY; + } + point = point.matrixTransform(container.getScreenCTM().inverse()); + return [point.x, point.y]; +}; +d3.svg.touches = function(container, touches) { + if (arguments.length < 2) touches = d3.event.touches; + + return touches ? d3_array(touches).map(function(touch) { + var point = d3_svg_mousePoint(container, touch); + point.identifier = touch.identifier; + return point; + }) : []; +}; +d3.svg.symbol = function() { + var type = d3_svg_symbolType, + size = d3_svg_symbolSize; + + function symbol(d, i) { + return (d3_svg_symbols[type.call(this, d, i)] + || d3_svg_symbols.circle) + (size.call(this, d, i)); + } + + symbol.type = function(x) { + if (!arguments.length) return type; + type = d3.functor(x); + return symbol; + }; + + // size of symbol in square pixels + symbol.size = function(x) { + if (!arguments.length) return size; + size = d3.functor(x); + return symbol; + }; + + return symbol; +}; + +function d3_svg_symbolSize() { + return 64; +} + +function d3_svg_symbolType() { + return "circle"; +} + +// TODO cross-diagonal? +var d3_svg_symbols = { + "circle": function(size) { + var r = Math.sqrt(size / Math.PI); + return "M0," + r + + "A" + r + "," + r + " 0 1,1 0," + (-r) + + "A" + r + "," + r + " 0 1,1 0," + r + + "Z"; + }, + "cross": function(size) { + var r = Math.sqrt(size / 5) / 2; + return "M" + -3 * r + "," + -r + + "H" + -r + + "V" + -3 * r + + "H" + r + + "V" + -r + + "H" + 3 * r + + "V" + r + + "H" + r + + "V" + 3 * r + + "H" + -r + + "V" + r + + "H" + -3 * r + + "Z"; + }, + "diamond": function(size) { + var ry = Math.sqrt(size / (2 * d3_svg_symbolTan30)), + rx = ry * d3_svg_symbolTan30; + return "M0," + -ry + + "L" + rx + ",0" + + " 0," + ry + + " " + -rx + ",0" + + "Z"; + }, + "square": function(size) { + var r = Math.sqrt(size) / 2; + return "M" + -r + "," + -r + + "L" + r + "," + -r + + " " + r + "," + r + + " " + -r + "," + r + + "Z"; + }, + "triangle-down": function(size) { + var rx = Math.sqrt(size / d3_svg_symbolSqrt3), + ry = rx * d3_svg_symbolSqrt3 / 2; + return "M0," + ry + + "L" + rx +"," + -ry + + " " + -rx + "," + -ry + + "Z"; + }, + "triangle-up": function(size) { + var rx = Math.sqrt(size / d3_svg_symbolSqrt3), + ry = rx * d3_svg_symbolSqrt3 / 2; + return "M0," + -ry + + "L" + rx +"," + ry + + " " + -rx + "," + ry + + "Z"; + } +}; + +d3.svg.symbolTypes = d3.keys(d3_svg_symbols); + +var d3_svg_symbolSqrt3 = Math.sqrt(3), + d3_svg_symbolTan30 = Math.tan(30 * Math.PI / 180); +d3.svg.axis = function() { + var scale = d3.scale.linear(), + orient = "bottom", + tickMajorSize = 6, + tickMinorSize = 6, + tickEndSize = 6, + tickPadding = 3, + tickArguments_ = [10], + tickFormat_, + tickSubdivide = 0; + + function axis(selection) { + selection.each(function(d, i, j) { + var g = d3.select(this); + + // If selection is a transition, create subtransitions. + var transition = selection.delay ? function(o) { + var id = d3_transitionInheritId; + try { + d3_transitionInheritId = selection.id; + return o.transition() + .delay(selection[j][i].delay) + .duration(selection[j][i].duration) + .ease(selection.ease()); + } finally { + d3_transitionInheritId = id; + } + } : Object; + + // Ticks, or domain values for ordinal scales. + var ticks = scale.ticks ? scale.ticks.apply(scale, tickArguments_) : scale.domain(), + tickFormat = tickFormat_ == null ? (scale.tickFormat ? scale.tickFormat.apply(scale, tickArguments_) : String) : tickFormat_; + + // Minor ticks. + var subticks = d3_svg_axisSubdivide(scale, ticks, tickSubdivide), + subtick = g.selectAll(".minor").data(subticks, String), + subtickEnter = subtick.enter().insert("line", "g").attr("class", "tick minor").style("opacity", 1e-6), + subtickExit = transition(subtick.exit()).style("opacity", 1e-6).remove(), + subtickUpdate = transition(subtick).style("opacity", 1); + + // Major ticks. + var tick = g.selectAll("g").data(ticks, String), + tickEnter = tick.enter().insert("g", "path").style("opacity", 1e-6), + tickExit = transition(tick.exit()).style("opacity", 1e-6).remove(), + tickUpdate = transition(tick).style("opacity", 1), + tickTransform; + + // Domain. + var range = d3_scaleRange(scale), + path = g.selectAll(".domain").data([0]), + pathEnter = path.enter().append("path").attr("class", "domain"), + pathUpdate = transition(path); + + // Stash a snapshot of the new scale, and retrieve the old snapshot. + var scale1 = scale.copy(), + scale0 = this.__chart__ || scale1; + this.__chart__ = scale1; + + tickEnter.append("line").attr("class", "tick"); + tickEnter.append("text"); + tickUpdate.select("text").text(tickFormat); + + switch (orient) { + case "bottom": { + tickTransform = d3_svg_axisX; + subtickUpdate.attr("x2", 0).attr("y2", tickMinorSize); + tickUpdate.select("line").attr("x2", 0).attr("y2", tickMajorSize); + tickUpdate.select("text").attr("x", 0).attr("y", Math.max(tickMajorSize, 0) + tickPadding).attr("dy", ".71em").attr("text-anchor", "middle"); + pathUpdate.attr("d", "M" + range[0] + "," + tickEndSize + "V0H" + range[1] + "V" + tickEndSize); + break; + } + case "top": { + tickTransform = d3_svg_axisX; + subtickUpdate.attr("x2", 0).attr("y2", -tickMinorSize); + tickUpdate.select("line").attr("x2", 0).attr("y2", -tickMajorSize); + tickUpdate.select("text").attr("x", 0).attr("y", -(Math.max(tickMajorSize, 0) + tickPadding)).attr("dy", "0em").attr("text-anchor", "middle"); + pathUpdate.attr("d", "M" + range[0] + "," + -tickEndSize + "V0H" + range[1] + "V" + -tickEndSize); + break; + } + case "left": { + tickTransform = d3_svg_axisY; + subtickUpdate.attr("x2", -tickMinorSize).attr("y2", 0); + tickUpdate.select("line").attr("x2", -tickMajorSize).attr("y2", 0); + tickUpdate.select("text").attr("x", -(Math.max(tickMajorSize, 0) + tickPadding)).attr("y", 0).attr("dy", ".32em").attr("text-anchor", "end"); + pathUpdate.attr("d", "M" + -tickEndSize + "," + range[0] + "H0V" + range[1] + "H" + -tickEndSize); + break; + } + case "right": { + tickTransform = d3_svg_axisY; + subtickUpdate.attr("x2", tickMinorSize).attr("y2", 0); + tickUpdate.select("line").attr("x2", tickMajorSize).attr("y2", 0); + tickUpdate.select("text").attr("x", Math.max(tickMajorSize, 0) + tickPadding).attr("y", 0).attr("dy", ".32em").attr("text-anchor", "start"); + pathUpdate.attr("d", "M" + tickEndSize + "," + range[0] + "H0V" + range[1] + "H" + tickEndSize); + break; + } + } + + // For quantitative scales: + // - enter new ticks from the old scale + // - exit old ticks to the new scale + if (scale.ticks) { + tickEnter.call(tickTransform, scale0); + tickUpdate.call(tickTransform, scale1); + tickExit.call(tickTransform, scale1); + subtickEnter.call(tickTransform, scale0); + subtickUpdate.call(tickTransform, scale1); + subtickExit.call(tickTransform, scale1); + } + + // For ordinal scales: + // - any entering ticks are undefined in the old scale + // - any exiting ticks are undefined in the new scale + // Therefore, we only need to transition updating ticks. + else { + var dx = scale1.rangeBand() / 2, x = function(d) { return scale1(d) + dx; }; + tickEnter.call(tickTransform, x); + tickUpdate.call(tickTransform, x); + } + }); + } + + axis.scale = function(x) { + if (!arguments.length) return scale; + scale = x; + return axis; + }; + + axis.orient = function(x) { + if (!arguments.length) return orient; + orient = x; + return axis; + }; + + axis.ticks = function() { + if (!arguments.length) return tickArguments_; + tickArguments_ = arguments; + return axis; + }; + + axis.tickFormat = function(x) { + if (!arguments.length) return tickFormat_; + tickFormat_ = x; + return axis; + }; + + axis.tickSize = function(x, y, z) { + if (!arguments.length) return tickMajorSize; + var n = arguments.length - 1; + tickMajorSize = +x; + tickMinorSize = n > 1 ? +y : tickMajorSize; + tickEndSize = n > 0 ? +arguments[n] : tickMajorSize; + return axis; + }; + + axis.tickPadding = function(x) { + if (!arguments.length) return tickPadding; + tickPadding = +x; + return axis; + }; + + axis.tickSubdivide = function(x) { + if (!arguments.length) return tickSubdivide; + tickSubdivide = +x; + return axis; + }; + + return axis; +}; + +function d3_svg_axisX(selection, x) { + selection.attr("transform", function(d) { return "translate(" + x(d) + ",0)"; }); +} + +function d3_svg_axisY(selection, y) { + selection.attr("transform", function(d) { return "translate(0," + y(d) + ")"; }); +} + +function d3_svg_axisSubdivide(scale, ticks, m) { + subticks = []; + if (m && ticks.length > 1) { + var extent = d3_scaleExtent(scale.domain()), + subticks, + i = -1, + n = ticks.length, + d = (ticks[1] - ticks[0]) / ++m, + j, + v; + while (++i < n) { + for (j = m; --j > 0;) { + if ((v = +ticks[i] - j * d) >= extent[0]) { + subticks.push(v); + } + } + } + for (--i, j = 0; ++j < m && (v = +ticks[i] + j * d) < extent[1];) { + subticks.push(v); + } + } + return subticks; +} +d3.svg.brush = function() { + var event = d3.dispatch("brushstart", "brush", "brushend"), + x, // x-scale, optional + y, // y-scale, optional + extent = [[0, 0], [0, 0]]; // [x0, y0], [x1, y1] + + function brush(g) { + var resizes = x && y ? ["n", "e", "s", "w", "nw", "ne", "se", "sw"] + : x ? ["e", "w"] + : y ? ["n", "s"] + : []; + + g.each(function() { + var g = d3.select(this).on("mousedown.brush", down), + bg = g.selectAll(".background").data([,]), + fg = g.selectAll(".extent").data([,]), + tz = g.selectAll(".resize").data(resizes, String), + e; + + // An invisible, mouseable area for starting a new brush. + bg.enter().append("rect") + .attr("class", "background") + .style("visibility", "hidden") + .style("pointer-events", "all") + .style("cursor", "crosshair"); + + // The visible brush extent; style this as you like! + fg.enter().append("rect") + .attr("class", "extent") + .style("cursor", "move"); + + // More invisible rects for resizing the extent. + tz.enter().append("rect") + .attr("class", function(d) { return "resize " + d; }) + .attr("width", 6) + .attr("height", 6) + .style("visibility", "hidden") + .style("pointer-events", brush.empty() ? "none" : "all") + .style("cursor", function(d) { return d3_svg_brushCursor[d]; }); + + // Remove any superfluous resizers. + tz.exit().remove(); + + // Initialize the background to fill the defined range. + // If the range isn't defined, you can post-process. + if (x) { + e = d3_scaleRange(x); + bg.attr("x", e[0]).attr("width", e[1] - e[0]); + d3_svg_brushRedrawX(g, extent); + } + if (y) { + e = d3_scaleRange(y); + bg.attr("y", e[0]).attr("height", e[1] - e[0]); + d3_svg_brushRedrawY(g, extent); + } + }); + } + + function down() { + var target = d3.select(d3.event.target); + + // Store some global state for the duration of the brush gesture. + d3_svg_brush = brush; + d3_svg_brushTarget = this; + d3_svg_brushExtent = extent; + d3_svg_brushOffset = d3.svg.mouse(d3_svg_brushTarget); + + // If the extent was clicked on, drag rather than brush; + // store the offset between the mouse and extent origin instead. + if (d3_svg_brushDrag = target.classed("extent")) { + d3_svg_brushOffset[0] = extent[0][0] - d3_svg_brushOffset[0]; + d3_svg_brushOffset[1] = extent[0][1] - d3_svg_brushOffset[1]; + } + + // If a resizer was clicked on, record which side is to be resized. + // Also, set the offset to the opposite side. + else if (target.classed("resize")) { + d3_svg_brushResize = d3.event.target.__data__; + d3_svg_brushOffset[0] = extent[+/w$/.test(d3_svg_brushResize)][0]; + d3_svg_brushOffset[1] = extent[+/^n/.test(d3_svg_brushResize)][1]; + } + + // If the ALT key is down when starting a brush, the center is at the mouse. + else if (d3.event.altKey) { + d3_svg_brushCenter = d3_svg_brushOffset.slice(); + } + + // Restrict which dimensions are resized. + d3_svg_brushX = !/^(n|s)$/.test(d3_svg_brushResize) && x; + d3_svg_brushY = !/^(e|w)$/.test(d3_svg_brushResize) && y; + + // Notify listeners. + d3_svg_brushDispatch = dispatcher(this, arguments); + d3_svg_brushDispatch("brushstart"); + d3_svg_brushMove(); + d3_eventCancel(); + } + + function dispatcher(that, argumentz) { + return function(type) { + var e = d3.event; + try { + d3.event = {type: type, target: brush}; + event[type].apply(that, argumentz); + } finally { + d3.event = e; + } + }; + } + + brush.x = function(z) { + if (!arguments.length) return x; + x = z; + return brush; + }; + + brush.y = function(z) { + if (!arguments.length) return y; + y = z; + return brush; + }; + + brush.extent = function(z) { + var x0, x1, y0, y1, t; + + // Invert the pixel extent to data-space. + if (!arguments.length) { + if (x) { + x0 = extent[0][0], x1 = extent[1][0]; + if (x.invert) x0 = x.invert(x0), x1 = x.invert(x1); + if (x1 < x0) t = x0, x0 = x1, x1 = t; + } + if (y) { + y0 = extent[0][1], y1 = extent[1][1]; + if (y.invert) y0 = y.invert(y0), y1 = y.invert(y1); + if (y1 < y0) t = y0, y0 = y1, y1 = t; + } + return x && y ? [[x0, y0], [x1, y1]] : x ? [x0, x1] : y && [y0, y1]; + } + + // Scale the data-space extent to pixels. + if (x) { + x0 = z[0], x1 = z[1]; + if (y) x0 = x0[0], x1 = x1[0]; + if (x.invert) x0 = x(x0), x1 = x(x1); + if (x1 < x0) t = x0, x0 = x1, x1 = t; + extent[0][0] = x0, extent[1][0] = x1; + } + if (y) { + y0 = z[0], y1 = z[1]; + if (x) y0 = y0[1], y1 = y1[1]; + if (y.invert) y0 = y(y0), y1 = y(y1); + if (y1 < y0) t = y0, y0 = y1, y1 = t; + extent[0][1] = y0, extent[1][1] = y1; + } + + return brush; + }; + + brush.clear = function() { + extent[0][0] = + extent[0][1] = + extent[1][0] = + extent[1][1] = 0; + return brush; + }; + + brush.empty = function() { + return (x && extent[0][0] === extent[1][0]) + || (y && extent[0][1] === extent[1][1]); + }; + + d3.select(window) + .on("mousemove.brush", d3_svg_brushMove) + .on("mouseup.brush", d3_svg_brushUp) + .on("keydown.brush", d3_svg_brushKeydown) + .on("keyup.brush", d3_svg_brushKeyup); + + return d3.rebind(brush, event, "on"); +}; + +var d3_svg_brush, + d3_svg_brushDispatch, + d3_svg_brushTarget, + d3_svg_brushX, + d3_svg_brushY, + d3_svg_brushExtent, + d3_svg_brushDrag, + d3_svg_brushResize, + d3_svg_brushCenter, + d3_svg_brushOffset; + +function d3_svg_brushRedrawX(g, extent) { + g.select(".extent").attr("x", extent[0][0]); + g.selectAll(".n,.s,.w,.nw,.sw").attr("x", extent[0][0] - 2); + g.selectAll(".e,.ne,.se").attr("x", extent[1][0] - 3); + g.selectAll(".extent,.n,.s").attr("width", extent[1][0] - extent[0][0]); +} + +function d3_svg_brushRedrawY(g, extent) { + g.select(".extent").attr("y", extent[0][1]); + g.selectAll(".n,.e,.w,.nw,.ne").attr("y", extent[0][1] - 3); + g.selectAll(".s,.se,.sw").attr("y", extent[1][1] - 4); + g.selectAll(".extent,.e,.w").attr("height", extent[1][1] - extent[0][1]); +} + +function d3_svg_brushKeydown() { + if (d3.event.keyCode == 32 && d3_svg_brushTarget && !d3_svg_brushDrag) { + d3_svg_brushCenter = null; + d3_svg_brushOffset[0] -= d3_svg_brushExtent[1][0]; + d3_svg_brushOffset[1] -= d3_svg_brushExtent[1][1]; + d3_svg_brushDrag = 2; + d3_eventCancel(); + } +} + +function d3_svg_brushKeyup() { + if (d3.event.keyCode == 32 && d3_svg_brushDrag == 2) { + d3_svg_brushOffset[0] += d3_svg_brushExtent[1][0]; + d3_svg_brushOffset[1] += d3_svg_brushExtent[1][1]; + d3_svg_brushDrag = 0; + d3_eventCancel(); + } +} + +function d3_svg_brushMove() { + if (d3_svg_brushOffset) { + var mouse = d3.svg.mouse(d3_svg_brushTarget), + g = d3.select(d3_svg_brushTarget); + + if (!d3_svg_brushDrag) { + + // If needed, determine the center from the current extent. + if (d3.event.altKey) { + if (!d3_svg_brushCenter) { + d3_svg_brushCenter = [ + (d3_svg_brushExtent[0][0] + d3_svg_brushExtent[1][0]) / 2, + (d3_svg_brushExtent[0][1] + d3_svg_brushExtent[1][1]) / 2 + ]; + } + + // Update the offset, for when the ALT key is released. + d3_svg_brushOffset[0] = d3_svg_brushExtent[+(mouse[0] < d3_svg_brushCenter[0])][0]; + d3_svg_brushOffset[1] = d3_svg_brushExtent[+(mouse[1] < d3_svg_brushCenter[1])][1]; + } + + // When the ALT key is released, we clear the center. + else d3_svg_brushCenter = null; + } + + // Update the brush extent for each dimension. + if (d3_svg_brushX) { + d3_svg_brushMove1(mouse, d3_svg_brushX, 0); + d3_svg_brushRedrawX(g, d3_svg_brushExtent); + } + if (d3_svg_brushY) { + d3_svg_brushMove1(mouse, d3_svg_brushY, 1); + d3_svg_brushRedrawY(g, d3_svg_brushExtent); + } + + // Notify listeners. + d3_svg_brushDispatch("brush"); + } +} + +function d3_svg_brushMove1(mouse, scale, i) { + var range = d3_scaleRange(scale), + r0 = range[0], + r1 = range[1], + offset = d3_svg_brushOffset[i], + size = d3_svg_brushExtent[1][i] - d3_svg_brushExtent[0][i], + min, + max; + + // When dragging, reduce the range by the extent size and offset. + if (d3_svg_brushDrag) { + r0 -= offset; + r1 -= size + offset; + } + + // Clamp the mouse so that the extent fits within the range extent. + min = Math.max(r0, Math.min(r1, mouse[i])); + + // Compute the new extent bounds. + if (d3_svg_brushDrag) { + max = (min += offset) + size; + } else { + + // If the ALT key is pressed, then preserve the center of the extent. + if (d3_svg_brushCenter) offset = Math.max(r0, Math.min(r1, 2 * d3_svg_brushCenter[i] - min)); + + // Compute the min and max of the offset and mouse. + if (offset < min) { + max = min; + min = offset; + } else { + max = offset; + } + } + + // Update the stored bounds. + d3_svg_brushExtent[0][i] = min; + d3_svg_brushExtent[1][i] = max; +} + +function d3_svg_brushUp() { + if (d3_svg_brushOffset) { + d3_svg_brushMove(); + d3.select(d3_svg_brushTarget).selectAll(".resize").style("pointer-events", d3_svg_brush.empty() ? "none" : "all"); + d3_svg_brushDispatch("brushend"); + d3_svg_brush = + d3_svg_brushDispatch = + d3_svg_brushTarget = + d3_svg_brushX = + d3_svg_brushY = + d3_svg_brushExtent = + d3_svg_brushDrag = + d3_svg_brushResize = + d3_svg_brushCenter = + d3_svg_brushOffset = null; + d3_eventCancel(); + } +} + +var d3_svg_brushCursor = { + n: "ns-resize", + e: "ew-resize", + s: "ns-resize", + w: "ew-resize", + nw: "nwse-resize", + ne: "nesw-resize", + se: "nwse-resize", + sw: "nesw-resize" +}; +d3.behavior = {}; +// TODO Track touch points by identifier. + +d3.behavior.drag = function() { + var event = d3.dispatch("drag", "dragstart", "dragend"), + origin = null; + + function drag() { + this + .on("mousedown.drag", mousedown) + .on("touchstart.drag", mousedown); + + d3.select(window) + .on("mousemove.drag", d3_behavior_dragMove) + .on("touchmove.drag", d3_behavior_dragMove) + .on("mouseup.drag", d3_behavior_dragUp, true) + .on("touchend.drag", d3_behavior_dragUp, true) + .on("click.drag", d3_behavior_dragClick, true); + } + + // snapshot the local context for subsequent dispatch + function start() { + d3_behavior_dragEvent = event; + d3_behavior_dragEventTarget = d3.event.target; + d3_behavior_dragTarget = this; + d3_behavior_dragArguments = arguments; + d3_behavior_dragOrigin = d3_behavior_dragPoint(); + if (origin) { + d3_behavior_dragOffset = origin.apply(d3_behavior_dragTarget, d3_behavior_dragArguments); + d3_behavior_dragOffset = [d3_behavior_dragOffset.x - d3_behavior_dragOrigin[0], d3_behavior_dragOffset.y - d3_behavior_dragOrigin[1]]; + } else { + d3_behavior_dragOffset = [0, 0]; + } + d3_behavior_dragMoved = 0; + } + + function mousedown() { + start.apply(this, arguments); + d3_behavior_dragDispatch("dragstart"); + } + + drag.origin = function(x) { + if (!arguments.length) return origin; + origin = x; + return drag; + }; + + return d3.rebind(drag, event, "on"); +}; + +var d3_behavior_dragEvent, + d3_behavior_dragEventTarget, + d3_behavior_dragTarget, + d3_behavior_dragArguments, + d3_behavior_dragOffset, + d3_behavior_dragOrigin, + d3_behavior_dragMoved; + +function d3_behavior_dragDispatch(type) { + var p = d3_behavior_dragPoint(), + o = d3.event, + e = d3.event = {type: type}; + + if (p) { + e.x = p[0] + d3_behavior_dragOffset[0]; + e.y = p[1] + d3_behavior_dragOffset[1]; + e.dx = p[0] - d3_behavior_dragOrigin[0]; + e.dy = p[1] - d3_behavior_dragOrigin[1]; + d3_behavior_dragMoved |= e.dx | e.dy; + d3_behavior_dragOrigin = p; + } + + try { + d3_behavior_dragEvent[type].apply(d3_behavior_dragTarget, d3_behavior_dragArguments); + } finally { + d3.event = o; + } + + o.stopPropagation(); + o.preventDefault(); +} + +function d3_behavior_dragPoint() { + var p = d3_behavior_dragTarget.parentNode, + t = d3.event.changedTouches; + return p && (t + ? d3.svg.touches(p, t)[0] + : d3.svg.mouse(p)); +} + +function d3_behavior_dragMove() { + if (!d3_behavior_dragTarget) return; + var parent = d3_behavior_dragTarget.parentNode; + + // O NOES! The drag element was removed from the DOM. + if (!parent) return d3_behavior_dragUp(); + + d3_behavior_dragDispatch("drag"); + d3_eventCancel(); +} + +function d3_behavior_dragUp() { + if (!d3_behavior_dragTarget) return; + d3_behavior_dragDispatch("dragend"); + + // If the node was moved, prevent the mouseup from propagating. + // Also prevent the subsequent click from propagating (e.g., for anchors). + if (d3_behavior_dragMoved) { + d3_eventCancel(); + d3_behavior_dragMoved = d3.event.target === d3_behavior_dragEventTarget; + } + + d3_behavior_dragEvent = + d3_behavior_dragEventTarget = + d3_behavior_dragTarget = + d3_behavior_dragArguments = + d3_behavior_dragOffset = + d3_behavior_dragOrigin = null; +} + +function d3_behavior_dragClick() { + if (d3_behavior_dragMoved) { + d3_eventCancel(); + d3_behavior_dragMoved = 0; + } +} +// TODO unbind zoom behavior? +d3.behavior.zoom = function() { + var xyz = [0, 0, 0], + event = d3.dispatch("zoom"), + extent = d3_behavior_zoomInfiniteExtent; + + function zoom() { + this + .on("mousedown.zoom", mousedown) + .on("mousewheel.zoom", mousewheel) + .on("DOMMouseScroll.zoom", mousewheel) + .on("dblclick.zoom", dblclick) + .on("touchstart.zoom", touchstart); + + d3.select(window) + .on("mousemove.zoom", d3_behavior_zoomMousemove) + .on("mouseup.zoom", d3_behavior_zoomMouseup) + .on("touchmove.zoom", d3_behavior_zoomTouchmove) + .on("touchend.zoom", d3_behavior_zoomTouchup) + .on("click.zoom", d3_behavior_zoomClick, true); + } + + // snapshot the local context for subsequent dispatch + function start() { + d3_behavior_zoomXyz = xyz; + d3_behavior_zoomExtent = extent; + d3_behavior_zoomDispatch = event.zoom; + d3_behavior_zoomEventTarget = d3.event.target; + d3_behavior_zoomTarget = this; + d3_behavior_zoomArguments = arguments; + } + + function mousedown() { + start.apply(this, arguments); + d3_behavior_zoomPanning = d3_behavior_zoomLocation(d3.svg.mouse(d3_behavior_zoomTarget)); + d3_behavior_zoomMoved = 0; + d3.event.preventDefault(); + window.focus(); + } + + // store starting mouse location + function mousewheel() { + start.apply(this, arguments); + if (!d3_behavior_zoomZooming) d3_behavior_zoomZooming = d3_behavior_zoomLocation(d3.svg.mouse(d3_behavior_zoomTarget)); + d3_behavior_zoomTo(d3_behavior_zoomDelta() + xyz[2], d3.svg.mouse(d3_behavior_zoomTarget), d3_behavior_zoomZooming); + } + + function dblclick() { + start.apply(this, arguments); + var mouse = d3.svg.mouse(d3_behavior_zoomTarget); + d3_behavior_zoomTo(d3.event.shiftKey ? Math.ceil(xyz[2] - 1) : Math.floor(xyz[2] + 1), mouse, d3_behavior_zoomLocation(mouse)); + } + + // doubletap detection + function touchstart() { + start.apply(this, arguments); + var touches = d3_behavior_zoomTouchup(), + touch, + now = Date.now(); + if ((touches.length === 1) && (now - d3_behavior_zoomLast < 300)) { + d3_behavior_zoomTo(1 + Math.floor(xyz[2]), touch = touches[0], d3_behavior_zoomLocations[touch.identifier]); + } + d3_behavior_zoomLast = now; + } + + zoom.extent = function(x) { + if (!arguments.length) return extent; + extent = x == null ? d3_behavior_zoomInfiniteExtent : x; + return zoom; + }; + + return d3.rebind(zoom, event, "on"); +}; + +var d3_behavior_zoomDiv, + d3_behavior_zoomPanning, + d3_behavior_zoomZooming, + d3_behavior_zoomLocations = {}, // identifier -> location + d3_behavior_zoomLast = 0, + d3_behavior_zoomXyz, + d3_behavior_zoomExtent, + d3_behavior_zoomDispatch, + d3_behavior_zoomEventTarget, + d3_behavior_zoomTarget, + d3_behavior_zoomArguments, + d3_behavior_zoomMoved; + +function d3_behavior_zoomLocation(point) { + return [ + point[0] - d3_behavior_zoomXyz[0], + point[1] - d3_behavior_zoomXyz[1], + d3_behavior_zoomXyz[2] + ]; +} + +// detect the pixels that would be scrolled by this wheel event +function d3_behavior_zoomDelta() { + + // mousewheel events are totally broken! + // https://bugs.webkit.org/show_bug.cgi?id=40441 + // not only that, but Chrome and Safari differ in re. to acceleration! + if (!d3_behavior_zoomDiv) { + d3_behavior_zoomDiv = d3.select("body").append("div") + .style("visibility", "hidden") + .style("top", 0) + .style("height", 0) + .style("width", 0) + .style("overflow-y", "scroll") + .append("div") + .style("height", "2000px") + .node().parentNode; + } + + var e = d3.event, delta; + try { + d3_behavior_zoomDiv.scrollTop = 1000; + d3_behavior_zoomDiv.dispatchEvent(e); + delta = 1000 - d3_behavior_zoomDiv.scrollTop; + } catch (error) { + delta = e.wheelDelta || (-e.detail * 5); + } + + return delta * .005; +} + +// Note: Since we don't rotate, it's possible for the touches to become +// slightly detached from their original positions. Thus, we recompute the +// touch points on touchend as well as touchstart! +function d3_behavior_zoomTouchup() { + var touches = d3.svg.touches(d3_behavior_zoomTarget), + i = -1, + n = touches.length, + touch; + while (++i < n) d3_behavior_zoomLocations[(touch = touches[i]).identifier] = d3_behavior_zoomLocation(touch); + return touches; +} + +function d3_behavior_zoomTouchmove() { + var touches = d3.svg.touches(d3_behavior_zoomTarget); + switch (touches.length) { + + // single-touch pan + case 1: { + var touch = touches[0]; + d3_behavior_zoomTo(d3_behavior_zoomXyz[2], touch, d3_behavior_zoomLocations[touch.identifier]); + break; + } + + // double-touch pan + zoom + case 2: { + var p0 = touches[0], + p1 = touches[1], + p2 = [(p0[0] + p1[0]) / 2, (p0[1] + p1[1]) / 2], + l0 = d3_behavior_zoomLocations[p0.identifier], + l1 = d3_behavior_zoomLocations[p1.identifier], + l2 = [(l0[0] + l1[0]) / 2, (l0[1] + l1[1]) / 2, l0[2]]; + d3_behavior_zoomTo(Math.log(d3.event.scale) / Math.LN2 + l0[2], p2, l2); + break; + } + } +} + +function d3_behavior_zoomMousemove() { + d3_behavior_zoomZooming = null; + if (d3_behavior_zoomPanning) { + d3_behavior_zoomMoved = 1; + d3_behavior_zoomTo(d3_behavior_zoomXyz[2], d3.svg.mouse(d3_behavior_zoomTarget), d3_behavior_zoomPanning); + } +} + +function d3_behavior_zoomMouseup() { + if (d3_behavior_zoomPanning) { + if (d3_behavior_zoomMoved) { + d3_eventCancel(); + d3_behavior_zoomMoved = d3_behavior_zoomEventTarget === d3.event.target; + } + + d3_behavior_zoomXyz = + d3_behavior_zoomExtent = + d3_behavior_zoomDispatch = + d3_behavior_zoomEventTarget = + d3_behavior_zoomTarget = + d3_behavior_zoomArguments = + d3_behavior_zoomPanning = null; + } +} + +function d3_behavior_zoomClick() { + if (d3_behavior_zoomMoved) { + d3_eventCancel(); + d3_behavior_zoomMoved = 0; + } +} + +function d3_behavior_zoomTo(z, x0, x1) { + z = d3_behavior_zoomExtentClamp(z, 2); + var j = Math.pow(2, d3_behavior_zoomXyz[2]), + k = Math.pow(2, z), + K = Math.pow(2, (d3_behavior_zoomXyz[2] = z) - x1[2]), + x_ = d3_behavior_zoomXyz[0], + y_ = d3_behavior_zoomXyz[1], + x = d3_behavior_zoomXyz[0] = d3_behavior_zoomExtentClamp((x0[0] - x1[0] * K), 0, k), + y = d3_behavior_zoomXyz[1] = d3_behavior_zoomExtentClamp((x0[1] - x1[1] * K), 1, k), + o = d3.event; // Events can be reentrant (e.g., focus). + + d3.event = { + scale: k, + translate: [x, y], + transform: function(sx, sy) { + if (sx) transform(sx, x_, x); + if (sy) transform(sy, y_, y); + } + }; + + function transform(scale, a, b) { + scale.domain(scale.range().map(function(v) { return scale.invert(((v - b) * j) / k + a); })); + } + + try { + d3_behavior_zoomDispatch.apply(d3_behavior_zoomTarget, d3_behavior_zoomArguments); + } finally { + d3.event = o; + } + + o.preventDefault(); +} + +var d3_behavior_zoomInfiniteExtent = [ + [-Infinity, Infinity], + [-Infinity, Infinity], + [-Infinity, Infinity] +]; + +function d3_behavior_zoomExtentClamp(x, i, k) { + var range = d3_behavior_zoomExtent[i], + r0 = range[0], + r1 = range[1]; + return arguments.length === 3 + ? Math.max(r1 * (r1 === Infinity ? -Infinity : 1 / k - 1), + Math.min(r0 === -Infinity ? Infinity : r0, x / k)) * k + : Math.max(r0, Math.min(r1, x)); +} +})(); diff --git a/ebus-datastore/ebus/web_static/lib/d3-v2.6.1/d3.time.js b/ebus-datastore/ebus/web_static/lib/d3-v2.6.1/d3.time.js new file mode 100644 index 0000000..4c1cda4 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/d3-v2.6.1/d3.time.js @@ -0,0 +1,687 @@ +(function(){d3.time = {}; + +var d3_time = Date; +d3.time.format = function(template) { + var n = template.length; + + function format(date) { + var string = [], + i = -1, + j = 0, + c, + f; + while (++i < n) { + if (template.charCodeAt(i) == 37) { + string.push( + template.substring(j, i), + (f = d3_time_formats[c = template.charAt(++i)]) + ? f(date) : c); + j = i + 1; + } + } + string.push(template.substring(j, i)); + return string.join(""); + } + + format.parse = function(string) { + var date = new d3_time(1900, 0, 1), + i = d3_time_parse(date, template, string, 0); + if (i != string.length) return null; + if (date.hour12) { + var hours = date.getHours() % 12; + date.setHours(date.hour12pm ? hours + 12 : hours); + } + delete date.hour12; + delete date.hour12pm; + return date; + }; + + format.toString = function() { + return template; + }; + + return format; +}; + +function d3_time_parse(date, template, string, j) { + var c, + p, + i = 0, + n = template.length, + m = string.length; + while (i < n) { + if (j >= m) return -1; + c = template.charCodeAt(i++); + if (c == 37) { + p = d3_time_parsers[template.charAt(i++)]; + if (!p || ((j = p(date, string, j)) < 0)) return -1; + } else if (c != string.charCodeAt(j++)) { + return -1; + } + } + return j; +} + +var d3_time_zfill2 = d3.format("02d"), + d3_time_zfill3 = d3.format("03d"), + d3_time_zfill4 = d3.format("04d"), + d3_time_sfill2 = d3.format("2d"); + +var d3_time_formats = { + a: function(d) { return d3_time_weekdays[d.getDay()].substring(0, 3); }, + A: function(d) { return d3_time_weekdays[d.getDay()]; }, + b: function(d) { return d3_time_months[d.getMonth()].substring(0, 3); }, + B: function(d) { return d3_time_months[d.getMonth()]; }, + c: d3.time.format("%a %b %e %H:%M:%S %Y"), + d: function(d) { return d3_time_zfill2(d.getDate()); }, + e: function(d) { return d3_time_sfill2(d.getDate()); }, + H: function(d) { return d3_time_zfill2(d.getHours()); }, + I: function(d) { return d3_time_zfill2(d.getHours() % 12 || 12); }, + j: d3_time_dayOfYear, + L: function(d) { return d3_time_zfill3(d.getMilliseconds()); }, + m: function(d) { return d3_time_zfill2(d.getMonth() + 1); }, + M: function(d) { return d3_time_zfill2(d.getMinutes()); }, + p: function(d) { return d.getHours() >= 12 ? "PM" : "AM"; }, + S: function(d) { return d3_time_zfill2(d.getSeconds()); }, + U: d3_time_weekNumberSunday, + w: function(d) { return d.getDay(); }, + W: d3_time_weekNumberMonday, + x: d3.time.format("%m/%d/%y"), + X: d3.time.format("%H:%M:%S"), + y: function(d) { return d3_time_zfill2(d.getFullYear() % 100); }, + Y: function(d) { return d3_time_zfill4(d.getFullYear() % 10000); }, + Z: d3_time_zone, + "%": function(d) { return "%"; } +}; + +var d3_time_parsers = { + a: d3_time_parseWeekdayAbbrev, + A: d3_time_parseWeekday, + b: d3_time_parseMonthAbbrev, + B: d3_time_parseMonth, + c: d3_time_parseLocaleFull, + d: d3_time_parseDay, + e: d3_time_parseDay, + H: d3_time_parseHour24, + I: d3_time_parseHour12, + // j: function(d, s, i) { /*TODO day of year [001,366] */ return i; }, + L: d3_time_parseMilliseconds, + m: d3_time_parseMonthNumber, + M: d3_time_parseMinutes, + p: d3_time_parseAmPm, + S: d3_time_parseSeconds, + // U: function(d, s, i) { /*TODO week number (sunday) [00,53] */ return i; }, + // w: function(d, s, i) { /*TODO weekday [0,6] */ return i; }, + // W: function(d, s, i) { /*TODO week number (monday) [00,53] */ return i; }, + x: d3_time_parseLocaleDate, + X: d3_time_parseLocaleTime, + y: d3_time_parseYear, + Y: d3_time_parseFullYear + // , + // Z: function(d, s, i) { /*TODO time zone */ return i; }, + // "%": function(d, s, i) { /*TODO literal % */ return i; } +}; + +// Note: weekday is validated, but does not set the date. +function d3_time_parseWeekdayAbbrev(date, string, i) { + return string.substring(i, i += 3).toLowerCase() in d3_time_weekdayAbbrevLookup ? i : -1; +} + +var d3_time_weekdayAbbrevLookup = { + sun: 3, + mon: 3, + tue: 3, + wed: 3, + thu: 3, + fri: 3, + sat: 3 +}; + +// Note: weekday is validated, but does not set the date. +function d3_time_parseWeekday(date, string, i) { + d3_time_weekdayRe.lastIndex = 0; + var n = d3_time_weekdayRe.exec(string.substring(i, i + 10)); + return n ? i += n[0].length : -1; +} + +var d3_time_weekdayRe = /^(?:Sunday|Monday|Tuesday|Wednesday|Thursday|Friday|Saturday)/ig; + +var d3_time_weekdays = [ + "Sunday", + "Monday", + "Tuesday", + "Wednesday", + "Thursday", + "Friday", + "Saturday" +]; + +function d3_time_parseMonthAbbrev(date, string, i) { + var n = d3_time_monthAbbrevLookup[string.substring(i, i += 3).toLowerCase()]; + return n == null ? -1 : (date.setMonth(n), i); +} + +var d3_time_monthAbbrevLookup = { + jan: 0, + feb: 1, + mar: 2, + apr: 3, + may: 4, + jun: 5, + jul: 6, + aug: 7, + sep: 8, + oct: 9, + nov: 10, + dec: 11 +}; + +function d3_time_parseMonth(date, string, i) { + d3_time_monthRe.lastIndex = 0; + var n = d3_time_monthRe.exec(string.substring(i, i + 12)); + return n ? (date.setMonth(d3_time_monthLookup[n[0].toLowerCase()]), i += n[0].length) : -1; +} + +var d3_time_monthRe = /^(?:January|February|March|April|May|June|July|August|September|October|November|December)/ig; + +var d3_time_monthLookup = { + january: 0, + february: 1, + march: 2, + april: 3, + may: 4, + june: 5, + july: 6, + august: 7, + september: 8, + october: 9, + november: 10, + december: 11 +}; + +var d3_time_months = [ + "January", + "February", + "March", + "April", + "May", + "June", + "July", + "August", + "September", + "October", + "November", + "December" +]; + +function d3_time_parseLocaleFull(date, string, i) { + return d3_time_parse(date, d3_time_formats.c.toString(), string, i); +} + +function d3_time_parseLocaleDate(date, string, i) { + return d3_time_parse(date, d3_time_formats.x.toString(), string, i); +} + +function d3_time_parseLocaleTime(date, string, i) { + return d3_time_parse(date, d3_time_formats.X.toString(), string, i); +} + +function d3_time_parseFullYear(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 4)); + return n ? (date.setFullYear(n[0]), i += n[0].length) : -1; +} + +function d3_time_parseYear(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.setFullYear(d3_time_century() + +n[0]), i += n[0].length) : -1; +} + +function d3_time_century() { + return ~~(new Date().getFullYear() / 1000) * 1000; +} + +function d3_time_parseMonthNumber(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.setMonth(n[0] - 1), i += n[0].length) : -1; +} + +function d3_time_parseDay(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.setDate(+n[0]), i += n[0].length) : -1; +} + +// Note: we don't validate that the hour is in the range [0,23]. +function d3_time_parseHour24(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.setHours(+n[0]), i += n[0].length) : -1; +} + +// Note: we don't validate that the hour is in the range [1,12]. +function d3_time_parseHour12(date, string, i) { + date.hour12 = true; + return d3_time_parseHour24(date, string, i); +} + +function d3_time_parseMinutes(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.setMinutes(+n[0]), i += n[0].length) : -1; +} + +function d3_time_parseSeconds(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.setSeconds(+n[0]), i += n[0].length) : -1; +} + +function d3_time_parseMilliseconds(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 3)); + return n ? (date.setMilliseconds(+n[0]), i += n[0].length) : -1; +} + +// Note: we don't look at the next directive. +var d3_time_numberRe = /\s*\d+/; + +function d3_time_parseAmPm(date, string, i) { + var n = d3_time_amPmLookup[string.substring(i, i += 2).toLowerCase()]; + return n == null ? -1 : (date.hour12pm = n, i); +} + +var d3_time_amPmLookup = { + am: 0, + pm: 1 +}; + +function d3_time_year(d) { + return new d3_time(d.getFullYear(), 0, 1); +} + +function d3_time_daysElapsed(d0, d1) { + return ~~((d1 - d0) / 864e5 - (d1.getTimezoneOffset() - d0.getTimezoneOffset()) / 1440); +} + +function d3_time_dayOfYear(d) { + return d3_time_zfill3(1 + d3_time_daysElapsed(d3_time_year(d), d)); +} + +function d3_time_weekNumberSunday(d) { + var d0 = d3_time_year(d); + return d3_time_zfill2(~~((d3_time_daysElapsed(d0, d) + d0.getDay()) / 7)); +} + +function d3_time_weekNumberMonday(d) { + var d0 = d3_time_year(d); + return d3_time_zfill2(~~((d3_time_daysElapsed(d0, d) + (d0.getDay() + 6) % 7) / 7)); +} + +// TODO table of time zone offset names? +function d3_time_zone(d) { + var z = d.getTimezoneOffset(), + zs = z > 0 ? "-" : "+", + zh = ~~(Math.abs(z) / 60), + zm = Math.abs(z) % 60; + return zs + d3_time_zfill2(zh) + d3_time_zfill2(zm); +} +d3.time.format.utc = function(template) { + var local = d3.time.format(template); + + function format(date) { + try { + d3_time = d3_time_format_utc; + var utc = new d3_time(); + utc._ = date; + return local(utc); + } finally { + d3_time = Date; + } + } + + format.parse = function(string) { + try { + d3_time = d3_time_format_utc; + var date = local.parse(string); + return date && date._; + } finally { + d3_time = Date; + } + }; + + format.toString = local.toString; + + return format; +}; + +function d3_time_format_utc() { + this._ = new Date(Date.UTC.apply(this, arguments)); +} + +d3_time_format_utc.prototype = { + getDate: function() { return this._.getUTCDate(); }, + getDay: function() { return this._.getUTCDay(); }, + getFullYear: function() { return this._.getUTCFullYear(); }, + getHours: function() { return this._.getUTCHours(); }, + getMilliseconds: function() { return this._.getUTCMilliseconds(); }, + getMinutes: function() { return this._.getUTCMinutes(); }, + getMonth: function() { return this._.getUTCMonth(); }, + getSeconds: function() { return this._.getUTCSeconds(); }, + getTimezoneOffset: function() { return 0; }, + valueOf: function() { return this._.getTime(); }, + setDate: function(x) { this._.setUTCDate(x); }, + setDay: function(x) { this._.setUTCDay(x); }, + setFullYear: function(x) { this._.setUTCFullYear(x); }, + setHours: function(x) { this._.setUTCHours(x); }, + setMilliseconds: function(x) { this._.setUTCMilliseconds(x); }, + setMinutes: function(x) { this._.setUTCMinutes(x); }, + setMonth: function(x) { this._.setUTCMonth(x); }, + setSeconds: function(x) { this._.setUTCSeconds(x); } +}; +var d3_time_formatIso = d3.time.format.utc("%Y-%m-%dT%H:%M:%S.%LZ"); + +d3.time.format.iso = Date.prototype.toISOString ? d3_time_formatIsoNative : d3_time_formatIso; + +function d3_time_formatIsoNative(date) { + return date.toISOString(); +} + +d3_time_formatIsoNative.parse = function(string) { + return new Date(string); +}; + +d3_time_formatIsoNative.toString = d3_time_formatIso.toString; +function d3_time_range(floor, step, number) { + return function(t0, t1, dt) { + var time = floor(t0), times = []; + if (time < t0) step(time); + if (dt > 1) { + while (time < t1) { + var date = new Date(+time); + if (!(number(date) % dt)) times.push(date); + step(time); + } + } else { + while (time < t1) times.push(new Date(+time)), step(time); + } + return times; + }; +} +d3.time.second = function(date) { + return new Date(~~(date / 1e3) * 1e3); +}; + +d3.time.second.utc = d3.time.second; +d3.time.seconds = d3_time_range(d3.time.second, function(date) { + date.setTime(date.getTime() + 1e3); +}, function(date) { + return date.getSeconds(); +}); + +d3.time.seconds.utc = d3.time.seconds; +d3.time.minute = function(date) { + return new Date(~~(date / 6e4) * 6e4); +}; + +d3.time.minute.utc = d3.time.minute;d3.time.minutes = d3_time_range(d3.time.minute, d3_time_minutesStep, function(date) { + return date.getMinutes(); +}); + +d3.time.minutes.utc = d3_time_range(d3.time.minute, d3_time_minutesStep, function(date) { + return date.getUTCMinutes(); +}); + +function d3_time_minutesStep(date) { + date.setTime(date.getTime() + 6e4); // assumes no leap seconds +} +d3.time.hour = function(date) { + var offset = date.getTimezoneOffset() / 60; + return new Date((~~(date / 36e5 - offset) + offset) * 36e5); +}; + +d3.time.hour.utc = function(date) { + return new Date(~~(date / 36e5) * 36e5); +}; +d3.time.hours = d3_time_range(d3.time.hour, d3_time_hoursStep, function(date) { + return date.getHours(); +}); + +d3.time.hours.utc = d3_time_range(d3.time.hour.utc, d3_time_hoursStep, function(date) { + return date.getUTCHours(); +}); + +function d3_time_hoursStep(date) { + date.setTime(date.getTime() + 36e5); +} +d3.time.day = function(date) { + return new Date(date.getFullYear(), date.getMonth(), date.getDate()); +}; + +d3.time.day.utc = function(date) { + return new Date(~~(date / 864e5) * 864e5); +}; +d3.time.days = d3_time_range(d3.time.day, function(date) { + date.setDate(date.getDate() + 1); +}, function(date) { + return date.getDate() - 1; +}); + +d3.time.days.utc = d3_time_range(d3.time.day.utc, function(date) { + date.setUTCDate(date.getUTCDate() + 1); +}, function(date) { + return date.getUTCDate() - 1; +}); +d3.time.week = function(date) { + (date = d3.time.day(date)).setDate(date.getDate() - date.getDay()); + return date; +}; + +d3.time.week.utc = function(date) { + (date = d3.time.day.utc(date)).setUTCDate(date.getUTCDate() - date.getUTCDay()); + return date; +}; +d3.time.weeks = d3_time_range(d3.time.week, function(date) { + date.setDate(date.getDate() + 7); +}, function(date) { + return ~~((date - new Date(date.getFullYear(), 0, 1)) / 6048e5); +}); + +d3.time.weeks.utc = d3_time_range(d3.time.week.utc, function(date) { + date.setUTCDate(date.getUTCDate() + 7); +}, function(date) { + return ~~((date - Date.UTC(date.getUTCFullYear(), 0, 1)) / 6048e5); +}); +d3.time.month = function(date) { + return new Date(date.getFullYear(), date.getMonth(), 1); +}; + +d3.time.month.utc = function(date) { + return new Date(Date.UTC(date.getUTCFullYear(), date.getUTCMonth(), 1)); +}; +d3.time.months = d3_time_range(d3.time.month, function(date) { + date.setMonth(date.getMonth() + 1); +}, function(date) { + return date.getMonth(); +}); + +d3.time.months.utc = d3_time_range(d3.time.month.utc, function(date) { + date.setUTCMonth(date.getUTCMonth() + 1); +}, function(date) { + return date.getUTCMonth(); +}); +d3.time.year = function(date) { + return new Date(date.getFullYear(), 0, 1); +}; + +d3.time.year.utc = function(date) { + return new Date(Date.UTC(date.getUTCFullYear(), 0, 1)); +}; +d3.time.years = d3_time_range(d3.time.year, function(date) { + date.setFullYear(date.getFullYear() + 1); +}, function(date) { + return date.getFullYear(); +}); + +d3.time.years.utc = d3_time_range(d3.time.year.utc, function(date) { + date.setUTCFullYear(date.getUTCFullYear() + 1); +}, function(date) { + return date.getUTCFullYear(); +}); +// TODO nice +function d3_time_scale(linear, methods, format) { + + function scale(x) { + return linear(x); + } + + scale.invert = function(x) { + return d3_time_scaleDate(linear.invert(x)); + }; + + scale.domain = function(x) { + if (!arguments.length) return linear.domain().map(d3_time_scaleDate); + linear.domain(x); + return scale; + }; + + scale.ticks = function(m, k) { + var extent = d3_time_scaleExtent(scale.domain()); + if (typeof m !== "function") { + var span = extent[1] - extent[0], + target = span / m, + i = d3.bisect(d3_time_scaleSteps, target, 1, d3_time_scaleSteps.length - 1); + if (Math.log(target / d3_time_scaleSteps[i - 1]) < Math.log(d3_time_scaleSteps[i] / target)) --i; + m = methods[i]; + k = m[1]; + m = m[0]; + } + return m(extent[0], extent[1], k); + }; + + scale.tickFormat = function() { + return format; + }; + + scale.copy = function() { + return d3_time_scale(linear.copy(), methods, format); + }; + + // TOOD expose d3_scale_linear_rebind? + return d3.rebind(scale, linear, "range", "rangeRound", "interpolate", "clamp"); +} + +// TODO expose d3_scaleExtent? +function d3_time_scaleExtent(domain) { + var start = domain[0], stop = domain[domain.length - 1]; + return start < stop ? [start, stop] : [stop, start]; +} + +function d3_time_scaleDate(t) { + return new Date(t); +} + +function d3_time_scaleFormat(formats) { + return function(date) { + var i = formats.length - 1, f = formats[i]; + while (!f[1](date)) f = formats[--i]; + return f[0](date); + }; +} + +var d3_time_scaleSteps = [ + 1e3, // 1-second + 5e3, // 5-second + 15e3, // 15-second + 3e4, // 30-second + 6e4, // 1-minute + 3e5, // 5-minute + 9e5, // 15-minute + 18e5, // 30-minute + 36e5, // 1-hour + 108e5, // 3-hour + 216e5, // 6-hour + 432e5, // 12-hour + 864e5, // 1-day + 1728e5, // 2-day + 6048e5, // 1-week + 1728e6, // 1-month + 7776e6, // 3-month + 31536e6 // 1-year +]; + +var d3_time_scaleLocalMethods = [ + [d3.time.seconds, 1], + [d3.time.seconds, 5], + [d3.time.seconds, 15], + [d3.time.seconds, 30], + [d3.time.minutes, 1], + [d3.time.minutes, 5], + [d3.time.minutes, 15], + [d3.time.minutes, 30], + [d3.time.hours, 1], + [d3.time.hours, 3], + [d3.time.hours, 6], + [d3.time.hours, 12], + [d3.time.days, 1], + [d3.time.days, 2], + [d3.time.weeks, 1], + [d3.time.months, 1], + [d3.time.months, 3], + [d3.time.years, 1] +]; + +var d3_time_scaleLocalFormats = [ + [d3.time.format("%Y"), function(d) { return true; }], + [d3.time.format("%B"), function(d) { return d.getMonth(); }], + [d3.time.format("%b %d"), function(d) { return d.getDate() != 1; }], + [d3.time.format("%a %d"), function(d) { return d.getDay() && d.getDate() != 1; }], + [d3.time.format("%I %p"), function(d) { return d.getHours(); }], + [d3.time.format("%I:%M"), function(d) { return d.getMinutes(); }], + [d3.time.format(":%S"), function(d) { return d.getSeconds() || d.getMilliseconds(); }] +]; + +var d3_time_scaleLocalFormat = d3_time_scaleFormat(d3_time_scaleLocalFormats); + +d3.time.scale = function() { + return d3_time_scale(d3.scale.linear(), d3_time_scaleLocalMethods, d3_time_scaleLocalFormat); +}; +var d3_time_scaleUTCMethods = [ + [d3.time.seconds.utc, 1], + [d3.time.seconds.utc, 5], + [d3.time.seconds.utc, 15], + [d3.time.seconds.utc, 30], + [d3.time.minutes.utc, 1], + [d3.time.minutes.utc, 5], + [d3.time.minutes.utc, 15], + [d3.time.minutes.utc, 30], + [d3.time.hours.utc, 1], + [d3.time.hours.utc, 3], + [d3.time.hours.utc, 6], + [d3.time.hours.utc, 12], + [d3.time.days.utc, 1], + [d3.time.days.utc, 2], + [d3.time.weeks.utc, 1], + [d3.time.months.utc, 1], + [d3.time.months.utc, 3], + [d3.time.years.utc, 1] +]; + +var d3_time_scaleUTCFormats = [ + [d3.time.format.utc("%Y"), function(d) { return true; }], + [d3.time.format.utc("%B"), function(d) { return d.getUTCMonth(); }], + [d3.time.format.utc("%b %d"), function(d) { return d.getUTCDate() != 1; }], + [d3.time.format.utc("%a %d"), function(d) { return d.getUTCDay() && d.getUTCDate() != 1; }], + [d3.time.format.utc("%I %p"), function(d) { return d.getUTCHours(); }], + [d3.time.format.utc("%I:%M"), function(d) { return d.getUTCMinutes(); }], + [d3.time.format.utc(":%S"), function(d) { return d.getUTCSeconds() || d.getUTCMilliseconds(); }] +]; + +var d3_time_scaleUTCFormat = d3_time_scaleFormat(d3_time_scaleUTCFormats); + +d3.time.scale.utc = function() { + return d3_time_scale(d3.scale.linear(), d3_time_scaleUTCMethods, d3_time_scaleUTCFormat); +}; +})(); diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/API.txt b/ebus-datastore/ebus/web_static/lib/flot-0.7/API.txt new file mode 100644 index 0000000..8a8dbc2 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/API.txt @@ -0,0 +1,1201 @@ +Flot Reference +-------------- + +Consider a call to the plot function: + + var plot = $.plot(placeholder, data, options) + +The placeholder is a jQuery object or DOM element or jQuery expression +that the plot will be put into. This placeholder needs to have its +width and height set as explained in the README (go read that now if +you haven't, it's short). The plot will modify some properties of the +placeholder so it's recommended you simply pass in a div that you +don't use for anything else. Make sure you check any fancy styling +you apply to the div, e.g. background images have been reported to be a +problem on IE 7. + +The format of the data is documented below, as is the available +options. The plot object returned from the call has some methods you +can call. These are documented separately below. + +Note that in general Flot gives no guarantees if you change any of the +objects you pass in to the plot function or get out of it since +they're not necessarily deep-copied. + + +Data Format +----------- + +The data is an array of data series: + + [ series1, series2, ... ] + +A series can either be raw data or an object with properties. The raw +data format is an array of points: + + [ [x1, y1], [x2, y2], ... ] + +E.g. + + [ [1, 3], [2, 14.01], [3.5, 3.14] ] + +Note that to simplify the internal logic in Flot both the x and y +values must be numbers (even if specifying time series, see below for +how to do this). This is a common problem because you might retrieve +data from the database and serialize them directly to JSON without +noticing the wrong type. If you're getting mysterious errors, double +check that you're inputting numbers and not strings. + +If a null is specified as a point or if one of the coordinates is null +or couldn't be converted to a number, the point is ignored when +drawing. As a special case, a null value for lines is interpreted as a +line segment end, i.e. the points before and after the null value are +not connected. + +Lines and points take two coordinates. For filled lines and bars, you +can specify a third coordinate which is the bottom of the filled +area/bar (defaults to 0). + +The format of a single series object is as follows: + + { + color: color or number + data: rawdata + label: string + lines: specific lines options + bars: specific bars options + points: specific points options + xaxis: number + yaxis: number + clickable: boolean + hoverable: boolean + shadowSize: number + } + +You don't have to specify any of them except the data, the rest are +options that will get default values. Typically you'd only specify +label and data, like this: + + { + label: "y = 3", + data: [[0, 3], [10, 3]] + } + +The label is used for the legend, if you don't specify one, the series +will not show up in the legend. + +If you don't specify color, the series will get a color from the +auto-generated colors. The color is either a CSS color specification +(like "rgb(255, 100, 123)") or an integer that specifies which of +auto-generated colors to select, e.g. 0 will get color no. 0, etc. + +The latter is mostly useful if you let the user add and remove series, +in which case you can hard-code the color index to prevent the colors +from jumping around between the series. + +The "xaxis" and "yaxis" options specify which axis to use. The axes +are numbered from 1 (default), so { yaxis: 2} means that the series +should be plotted against the second y axis. + +"clickable" and "hoverable" can be set to false to disable +interactivity for specific series if interactivity is turned on in +the plot, see below. + +The rest of the options are all documented below as they are the same +as the default options passed in via the options parameter in the plot +commmand. When you specify them for a specific data series, they will +override the default options for the plot for that data series. + +Here's a complete example of a simple data specification: + + [ { label: "Foo", data: [ [10, 1], [17, -14], [30, 5] ] }, + { label: "Bar", data: [ [11, 13], [19, 11], [30, -7] ] } ] + + +Plot Options +------------ + +All options are completely optional. They are documented individually +below, to change them you just specify them in an object, e.g. + + var options = { + series: { + lines: { show: true }, + points: { show: true } + } + }; + + $.plot(placeholder, data, options); + + +Customizing the legend +====================== + + legend: { + show: boolean + labelFormatter: null or (fn: string, series object -> string) + labelBoxBorderColor: color + noColumns: number + position: "ne" or "nw" or "se" or "sw" + margin: number of pixels or [x margin, y margin] + backgroundColor: null or color + backgroundOpacity: number between 0 and 1 + container: null or jQuery object/DOM element/jQuery expression + } + +The legend is generated as a table with the data series labels and +small label boxes with the color of the series. If you want to format +the labels in some way, e.g. make them to links, you can pass in a +function for "labelFormatter". Here's an example that makes them +clickable: + + labelFormatter: function(label, series) { + // series is the series object for the label + return '<a href="#' + label + '">' + label + '</a>'; + } + +"noColumns" is the number of columns to divide the legend table into. +"position" specifies the overall placement of the legend within the +plot (top-right, top-left, etc.) and margin the distance to the plot +edge (this can be either a number or an array of two numbers like [x, +y]). "backgroundColor" and "backgroundOpacity" specifies the +background. The default is a partly transparent auto-detected +background. + +If you want the legend to appear somewhere else in the DOM, you can +specify "container" as a jQuery object/expression to put the legend +table into. The "position" and "margin" etc. options will then be +ignored. Note that Flot will overwrite the contents of the container. + + +Customizing the axes +==================== + + xaxis, yaxis: { + show: null or true/false + position: "bottom" or "top" or "left" or "right" + mode: null or "time" + + color: null or color spec + tickColor: null or color spec + + min: null or number + max: null or number + autoscaleMargin: null or number + + transform: null or fn: number -> number + inverseTransform: null or fn: number -> number + + ticks: null or number or ticks array or (fn: range -> ticks array) + tickSize: number or array + minTickSize: number or array + tickFormatter: (fn: number, object -> string) or string + tickDecimals: null or number + + labelWidth: null or number + labelHeight: null or number + reserveSpace: null or true + + tickLength: null or number + + alignTicksWithAxis: null or number + } + +All axes have the same kind of options. The following describes how to +configure one axis, see below for what to do if you've got more than +one x axis or y axis. + +If you don't set the "show" option (i.e. it is null), visibility is +auto-detected, i.e. the axis will show up if there's data associated +with it. You can override this by setting the "show" option to true or +false. + +The "position" option specifies where the axis is placed, bottom or +top for x axes, left or right for y axes. The "mode" option determines +how the data is interpreted, the default of null means as decimal +numbers. Use "time" for time series data, see the time series data +section. + +The "color" option determines the color of the labels and ticks for +the axis (default is the grid color). For more fine-grained control +you can also set the color of the ticks separately with "tickColor" +(otherwise it's autogenerated as the base color with some +transparency). + +The options "min"/"max" are the precise minimum/maximum value on the +scale. If you don't specify either of them, a value will automatically +be chosen based on the minimum/maximum data values. Note that Flot +always examines all the data values you feed to it, even if a +restriction on another axis may make some of them invisible (this +makes interactive use more stable). + +The "autoscaleMargin" is a bit esoteric: it's the fraction of margin +that the scaling algorithm will add to avoid that the outermost points +ends up on the grid border. Note that this margin is only applied when +a min or max value is not explicitly set. If a margin is specified, +the plot will furthermore extend the axis end-point to the nearest +whole tick. The default value is "null" for the x axes and 0.02 for y +axes which seems appropriate for most cases. + +"transform" and "inverseTransform" are callbacks you can put in to +change the way the data is drawn. You can design a function to +compress or expand certain parts of the axis non-linearly, e.g. +suppress weekends or compress far away points with a logarithm or some +other means. When Flot draws the plot, each value is first put through +the transform function. Here's an example, the x axis can be turned +into a natural logarithm axis with the following code: + + xaxis: { + transform: function (v) { return Math.log(v); }, + inverseTransform: function (v) { return Math.exp(v); } + } + +Similarly, for reversing the y axis so the values appear in inverse +order: + + yaxis: { + transform: function (v) { return -v; }, + inverseTransform: function (v) { return -v; } + } + +Note that for finding extrema, Flot assumes that the transform +function does not reorder values (it should be monotone). + +The inverseTransform is simply the inverse of the transform function +(so v == inverseTransform(transform(v)) for all relevant v). It is +required for converting from canvas coordinates to data coordinates, +e.g. for a mouse interaction where a certain pixel is clicked. If you +don't use any interactive features of Flot, you may not need it. + + +The rest of the options deal with the ticks. + +If you don't specify any ticks, a tick generator algorithm will make +some for you. The algorithm has two passes. It first estimates how +many ticks would be reasonable and uses this number to compute a nice +round tick interval size. Then it generates the ticks. + +You can specify how many ticks the algorithm aims for by setting +"ticks" to a number. The algorithm always tries to generate reasonably +round tick values so even if you ask for three ticks, you might get +five if that fits better with the rounding. If you don't want any +ticks at all, set "ticks" to 0 or an empty array. + +Another option is to skip the rounding part and directly set the tick +interval size with "tickSize". If you set it to 2, you'll get ticks at +2, 4, 6, etc. Alternatively, you can specify that you just don't want +ticks at a size less than a specific tick size with "minTickSize". +Note that for time series, the format is an array like [2, "month"], +see the next section. + +If you want to completely override the tick algorithm, you can specify +an array for "ticks", either like this: + + ticks: [0, 1.2, 2.4] + +Or like this where the labels are also customized: + + ticks: [[0, "zero"], [1.2, "one mark"], [2.4, "two marks"]] + +You can mix the two if you like. + +For extra flexibility you can specify a function as the "ticks" +parameter. The function will be called with an object with the axis +min and max and should return a ticks array. Here's a simplistic tick +generator that spits out intervals of pi, suitable for use on the x +axis for trigonometric functions: + + function piTickGenerator(axis) { + var res = [], i = Math.floor(axis.min / Math.PI); + do { + var v = i * Math.PI; + res.push([v, i + "\u03c0"]); + ++i; + } while (v < axis.max); + + return res; + } + +You can control how the ticks look like with "tickDecimals", the +number of decimals to display (default is auto-detected). + +Alternatively, for ultimate control over how ticks are formatted you can +provide a function to "tickFormatter". The function is passed two +parameters, the tick value and an axis object with information, and +should return a string. The default formatter looks like this: + + function formatter(val, axis) { + return val.toFixed(axis.tickDecimals); + } + +The axis object has "min" and "max" with the range of the axis, +"tickDecimals" with the number of decimals to round the value to and +"tickSize" with the size of the interval between ticks as calculated +by the automatic axis scaling algorithm (or specified by you). Here's +an example of a custom formatter: + + function suffixFormatter(val, axis) { + if (val > 1000000) + return (val / 1000000).toFixed(axis.tickDecimals) + " MB"; + else if (val > 1000) + return (val / 1000).toFixed(axis.tickDecimals) + " kB"; + else + return val.toFixed(axis.tickDecimals) + " B"; + } + +"labelWidth" and "labelHeight" specifies a fixed size of the tick +labels in pixels. They're useful in case you need to align several +plots. "reserveSpace" means that even if an axis isn't shown, Flot +should reserve space for it - it is useful in combination with +labelWidth and labelHeight for aligning multi-axis charts. + +"tickLength" is the length of the tick lines in pixels. By default, the +innermost axes will have ticks that extend all across the plot, while +any extra axes use small ticks. A value of null means use the default, +while a number means small ticks of that length - set it to 0 to hide +the lines completely. + +If you set "alignTicksWithAxis" to the number of another axis, e.g. +alignTicksWithAxis: 1, Flot will ensure that the autogenerated ticks +of this axis are aligned with the ticks of the other axis. This may +improve the looks, e.g. if you have one y axis to the left and one to +the right, because the grid lines will then match the ticks in both +ends. The trade-off is that the forced ticks won't necessarily be at +natural places. + + +Multiple axes +============= + +If you need more than one x axis or y axis, you need to specify for +each data series which axis they are to use, as described under the +format of the data series, e.g. { data: [...], yaxis: 2 } specifies +that a series should be plotted against the second y axis. + +To actually configure that axis, you can't use the xaxis/yaxis options +directly - instead there are two arrays in the options: + + xaxes: [] + yaxes: [] + +Here's an example of configuring a single x axis and two y axes (we +can leave options of the first y axis empty as the defaults are fine): + + { + xaxes: [ { position: "top" } ], + yaxes: [ { }, { position: "right", min: 20 } ] + } + +The arrays get their default values from the xaxis/yaxis settings, so +say you want to have all y axes start at zero, you can simply specify +yaxis: { min: 0 } instead of adding a min parameter to all the axes. + +Generally, the various interfaces in Flot dealing with data points +either accept an xaxis/yaxis parameter to specify which axis number to +use (starting from 1), or lets you specify the coordinate directly as +x2/x3/... or x2axis/x3axis/... instead of "x" or "xaxis". + + +Time series data +================ + +Time series are a bit more difficult than scalar data because +calendars don't follow a simple base 10 system. For many cases, Flot +abstracts most of this away, but it can still be a bit difficult to +get the data into Flot. So we'll first discuss the data format. + +The time series support in Flot is based on Javascript timestamps, +i.e. everywhere a time value is expected or handed over, a Javascript +timestamp number is used. This is a number, not a Date object. A +Javascript timestamp is the number of milliseconds since January 1, +1970 00:00:00 UTC. This is almost the same as Unix timestamps, except it's +in milliseconds, so remember to multiply by 1000! + +You can see a timestamp like this + + alert((new Date()).getTime()) + +Normally you want the timestamps to be displayed according to a +certain time zone, usually the time zone in which the data has been +produced. However, Flot always displays timestamps according to UTC. +It has to as the only alternative with core Javascript is to interpret +the timestamps according to the time zone that the visitor is in, +which means that the ticks will shift unpredictably with the time zone +and daylight savings of each visitor. + +So given that there's no good support for custom time zones in +Javascript, you'll have to take care of this server-side. + +The easiest way to think about it is to pretend that the data +production time zone is UTC, even if it isn't. So if you have a +datapoint at 2002-02-20 08:00, you can generate a timestamp for eight +o'clock UTC even if it really happened eight o'clock UTC+0200. + +In PHP you can get an appropriate timestamp with +'strtotime("2002-02-20 UTC") * 1000', in Python with +'calendar.timegm(datetime_object.timetuple()) * 1000', in .NET with +something like: + + public static int GetJavascriptTimestamp(System.DateTime input) + { + System.TimeSpan span = new System.TimeSpan(System.DateTime.Parse("1/1/1970").Ticks); + System.DateTime time = input.Subtract(span); + return (long)(time.Ticks / 10000); + } + +Javascript also has some support for parsing date strings, so it is +possible to generate the timestamps manually client-side. + +If you've already got the real UTC timestamp, it's too late to use the +pretend trick described above. But you can fix up the timestamps by +adding the time zone offset, e.g. for UTC+0200 you would add 2 hours +to the UTC timestamp you got. Then it'll look right on the plot. Most +programming environments have some means of getting the timezone +offset for a specific date (note that you need to get the offset for +each individual timestamp to account for daylight savings). + +Once you've gotten the timestamps into the data and specified "time" +as the axis mode, Flot will automatically generate relevant ticks and +format them. As always, you can tweak the ticks via the "ticks" option +- just remember that the values should be timestamps (numbers), not +Date objects. + +Tick generation and formatting can also be controlled separately +through the following axis options: + + minTickSize: array + timeformat: null or format string + monthNames: null or array of size 12 of strings + twelveHourClock: boolean + +Here "timeformat" is a format string to use. You might use it like +this: + + xaxis: { + mode: "time" + timeformat: "%y/%m/%d" + } + +This will result in tick labels like "2000/12/24". The following +specifiers are supported + + %h: hours + %H: hours (left-padded with a zero) + %M: minutes (left-padded with a zero) + %S: seconds (left-padded with a zero) + %d: day of month (1-31), use %0d for zero-padding + %m: month (1-12), use %0m for zero-padding + %y: year (four digits) + %b: month name (customizable) + %p: am/pm, additionally switches %h/%H to 12 hour instead of 24 + %P: AM/PM (uppercase version of %p) + +Inserting a zero like %0m or %0d means that the specifier will be +left-padded with a zero if it's only single-digit. So %y-%0m-%0d +results in unambigious ISO timestamps like 2007-05-10 (for May 10th). + +You can customize the month names with the "monthNames" option. For +instance, for Danish you might specify: + + monthNames: ["jan", "feb", "mar", "apr", "maj", "jun", "jul", "aug", "sep", "okt", "nov", "dec"] + +If you set "twelveHourClock" to true, the autogenerated timestamps +will use 12 hour AM/PM timestamps instead of 24 hour. + +The format string and month names are used by a very simple built-in +format function that takes a date object, a format string (and +optionally an array of month names) and returns the formatted string. +If needed, you can access it as $.plot.formatDate(date, formatstring, +monthNames) or even replace it with another more advanced function +from a date library if you're feeling adventurous. + +If everything else fails, you can control the formatting by specifying +a custom tick formatter function as usual. Here's a simple example +which will format December 24 as 24/12: + + tickFormatter: function (val, axis) { + var d = new Date(val); + return d.getUTCDate() + "/" + (d.getUTCMonth() + 1); + } + +Note that for the time mode "tickSize" and "minTickSize" are a bit +special in that they are arrays on the form "[value, unit]" where unit +is one of "second", "minute", "hour", "day", "month" and "year". So +you can specify + + minTickSize: [1, "month"] + +to get a tick interval size of at least 1 month and correspondingly, +if axis.tickSize is [2, "day"] in the tick formatter, the ticks have +been produced with two days in-between. + + + +Customizing the data series +=========================== + + series: { + lines, points, bars: { + show: boolean + lineWidth: number + fill: boolean or number + fillColor: null or color/gradient + } + + points: { + radius: number + symbol: "circle" or function + } + + bars: { + barWidth: number + align: "left" or "center" + horizontal: boolean + } + + lines: { + steps: boolean + } + + shadowSize: number + } + + colors: [ color1, color2, ... ] + +The options inside "series: {}" are copied to each of the series. So +you can specify that all series should have bars by putting it in the +global options, or override it for individual series by specifying +bars in a particular the series object in the array of data. + +The most important options are "lines", "points" and "bars" that +specify whether and how lines, points and bars should be shown for +each data series. In case you don't specify anything at all, Flot will +default to showing lines (you can turn this off with +lines: { show: false }). You can specify the various types +independently of each other, and Flot will happily draw each of them +in turn (this is probably only useful for lines and points), e.g. + + var options = { + series: { + lines: { show: true, fill: true, fillColor: "rgba(255, 255, 255, 0.8)" }, + points: { show: true, fill: false } + } + }; + +"lineWidth" is the thickness of the line or outline in pixels. You can +set it to 0 to prevent a line or outline from being drawn; this will +also hide the shadow. + +"fill" is whether the shape should be filled. For lines, this produces +area graphs. You can use "fillColor" to specify the color of the fill. +If "fillColor" evaluates to false (default for everything except +points which are filled with white), the fill color is auto-set to the +color of the data series. You can adjust the opacity of the fill by +setting fill to a number between 0 (fully transparent) and 1 (fully +opaque). + +For bars, fillColor can be a gradient, see the gradient documentation +below. "barWidth" is the width of the bars in units of the x axis (or +the y axis if "horizontal" is true), contrary to most other measures +that are specified in pixels. For instance, for time series the unit +is milliseconds so 24 * 60 * 60 * 1000 produces bars with the width of +a day. "align" specifies whether a bar should be left-aligned +(default) or centered on top of the value it represents. When +"horizontal" is on, the bars are drawn horizontally, i.e. from the y +axis instead of the x axis; note that the bar end points are still +defined in the same way so you'll probably want to swap the +coordinates if you've been plotting vertical bars first. + +For lines, "steps" specifies whether two adjacent data points are +connected with a straight (possibly diagonal) line or with first a +horizontal and then a vertical line. Note that this transforms the +data by adding extra points. + +For points, you can specify the radius and the symbol. The only +built-in symbol type is circles, for other types you can use a plugin +or define them yourself by specifying a callback: + + function cross(ctx, x, y, radius, shadow) { + var size = radius * Math.sqrt(Math.PI) / 2; + ctx.moveTo(x - size, y - size); + ctx.lineTo(x + size, y + size); + ctx.moveTo(x - size, y + size); + ctx.lineTo(x + size, y - size); + } + +The parameters are the drawing context, x and y coordinates of the +center of the point, a radius which corresponds to what the circle +would have used and whether the call is to draw a shadow (due to +limited canvas support, shadows are currently faked through extra +draws). It's good practice to ensure that the area covered by the +symbol is the same as for the circle with the given radius, this +ensures that all symbols have approximately the same visual weight. + +"shadowSize" is the default size of shadows in pixels. Set it to 0 to +remove shadows. + +The "colors" array specifies a default color theme to get colors for +the data series from. You can specify as many colors as you like, like +this: + + colors: ["#d18b2c", "#dba255", "#919733"] + +If there are more data series than colors, Flot will try to generate +extra colors by lightening and darkening colors in the theme. + + +Customizing the grid +==================== + + grid: { + show: boolean + aboveData: boolean + color: color + backgroundColor: color/gradient or null + labelMargin: number + axisMargin: number + markings: array of markings or (fn: axes -> array of markings) + borderWidth: number + borderColor: color or null + minBorderMargin: number or null + clickable: boolean + hoverable: boolean + autoHighlight: boolean + mouseActiveRadius: number + } + +The grid is the thing with the axes and a number of ticks. Many of the +things in the grid are configured under the individual axes, but not +all. "color" is the color of the grid itself whereas "backgroundColor" +specifies the background color inside the grid area, here null means +that the background is transparent. You can also set a gradient, see +the gradient documentation below. + +You can turn off the whole grid including tick labels by setting +"show" to false. "aboveData" determines whether the grid is drawn +above the data or below (below is default). + +"labelMargin" is the space in pixels between tick labels and axis +line, and "axisMargin" is the space in pixels between axes when there +are two next to each other. Note that you can style the tick labels +with CSS, e.g. to change the color. They have class "tickLabel". + +"borderWidth" is the width of the border around the plot. Set it to 0 +to disable the border. You can also set "borderColor" if you want the +border to have a different color than the grid lines. +"minBorderMargin" controls the default minimum margin around the +border - it's used to make sure that points aren't accidentally +clipped by the canvas edge so by default the value is computed from +the point radius. + +"markings" is used to draw simple lines and rectangular areas in the +background of the plot. You can either specify an array of ranges on +the form { xaxis: { from, to }, yaxis: { from, to } } (with multiple +axes, you can specify coordinates for other axes instead, e.g. as +x2axis/x3axis/...) or with a function that returns such an array given +the axes for the plot in an object as the first parameter. + +You can set the color of markings by specifying "color" in the ranges +object. Here's an example array: + + markings: [ { xaxis: { from: 0, to: 2 }, yaxis: { from: 10, to: 10 }, color: "#bb0000" }, ... ] + +If you leave out one of the values, that value is assumed to go to the +border of the plot. So for example if you only specify { xaxis: { +from: 0, to: 2 } } it means an area that extends from the top to the +bottom of the plot in the x range 0-2. + +A line is drawn if from and to are the same, e.g. + + markings: [ { yaxis: { from: 1, to: 1 } }, ... ] + +would draw a line parallel to the x axis at y = 1. You can control the +line width with "lineWidth" in the range object. + +An example function that makes vertical stripes might look like this: + + markings: function (axes) { + var markings = []; + for (var x = Math.floor(axes.xaxis.min); x < axes.xaxis.max; x += 2) + markings.push({ xaxis: { from: x, to: x + 1 } }); + return markings; + } + + +If you set "clickable" to true, the plot will listen for click events +on the plot area and fire a "plotclick" event on the placeholder with +a position and a nearby data item object as parameters. The coordinates +are available both in the unit of the axes (not in pixels) and in +global screen coordinates. + +Likewise, if you set "hoverable" to true, the plot will listen for +mouse move events on the plot area and fire a "plothover" event with +the same parameters as the "plotclick" event. If "autoHighlight" is +true (the default), nearby data items are highlighted automatically. +If needed, you can disable highlighting and control it yourself with +the highlight/unhighlight plot methods described elsewhere. + +You can use "plotclick" and "plothover" events like this: + + $.plot($("#placeholder"), [ d ], { grid: { clickable: true } }); + + $("#placeholder").bind("plotclick", function (event, pos, item) { + alert("You clicked at " + pos.x + ", " + pos.y); + // axis coordinates for other axes, if present, are in pos.x2, pos.x3, ... + // if you need global screen coordinates, they are pos.pageX, pos.pageY + + if (item) { + highlight(item.series, item.datapoint); + alert("You clicked a point!"); + } + }); + +The item object in this example is either null or a nearby object on the form: + + item: { + datapoint: the point, e.g. [0, 2] + dataIndex: the index of the point in the data array + series: the series object + seriesIndex: the index of the series + pageX, pageY: the global screen coordinates of the point + } + +For instance, if you have specified the data like this + + $.plot($("#placeholder"), [ { label: "Foo", data: [[0, 10], [7, 3]] } ], ...); + +and the mouse is near the point (7, 3), "datapoint" is [7, 3], +"dataIndex" will be 1, "series" is a normalized series object with +among other things the "Foo" label in series.label and the color in +series.color, and "seriesIndex" is 0. Note that plugins and options +that transform the data can shift the indexes from what you specified +in the original data array. + +If you use the above events to update some other information and want +to clear out that info in case the mouse goes away, you'll probably +also need to listen to "mouseout" events on the placeholder div. + +"mouseActiveRadius" specifies how far the mouse can be from an item +and still activate it. If there are two or more points within this +radius, Flot chooses the closest item. For bars, the top-most bar +(from the latest specified data series) is chosen. + +If you want to disable interactivity for a specific data series, you +can set "hoverable" and "clickable" to false in the options for that +series, like this { data: [...], label: "Foo", clickable: false }. + + +Specifying gradients +==================== + +A gradient is specified like this: + + { colors: [ color1, color2, ... ] } + +For instance, you might specify a background on the grid going from +black to gray like this: + + grid: { + backgroundColor: { colors: ["#000", "#999"] } + } + +For the series you can specify the gradient as an object that +specifies the scaling of the brightness and the opacity of the series +color, e.g. + + { colors: [{ opacity: 0.8 }, { brightness: 0.6, opacity: 0.8 } ] } + +where the first color simply has its alpha scaled, whereas the second +is also darkened. For instance, for bars the following makes the bars +gradually disappear, without outline: + + bars: { + show: true, + lineWidth: 0, + fill: true, + fillColor: { colors: [ { opacity: 0.8 }, { opacity: 0.1 } ] } + } + +Flot currently only supports vertical gradients drawn from top to +bottom because that's what works with IE. + + +Plot Methods +------------ + +The Plot object returned from the plot function has some methods you +can call: + + - highlight(series, datapoint) + + Highlight a specific datapoint in the data series. You can either + specify the actual objects, e.g. if you got them from a + "plotclick" event, or you can specify the indices, e.g. + highlight(1, 3) to highlight the fourth point in the second series + (remember, zero-based indexing). + + + - unhighlight(series, datapoint) or unhighlight() + + Remove the highlighting of the point, same parameters as + highlight. + + If you call unhighlight with no parameters, e.g. as + plot.unhighlight(), all current highlights are removed. + + + - setData(data) + + You can use this to reset the data used. Note that axis scaling, + ticks, legend etc. will not be recomputed (use setupGrid() to do + that). You'll probably want to call draw() afterwards. + + You can use this function to speed up redrawing a small plot if + you know that the axes won't change. Put in the new data with + setData(newdata), call draw(), and you're good to go. Note that + for large datasets, almost all the time is consumed in draw() + plotting the data so in this case don't bother. + + + - setupGrid() + + Recalculate and set axis scaling, ticks, legend etc. + + Note that because of the drawing model of the canvas, this + function will immediately redraw (actually reinsert in the DOM) + the labels and the legend, but not the actual tick lines because + they're drawn on the canvas. You need to call draw() to get the + canvas redrawn. + + - draw() + + Redraws the plot canvas. + + - triggerRedrawOverlay() + + Schedules an update of an overlay canvas used for drawing + interactive things like a selection and point highlights. This + is mostly useful for writing plugins. The redraw doesn't happen + immediately, instead a timer is set to catch multiple successive + redraws (e.g. from a mousemove). You can get to the overlay by + setting up a drawOverlay hook. + + - width()/height() + + Gets the width and height of the plotting area inside the grid. + This is smaller than the canvas or placeholder dimensions as some + extra space is needed (e.g. for labels). + + - offset() + + Returns the offset of the plotting area inside the grid relative + to the document, useful for instance for calculating mouse + positions (event.pageX/Y minus this offset is the pixel position + inside the plot). + + - pointOffset({ x: xpos, y: ypos }) + + Returns the calculated offset of the data point at (x, y) in data + space within the placeholder div. If you are working with multiple axes, you + can specify the x and y axis references, e.g. + + o = pointOffset({ x: xpos, y: ypos, xaxis: 2, yaxis: 3 }) + // o.left and o.top now contains the offset within the div + + - resize() + + Tells Flot to resize the drawing canvas to the size of the + placeholder. You need to run setupGrid() and draw() afterwards as + canvas resizing is a destructive operation. This is used + internally by the resize plugin. + + - shutdown() + + Cleans up any event handlers Flot has currently registered. This + is used internally. + + +There are also some members that let you peek inside the internal +workings of Flot which is useful in some cases. Note that if you change +something in the objects returned, you're changing the objects used by +Flot to keep track of its state, so be careful. + + - getData() + + Returns an array of the data series currently used in normalized + form with missing settings filled in according to the global + options. So for instance to find out what color Flot has assigned + to the data series, you could do this: + + var series = plot.getData(); + for (var i = 0; i < series.length; ++i) + alert(series[i].color); + + A notable other interesting field besides color is datapoints + which has a field "points" with the normalized data points in a + flat array (the field "pointsize" is the increment in the flat + array to get to the next point so for a dataset consisting only of + (x,y) pairs it would be 2). + + - getAxes() + + Gets an object with the axes. The axes are returned as the + attributes of the object, so for instance getAxes().xaxis is the + x axis. + + Various things are stuffed inside an axis object, e.g. you could + use getAxes().xaxis.ticks to find out what the ticks are for the + xaxis. Two other useful attributes are p2c and c2p, functions for + transforming from data point space to the canvas plot space and + back. Both returns values that are offset with the plot offset. + Check the Flot source code for the complete set of attributes (or + output an axis with console.log() and inspect it). + + With multiple axes, the extra axes are returned as x2axis, x3axis, + etc., e.g. getAxes().y2axis is the second y axis. You can check + y2axis.used to see whether the axis is associated with any data + points and y2axis.show to see if it is currently shown. + + - getPlaceholder() + + Returns placeholder that the plot was put into. This can be useful + for plugins for adding DOM elements or firing events. + + - getCanvas() + + Returns the canvas used for drawing in case you need to hack on it + yourself. You'll probably need to get the plot offset too. + + - getPlotOffset() + + Gets the offset that the grid has within the canvas as an object + with distances from the canvas edges as "left", "right", "top", + "bottom". I.e., if you draw a circle on the canvas with the center + placed at (left, top), its center will be at the top-most, left + corner of the grid. + + - getOptions() + + Gets the options for the plot, normalized, with default values + filled in. You get a reference to actual values used by Flot, so + if you modify the values in here, Flot will use the new values. + If you change something, you probably have to call draw() or + setupGrid() or triggerRedrawOverlay() to see the change. + + +Hooks +===== + +In addition to the public methods, the Plot object also has some hooks +that can be used to modify the plotting process. You can install a +callback function at various points in the process, the function then +gets access to the internal data structures in Flot. + +Here's an overview of the phases Flot goes through: + + 1. Plugin initialization, parsing options + + 2. Constructing the canvases used for drawing + + 3. Set data: parsing data specification, calculating colors, + copying raw data points into internal format, + normalizing them, finding max/min for axis auto-scaling + + 4. Grid setup: calculating axis spacing, ticks, inserting tick + labels, the legend + + 5. Draw: drawing the grid, drawing each of the series in turn + + 6. Setting up event handling for interactive features + + 7. Responding to events, if any + + 8. Shutdown: this mostly happens in case a plot is overwritten + +Each hook is simply a function which is put in the appropriate array. +You can add them through the "hooks" option, and they are also available +after the plot is constructed as the "hooks" attribute on the returned +plot object, e.g. + + // define a simple draw hook + function hellohook(plot, canvascontext) { alert("hello!"); }; + + // pass it in, in an array since we might want to specify several + var plot = $.plot(placeholder, data, { hooks: { draw: [hellohook] } }); + + // we can now find it again in plot.hooks.draw[0] unless a plugin + // has added other hooks + +The available hooks are described below. All hook callbacks get the +plot object as first parameter. You can find some examples of defined +hooks in the plugins bundled with Flot. + + - processOptions [phase 1] + + function(plot, options) + + Called after Flot has parsed and merged options. Useful in the + instance where customizations beyond simple merging of default + values is needed. A plugin might use it to detect that it has been + enabled and then turn on or off other options. + + + - processRawData [phase 3] + + function(plot, series, data, datapoints) + + Called before Flot copies and normalizes the raw data for the given + series. If the function fills in datapoints.points with normalized + points and sets datapoints.pointsize to the size of the points, + Flot will skip the copying/normalization step for this series. + + In any case, you might be interested in setting datapoints.format, + an array of objects for specifying how a point is normalized and + how it interferes with axis scaling. + + The default format array for points is something along the lines of: + + [ + { x: true, number: true, required: true }, + { y: true, number: true, required: true } + ] + + The first object means that for the first coordinate it should be + taken into account when scaling the x axis, that it must be a + number, and that it is required - so if it is null or cannot be + converted to a number, the whole point will be zeroed out with + nulls. Beyond these you can also specify "defaultValue", a value to + use if the coordinate is null. This is for instance handy for bars + where one can omit the third coordinate (the bottom of the bar) + which then defaults to 0. + + + - processDatapoints [phase 3] + + function(plot, series, datapoints) + + Called after normalization of the given series but before finding + min/max of the data points. This hook is useful for implementing data + transformations. "datapoints" contains the normalized data points in + a flat array as datapoints.points with the size of a single point + given in datapoints.pointsize. Here's a simple transform that + multiplies all y coordinates by 2: + + function multiply(plot, series, datapoints) { + var points = datapoints.points, ps = datapoints.pointsize; + for (var i = 0; i < points.length; i += ps) + points[i + 1] *= 2; + } + + Note that you must leave datapoints in a good condition as Flot + doesn't check it or do any normalization on it afterwards. + + + - drawSeries [phase 5] + + function(plot, canvascontext, series) + + Hook for custom drawing of a single series. Called just before the + standard drawing routine has been called in the loop that draws + each series. + + + - draw [phase 5] + + function(plot, canvascontext) + + Hook for drawing on the canvas. Called after the grid is drawn + (unless it's disabled or grid.aboveData is set) and the series have + been plotted (in case any points, lines or bars have been turned + on). For examples of how to draw things, look at the source code. + + + - bindEvents [phase 6] + + function(plot, eventHolder) + + Called after Flot has setup its event handlers. Should set any + necessary event handlers on eventHolder, a jQuery object with the + canvas, e.g. + + function (plot, eventHolder) { + eventHolder.mousedown(function (e) { + alert("You pressed the mouse at " + e.pageX + " " + e.pageY); + }); + } + + Interesting events include click, mousemove, mouseup/down. You can + use all jQuery events. Usually, the event handlers will update the + state by drawing something (add a drawOverlay hook and call + triggerRedrawOverlay) or firing an externally visible event for + user code. See the crosshair plugin for an example. + + Currently, eventHolder actually contains both the static canvas + used for the plot itself and the overlay canvas used for + interactive features because some versions of IE get the stacking + order wrong. The hook only gets one event, though (either for the + overlay or for the static canvas). + + Note that custom plot events generated by Flot are not generated on + eventHolder, but on the div placeholder supplied as the first + argument to the plot call. You can get that with + plot.getPlaceholder() - that's probably also the one you should use + if you need to fire a custom event. + + + - drawOverlay [phase 7] + + function (plot, canvascontext) + + The drawOverlay hook is used for interactive things that need a + canvas to draw on. The model currently used by Flot works the way + that an extra overlay canvas is positioned on top of the static + canvas. This overlay is cleared and then completely redrawn + whenever something interesting happens. This hook is called when + the overlay canvas is to be redrawn. + + "canvascontext" is the 2D context of the overlay canvas. You can + use this to draw things. You'll most likely need some of the + metrics computed by Flot, e.g. plot.width()/plot.height(). See the + crosshair plugin for an example. + + + - shutdown [phase 8] + + function (plot, eventHolder) + + Run when plot.shutdown() is called, which usually only happens in + case a plot is overwritten by a new plot. If you're writing a + plugin that adds extra DOM elements or event handlers, you should + add a callback to clean up after you. Take a look at the section in + PLUGINS.txt for more info. + + +Plugins +------- + +Plugins extend the functionality of Flot. To use a plugin, simply +include its Javascript file after Flot in the HTML page. + +If you're worried about download size/latency, you can concatenate all +the plugins you use, and Flot itself for that matter, into one big file +(make sure you get the order right), then optionally run it through a +Javascript minifier such as YUI Compressor. + +Here's a brief explanation of how the plugin plumbings work: + +Each plugin registers itself in the global array $.plot.plugins. When +you make a new plot object with $.plot, Flot goes through this array +calling the "init" function of each plugin and merging default options +from the "option" attribute of the plugin. The init function gets a +reference to the plot object created and uses this to register hooks +and add new public methods if needed. + +See the PLUGINS.txt file for details on how to write a plugin. As the +above description hints, it's actually pretty easy. + + +Version number +-------------- + +The version number of Flot is available in $.plot.version. diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/FAQ.txt b/ebus-datastore/ebus/web_static/lib/flot-0.7/FAQ.txt new file mode 100644 index 0000000..e02b761 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/FAQ.txt @@ -0,0 +1,76 @@ +Frequently asked questions +-------------------------- + +Q: How much data can Flot cope with? + +A: Flot will happily draw everything you send to it so the answer +depends on the browser. The excanvas emulation used for IE (built with +VML) makes IE by far the slowest browser so be sure to test with that +if IE users are in your target group. + +1000 points is not a problem, but as soon as you start having more +points than the pixel width, you should probably start thinking about +downsampling/aggregation as this is near the resolution limit of the +chart anyway. If you downsample server-side, you also save bandwidth. + + +Q: Flot isn't working when I'm using JSON data as source! + +A: Actually, Flot loves JSON data, you just got the format wrong. +Double check that you're not inputting strings instead of numbers, +like [["0", "-2.13"], ["5", "4.3"]]. This is most common mistake, and +the error might not show up immediately because Javascript can do some +conversion automatically. + + +Q: Can I export the graph? + +A: This is a limitation of the canvas technology. There's a hook in +the canvas object for getting an image out, but you won't get the tick +labels. And it's not likely to be supported by IE. At this point, your +best bet is probably taking a screenshot, e.g. with PrtScn. + + +Q: The bars are all tiny in time mode? + +A: It's not really possible to determine the bar width automatically. +So you have to set the width with the barWidth option which is NOT in +pixels, but in the units of the x axis (or the y axis for horizontal +bars). For time mode that's milliseconds so the default value of 1 +makes the bars 1 millisecond wide. + + +Q: Can I use Flot with libraries like Mootools or Prototype? + +A: Yes, Flot supports it out of the box and it's easy! Just use jQuery +instead of $, e.g. call jQuery.plot instead of $.plot and use +jQuery(something) instead of $(something). As a convenience, you can +put in a DOM element for the graph placeholder where the examples and +the API documentation are using jQuery objects. + +Depending on how you include jQuery, you may have to add one line of +code to prevent jQuery from overwriting functions from the other +libraries, see the documentation in jQuery ("Using jQuery with other +libraries") for details. + + +Q: Flot doesn't work with [insert name of Javascript UI framework]! + +A: The only non-standard thing used by Flot is the canvas tag; +otherwise it is simply a series of absolute positioned divs within the +placeholder tag you put in. If this is not working, it's probably +because the framework you're using is doing something weird with the +DOM, or you're using it the wrong way. + +A common problem is that there's display:none on a container until the +user does something. Many tab widgets work this way, and there's +nothing wrong with it - you just can't call Flot inside a display:none +container as explained in the README so you need to hold off the Flot +call until the container is actually displayed (or use +visibility:hidden instead of display:none or move the container +off-screen). + +If you find there's a specific thing we can do to Flot to help, feel +free to submit a bug report. Otherwise, you're welcome to ask for help +on the forum/mailing list, but please don't submit a bug report to +Flot. diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/LICENSE.txt b/ebus-datastore/ebus/web_static/lib/flot-0.7/LICENSE.txt new file mode 100644 index 0000000..07d5b20 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/LICENSE.txt @@ -0,0 +1,22 @@ +Copyright (c) 2007-2009 IOLA and Ole Laursen + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/Makefile b/ebus-datastore/ebus/web_static/lib/flot-0.7/Makefile new file mode 100644 index 0000000..b300f1a --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/Makefile @@ -0,0 +1,9 @@ +# Makefile for generating minified files + +.PHONY: all + +# we cheat and process all .js files instead of an exhaustive list +all: $(patsubst %.js,%.min.js,$(filter-out %.min.js,$(wildcard *.js))) + +%.min.js: %.js + yui-compressor $< -o $@ diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/NEWS.txt b/ebus-datastore/ebus/web_static/lib/flot-0.7/NEWS.txt new file mode 100644 index 0000000..5f8e1a0 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/NEWS.txt @@ -0,0 +1,508 @@ +Flot 0.7 +-------- + +API changes: + +Multiple axes support. Code using dual axes should be changed from +using x2axis/y2axis in the options to using an array (although +backwards-compatibility hooks are in place). For instance, + + { + xaxis: { ... }, x2axis: { ... }, + yaxis: { ... }, y2axis: { ... } + } + +becomes + + { + xaxes: [ { ... }, { ... } ], + yaxes: [ { ... }, { ... } ] + } + +Note that if you're just using one axis, continue to use the +xaxis/yaxis directly (it now sets the default settings for the +arrays). Plugins touching the axes must be ported to take the extra +axes into account, check the source to see some examples. + +A related change is that the visibility of axes is now auto-detected. +So if you were relying on an axis to show up even without any data in +the chart, you now need to set the axis "show" option explicitly. + +"tickColor" on the grid options is now deprecated in favour of a +corresponding option on the axes, so { grid: { tickColor: "#000" }} +becomes { xaxis: { tickColor: "#000"}, yaxis: { tickColor: "#000"} }, +but if you just configure a base color Flot will now autogenerate a +tick color by adding transparency. Backwards-compatibility hooks are +in place. + +Final note: now that IE 9 is coming out with canvas support, you may +want to adapt the excanvas include to skip loading it in IE 9 (the +examples have been adapted thanks to Ryley Breiddal). An alternative +to excanvas using Flash has also surfaced, if your graphs are slow in +IE, you may want to give it a spin: + + http://code.google.com/p/flashcanvas/ + + +Changes: + +- Support for specifying a bottom for each point for line charts when + filling them, this means that an arbitrary bottom can be used + instead of just the x axis (based on patches patiently provided by + Roman V. Prikhodchenko). +- New fillbetween plugin that can compute a bottom for a series from + another series, useful for filling areas between lines (see new + example percentiles.html for a use case). +- More predictable handling of gaps for the stacking plugin, now all + undefined ranges are skipped. +- Stacking plugin can stack horizontal bar charts. +- Navigate plugin now redraws the plot while panning instead of only + after the fact (can be disabled by setting the pan.frameRate option + to null), raised by lastthemy (issue 235). +- Date formatter now accepts %0m and %0d to get a zero-padded month or + day (issue raised by Maximillian Dornseif). +- Revamped internals to support an unlimited number of axes, not just + dual (sponsored by Flight Data Services, + www.flightdataservices.com). +- New setting on axes, "tickLength", to control the size of ticks or + turn them off without turning off the labels. +- Axis labels are now put in container divs with classes, for instance + labels in the x axes can be reached via ".xAxis .tickLabel". +- Support for setting the color of an axis (sponsored by Flight Data + Services, www.flightdataservices.com). +- Tick color is now auto-generated as the base color with some + transparency (unless you override it). +- Support for aligning ticks in the axes with "alignTicksWithAxis" to + ensure that they appear next to each other rather than in between, + at the expense of possibly awkward tick steps (sponsored by Flight + Data Services, www.flightdataservices.com). +- Support for customizing the point type through a callback when + plotting points and new symbol plugin with some predefined point + types (sponsored by Utility Data Corporation). +- Resize plugin for automatically redrawing when the placeholder + changes size, e.g. on window resizes (sponsored by Novus Partners). + A resize() method has been added to plot object facilitate this. +- Support Infinity/-Infinity for plotting asymptotes by hacking it + into +/-Number.MAX_VALUE (reported by rabaea.mircea). +- Support for restricting navigate plugin to not pan/zoom an axis (based + on patch by kkaefer). +- Support for providing the drag cursor for the navigate plugin as an + option (based on patch by Kelly T. Moore). +- Options for controlling whether an axis is shown or not (suggestion + by Timo Tuominen) and whether to reserve space for it even if it + isn't shown. +- New attribute $.plot.version with the Flot version as a string. +- The version comment is now included in the minified jquery.flot.min.js. +- New options.grid.minBorderMargin for adjusting the minimum margin + provided around the border (based on patch by corani, issue 188). +- Refactor replot behaviour so Flot tries to reuse the existing + canvas, adding shutdown() methods to the plot (based on patch by + Ryley Breiddal, issue 269). This prevents a memory leak in Chrome + and hopefully makes replotting faster for those who are using $.plot + instead of .setData()/.draw(). Also update jQuery to 1.5.1 to + prevent IE leaks fixed in jQuery. +- New real-time line chart example. + +- New hooks: drawSeries, shutdown + +Bug fixes: + +- Fixed problem with findNearbyItem and bars on top of each other + (reported by ragingchikn, issue 242). +- Fixed problem with ticks and the border (based on patch from + ultimatehustler69, issue 236). +- Fixed problem with plugins adding options to the series objects. +- Fixed a problem introduced in 0.6 with specifying a gradient with { + brightness: x, opacity: y }. +- Don't use $.browser.msie, check for getContext on the created canvas + element instead and try to use excanvas if it's not found (fixes IE + 9 compatibility). +- highlight(s, index) was looking up the point in the original s.data + instead of in the computed datapoints array, which breaks with + plugins that modify the datapoints (such as the stacking plugin). + Issue 316 reported by curlypaul924. +- More robust handling of axis from data passed in from getData() + (problem reported by Morgan). +- Fixed problem with turning off bar outline (issue 253, fix by Jordi + Castells). +- Check the selection passed into setSelection in the selection + plugin, to guard against errors when synchronizing plots (fix by Lau + Bech Lauritzen). +- Fix bug in crosshair code with mouseout resetting the crosshair even + if it is locked (fix by Lau Bech Lauritzen and Banko Adam). +- Fix bug with points plotting using line width from lines rather than + points. +- Fix bug with passing non-array 0 data (for plugins that don't expect + arrays, patch by vpapp1). +- Fix errors in JSON in examples so they work with jQuery 1.4.2 + (fix reported by honestbleeps, issue 357). +- Fix bug with tooltip in interacting.html, this makes the tooltip + much smoother (fix by bdkahn). Fix related bug inside highlighting + handler in Flot. +- Use closure trick to make inline colorhelpers plugin respect + jQuery.noConflict(true), renaming the global jQuery object (reported + by Nick Stielau). +- Listen for mouseleave events and fire a plothover event with empty + item when it occurs to drop highlights when the mouse leaves the + plot (reported by by outspirit). +- Fix bug with using aboveData with a background (reported by + amitayd). +- Fix possible excanvas leak (report and suggested fix by tom9729). +- Fix bug with backwards compatibility for shadowSize = 0 (report and + suggested fix by aspinak). +- Adapt examples to skip loading excanvas (fix by Ryley Breiddal). +- Fix bug that prevent a simple f(x) = -x transform from working + correctly (fix by Mike, issue 263). +- Fix bug in restoring cursor in navigate plugin (reported by Matteo + Gattanini, issue 395). +- Fix bug in picking items when transform/inverseTransform is in use + (reported by Ofri Raviv, and patches and analysis by Jan and Tom + Paton, issue 334 and 467). +- Fix problem with unaligned ticks and hover/click events caused by + padding on the placeholder by hardcoding the placeholder padding to + 0 (reported by adityadineshsaxena, Matt Sommer, Daniel Atos and some + other people, issue 301). +- Update colorhelpers plugin to avoid dying when trying to parse an + invalid string (reported by cadavor, issue 483). + + +Flot 0.6 +-------- + +API changes: + +1. Selection support has been moved to a plugin. Thus if you're +passing selection: { mode: something }, you MUST include the file +jquery.flot.selection.js after jquery.flot.js. This reduces the size +of base Flot and makes it easier to customize the selection as well as +improving code clarity. The change is based on a patch from andershol. + +2. In the global options specified in the $.plot command, +"lines", "points", "bars" and "shadowSize" have been moved to a +sub-object called "series", i.e. + + $.plot(placeholder, data, { lines: { show: true }}) + +should be changed to + + $.plot(placeholder, data, { series: { lines: { show: true }}}) + +All future series-specific options will go into this sub-object to +simplify plugin writing. Backward-compatibility code is in place, so +old code should not break. + +3. "plothover" no longer provides the original data point, but instead +a normalized one, since there may be no corresponding original point. + +4. Due to a bug in previous versions of jQuery, you now need at least +jQuery 1.2.6. But if you can, try jQuery 1.3.2 as it got some +improvements in event handling speed. + + +Changes: + +- Added support for disabling interactivity for specific data series + (request from Ronald Schouten and Steve Upton). + +- Flot now calls $() on the placeholder and optional legend container + passed in so you can specify DOM elements or CSS expressions to make + it easier to use Flot with libraries like Prototype or Mootools or + through raw JSON from Ajax responses. + +- A new "plotselecting" event is now emitted while the user is making + a selection. + +- The "plothover" event is now emitted immediately instead of at most + 10 times per second, you'll have to put in a setTimeout yourself if + you're doing something really expensive on this event. + +- The built-in date formatter can now be accessed as + $.plot.formatDate(...) (suggestion by Matt Manela) and even + replaced. + +- Added "borderColor" option to the grid (patch from Amaury Chamayou + and patch from Mike R. Williamson). + +- Added support for gradient backgrounds for the grid, take a look at + the "setting options" example (based on patch from Amaury Chamayou, + issue 90). + +- Gradient bars (suggestion by stefpet). + +- Added a "plotunselected" event which is triggered when the selection + is removed, see "selection" example (suggestion by Meda Ugo); + +- The option legend.margin can now specify horizontal and vertical + margins independently (suggestion by someone who's annoyed). + +- Data passed into Flot is now copied to a new canonical format to + enable further processing before it hits the drawing routines. As a + side-effect, this should make Flot more robust in the face of bad + data (and fixes issue 112). + +- Step-wise charting: line charts have a new option "steps" that when + set to true connects the points with horizontal/vertical steps + instead of diagonal lines. + +- The legend labelFormatter now passes the series in addition to just + the label (suggestion by Vincent Lemeltier). + +- Horizontal bars (based on patch by Jason LeBrun). + +- Support for partial bars by specifying a third coordinate, i.e. they + don't have to start from the axis. This can be used to make stacked + bars. + +- New option to disable the (grid.show). + +- Added pointOffset method for converting a point in data space to an + offset within the placeholder. + +- Plugin system: register an init method in the $.flot.plugins array + to get started, see PLUGINS.txt for details on how to write plugins + (it's easy). There are also some extra methods to enable access to + internal state. + +- Hooks: you can register functions that are called while Flot is + crunching the data and doing the plot. This can be used to modify + Flot without changing the source, useful for writing plugins. Some + hooks are defined, more are likely to come. + +- Threshold plugin: you can set a threshold and a color, and the data + points below that threshold will then get the color. Useful for + marking data below 0, for instance. + +- Stack plugin: you can specify a stack key for each series to have + them summed. This is useful for drawing additive/cumulative graphs + with bars and (currently unfilled) lines. + +- Crosshairs plugin: trace the mouse position on the axes, enable with + crosshair: { mode: "x"} (see the new tracking example for a use). + +- Image plugin: plot prerendered images. + +- Navigation plugin for panning and zooming a plot. + +- More configurable grid. + +- Axis transformation support, useful for non-linear plots, e.g. log + axes and compressed time axes (like omitting weekends). + +- Support for twelve-hour date formatting (patch by Forrest Aldridge). + +- The color parsing code in Flot has been cleaned up and split out so + it's now available as a separate jQuery plugin. It's included inline + in the Flot source to make dependency managing easier. This also + makes it really easy to use the color helpers in Flot plugins. + +Bug fixes: + +- Fixed two corner-case bugs when drawing filled curves (report and + analysis by Joshua Varner). +- Fix auto-adjustment code when setting min to 0 for an axis where the + dataset is completely flat on that axis (report by chovy). +- Fixed a bug with passing in data from getData to setData when the + secondary axes are used (issue 65, reported by nperelman). +- Fixed so that it is possible to turn lines off when no other chart + type is shown (based on problem reported by Glenn Vanderburg), and + fixed so that setting lineWidth to 0 also hides the shadow (based on + problem reported by Sergio Nunes). +- Updated mousemove position expression to the latest from jQuery (bug + reported by meyuchas). +- Use CSS borders instead of background in legend (fix printing issue 25 + and 45). +- Explicitly convert axis min/max to numbers. +- Fixed a bug with drawing marking lines with different colors + (reported by Khurram). +- Fixed a bug with returning y2 values in the selection event (fix + by exists, issue 75). +- Only set position relative on placeholder if it hasn't already a + position different from static (reported by kyberneticist, issue 95). +- Don't round markings to prevent sub-pixel problems (reported by Dan + Lipsitt). +- Make the grid border act similarly to a regular CSS border, i.e. + prevent it from overlapping the plot itself. This also fixes a + problem with anti-aliasing when the width is 1 pixel (reported by + Anthony Ettinger). +- Imported version 3 of excanvas and fixed two issues with the newer + version. Hopefully, this will make Flot work with IE8 (nudge by + Fabien Menager, further analysis by Booink, issue 133). +- Changed the shadow code for lines to hopefully look a bit better + with vertical lines. +- Round tick positions to avoid possible problems with fractions + (suggestion by Fred, issue 130). +- Made the heuristic for determining how many ticks to aim for a bit + smarter. +- Fix for uneven axis margins (report and patch by Paul Kienzle) and + snapping to ticks (concurrent report and patch by lifthrasiir). +- Fixed bug with slicing in findNearbyItems (patch by zollman). +- Make heuristic for x axis label widths more dynamic (patch by + rickinhethuis). +- Make sure points on top take precedence when finding nearby points + when hovering (reported by didroe, issue 224). + +Flot 0.5 +-------- + +Backwards API change summary: Timestamps are now in UTC. Also +"selected" event -> becomes "plotselected" with new data, the +parameters for setSelection are now different (but backwards +compatibility hooks are in place), coloredAreas becomes markings with +a new interface (but backwards compatibility hooks are in place). + + +Interactivity: added a new "plothover" event and this and the +"plotclick" event now returns the closest data item (based on patch by +/david, patch by Mark Byers for bar support). See the revamped +"interacting with the data" example for some hints on what you can do. + +Highlighting: you can now highlight points and datapoints are +autohighlighted when you hover over them (if hovering is turned on). + +Support for dual axis has been added (based on patch by someone who's +annoyed and /david). For each data series you can specify which axes +it belongs to, and there are two more axes, x2axis and y2axis, to +customize. This affects the "selected" event which has been renamed to +"plotselected" and spews out { xaxis: { from: -10, to: 20 } ... }, +setSelection in which the parameters are on a new form (backwards +compatible hooks are in place so old code shouldn't break) and +markings (formerly coloredAreas). + +Timestamps in time mode are now displayed according to +UTC instead of the time zone of the visitor. This affects the way the +timestamps should be input; you'll probably have to offset the +timestamps according to your local time zone. It also affects any +custom date handling code (which basically now should use the +equivalent UTC date mehods, e.g. .setUTCMonth() instead of +.setMonth(). + +Added support for specifying the size of tick labels (axis.labelWidth, +axis.labelHeight). Useful for specifying a max label size to keep +multiple plots aligned. + +Markings, previously coloredAreas, are now specified as ranges on the +axes, like { xaxis: { from: 0, to: 10 }}. Furthermore with markings +you can now draw horizontal/vertical lines by setting from and to to +the same coordinate (idea from line support patch by by Ryan Funduk). + +The "fill" option can now be a number that specifies the opacity of +the fill. + +You can now specify a coordinate as null (like [2, null]) and Flot +will take the other coordinate into account when scaling the axes +(based on patch by joebno). + +New option for bars "align". Set it to "center" to center the bars on +the value they represent. + +setSelection now takes a second parameter which you can use to prevent +the method from firing the "plotselected" handler. + +Using the "container" option in legend now overwrites the container +element instead of just appending to it (fixes infinite legend bug, +reported by several people, fix by Brad Dewey). + +Fixed a bug in calculating spacing around the plot (reported by +timothytoe). Fixed a bug in finding max values for all-negative data +sets. Prevent the possibility of eternal looping in tick calculations. +Fixed a bug when borderWidth is set to 0 (reported by +Rob/sanchothefat). Fixed a bug with drawing bars extending below 0 +(reported by James Hewitt, patch by Ryan Funduk). Fixed a +bug with line widths of bars (reported by MikeM). Fixed a bug with +'nw' and 'sw' legend positions. Improved the handling of axis +auto-scaling with bars. Fixed a bug with multi-line x-axis tick +labels (reported by Luca Ciano). IE-fix help by Savage Zhang. + + +Flot 0.4 +-------- + +API changes: deprecated axis.noTicks in favor of just specifying the +number as axis.ticks. So "xaxis: { noTicks: 10 }" becomes +"xaxis: { ticks: 10 }" + +Time series support. Specify axis.mode: "time", put in Javascript +timestamps as data, and Flot will automatically spit out sensible +ticks. Take a look at the two new examples. The format can be +customized with axis.timeformat and axis.monthNames, or if that fails +with axis.tickFormatter. + +Support for colored background areas via grid.coloredAreas. Specify an +array of { x1, y1, x2, y2 } objects or a function that returns these +given { xmin, xmax, ymin, ymax }. + +More members on the plot object (report by Chris Davies and others). +"getData" for inspecting the assigned settings on data series (e.g. +color) and "setData", "setupGrid" and "draw" for updating the contents +without a total replot. + +The default number of ticks to aim for is now dependent on the size of +the plot in pixels. Support for customizing tick interval sizes +directly with axis.minTickSize and axis.tickSize. + +Cleaned up the automatic axis scaling algorithm and fixed how it +interacts with ticks. Also fixed a couple of tick-related corner case +bugs (one reported by mainstreetmark, another reported by timothytoe). + +The option axis.tickFormatter now takes a function with two +parameters, the second parameter is an optional object with +information about the axis. It has min, max, tickDecimals, tickSize. + +Added support for segmented lines (based on patch from Michael +MacDonald) and for ignoring null and bad values (suggestion from Nick +Konidaris and joshwaihi). + +Added support for changing the border width (joebno and safoo). +Label colors can be changed via CSS by selecting the tickLabel class. + +Fixed a bug in handling single-item bar series (reported by Emil +Filipov). Fixed erratic behaviour when interacting with the plot +with IE 7 (reported by Lau Bech Lauritzen). Prevent IE/Safari text +selection when selecting stuff on the canvas. + + + +Flot 0.3 +-------- + +This is mostly a quick-fix release because jquery.js wasn't included +in the previous zip/tarball. + +Support clicking on the plot. Turn it on with grid: { clickable: true }, +then you get a "plotclick" event on the graph placeholder with the +position in units of the plot. + +Fixed a bug in dealing with data where min = max, thanks to Michael +Messinides. + +Include jquery.js in the zip/tarball. + + +Flot 0.2 +-------- + +Added support for putting a background behind the default legend. The +default is the partly transparent background color. Added +backgroundColor and backgroundOpacity to the legend options to control +this. + +The ticks options can now be a callback function that takes one +parameter, an object with the attributes min and max. The function +should return a ticks array. + +Added labelFormatter option in legend, useful for turning the legend +labels into links. + +Fixed a couple of bugs. + +The API should now be fully documented. + +Patch from Guy Fraser to make parts of the code smaller. + +API changes: Moved labelMargin option to grid from x/yaxis. + + +Flot 0.1 +-------- + +First public release. diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/PLUGINS.txt b/ebus-datastore/ebus/web_static/lib/flot-0.7/PLUGINS.txt new file mode 100644 index 0000000..af3d90b --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/PLUGINS.txt @@ -0,0 +1,137 @@ +Writing plugins +--------------- + +All you need to do to make a new plugin is creating an init function +and a set of options (if needed), stuffing it into an object and +putting it in the $.plot.plugins array. For example: + + function myCoolPluginInit(plot) { + plot.coolstring = "Hello!"; + }; + + $.plot.plugins.push({ init: myCoolPluginInit, options: { ... } }); + + // if $.plot is called, it will return a plot object with the + // attribute "coolstring" + +Now, given that the plugin might run in many different places, it's +a good idea to avoid leaking names. The usual trick here is wrap the +above lines in an anonymous function which is called immediately, like +this: (function () { inner code ... })(). To make it even more robust +in case $ is not bound to jQuery but some other Javascript library, we +can write it as + + (function ($) { + // plugin definition + // ... + })(jQuery); + +There's a complete example below, but you should also check out the +plugins bundled with Flot. + + +Complete example +---------------- + +Here is a simple debug plugin which alerts each of the series in the +plot. It has a single option that control whether it is enabled and +how much info to output: + + (function ($) { + function init(plot) { + var debugLevel = 1; + + function checkDebugEnabled(plot, options) { + if (options.debug) { + debugLevel = options.debug; + + plot.hooks.processDatapoints.push(alertSeries); + } + } + + function alertSeries(plot, series, datapoints) { + var msg = "series " + series.label; + if (debugLevel > 1) + msg += " with " + series.data.length + " points"; + alert(msg); + } + + plot.hooks.processOptions.push(checkDebugEnabled); + } + + var options = { debug: 0 }; + + $.plot.plugins.push({ + init: init, + options: options, + name: "simpledebug", + version: "0.1" + }); + })(jQuery); + +We also define "name" and "version". It's not used by Flot, but might +be helpful for other plugins in resolving dependencies. + +Put the above in a file named "jquery.flot.debug.js", include it in an +HTML page and then it can be used with: + + $.plot($("#placeholder"), [...], { debug: 2 }); + +This simple plugin illustrates a couple of points: + + - It uses the anonymous function trick to avoid name pollution. + - It can be enabled/disabled through an option. + - Variables in the init function can be used to store plot-specific + state between the hooks. + +The two last points are important because there may be multiple plots +on the same page, and you'd want to make sure they are not mixed up. + + +Shutting down a plugin +---------------------- + +Each plot object has a shutdown hook which is run when plot.shutdown() +is called. This usually mostly happens in case another plot is made on +top of an existing one. + +The purpose of the hook is to give you a chance to unbind any event +handlers you've registered and remove any extra DOM things you've +inserted. + +The problem with event handlers is that you can have registered a +handler which is run in some point in the future, e.g. with +setTimeout(). Meanwhile, the plot may have been shutdown and removed, +but because your event handler is still referencing it, it can't be +garbage collected yet, and worse, if your handler eventually runs, it +may overwrite stuff on a completely different plot. + + +Some hints on the options +------------------------- + +Plugins should always support appropriate options to enable/disable +them because the plugin user may have several plots on the same page +where only one should use the plugin. In most cases it's probably a +good idea if the plugin is turned off rather than on per default, just +like most of the powerful features in Flot. + +If the plugin needs options that are specific to each series, like the +points or lines options in core Flot, you can put them in "series" in +the options object, e.g. + + var options = { + series: { + downsample: { + algorithm: null, + maxpoints: 1000 + } + } + } + +Then they will be copied by Flot into each series, providing default +values in case none are specified. + +Think hard and long about naming the options. These names are going to +be public API, and code is going to depend on them if the plugin is +successful. diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/README.txt b/ebus-datastore/ebus/web_static/lib/flot-0.7/README.txt new file mode 100644 index 0000000..1e49787 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/README.txt @@ -0,0 +1,90 @@ +About +----- + +Flot is a Javascript plotting library for jQuery. Read more at the +website: + + http://code.google.com/p/flot/ + +Take a look at the examples linked from above, they should give a good +impression of what Flot can do and the source code of the examples is +probably the fastest way to learn how to use Flot. + + +Installation +------------ + +Just include the Javascript file after you've included jQuery. + +Generally, all browsers that support the HTML5 canvas tag are +supported. + +For support for Internet Explorer < 9, you can use Excanvas, a canvas +emulator; this is used in the examples bundled with Flot. You just +include the excanvas script like this: + + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="excanvas.min.js"></script><![endif]--> + +If it's not working on your development IE 6.0, check that it has +support for VML which Excanvas is relying on. It appears that some +stripped down versions used for test environments on virtual machines +lack the VML support. + +You can also try using Flashcanvas (see +http://code.google.com/p/flashcanvas/), which uses Flash to do the +emulation. Although Flash can be a bit slower to load than VML, if +you've got a lot of points, the Flash version can be much faster +overall. Flot contains some wrapper code for activating Excanvas which +Flashcanvas is compatible with. + +You need at least jQuery 1.2.6, but try at least 1.3.2 for interactive +charts because of performance improvements in event handling. + + +Basic usage +----------- + +Create a placeholder div to put the graph in: + + <div id="placeholder"></div> + +You need to set the width and height of this div, otherwise the plot +library doesn't know how to scale the graph. You can do it inline like +this: + + <div id="placeholder" style="width:600px;height:300px"></div> + +You can also do it with an external stylesheet. Make sure that the +placeholder isn't within something with a display:none CSS property - +in that case, Flot has trouble measuring label dimensions which +results in garbled looks and might have trouble measuring the +placeholder dimensions which is fatal (it'll throw an exception). + +Then when the div is ready in the DOM, which is usually on document +ready, run the plot function: + + $.plot($("#placeholder"), data, options); + +Here, data is an array of data series and options is an object with +settings if you want to customize the plot. Take a look at the +examples for some ideas of what to put in or look at the reference +in the file "API.txt". Here's a quick example that'll draw a line from +(0, 0) to (1, 1): + + $.plot($("#placeholder"), [ [[0, 0], [1, 1]] ], { yaxis: { max: 1 } }); + +The plot function immediately draws the chart and then returns a plot +object with a couple of methods. + + +What's with the name? +--------------------- + +First: it's pronounced with a short o, like "plot". Not like "flawed". + +So "Flot" rhymes with "plot". + +And if you look up "flot" in a Danish-to-English dictionary, some up +the words that come up are "good-looking", "attractive", "stylish", +"smart", "impressive", "extravagant". One of the main goals with Flot +is pretty looks. diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/ajax.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/ajax.html new file mode 100644 index 0000000..9b5ec85 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/ajax.html @@ -0,0 +1,143 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px;"></div> + + <p>Example of loading data dynamically with AJAX. Percentage change in GDP (source: <a href="http://epp.eurostat.ec.europa.eu/tgm/table.do?tab=table&init=1&plugin=1&language=en&pcode=tsieb020">Eurostat</a>). Click the buttons below.</p> + + <p>The data is fetched over HTTP, in this case directly from text + files. Usually the URL would point to some web server handler + (e.g. a PHP page or Java/.NET/Python/Ruby on Rails handler) that + extracts it from a database and serializes it to JSON.</p> + + <p> + <input class="fetchSeries" type="button" value="First dataset"> - + <a href="data-eu-gdp-growth.json">data</a> - + <span></span> + </p> + + <p> + <input class="fetchSeries" type="button" value="Second dataset"> - + <a href="data-japan-gdp-growth.json">data</a> - + <span></span> + </p> + + <p> + <input class="fetchSeries" type="button" value="Third dataset"> - + <a href="data-usa-gdp-growth.json">data</a> - + <span></span> + </p> + + <p>If you combine AJAX with setTimeout, you can poll the server + for new data.</p> + + <p> + <input class="dataUpdate" type="button" value="Poll for data"> + </p> + +<script type="text/javascript"> +$(function () { + var options = { + lines: { show: true }, + points: { show: true }, + xaxis: { tickDecimals: 0, tickSize: 1 } + }; + var data = []; + var placeholder = $("#placeholder"); + + $.plot(placeholder, data, options); + + + // fetch one series, adding to what we got + var alreadyFetched = {}; + + $("input.fetchSeries").click(function () { + var button = $(this); + + // find the URL in the link right next to us + var dataurl = button.siblings('a').attr('href'); + + // then fetch the data with jQuery + function onDataReceived(series) { + // extract the first coordinate pair so you can see that + // data is now an ordinary Javascript object + var firstcoordinate = '(' + series.data[0][0] + ', ' + series.data[0][1] + ')'; + + button.siblings('span').text('Fetched ' + series.label + ', first point: ' + firstcoordinate); + + // let's add it to our current data + if (!alreadyFetched[series.label]) { + alreadyFetched[series.label] = true; + data.push(series); + } + + // and plot all we got + $.plot(placeholder, data, options); + } + + $.ajax({ + url: dataurl, + method: 'GET', + dataType: 'json', + success: onDataReceived + }); + }); + + + // initiate a recurring data update + $("input.dataUpdate").click(function () { + // reset data + data = []; + alreadyFetched = {}; + + $.plot(placeholder, data, options); + + var iteration = 0; + + function fetchData() { + ++iteration; + + function onDataReceived(series) { + // we get all the data in one go, if we only got partial + // data, we could merge it with what we already got + data = [ series ]; + + $.plot($("#placeholder"), data, options); + } + + $.ajax({ + // usually, we'll just call the same URL, a script + // connected to a database, but in this case we only + // have static example files so we need to modify the + // URL + url: "data-eu-gdp-growth-" + iteration + ".json", + method: 'GET', + dataType: 'json', + success: onDataReceived + }); + + if (iteration < 5) + setTimeout(fetchData, 1000); + else { + data = []; + alreadyFetched = {}; + } + } + + setTimeout(fetchData, 1000); + }); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/annotating.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/annotating.html new file mode 100644 index 0000000..72c212b --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/annotating.html @@ -0,0 +1,75 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px;"></div> + + <p>Flot has support for simple background decorations such as + lines and rectangles. They can be useful for marking up certain + areas. You can easily add any HTML you need with standard DOM + manipulation, e.g. for labels. For drawing custom shapes there is + also direct access to the canvas.</p> + +<script type="text/javascript"> +$(function () { + // generate a dataset + var d1 = []; + for (var i = 0; i < 20; ++i) + d1.push([i, Math.sin(i)]); + + var data = [{ data: d1, label: "Pressure", color: "#333" }]; + + // setup background areas + var markings = [ + { color: '#f6f6f6', yaxis: { from: 1 } }, + { color: '#f6f6f6', yaxis: { to: -1 } }, + { color: '#000', lineWidth: 1, xaxis: { from: 2, to: 2 } }, + { color: '#000', lineWidth: 1, xaxis: { from: 8, to: 8 } } + ]; + + var placeholder = $("#placeholder"); + + // plot it + var plot = $.plot(placeholder, data, { + bars: { show: true, barWidth: 0.5, fill: 0.9 }, + xaxis: { ticks: [], autoscaleMargin: 0.02 }, + yaxis: { min: -2, max: 2 }, + grid: { markings: markings } + }); + + // add labels + var o; + + o = plot.pointOffset({ x: 2, y: -1.2}); + // we just append it to the placeholder which Flot already uses + // for positioning + placeholder.append('<div style="position:absolute;left:' + (o.left + 4) + 'px;top:' + o.top + 'px;color:#666;font-size:smaller">Warming up</div>'); + + o = plot.pointOffset({ x: 8, y: -1.2}); + placeholder.append('<div style="position:absolute;left:' + (o.left + 4) + 'px;top:' + o.top + 'px;color:#666;font-size:smaller">Actual measurements</div>'); + + // draw a little arrow on top of the last label to demonstrate + // canvas drawing + var ctx = plot.getCanvas().getContext("2d"); + ctx.beginPath(); + o.left += 4; + ctx.moveTo(o.left, o.top); + ctx.lineTo(o.left, o.top - 10); + ctx.lineTo(o.left + 10, o.top - 5); + ctx.lineTo(o.left, o.top); + ctx.fillStyle = "#000"; + ctx.fill(); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/arrow-down.gif b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/arrow-down.gif Binary files differnew file mode 100644 index 0000000..e239d11 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/arrow-down.gif diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/arrow-left.gif b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/arrow-left.gif Binary files differnew file mode 100644 index 0000000..93ffd5a --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/arrow-left.gif diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/arrow-right.gif b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/arrow-right.gif Binary files differnew file mode 100644 index 0000000..5fd0530 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/arrow-right.gif diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/arrow-up.gif b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/arrow-up.gif Binary files differnew file mode 100644 index 0000000..7d19626 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/arrow-up.gif diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/basic.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/basic.html new file mode 100644 index 0000000..b116d94 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/basic.html @@ -0,0 +1,38 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px;"></div> + + <p>Simple example. You don't need to specify much to get an + attractive look. Put in a placeholder, make sure you set its + dimensions (otherwise the plot library will barf) and call the + plot function with the data. The axes are automatically + scaled.</p> + +<script type="text/javascript"> +$(function () { + var d1 = []; + for (var i = 0; i < 14; i += 0.5) + d1.push([i, Math.sin(i)]); + + var d2 = [[0, 3], [4, 8], [8, 5], [9, 13]]; + + // a null signifies separate line segments + var d3 = [[0, 12], [7, 12], null, [7, 2.5], [12, 2.5]]; + + $.plot($("#placeholder"), [ d1, d2, d3 ]); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth-1.json b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth-1.json new file mode 100644 index 0000000..51952cf --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth-1.json @@ -0,0 +1,4 @@ +{ + "label": "Europe (EU27)", + "data": [[1999, 3.0], [2000, 3.9]] +} diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth-2.json b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth-2.json new file mode 100644 index 0000000..82004d6 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth-2.json @@ -0,0 +1,4 @@ +{ + "label": "Europe (EU27)", + "data": [[1999, 3.0], [2000, 3.9], [2001, 2.0], [2002, 1.2]] +} diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth-3.json b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth-3.json new file mode 100644 index 0000000..8684479 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth-3.json @@ -0,0 +1,4 @@ +{ + "label": "Europe (EU27)", + "data": [[1999, 3.0], [2000, 3.9], [2001, 2.0], [2002, 1.2], [2003, 1.3], [2004, 2.5]] +} diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth-4.json b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth-4.json new file mode 100644 index 0000000..b363578 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth-4.json @@ -0,0 +1,4 @@ +{ + "label": "Europe (EU27)", + "data": [[1999, 3.0], [2000, 3.9], [2001, 2.0], [2002, 1.2], [2003, 1.3], [2004, 2.5], [2005, 2.0], [2006, 3.1]] +} diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth-5.json b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth-5.json new file mode 100644 index 0000000..a7e1e13 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth-5.json @@ -0,0 +1,4 @@ +{ + "label": "Europe (EU27)", + "data": [[1999, 3.0], [2000, 3.9], [2001, 2.0], [2002, 1.2], [2003, 1.3], [2004, 2.5], [2005, 2.0], [2006, 3.1], [2007, 2.9], [2008, 0.9]] +} diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth.json b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth.json new file mode 100644 index 0000000..a7e1e13 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-eu-gdp-growth.json @@ -0,0 +1,4 @@ +{ + "label": "Europe (EU27)", + "data": [[1999, 3.0], [2000, 3.9], [2001, 2.0], [2002, 1.2], [2003, 1.3], [2004, 2.5], [2005, 2.0], [2006, 3.1], [2007, 2.9], [2008, 0.9]] +} diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-japan-gdp-growth.json b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-japan-gdp-growth.json new file mode 100644 index 0000000..855477c --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-japan-gdp-growth.json @@ -0,0 +1,4 @@ +{ + "label": "Japan", + "data": [[1999, -0.1], [2000, 2.9], [2001, 0.2], [2002, 0.3], [2003, 1.4], [2004, 2.7], [2005, 1.9], [2006, 2.0], [2007, 2.3], [2008, -0.7]] +} diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-usa-gdp-growth.json b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-usa-gdp-growth.json new file mode 100644 index 0000000..33f66c6 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/data-usa-gdp-growth.json @@ -0,0 +1,4 @@ +{ + "label": "USA", + "data": [[1999, 4.4], [2000, 3.7], [2001, 0.8], [2002, 1.6], [2003, 2.5], [2004, 3.6], [2005, 2.9], [2006, 2.8], [2007, 2.0], [2008, 1.1]] +} diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/graph-types.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/graph-types.html new file mode 100644 index 0000000..dd21a31 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/graph-types.html @@ -0,0 +1,75 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px"></div> + + <p>Flot supports lines, points, filled areas, bars and any + combinations of these, in the same plot and even on the same data + series.</p> + +<script type="text/javascript"> +$(function () { + var d1 = []; + for (var i = 0; i < 14; i += 0.5) + d1.push([i, Math.sin(i)]); + + var d2 = [[0, 3], [4, 8], [8, 5], [9, 13]]; + + var d3 = []; + for (var i = 0; i < 14; i += 0.5) + d3.push([i, Math.cos(i)]); + + var d4 = []; + for (var i = 0; i < 14; i += 0.1) + d4.push([i, Math.sqrt(i * 10)]); + + var d5 = []; + for (var i = 0; i < 14; i += 0.5) + d5.push([i, Math.sqrt(i)]); + + var d6 = []; + for (var i = 0; i < 14; i += 0.5 + Math.random()) + d6.push([i, Math.sqrt(2*i + Math.sin(i) + 5)]); + + $.plot($("#placeholder"), [ + { + data: d1, + lines: { show: true, fill: true } + }, + { + data: d2, + bars: { show: true } + }, + { + data: d3, + points: { show: true } + }, + { + data: d4, + lines: { show: true } + }, + { + data: d5, + lines: { show: true }, + points: { show: true } + }, + { + data: d6, + lines: { show: true, steps: true } + } + ]); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/hs-2004-27-a-large_web.jpg b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/hs-2004-27-a-large_web.jpg Binary files differnew file mode 100644 index 0000000..a1d5c05 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/hs-2004-27-a-large_web.jpg diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/image.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/image.html new file mode 100644 index 0000000..073ad43 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/image.html @@ -0,0 +1,45 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.image.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:400px;height:400px;"></div> + + <p>The Cat's Eye Nebula (<a href="http://hubblesite.org/gallery/album/nebula/pr2004027a/">picture from Hubble</a>).</p> + + <p>With the image plugin, you can plot images. This is for example + useful for getting ticks on complex prerendered visualizations. + Instead of inputting data points, you put in the images and where + their two opposite corners are supposed to be in plot space.</p> + + <p>Images represent a little further complication because you need + to make sure they are loaded before you can use them (Flot skips + incomplete images). The plugin comes with a couple of helpers + for doing that.</p> + +<script type="text/javascript"> +$(function () { + var data = [ [ ["hs-2004-27-a-large_web.jpg", -10, -10, 10, 10] ] ]; + var options = { + series: { images: { show: true } }, + xaxis: { min: -8, max: 4 }, + yaxis: { min: -8, max: 4 } + }; + + $.plot.image.loadDataImages(data, options, function () { + $.plot($("#placeholder"), data, options); + }); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/index.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/index.html new file mode 100644 index 0000000..f24f750 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/index.html @@ -0,0 +1,44 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + </head> + <body> + <h1>Flot Examples</h1> + + <p>Here are some examples for <a href="http://code.google.com/p/flot/">Flot</a>, the Javascript charting library for jQuery:</p> + + <ul> + <li><a href="basic.html">Basic example</a></li> + <li><a href="graph-types.html">Different graph types</a></li> + <li><a href="setting-options.html">Setting various options</a> and <a href="annotating.html">annotating a chart</a></li> + <li><a href="ajax.html">Updating graphs with AJAX</a> and <a href="realtime.html">real-time updates</a></li> + </ul> + + <p>Being interactive:</p> + + <ul> + <li><a href="turning-series.html">Turning series on/off</a></li> + <li><a href="selection.html">Rectangular selection support and zooming</a> and <a href="zooming.html">zooming with overview</a> (both with selection plugin)</li> + <li><a href="interacting.html">Interacting with the data points</a></li> + <li><a href="navigate.html">Panning and zooming</a> (with navigation plugin)</li> + <li><a href="resize.html">Automatically redraw when window is resized</a> (with resize plugin)</li> + </ul> + + <p>Various features:</p> + + <ul> + <li><a href="symbols.html">Using other symbols than circles for points</a> (with symbol plugin)</li> + <li><a href="time.html">Plotting time series</a> and <a href="visitors.html">visitors per day with zooming and weekends</a> (with selection plugin)</li> + <li><a href="multiple-axes.html">Multiple axes</a> and <a href="interacting-axes.html">interacting with the axes</a></li> + <li><a href="thresholding.html">Thresholding the data</a> (with threshold plugin)</li> + <li><a href="stacking.html">Stacked charts</a> (with stacking plugin)</li> + <li><a href="percentiles.html">Using filled areas to plot percentiles</a> (with fillbetween plugin)</li> + <li><a href="tracking.html">Tracking curves with crosshair</a> (with crosshair plugin)</li> + <li><a href="image.html">Plotting prerendered images</a> (with image plugin)</li> + <li><a href="pie.html">Pie charts</a> (with pie plugin)</li> + </ul> + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/interacting-axes.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/interacting-axes.html new file mode 100644 index 0000000..5b6e3bb --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/interacting-axes.html @@ -0,0 +1,97 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px;"></div> + + <p>With multiple axes, you sometimes need to interact with them. A + simple way to do this is to draw the plot, deduce the axis + placements and insert a couple of divs on top to catch events. + Try clicking an axis.</p> + + <p id="click"></p> + +<script type="text/javascript"> +$(function () { + function generate(start, end, fn) { + var res = []; + for (var i = 0; i <= 100; ++i) { + var x = start + i / 100 * (end - start); + res.push([x, fn(x)]); + } + return res; + } + + var data = [ + { data: generate(0, 10, function (x) { return Math.sqrt(x)}), xaxis: 1, yaxis:1 }, + { data: generate(0, 10, function (x) { return Math.sin(x)}), xaxis: 1, yaxis:2 }, + { data: generate(0, 10, function (x) { return Math.cos(x)}), xaxis: 1, yaxis:3 }, + { data: generate(2, 10, function (x) { return Math.tan(x)}), xaxis: 2, yaxis: 4 } + ]; + + var plot = $.plot($("#placeholder"), + data, + { + xaxes: [ + { position: 'bottom' }, + { position: 'top'} + ], + yaxes: [ + { position: 'left' }, + { position: 'left' }, + { position: 'right' }, + { position: 'left' } + ] + }); + + // now for each axis, create a div + + function getBoundingBoxForAxis(plot, axis) { + var left = axis.box.left, top = axis.box.top, + right = left + axis.box.width, bottom = top + axis.box.height; + + // some ticks may stick out, enlarge the box to encompass all ticks + var cls = axis.direction + axis.n + 'Axis'; + plot.getPlaceholder().find('.' + cls + ' .tickLabel').each(function () { + var pos = $(this).position(); + left = Math.min(pos.left, left); + top = Math.min(pos.top, top); + right = Math.max(Math.round(pos.left) + $(this).outerWidth(), right); + bottom = Math.max(Math.round(pos.top) + $(this).outerHeight(), bottom); + }); + + return { left: left, top: top, width: right - left, height: bottom - top }; + } + + $.each(plot.getAxes(), function (i, axis) { + if (!axis.show) + return; + + var box = getBoundingBoxForAxis(plot, axis); + + $('<div class="axisTarget" style="position:absolute;left:' + box.left + 'px;top:' + box.top + 'px;width:' + box.width + 'px;height:' + box.height + 'px"></div>') + .data('axis.direction', axis.direction) + .data('axis.n', axis.n) + .css({ backgroundColor: "#f00", opacity: 0, cursor: "pointer" }) + .appendTo(plot.getPlaceholder()) + .hover( + function () { $(this).css({ opacity: 0.10 }) }, + function () { $(this).css({ opacity: 0 }) } + ) + .click(function () { + $("#click").text("You clicked the " + axis.direction + axis.n + "axis!") + }); + }); +}); +</script> + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/interacting.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/interacting.html new file mode 100644 index 0000000..d04eedd --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/interacting.html @@ -0,0 +1,93 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px"></div> + + <p>One of the goals of Flot is to support user interactions. Try + pointing and clicking on the points.</p> + + <p id="hoverdata">Mouse hovers at + (<span id="x">0</span>, <span id="y">0</span>). <span id="clickdata"></span></p> + + <p>A tooltip is easy to build with a bit of jQuery code and the + data returned from the plot.</p> + + <p><input id="enableTooltip" type="checkbox">Enable tooltip</p> + +<script type="text/javascript"> +$(function () { + var sin = [], cos = []; + for (var i = 0; i < 14; i += 0.5) { + sin.push([i, Math.sin(i)]); + cos.push([i, Math.cos(i)]); + } + + var plot = $.plot($("#placeholder"), + [ { data: sin, label: "sin(x)"}, { data: cos, label: "cos(x)" } ], { + series: { + lines: { show: true }, + points: { show: true } + }, + grid: { hoverable: true, clickable: true }, + yaxis: { min: -1.2, max: 1.2 } + }); + + function showTooltip(x, y, contents) { + $('<div id="tooltip">' + contents + '</div>').css( { + position: 'absolute', + display: 'none', + top: y + 5, + left: x + 5, + border: '1px solid #fdd', + padding: '2px', + 'background-color': '#fee', + opacity: 0.80 + }).appendTo("body").fadeIn(200); + } + + var previousPoint = null; + $("#placeholder").bind("plothover", function (event, pos, item) { + $("#x").text(pos.x.toFixed(2)); + $("#y").text(pos.y.toFixed(2)); + + if ($("#enableTooltip:checked").length > 0) { + if (item) { + if (previousPoint != item.dataIndex) { + previousPoint = item.dataIndex; + + $("#tooltip").remove(); + var x = item.datapoint[0].toFixed(2), + y = item.datapoint[1].toFixed(2); + + showTooltip(item.pageX, item.pageY, + item.series.label + " of " + x + " = " + y); + } + } + else { + $("#tooltip").remove(); + previousPoint = null; + } + } + }); + + $("#placeholder").bind("plotclick", function (event, pos, item) { + if (item) { + $("#clickdata").text("You clicked point " + item.dataIndex + " in " + item.series.label + "."); + plot.highlight(item.series, item.datapoint); + } + }); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/layout.css b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/layout.css new file mode 100644 index 0000000..7ef7dd4 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/layout.css @@ -0,0 +1,6 @@ +body { + font-family: sans-serif; + font-size: 16px; + margin: 50px; + max-width: 800px; +} diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/multiple-axes.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/multiple-axes.html new file mode 100644 index 0000000..4b32e64 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/multiple-axes.html @@ -0,0 +1,60 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px;"></div> + + <p>Multiple axis support showing the raw oil price in US $/barrel of + crude oil vs. the exchange rate from US $ to €.</p> + + <p>As illustrated, you can put in multiple axes if you + need to. For each data series, simply specify the axis number. + In the options, you can then configure where you want the extra + axes to appear.</p> + + <p>Position axis <button>left</button> or <button>right</button>.</p> + +<script type="text/javascript"> +$(function () { + var oilprices = [[1167692400000,61.05], [1167778800000,58.32], [1167865200000,57.35], [1167951600000,56.31], [1168210800000,55.55], [1168297200000,55.64], [1168383600000,54.02], [1168470000000,51.88], [1168556400000,52.99], [1168815600000,52.99], [1168902000000,51.21], [1168988400000,52.24], [1169074800000,50.48], [1169161200000,51.99], [1169420400000,51.13], [1169506800000,55.04], [1169593200000,55.37], [1169679600000,54.23], [1169766000000,55.42], [1170025200000,54.01], [1170111600000,56.97], [1170198000000,58.14], [1170284400000,58.14], [1170370800000,59.02], [1170630000000,58.74], [1170716400000,58.88], [1170802800000,57.71], [1170889200000,59.71], [1170975600000,59.89], [1171234800000,57.81], [1171321200000,59.06], [1171407600000,58.00], [1171494000000,57.99], [1171580400000,59.39], [1171839600000,59.39], [1171926000000,58.07], [1172012400000,60.07], [1172098800000,61.14], [1172444400000,61.39], [1172530800000,61.46], [1172617200000,61.79], [1172703600000,62.00], [1172790000000,60.07], [1173135600000,60.69], [1173222000000,61.82], [1173308400000,60.05], [1173654000000,58.91], [1173740400000,57.93], [1173826800000,58.16], [1173913200000,57.55], [1173999600000,57.11], [1174258800000,56.59], [1174345200000,59.61], [1174518000000,61.69], [1174604400000,62.28], [1174860000000,62.91], [1174946400000,62.93], [1175032800000,64.03], [1175119200000,66.03], [1175205600000,65.87], [1175464800000,64.64], [1175637600000,64.38], [1175724000000,64.28], [1175810400000,64.28], [1176069600000,61.51], [1176156000000,61.89], [1176242400000,62.01], [1176328800000,63.85], [1176415200000,63.63], [1176674400000,63.61], [1176760800000,63.10], [1176847200000,63.13], [1176933600000,61.83], [1177020000000,63.38], [1177279200000,64.58], [1177452000000,65.84], [1177538400000,65.06], [1177624800000,66.46], [1177884000000,64.40], [1178056800000,63.68], [1178143200000,63.19], [1178229600000,61.93], [1178488800000,61.47], [1178575200000,61.55], [1178748000000,61.81], [1178834400000,62.37], [1179093600000,62.46], [1179180000000,63.17], [1179266400000,62.55], [1179352800000,64.94], [1179698400000,66.27], [1179784800000,65.50], [1179871200000,65.77], [1179957600000,64.18], [1180044000000,65.20], [1180389600000,63.15], [1180476000000,63.49], [1180562400000,65.08], [1180908000000,66.30], [1180994400000,65.96], [1181167200000,66.93], [1181253600000,65.98], [1181599200000,65.35], [1181685600000,66.26], [1181858400000,68.00], [1182117600000,69.09], [1182204000000,69.10], [1182290400000,68.19], [1182376800000,68.19], [1182463200000,69.14], [1182722400000,68.19], [1182808800000,67.77], [1182895200000,68.97], [1182981600000,69.57], [1183068000000,70.68], [1183327200000,71.09], [1183413600000,70.92], [1183586400000,71.81], [1183672800000,72.81], [1183932000000,72.19], [1184018400000,72.56], [1184191200000,72.50], [1184277600000,74.15], [1184623200000,75.05], [1184796000000,75.92], [1184882400000,75.57], [1185141600000,74.89], [1185228000000,73.56], [1185314400000,75.57], [1185400800000,74.95], [1185487200000,76.83], [1185832800000,78.21], [1185919200000,76.53], [1186005600000,76.86], [1186092000000,76.00], [1186437600000,71.59], [1186696800000,71.47], [1186956000000,71.62], [1187042400000,71.00], [1187301600000,71.98], [1187560800000,71.12], [1187647200000,69.47], [1187733600000,69.26], [1187820000000,69.83], [1187906400000,71.09], [1188165600000,71.73], [1188338400000,73.36], [1188511200000,74.04], [1188856800000,76.30], [1189116000000,77.49], [1189461600000,78.23], [1189548000000,79.91], [1189634400000,80.09], [1189720800000,79.10], [1189980000000,80.57], [1190066400000,81.93], [1190239200000,83.32], [1190325600000,81.62], [1190584800000,80.95], [1190671200000,79.53], [1190757600000,80.30], [1190844000000,82.88], [1190930400000,81.66], [1191189600000,80.24], [1191276000000,80.05], [1191362400000,79.94], [1191448800000,81.44], [1191535200000,81.22], [1191794400000,79.02], [1191880800000,80.26], [1191967200000,80.30], [1192053600000,83.08], [1192140000000,83.69], [1192399200000,86.13], [1192485600000,87.61], [1192572000000,87.40], [1192658400000,89.47], [1192744800000,88.60], [1193004000000,87.56], [1193090400000,87.56], [1193176800000,87.10], [1193263200000,91.86], [1193612400000,93.53], [1193698800000,94.53], [1193871600000,95.93], [1194217200000,93.98], [1194303600000,96.37], [1194476400000,95.46], [1194562800000,96.32], [1195081200000,93.43], [1195167600000,95.10], [1195426800000,94.64], [1195513200000,95.10], [1196031600000,97.70], [1196118000000,94.42], [1196204400000,90.62], [1196290800000,91.01], [1196377200000,88.71], [1196636400000,88.32], [1196809200000,90.23], [1196982000000,88.28], [1197241200000,87.86], [1197327600000,90.02], [1197414000000,92.25], [1197586800000,90.63], [1197846000000,90.63], [1197932400000,90.49], [1198018800000,91.24], [1198105200000,91.06], [1198191600000,90.49], [1198710000000,96.62], [1198796400000,96.00], [1199142000000,99.62], [1199314800000,99.18], [1199401200000,95.09], [1199660400000,96.33], [1199833200000,95.67], [1200351600000,91.90], [1200438000000,90.84], [1200524400000,90.13], [1200610800000,90.57], [1200956400000,89.21], [1201042800000,86.99], [1201129200000,89.85], [1201474800000,90.99], [1201561200000,91.64], [1201647600000,92.33], [1201734000000,91.75], [1202079600000,90.02], [1202166000000,88.41], [1202252400000,87.14], [1202338800000,88.11], [1202425200000,91.77], [1202770800000,92.78], [1202857200000,93.27], [1202943600000,95.46], [1203030000000,95.46], [1203289200000,101.74], [1203462000000,98.81], [1203894000000,100.88], [1204066800000,99.64], [1204153200000,102.59], [1204239600000,101.84], [1204498800000,99.52], [1204585200000,99.52], [1204671600000,104.52], [1204758000000,105.47], [1204844400000,105.15], [1205103600000,108.75], [1205276400000,109.92], [1205362800000,110.33], [1205449200000,110.21], [1205708400000,105.68], [1205967600000,101.84], [1206313200000,100.86], [1206399600000,101.22], [1206486000000,105.90], [1206572400000,107.58], [1206658800000,105.62], [1206914400000,101.58], [1207000800000,100.98], [1207173600000,103.83], [1207260000000,106.23], [1207605600000,108.50], [1207778400000,110.11], [1207864800000,110.14], [1208210400000,113.79], [1208296800000,114.93], [1208383200000,114.86], [1208728800000,117.48], [1208815200000,118.30], [1208988000000,116.06], [1209074400000,118.52], [1209333600000,118.75], [1209420000000,113.46], [1209592800000,112.52], [1210024800000,121.84], [1210111200000,123.53], [1210197600000,123.69], [1210543200000,124.23], [1210629600000,125.80], [1210716000000,126.29], [1211148000000,127.05], [1211320800000,129.07], [1211493600000,132.19], [1211839200000,128.85], [1212357600000,127.76], [1212703200000,138.54], [1212962400000,136.80], [1213135200000,136.38], [1213308000000,134.86], [1213653600000,134.01], [1213740000000,136.68], [1213912800000,135.65], [1214172000000,134.62], [1214258400000,134.62], [1214344800000,134.62], [1214431200000,139.64], [1214517600000,140.21], [1214776800000,140.00], [1214863200000,140.97], [1214949600000,143.57], [1215036000000,145.29], [1215381600000,141.37], [1215468000000,136.04], [1215727200000,146.40], [1215986400000,145.18], [1216072800000,138.74], [1216159200000,134.60], [1216245600000,129.29], [1216332000000,130.65], [1216677600000,127.95], [1216850400000,127.95], [1217282400000,122.19], [1217455200000,124.08], [1217541600000,125.10], [1217800800000,121.41], [1217887200000,119.17], [1217973600000,118.58], [1218060000000,120.02], [1218405600000,114.45], [1218492000000,113.01], [1218578400000,116.00], [1218751200000,113.77], [1219010400000,112.87], [1219096800000,114.53], [1219269600000,114.98], [1219356000000,114.98], [1219701600000,116.27], [1219788000000,118.15], [1219874400000,115.59], [1219960800000,115.46], [1220306400000,109.71], [1220392800000,109.35], [1220565600000,106.23], [1220824800000,106.34]]; + var exchangerates = [[1167606000000,0.7580], [1167692400000,0.7580], [1167778800000,0.75470], [1167865200000,0.75490], [1167951600000,0.76130], [1168038000000,0.76550], [1168124400000,0.76930], [1168210800000,0.76940], [1168297200000,0.76880], [1168383600000,0.76780], [1168470000000,0.77080], [1168556400000,0.77270], [1168642800000,0.77490], [1168729200000,0.77410], [1168815600000,0.77410], [1168902000000,0.77320], [1168988400000,0.77270], [1169074800000,0.77370], [1169161200000,0.77240], [1169247600000,0.77120], [1169334000000,0.7720], [1169420400000,0.77210], [1169506800000,0.77170], [1169593200000,0.77040], [1169679600000,0.7690], [1169766000000,0.77110], [1169852400000,0.7740], [1169938800000,0.77450], [1170025200000,0.77450], [1170111600000,0.7740], [1170198000000,0.77160], [1170284400000,0.77130], [1170370800000,0.76780], [1170457200000,0.76880], [1170543600000,0.77180], [1170630000000,0.77180], [1170716400000,0.77280], [1170802800000,0.77290], [1170889200000,0.76980], [1170975600000,0.76850], [1171062000000,0.76810], [1171148400000,0.7690], [1171234800000,0.7690], [1171321200000,0.76980], [1171407600000,0.76990], [1171494000000,0.76510], [1171580400000,0.76130], [1171666800000,0.76160], [1171753200000,0.76140], [1171839600000,0.76140], [1171926000000,0.76070], [1172012400000,0.76020], [1172098800000,0.76110], [1172185200000,0.76220], [1172271600000,0.76150], [1172358000000,0.75980], [1172444400000,0.75980], [1172530800000,0.75920], [1172617200000,0.75730], [1172703600000,0.75660], [1172790000000,0.75670], [1172876400000,0.75910], [1172962800000,0.75820], [1173049200000,0.75850], [1173135600000,0.76130], [1173222000000,0.76310], [1173308400000,0.76150], [1173394800000,0.760], [1173481200000,0.76130], [1173567600000,0.76270], [1173654000000,0.76270], [1173740400000,0.76080], [1173826800000,0.75830], [1173913200000,0.75750], [1173999600000,0.75620], [1174086000000,0.7520], [1174172400000,0.75120], [1174258800000,0.75120], [1174345200000,0.75170], [1174431600000,0.7520], [1174518000000,0.75110], [1174604400000,0.7480], [1174690800000,0.75090], [1174777200000,0.75310], [1174860000000,0.75310], [1174946400000,0.75270], [1175032800000,0.74980], [1175119200000,0.74930], [1175205600000,0.75040], [1175292000000,0.750], [1175378400000,0.74910], [1175464800000,0.74910], [1175551200000,0.74850], [1175637600000,0.74840], [1175724000000,0.74920], [1175810400000,0.74710], [1175896800000,0.74590], [1175983200000,0.74770], [1176069600000,0.74770], [1176156000000,0.74830], [1176242400000,0.74580], [1176328800000,0.74480], [1176415200000,0.7430], [1176501600000,0.73990], [1176588000000,0.73950], [1176674400000,0.73950], [1176760800000,0.73780], [1176847200000,0.73820], [1176933600000,0.73620], [1177020000000,0.73550], [1177106400000,0.73480], [1177192800000,0.73610], [1177279200000,0.73610], [1177365600000,0.73650], [1177452000000,0.73620], [1177538400000,0.73310], [1177624800000,0.73390], [1177711200000,0.73440], [1177797600000,0.73270], [1177884000000,0.73270], [1177970400000,0.73360], [1178056800000,0.73330], [1178143200000,0.73590], [1178229600000,0.73590], [1178316000000,0.73720], [1178402400000,0.7360], [1178488800000,0.7360], [1178575200000,0.7350], [1178661600000,0.73650], [1178748000000,0.73840], [1178834400000,0.73950], [1178920800000,0.74130], [1179007200000,0.73970], [1179093600000,0.73960], [1179180000000,0.73850], [1179266400000,0.73780], [1179352800000,0.73660], [1179439200000,0.740], [1179525600000,0.74110], [1179612000000,0.74060], [1179698400000,0.74050], [1179784800000,0.74140], [1179871200000,0.74310], [1179957600000,0.74310], [1180044000000,0.74380], [1180130400000,0.74430], [1180216800000,0.74430], [1180303200000,0.74430], [1180389600000,0.74340], [1180476000000,0.74290], [1180562400000,0.74420], [1180648800000,0.7440], [1180735200000,0.74390], [1180821600000,0.74370], [1180908000000,0.74370], [1180994400000,0.74290], [1181080800000,0.74030], [1181167200000,0.73990], [1181253600000,0.74180], [1181340000000,0.74680], [1181426400000,0.7480], [1181512800000,0.7480], [1181599200000,0.7490], [1181685600000,0.74940], [1181772000000,0.75220], [1181858400000,0.75150], [1181944800000,0.75020], [1182031200000,0.74720], [1182117600000,0.74720], [1182204000000,0.74620], [1182290400000,0.74550], [1182376800000,0.74490], [1182463200000,0.74670], [1182549600000,0.74580], [1182636000000,0.74270], [1182722400000,0.74270], [1182808800000,0.7430], [1182895200000,0.74290], [1182981600000,0.7440], [1183068000000,0.7430], [1183154400000,0.74220], [1183240800000,0.73880], [1183327200000,0.73880], [1183413600000,0.73690], [1183500000000,0.73450], [1183586400000,0.73450], [1183672800000,0.73450], [1183759200000,0.73520], [1183845600000,0.73410], [1183932000000,0.73410], [1184018400000,0.7340], [1184104800000,0.73240], [1184191200000,0.72720], [1184277600000,0.72640], [1184364000000,0.72550], [1184450400000,0.72580], [1184536800000,0.72580], [1184623200000,0.72560], [1184709600000,0.72570], [1184796000000,0.72470], [1184882400000,0.72430], [1184968800000,0.72440], [1185055200000,0.72350], [1185141600000,0.72350], [1185228000000,0.72350], [1185314400000,0.72350], [1185400800000,0.72620], [1185487200000,0.72880], [1185573600000,0.73010], [1185660000000,0.73370], [1185746400000,0.73370], [1185832800000,0.73240], [1185919200000,0.72970], [1186005600000,0.73170], [1186092000000,0.73150], [1186178400000,0.72880], [1186264800000,0.72630], [1186351200000,0.72630], [1186437600000,0.72420], [1186524000000,0.72530], [1186610400000,0.72640], [1186696800000,0.7270], [1186783200000,0.73120], [1186869600000,0.73050], [1186956000000,0.73050], [1187042400000,0.73180], [1187128800000,0.73580], [1187215200000,0.74090], [1187301600000,0.74540], [1187388000000,0.74370], [1187474400000,0.74240], [1187560800000,0.74240], [1187647200000,0.74150], [1187733600000,0.74190], [1187820000000,0.74140], [1187906400000,0.73770], [1187992800000,0.73550], [1188079200000,0.73150], [1188165600000,0.73150], [1188252000000,0.7320], [1188338400000,0.73320], [1188424800000,0.73460], [1188511200000,0.73280], [1188597600000,0.73230], [1188684000000,0.7340], [1188770400000,0.7340], [1188856800000,0.73360], [1188943200000,0.73510], [1189029600000,0.73460], [1189116000000,0.73210], [1189202400000,0.72940], [1189288800000,0.72660], [1189375200000,0.72660], [1189461600000,0.72540], [1189548000000,0.72420], [1189634400000,0.72130], [1189720800000,0.71970], [1189807200000,0.72090], [1189893600000,0.7210], [1189980000000,0.7210], [1190066400000,0.7210], [1190152800000,0.72090], [1190239200000,0.71590], [1190325600000,0.71330], [1190412000000,0.71050], [1190498400000,0.70990], [1190584800000,0.70990], [1190671200000,0.70930], [1190757600000,0.70930], [1190844000000,0.70760], [1190930400000,0.7070], [1191016800000,0.70490], [1191103200000,0.70120], [1191189600000,0.70110], [1191276000000,0.70190], [1191362400000,0.70460], [1191448800000,0.70630], [1191535200000,0.70890], [1191621600000,0.70770], [1191708000000,0.70770], [1191794400000,0.70770], [1191880800000,0.70910], [1191967200000,0.71180], [1192053600000,0.70790], [1192140000000,0.70530], [1192226400000,0.7050], [1192312800000,0.70550], [1192399200000,0.70550], [1192485600000,0.70450], [1192572000000,0.70510], [1192658400000,0.70510], [1192744800000,0.70170], [1192831200000,0.70], [1192917600000,0.69950], [1193004000000,0.69940], [1193090400000,0.70140], [1193176800000,0.70360], [1193263200000,0.70210], [1193349600000,0.70020], [1193436000000,0.69670], [1193522400000,0.6950], [1193612400000,0.6950], [1193698800000,0.69390], [1193785200000,0.6940], [1193871600000,0.69220], [1193958000000,0.69190], [1194044400000,0.69140], [1194130800000,0.68940], [1194217200000,0.68910], [1194303600000,0.69040], [1194390000000,0.6890], [1194476400000,0.68340], [1194562800000,0.68230], [1194649200000,0.68070], [1194735600000,0.68150], [1194822000000,0.68150], [1194908400000,0.68470], [1194994800000,0.68590], [1195081200000,0.68220], [1195167600000,0.68270], [1195254000000,0.68370], [1195340400000,0.68230], [1195426800000,0.68220], [1195513200000,0.68220], [1195599600000,0.67920], [1195686000000,0.67460], [1195772400000,0.67350], [1195858800000,0.67310], [1195945200000,0.67420], [1196031600000,0.67440], [1196118000000,0.67390], [1196204400000,0.67310], [1196290800000,0.67610], [1196377200000,0.67610], [1196463600000,0.67850], [1196550000000,0.68180], [1196636400000,0.68360], [1196722800000,0.68230], [1196809200000,0.68050], [1196895600000,0.67930], [1196982000000,0.68490], [1197068400000,0.68330], [1197154800000,0.68250], [1197241200000,0.68250], [1197327600000,0.68160], [1197414000000,0.67990], [1197500400000,0.68130], [1197586800000,0.68090], [1197673200000,0.68680], [1197759600000,0.69330], [1197846000000,0.69330], [1197932400000,0.69450], [1198018800000,0.69440], [1198105200000,0.69460], [1198191600000,0.69640], [1198278000000,0.69650], [1198364400000,0.69560], [1198450800000,0.69560], [1198537200000,0.6950], [1198623600000,0.69480], [1198710000000,0.69280], [1198796400000,0.68870], [1198882800000,0.68240], [1198969200000,0.67940], [1199055600000,0.67940], [1199142000000,0.68030], [1199228400000,0.68550], [1199314800000,0.68240], [1199401200000,0.67910], [1199487600000,0.67830], [1199574000000,0.67850], [1199660400000,0.67850], [1199746800000,0.67970], [1199833200000,0.680], [1199919600000,0.68030], [1200006000000,0.68050], [1200092400000,0.6760], [1200178800000,0.6770], [1200265200000,0.6770], [1200351600000,0.67360], [1200438000000,0.67260], [1200524400000,0.67640], [1200610800000,0.68210], [1200697200000,0.68310], [1200783600000,0.68420], [1200870000000,0.68420], [1200956400000,0.68870], [1201042800000,0.69030], [1201129200000,0.68480], [1201215600000,0.68240], [1201302000000,0.67880], [1201388400000,0.68140], [1201474800000,0.68140], [1201561200000,0.67970], [1201647600000,0.67690], [1201734000000,0.67650], [1201820400000,0.67330], [1201906800000,0.67290], [1201993200000,0.67580], [1202079600000,0.67580], [1202166000000,0.6750], [1202252400000,0.6780], [1202338800000,0.68330], [1202425200000,0.68560], [1202511600000,0.69030], [1202598000000,0.68960], [1202684400000,0.68960], [1202770800000,0.68820], [1202857200000,0.68790], [1202943600000,0.68620], [1203030000000,0.68520], [1203116400000,0.68230], [1203202800000,0.68130], [1203289200000,0.68130], [1203375600000,0.68220], [1203462000000,0.68020], [1203548400000,0.68020], [1203634800000,0.67840], [1203721200000,0.67480], [1203807600000,0.67470], [1203894000000,0.67470], [1203980400000,0.67480], [1204066800000,0.67330], [1204153200000,0.6650], [1204239600000,0.66110], [1204326000000,0.65830], [1204412400000,0.6590], [1204498800000,0.6590], [1204585200000,0.65810], [1204671600000,0.65780], [1204758000000,0.65740], [1204844400000,0.65320], [1204930800000,0.65020], [1205017200000,0.65140], [1205103600000,0.65140], [1205190000000,0.65070], [1205276400000,0.6510], [1205362800000,0.64890], [1205449200000,0.64240], [1205535600000,0.64060], [1205622000000,0.63820], [1205708400000,0.63820], [1205794800000,0.63410], [1205881200000,0.63440], [1205967600000,0.63780], [1206054000000,0.64390], [1206140400000,0.64780], [1206226800000,0.64810], [1206313200000,0.64810], [1206399600000,0.64940], [1206486000000,0.64380], [1206572400000,0.63770], [1206658800000,0.63290], [1206745200000,0.63360], [1206831600000,0.63330], [1206914400000,0.63330], [1207000800000,0.6330], [1207087200000,0.63710], [1207173600000,0.64030], [1207260000000,0.63960], [1207346400000,0.63640], [1207432800000,0.63560], [1207519200000,0.63560], [1207605600000,0.63680], [1207692000000,0.63570], [1207778400000,0.63540], [1207864800000,0.6320], [1207951200000,0.63320], [1208037600000,0.63280], [1208124000000,0.63310], [1208210400000,0.63420], [1208296800000,0.63210], [1208383200000,0.63020], [1208469600000,0.62780], [1208556000000,0.63080], [1208642400000,0.63240], [1208728800000,0.63240], [1208815200000,0.63070], [1208901600000,0.62770], [1208988000000,0.62690], [1209074400000,0.63350], [1209160800000,0.63920], [1209247200000,0.640], [1209333600000,0.64010], [1209420000000,0.63960], [1209506400000,0.64070], [1209592800000,0.64230], [1209679200000,0.64290], [1209765600000,0.64720], [1209852000000,0.64850], [1209938400000,0.64860], [1210024800000,0.64670], [1210111200000,0.64440], [1210197600000,0.64670], [1210284000000,0.65090], [1210370400000,0.64780], [1210456800000,0.64610], [1210543200000,0.64610], [1210629600000,0.64680], [1210716000000,0.64490], [1210802400000,0.6470], [1210888800000,0.64610], [1210975200000,0.64520], [1211061600000,0.64220], [1211148000000,0.64220], [1211234400000,0.64250], [1211320800000,0.64140], [1211407200000,0.63660], [1211493600000,0.63460], [1211580000000,0.6350], [1211666400000,0.63460], [1211752800000,0.63460], [1211839200000,0.63430], [1211925600000,0.63460], [1212012000000,0.63790], [1212098400000,0.64160], [1212184800000,0.64420], [1212271200000,0.64310], [1212357600000,0.64310], [1212444000000,0.64350], [1212530400000,0.6440], [1212616800000,0.64730], [1212703200000,0.64690], [1212789600000,0.63860], [1212876000000,0.63560], [1212962400000,0.6340], [1213048800000,0.63460], [1213135200000,0.6430], [1213221600000,0.64520], [1213308000000,0.64670], [1213394400000,0.65060], [1213480800000,0.65040], [1213567200000,0.65030], [1213653600000,0.64810], [1213740000000,0.64510], [1213826400000,0.6450], [1213912800000,0.64410], [1213999200000,0.64140], [1214085600000,0.64090], [1214172000000,0.64090], [1214258400000,0.64280], [1214344800000,0.64310], [1214431200000,0.64180], [1214517600000,0.63710], [1214604000000,0.63490], [1214690400000,0.63330], [1214776800000,0.63340], [1214863200000,0.63380], [1214949600000,0.63420], [1215036000000,0.6320], [1215122400000,0.63180], [1215208800000,0.6370], [1215295200000,0.63680], [1215381600000,0.63680], [1215468000000,0.63830], [1215554400000,0.63710], [1215640800000,0.63710], [1215727200000,0.63550], [1215813600000,0.6320], [1215900000000,0.62770], [1215986400000,0.62760], [1216072800000,0.62910], [1216159200000,0.62740], [1216245600000,0.62930], [1216332000000,0.63110], [1216418400000,0.6310], [1216504800000,0.63120], [1216591200000,0.63120], [1216677600000,0.63040], [1216764000000,0.62940], [1216850400000,0.63480], [1216936800000,0.63780], [1217023200000,0.63680], [1217109600000,0.63680], [1217196000000,0.63680], [1217282400000,0.6360], [1217368800000,0.6370], [1217455200000,0.64180], [1217541600000,0.64110], [1217628000000,0.64350], [1217714400000,0.64270], [1217800800000,0.64270], [1217887200000,0.64190], [1217973600000,0.64460], [1218060000000,0.64680], [1218146400000,0.64870], [1218232800000,0.65940], [1218319200000,0.66660], [1218405600000,0.66660], [1218492000000,0.66780], [1218578400000,0.67120], [1218664800000,0.67050], [1218751200000,0.67180], [1218837600000,0.67840], [1218924000000,0.68110], [1219010400000,0.68110], [1219096800000,0.67940], [1219183200000,0.68040], [1219269600000,0.67810], [1219356000000,0.67560], [1219442400000,0.67350], [1219528800000,0.67630], [1219615200000,0.67620], [1219701600000,0.67770], [1219788000000,0.68150], [1219874400000,0.68020], [1219960800000,0.6780], [1220047200000,0.67960], [1220133600000,0.68170], [1220220000000,0.68170], [1220306400000,0.68320], [1220392800000,0.68770], [1220479200000,0.69120], [1220565600000,0.69140], [1220652000000,0.70090], [1220738400000,0.70120], [1220824800000,0.7010], [1220911200000,0.70050]]; + + function euroFormatter(v, axis) { + return v.toFixed(axis.tickDecimals) +"€"; + } + + function doPlot(position) { + $.plot($("#placeholder"), + [ { data: oilprices, label: "Oil price ($)" }, + { data: exchangerates, label: "USD/EUR exchange rate", yaxis: 2 }], + { + xaxes: [ { mode: 'time' } ], + yaxes: [ { min: 0 }, + { + // align if we are to the right + alignTicksWithAxis: position == "right" ? 1 : null, + position: position, + tickFormatter: euroFormatter + } ], + legend: { position: 'sw' } + }); + } + + doPlot("right"); + + $("button").click(function () { + doPlot($(this).text()); + }); +}); +</script> + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/navigate.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/navigate.html new file mode 100644 index 0000000..c916ef2 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/navigate.html @@ -0,0 +1,118 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.navigate.js"></script> + <style type="text/css"> + #placeholder .button { + position: absolute; + cursor: pointer; + } + #placeholder div.button { + font-size: smaller; + color: #999; + background-color: #eee; + padding: 2px; + } + .message { + padding-left: 50px; + font-size: smaller; + } + </style> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px;"></div> + + <p class="message"></p> + + <p>With the navigate plugin it is easy to add panning and zooming. + Drag to pan, double click to zoom (or use the mouse scrollwheel).</p> + + <p>The plugin fires events (useful for synchronizing several + plots) and adds a couple of public methods so you can easily build + a little user interface around it, like the little buttons at the + top right in the plot.</p> + + +<script type="text/javascript"> +$(function () { + // generate data set from a parametric function with a fractal + // look + function sumf(f, t, m) { + var res = 0; + for (var i = 1; i < m; ++i) + res += f(i * i * t) / (i * i); + return res; + } + + var d1 = []; + for (var t = 0; t <= 2 * Math.PI; t += 0.01) + d1.push([sumf(Math.cos, t, 10), sumf(Math.sin, t, 10)]); + var data = [ d1 ]; + + + var placeholder = $("#placeholder"); + var options = { + series: { lines: { show: true }, shadowSize: 0 }, + xaxis: { zoomRange: [0.1, 10], panRange: [-10, 10] }, + yaxis: { zoomRange: [0.1, 10], panRange: [-10, 10] }, + zoom: { + interactive: true + }, + pan: { + interactive: true + } + }; + + var plot = $.plot(placeholder, data, options); + + // show pan/zoom messages to illustrate events + placeholder.bind('plotpan', function (event, plot) { + var axes = plot.getAxes(); + $(".message").html("Panning to x: " + axes.xaxis.min.toFixed(2) + + " – " + axes.xaxis.max.toFixed(2) + + " and y: " + axes.yaxis.min.toFixed(2) + + " – " + axes.yaxis.max.toFixed(2)); + }); + + placeholder.bind('plotzoom', function (event, plot) { + var axes = plot.getAxes(); + $(".message").html("Zooming to x: " + axes.xaxis.min.toFixed(2) + + " – " + axes.xaxis.max.toFixed(2) + + " and y: " + axes.yaxis.min.toFixed(2) + + " – " + axes.yaxis.max.toFixed(2)); + }); + + // add zoom out button + $('<div class="button" style="right:20px;top:20px">zoom out</div>').appendTo(placeholder).click(function (e) { + e.preventDefault(); + plot.zoomOut(); + }); + + // and add panning buttons + + // little helper for taking the repetitive work out of placing + // panning arrows + function addArrow(dir, right, top, offset) { + $('<img class="button" src="arrow-' + dir + '.gif" style="right:' + right + 'px;top:' + top + 'px">').appendTo(placeholder).click(function (e) { + e.preventDefault(); + plot.pan(offset); + }); + } + + addArrow('left', 55, 60, { left: -100 }); + addArrow('right', 25, 60, { left: 100 }); + addArrow('up', 40, 45, { top: -100 }); + addArrow('down', 40, 75, { top: 100 }); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/percentiles.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/percentiles.html new file mode 100644 index 0000000..9f2ba3a --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/percentiles.html @@ -0,0 +1,57 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.fillbetween.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:400px;"></div> + + <p>Height in centimeters of individuals from the US (2003-2006) as function of + age in years (source: <a href="http://www.cdc.gov/nchs/data/nhsr/nhsr010.pdf">CDC</a>). + The 15%-85%, 25%-75% and 50% percentiles are indicated.</p> + + <p>For each point of a filled curve, you can specify an arbitrary + bottom. As this example illustrates, this can be useful for + plotting percentiles. If you have the data sets available without + appropriate fill bottoms, you can use the fillbetween plugin to + compute the data point bottoms automatically.</p> + +<script type="text/javascript"> +$(function () { + var males = {'15%': [[2, 88.0], [3, 93.3], [4, 102.0], [5, 108.5], [6, 115.7], [7, 115.6], [8, 124.6], [9, 130.3], [10, 134.3], [11, 141.4], [12, 146.5], [13, 151.7], [14, 159.9], [15, 165.4], [16, 167.8], [17, 168.7], [18, 169.5], [19, 168.0]], '90%': [[2, 96.8], [3, 105.2], [4, 113.9], [5, 120.8], [6, 127.0], [7, 133.1], [8, 139.1], [9, 143.9], [10, 151.3], [11, 161.1], [12, 164.8], [13, 173.5], [14, 179.0], [15, 182.0], [16, 186.9], [17, 185.2], [18, 186.3], [19, 186.6]], '25%': [[2, 89.2], [3, 94.9], [4, 104.4], [5, 111.4], [6, 117.5], [7, 120.2], [8, 127.1], [9, 132.9], [10, 136.8], [11, 144.4], [12, 149.5], [13, 154.1], [14, 163.1], [15, 169.2], [16, 170.4], [17, 171.2], [18, 172.4], [19, 170.8]], '10%': [[2, 86.9], [3, 92.6], [4, 99.9], [5, 107.0], [6, 114.0], [7, 113.5], [8, 123.6], [9, 129.2], [10, 133.0], [11, 140.6], [12, 145.2], [13, 149.7], [14, 158.4], [15, 163.5], [16, 166.9], [17, 167.5], [18, 167.1], [19, 165.3]], 'mean': [[2, 91.9], [3, 98.5], [4, 107.1], [5, 114.4], [6, 120.6], [7, 124.7], [8, 131.1], [9, 136.8], [10, 142.3], [11, 150.0], [12, 154.7], [13, 161.9], [14, 168.7], [15, 173.6], [16, 175.9], [17, 176.6], [18, 176.8], [19, 176.7]], '75%': [[2, 94.5], [3, 102.1], [4, 110.8], [5, 117.9], [6, 124.0], [7, 129.3], [8, 134.6], [9, 141.4], [10, 147.0], [11, 156.1], [12, 160.3], [13, 168.3], [14, 174.7], [15, 178.0], [16, 180.2], [17, 181.7], [18, 181.3], [19, 182.5]], '85%': [[2, 96.2], [3, 103.8], [4, 111.8], [5, 119.6], [6, 125.6], [7, 131.5], [8, 138.0], [9, 143.3], [10, 149.3], [11, 159.8], [12, 162.5], [13, 171.3], [14, 177.5], [15, 180.2], [16, 183.8], [17, 183.4], [18, 183.5], [19, 185.5]], '50%': [[2, 91.9], [3, 98.2], [4, 106.8], [5, 114.6], [6, 120.8], [7, 125.2], [8, 130.3], [9, 137.1], [10, 141.5], [11, 149.4], [12, 153.9], [13, 162.2], [14, 169.0], [15, 174.8], [16, 176.0], [17, 176.8], [18, 176.4], [19, 177.4]]}; + var females = {'15%': [[2, 84.8], [3, 93.7], [4, 100.6], [5, 105.8], [6, 113.3], [7, 119.3], [8, 124.3], [9, 131.4], [10, 136.9], [11, 143.8], [12, 149.4], [13, 151.2], [14, 152.3], [15, 155.9], [16, 154.7], [17, 157.0], [18, 156.1], [19, 155.4]], '90%': [[2, 95.6], [3, 104.1], [4, 111.9], [5, 119.6], [6, 127.6], [7, 133.1], [8, 138.7], [9, 147.1], [10, 152.8], [11, 161.3], [12, 166.6], [13, 167.9], [14, 169.3], [15, 170.1], [16, 172.4], [17, 169.2], [18, 171.1], [19, 172.4]], '25%': [[2, 87.2], [3, 95.9], [4, 101.9], [5, 107.4], [6, 114.8], [7, 121.4], [8, 126.8], [9, 133.4], [10, 138.6], [11, 146.2], [12, 152.0], [13, 153.8], [14, 155.7], [15, 158.4], [16, 157.0], [17, 158.5], [18, 158.4], [19, 158.1]], '10%': [[2, 84.0], [3, 91.9], [4, 99.2], [5, 105.2], [6, 112.7], [7, 118.0], [8, 123.3], [9, 130.2], [10, 135.0], [11, 141.1], [12, 148.3], [13, 150.0], [14, 150.7], [15, 154.3], [16, 153.6], [17, 155.6], [18, 154.7], [19, 153.1]], 'mean': [[2, 90.2], [3, 98.3], [4, 105.2], [5, 112.2], [6, 119.0], [7, 125.8], [8, 131.3], [9, 138.6], [10, 144.2], [11, 151.3], [12, 156.7], [13, 158.6], [14, 160.5], [15, 162.1], [16, 162.9], [17, 162.2], [18, 163.0], [19, 163.1]], '75%': [[2, 93.2], [3, 101.5], [4, 107.9], [5, 116.6], [6, 122.8], [7, 129.3], [8, 135.2], [9, 143.7], [10, 148.7], [11, 156.9], [12, 160.8], [13, 163.0], [14, 165.0], [15, 165.8], [16, 168.7], [17, 166.2], [18, 167.6], [19, 168.0]], '85%': [[2, 94.5], [3, 102.8], [4, 110.4], [5, 119.0], [6, 125.7], [7, 131.5], [8, 137.9], [9, 146.0], [10, 151.3], [11, 159.9], [12, 164.0], [13, 166.5], [14, 167.5], [15, 168.5], [16, 171.5], [17, 168.0], [18, 169.8], [19, 170.3]], '50%': [[2, 90.2], [3, 98.1], [4, 105.2], [5, 111.7], [6, 118.2], [7, 125.6], [8, 130.5], [9, 138.3], [10, 143.7], [11, 151.4], [12, 156.7], [13, 157.7], [14, 161.0], [15, 162.0], [16, 162.8], [17, 162.2], [18, 162.8], [19, 163.3]]}; + + var dataset = [ + { label: 'Female mean', data: females['mean'], lines: { show: true }, color: "rgb(255,50,50)" }, + { id: 'f15%', data: females['15%'], lines: { show: true, lineWidth: 0, fill: false }, color: "rgb(255,50,50)" }, + { id: 'f25%', data: females['25%'], lines: { show: true, lineWidth: 0, fill: 0.2 }, color: "rgb(255,50,50)", fillBetween: 'f15%' }, + { id: 'f50%', data: females['50%'], lines: { show: true, lineWidth: 0.5, fill: 0.4, shadowSize: 0 }, color: "rgb(255,50,50)", fillBetween: 'f25%' }, + { id: 'f75%', data: females['75%'], lines: { show: true, lineWidth: 0, fill: 0.4 }, color: "rgb(255,50,50)", fillBetween: 'f50%' }, + { id: 'f85%', data: females['85%'], lines: { show: true, lineWidth: 0, fill: 0.2 }, color: "rgb(255,50,50)", fillBetween: 'f75%' }, + + { label: 'Male mean', data: males['mean'], lines: { show: true }, color: "rgb(50,50,255)" }, + { id: 'm15%', data: males['15%'], lines: { show: true, lineWidth: 0, fill: false }, color: "rgb(50,50,255)" }, + { id: 'm25%', data: males['25%'], lines: { show: true, lineWidth: 0, fill: 0.2 }, color: "rgb(50,50,255)", fillBetween: 'm15%' }, + { id: 'm50%', data: males['50%'], lines: { show: true, lineWidth: 0.5, fill: 0.4, shadowSize: 0 }, color: "rgb(50,50,255)", fillBetween: 'm25%' }, + { id: 'm75%', data: males['75%'], lines: { show: true, lineWidth: 0, fill: 0.4 }, color: "rgb(50,50,255)", fillBetween: 'm50%' }, + { id: 'm85%', data: males['85%'], lines: { show: true, lineWidth: 0, fill: 0.2 }, color: "rgb(50,50,255)", fillBetween: 'm75%' } + ] + + $.plot($("#placeholder"), dataset, { + xaxis: { tickDecimals: 0 }, + yaxis: { tickFormatter: function (v) { return v + " cm"; } }, + legend: { position: 'se' } + }); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/pie.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/pie.html new file mode 100644 index 0000000..8f51411 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/pie.html @@ -0,0 +1,756 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd">
+<html>
+ <head>
+ <meta http-equiv="Content-Type" content="text/html; charset=utf-8">
+ <title>Flot Pie Examples</title>
+ <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]-->
+ <script language="javascript" type="text/javascript" src="../jquery.js"></script>
+ <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script>
+ <script language="javascript" type="text/javascript" src="../jquery.flot.pie.js"></script>
+
+<script type="text/javascript">
+$(function () {
+ // data
+ /*var data = [
+ { label: "Series1", data: 10},
+ { label: "Series2", data: 30},
+ { label: "Series3", data: 90},
+ { label: "Series4", data: 70},
+ { label: "Series5", data: 80},
+ { label: "Series6", data: 110}
+ ];*/
+ /*var data = [
+ { label: "Series1", data: [[1,10]]},
+ { label: "Series2", data: [[1,30]]},
+ { label: "Series3", data: [[1,90]]},
+ { label: "Series4", data: [[1,70]]},
+ { label: "Series5", data: [[1,80]]},
+ { label: "Series6", data: [[1,0]]}
+ ];*/
+ var data = [];
+ var series = Math.floor(Math.random()*10)+1;
+ for( var i = 0; i<series; i++)
+ {
+ data[i] = { label: "Series"+(i+1), data: Math.floor(Math.random()*100)+1 }
+ }
+
+ // DEFAULT
+ $.plot($("#default"), data,
+ {
+ series: {
+ pie: {
+ show: true
+ }
+ }
+ });
+
+ // GRAPH 1
+ $.plot($("#graph1"), data,
+ {
+ series: {
+ pie: {
+ show: true
+ }
+ },
+ legend: {
+ show: false
+ }
+ });
+
+ // GRAPH 2
+ $.plot($("#graph2"), data,
+ {
+ series: {
+ pie: {
+ show: true,
+ radius: 1,
+ label: {
+ show: true,
+ radius: 1,
+ formatter: function(label, series){
+ return '<div style="font-size:8pt;text-align:center;padding:2px;color:white;">'+label+'<br/>'+Math.round(series.percent)+'%</div>';
+ },
+ background: { opacity: 0.8 }
+ }
+ }
+ },
+ legend: {
+ show: false
+ }
+ });
+
+ // GRAPH 3
+ $.plot($("#graph3"), data,
+ {
+ series: {
+ pie: {
+ show: true,
+ radius: 1,
+ label: {
+ show: true,
+ radius: 3/4,
+ formatter: function(label, series){
+ return '<div style="font-size:8pt;text-align:center;padding:2px;color:white;">'+label+'<br/>'+Math.round(series.percent)+'%</div>';
+ },
+ background: { opacity: 0.5 }
+ }
+ }
+ },
+ legend: {
+ show: false
+ }
+ });
+
+ // GRAPH 4
+ $.plot($("#graph4"), data,
+ {
+ series: {
+ pie: {
+ show: true,
+ radius: 1,
+ label: {
+ show: true,
+ radius: 3/4,
+ formatter: function(label, series){
+ return '<div style="font-size:8pt;text-align:center;padding:2px;color:white;">'+label+'<br/>'+Math.round(series.percent)+'%</div>';
+ },
+ background: {
+ opacity: 0.5,
+ color: '#000'
+ }
+ }
+ }
+ },
+ legend: {
+ show: false
+ }
+ });
+
+ // GRAPH 5
+ $.plot($("#graph5"), data,
+ {
+ series: {
+ pie: {
+ show: true,
+ radius: 3/4,
+ label: {
+ show: true,
+ radius: 3/4,
+ formatter: function(label, series){
+ return '<div style="font-size:8pt;text-align:center;padding:2px;color:white;">'+label+'<br/>'+Math.round(series.percent)+'%</div>';
+ },
+ background: {
+ opacity: 0.5,
+ color: '#000'
+ }
+ }
+ }
+ },
+ legend: {
+ show: false
+ }
+ });
+
+ // GRAPH 6
+ $.plot($("#graph6"), data,
+ {
+ series: {
+ pie: {
+ show: true,
+ radius: 1,
+ label: {
+ show: true,
+ radius: 2/3,
+ formatter: function(label, series){
+ return '<div style="font-size:8pt;text-align:center;padding:2px;color:white;">'+label+'<br/>'+Math.round(series.percent)+'%</div>';
+ },
+ threshold: 0.1
+ }
+ }
+ },
+ legend: {
+ show: false
+ }
+ });
+
+ // GRAPH 7
+ $.plot($("#graph7"), data,
+ {
+ series: {
+ pie: {
+ show: true,
+ combine: {
+ color: '#999',
+ threshold: 0.1
+ }
+ }
+ },
+ legend: {
+ show: false
+ }
+ });
+
+ // GRAPH 8
+ $.plot($("#graph8"), data,
+ {
+ series: {
+ pie: {
+ show: true,
+ radius:300,
+ label: {
+ show: true,
+ formatter: function(label, series){
+ return '<div style="font-size:8pt;text-align:center;padding:2px;color:white;">'+label+'<br/>'+Math.round(series.percent)+'%</div>';
+ },
+ threshold: 0.1
+ }
+ }
+ },
+ legend: {
+ show: false
+ }
+ });
+
+ // GRAPH 9
+ $.plot($("#graph9"), data,
+ {
+ series: {
+ pie: {
+ show: true,
+ radius: 1,
+ tilt: 0.5,
+ label: {
+ show: true,
+ radius: 1,
+ formatter: function(label, series){
+ return '<div style="font-size:8pt;text-align:center;padding:2px;color:white;">'+label+'<br/>'+Math.round(series.percent)+'%</div>';
+ },
+ background: { opacity: 0.8 }
+ },
+ combine: {
+ color: '#999',
+ threshold: 0.1
+ }
+ }
+ },
+ legend: {
+ show: false
+ }
+ });
+
+ // DONUT
+ $.plot($("#donut"), data,
+ {
+ series: {
+ pie: {
+ innerRadius: 0.5,
+ show: true
+ }
+ }
+ });
+
+ // INTERACTIVE
+ $.plot($("#interactive"), data,
+ {
+ series: {
+ pie: {
+ show: true
+ }
+ },
+ grid: {
+ hoverable: true,
+ clickable: true
+ }
+ });
+ $("#interactive").bind("plothover", pieHover);
+ $("#interactive").bind("plotclick", pieClick);
+
+});
+
+function pieHover(event, pos, obj)
+{
+ if (!obj)
+ return;
+ percent = parseFloat(obj.series.percent).toFixed(2);
+ $("#hover").html('<span style="font-weight: bold; color: '+obj.series.color+'">'+obj.series.label+' ('+percent+'%)</span>');
+}
+
+function pieClick(event, pos, obj)
+{
+ if (!obj)
+ return;
+ percent = parseFloat(obj.series.percent).toFixed(2);
+ alert(''+obj.series.label+': '+percent+'%');
+}
+</script>
+ <style type="text/css">
+ * {
+ font-family: sans-serif;
+ }
+
+ body
+ {
+ padding: 0 1em 1em 1em;
+ }
+
+ div.graph
+ {
+ width: 400px;
+ height: 300px;
+ float: left;
+ border: 1px dashed gainsboro;
+ }
+
+ label
+ {
+ display: block;
+ margin-left: 400px;
+ padding-left: 1em;
+ }
+
+ h2
+ {
+ padding-top: 1em;
+ margin-bottom: 0;
+ clear: both;
+ color: #ccc;
+ }
+
+ code
+ {
+ display: block;
+ background-color: #eee;
+ border: 1px dashed #999;
+ padding: 0.5em;
+ margin: 0.5em;
+ color: #666;
+ font-size: 10pt;
+ }
+
+ code b
+ {
+ color: black;
+ }
+
+ ul
+ {
+ font-size: 10pt;
+ }
+
+ ul li
+ {
+ margin-bottom: 0.5em;
+ }
+
+ ul.options li
+ {
+ list-style: none;
+ margin-bottom: 1em;
+ }
+
+ ul li i
+ {
+ color: #999;
+ }
+ </style>
+ </head>
+ <body>
+ <h1>Flot Pie Examples</h1>
+
+ <h2>Default with Legend</h2>
+ <div id="default" class="graph"></div>
+ <label for="default">
+ Default pie graph with no options set.
+ <code>
+$.plot($("#default"), data,<br/>
+{<br/>
+ series: {<br/>
+ pie: { <br/>
+ show: true<br/>
+ }<br/>
+ }<br/>
+});<br/>
+ </code>
+ </label>
+
+ <h2>Default without Legend</h2>
+ <div id="graph1" class="graph"></div>
+ <label for="graph1">
+ Default pie graph when legend is disabled. Since the labels would normally be outside the container, the graph is resized to fit.
+ <code>
+$.plot($("#graph1"), data, <br/>
+{<br/>
+ series: {<br/>
+ pie: { <br/>
+ show: true<br/>
+ }<br/>
+ },<br/>
+ <b>legend: {<br/>
+ show: false<br/>
+ }</b><br/>
+});<br/>
+ </code>
+ </label>
+
+ <h2>Graph2</h2>
+ <div id="graph2" class="graph"></div>
+ <label for="graph2">
+ Added a semi-transparent background to the labels and a custom labelFormatter function.
+ <code>
+$.plot($("#graph2"), data, <br/>
+{<br/>
+ series: {<br/>
+ pie: { <br/>
+ show: true,<br/>
+ radius: 1,<br/>
+ <b>label: {<br/>
+ show: true,<br/>
+ radius: 1,<br/>
+ formatter: function(label, series){<br/>
+ return '<div style="font-size:8pt;text-align:center;padding:2px;color:white;">'+label+'<br/>'+Math.round(series.percent)+'%</div>';<br/>
+ },<br/>
+ background: { opacity: 0.8 }<br/>
+ }</b><br/>
+ }<br/>
+ },<br/>
+ legend: {<br/>
+ show: false<br/>
+ }<br/>
+});<br/>
+ </code>
+ </label>
+
+ <h2>Graph3</h2>
+ <div id="graph3" class="graph"></div>
+ <label for="graph3">
+ Slightly more transparent label backgrounds and adjusted the radius values to place them within the pie.
+ <code>
+$.plot($("#graph3"), data, <br/>
+{<br/>
+ series: {<br/>
+ pie: { <br/>
+ show: true,<br/>
+ radius: 1,<br/>
+ label: {<br/>
+ show: true,<br/>
+ <b>radius: 3/4,</b><br/>
+ formatter: function(label, series){<br/>
+ return '<div style="font-size:8pt;text-align:center;padding:2px;color:white;">'+label+'<br/>'+Math.round(series.percent)+'%</div>';<br/>
+ },<br/>
+ <b>background: { opacity: 0.5 }</b><br/>
+ }<br/>
+ }<br/>
+ },<br/>
+ legend: {<br/>
+ show: false<br/>
+ }<br/>
+});<br/>
+ </code>
+ </label>
+
+ <h2>Graph4</h2>
+ <div id="graph4" class="graph"></div>
+ <label for="graph4">
+ Semi-transparent, black-colored label background.
+ <code>
+$.plot($("#graph4"), data, <br/>
+{<br/>
+ series: {<br/>
+ pie: { <br/>
+ show: true,<br/>
+ radius: 1,<br/>
+ label: {<br/>
+ show: true,<br/>
+ radius: 3/4,<br/>
+ formatter: function(label, series){<br/>
+ return '<div style="font-size:8pt;text-align:center;padding:2px;color:white;">'+label+'<br/>'+Math.round(series.percent)+'%</div>';<br/>
+ },<br/>
+ background: { <br/>
+ opacity: 0.5,<br/>
+ <b>color: '#000'</b><br/>
+ }<br/>
+ }<br/>
+ },<br/>
+ legend: {<br/>
+ show: false<br/>
+ }<br/>
+});<br/>
+ </code>
+ </label>
+
+ <h2>Graph5</h2>
+ <div id="graph5" class="graph"></div>
+ <label for="graph5">
+ Semi-transparent, black-colored label background placed at pie edge.
+ <code>
+$.plot($("#graph5"), data, <br/>
+{<br/>
+ series: {<br/>
+ pie: { <br/>
+ show: true,<br/>
+ <b>radius: 3/4,</b><br/>
+ label: {<br/>
+ show: true,<br/>
+ radius: 3/4,<br/>
+ formatter: function(label, series){<br/>
+ return '<div style="font-size:8pt;text-align:center;padding:2px;color:white;">'+label+'<br/>'+Math.round(series.percent)+'%</div>';<br/>
+ },<br/>
+ background: { <br/>
+ opacity: 0.5,<br/>
+ color: '#000'<br/>
+ }<br/>
+ }<br/>
+ },<br/>
+ legend: {<br/>
+ show: false<br/>
+ }<br/>
+});<br/>
+ </code>
+ </label>
+
+ <h2>Graph6</h2>
+ <div id="graph6" class="graph"></div>
+ <label for="graph6">
+ Labels can be hidden if the slice is less than a given percentage of the pie (10% in this case).
+ <br><span style="color: red">Note: you may need to refresh the page to see this effect.</span>
+ <code>
+$.plot($("#graph6"), data, <br/>
+{<br/>
+ series: {<br/>
+ pie: { <br/>
+ show: true,<br/>
+ <b>radius: 1,</b><br/>
+ label: {<br/>
+ show: true,<br/>
+ <b>radius: 2/3,</b><br/>
+ formatter: function(label, series){<br/>
+ return '<div style="font-size:8pt;text-align:center;padding:2px;color:white;">'+label+'<br/>'+Math.round(series.percent)+'%</div>';<br/>
+ },<br/>
+ <b>threshold: 0.1</b><br/>
+ }<br/>
+ }<br/>
+ },<br/>
+ legend: {<br/>
+ show: false<br/>
+ }<br/>
+});<br/>
+ </code>
+ </label>
+
+ <h2>Graph7</h2>
+ <div id="graph7" class="graph"></div>
+ <label for="graph7">
+ All slices less than a given percentage of the pie can be combined into a single, larger slice (10% in this case).
+ <br><span style="color: red">Note: you may need to refresh the page to see this effect.</span>
+ <code>
+$.plot($("#graph7"), data, <br/>
+{<br/>
+ series: {<br/>
+ pie: { <br/>
+ show: true,<br/>
+ <b>combine: {<br/>
+ color: '#999',<br/>
+ threshold: 0.1<br/>
+ }</b><br/>
+ }<br/>
+ },<br/>
+ legend: {<br/>
+ show: false<br/>
+ }<br/>
+});<br/>
+ </code>
+ </label>
+
+ <h2>Graph8</h2>
+ <div id="graph8" class="graph"></div>
+ <label for="graph8">
+ The radius can also be set to a specific size (even larger than the container itself).
+ <code>
+$.plot($("#graph8"), data, <br/>
+{<br/>
+ series: {<br/>
+ pie: { <br/>
+ show: true,<br/>
+ <b>radius:300,</b><br/>
+ label: {<br/>
+ show: true,<br/>
+ formatter: function(label, series){<br/>
+ return '<div style="font-size:8pt;text-align:center;padding:2px;color:white;">'+label+'<br/>'+Math.round(series.percent)+'%</div>';<br/>
+ },<br/>
+ threshold: 0.1<br/>
+ }<br/>
+ }<br/>
+ },<br/>
+ legend: {<br/>
+ show: false<br/>
+ }<br/>
+});<br/>
+ </code>
+ </label>
+
+ <h2>Graph9</h2>
+ <div id="graph9" class="graph" style="height: 250px;"></div>
+ <label for="graph9">
+ The pie can be tilted at an angle.
+ <code>
+$.plot($("#graph9"), data, <br/>
+{<br/>
+ series: {<br/>
+ pie: { <br/>
+ show: true,<br/>
+ radius: 1,<br/>
+ <b>tilt: 0.5,</b><br/>
+ label: {<br/>
+ show: true,<br/>
+ radius: 1,<br/>
+ formatter: function(label, series){<br/>
+ return '<div style="font-size:8pt;text-align:center;padding:2px;color:white;">'+label+'<br/>'+Math.round(series.percent)+'%</div>';<br/>
+ },<br/>
+ background: { opacity: 0.8 }<br/>
+ },<br/>
+ combine: {<br/>
+ color: '#999',<br/>
+ threshold: 0.1<br/>
+ }<br/>
+ }<br/>
+ },<br/>
+ legend: {<br/>
+ show: false<br/>
+ }<br/>
+});<br/>
+ </code>
+ </label>
+
+ <h2>Donut</h2>
+ <div id="donut" class="graph"></div>
+ <label for="donut">
+ A donut hole can be added.
+ <code>
+$.plot($("#donut"), data,<br/>
+{<br/>
+ series: {<br/>
+ pie: { <br/>
+ <b>innerRadius: 0.5,</b><br/>
+ show: true<br/>
+ }<br/>
+ }<br/>
+});<br/>
+ </code>
+ </label>
+
+ <h2>Interactive</h2>
+ <div id="interactive" class="graph"></div>
+ <label for="interactive">
+ The pie can be made interactive with hover and click events.
+ <code>
+$.plot($("#interactive"), data,<br/>
+{<br/>
+ series: {<br/>
+ pie: { <br/>
+ show: true<br/>
+ }<br/>
+ },<br/>
+ <b>grid: {<br/>
+ hoverable: true,<br/>
+ clickable: true<br/>
+ }</b><br/>
+});<br/>
+<b>$("#interactive").bind("plothover", pieHover);<br/>
+$("#interactive").bind("plotclick", pieClick);</b><br/>
+ </code>
+ <div id="hover"></div>
+ </label>
+
+ <h2>Pie Options</h2>
+ <ul class="options">
+ <li style="border-bottom: 1px dotted #ccc;"><b>option:</b> <i>default value</i> - Description of option</li>
+ <li><b>show:</b> <i>false</i> - Enable the plugin and draw as a pie.</li>
+ <li><b>radius:</b> <i>'auto'</i> - Sets the radius of the pie. If value is between 0 and 1 (inclusive) then it will use that as a percentage of the available space (size of the container), otherwise it will use the value as a direct pixel length. If set to 'auto', it will be set to 1 if the legend is enabled and 3/4 if not.</li>
+ <li><b>innerRadius:</b> <i>0</i> - Sets the radius of the donut hole. If value is between 0 and 1 (inclusive) then it will use that as a percentage of the radius, otherwise it will use the value as a direct pixel length.</li>
+ <li><b>startAngle:</b> <i>3/2</i> - Factor of PI used for the starting angle (in radians) It can range between 0 and 2 (where 0 and 2 have the same result).</li>
+ <li><b>tilt:</b> <i>1</i> - Percentage of tilt ranging from 0 and 1, where 1 has no change (fully vertical) and 0 is completely flat (fully horizontal -- in which case nothing actually gets drawn).</li>
+ <li><b>offset:</b> <ul>
+ <li><b>top:</b> <i>0</i> - Pixel distance to move the pie up and down (relative to the center).</li>
+ <li><b>left:</b> <i>'auto'</i> - Pixel distance to move the pie left and right (relative to the center).</li>
+ </ul>
+ <li><b>stroke:</b> <ul>
+ <li><b>color:</b> <i>'#FFF'</i> - Color of the border of each slice. Hexadecimal color definitions are prefered (other formats may or may not work).</li>
+ <li><b>width:</b> <i>1</i> - Pixel width of the border of each slice.</li>
+ </ul>
+ <li><b>label:</b> <ul>
+ <li><b>show:</b> <i>'auto'</i> - Enable/Disable the labels. This can be set to true, false, or 'auto'. When set to 'auto', it will be set to false if the legend is enabled and true if not.</li>
+ <li><b>radius:</b> <i>1</i> - Sets the radius at which to place the labels. If value is between 0 and 1 (inclusive) then it will use that as a percentage of the available space (size of the container), otherwise it will use the value as a direct pixel length.</li>
+ <li><b>threshold:</b> <i>0</i> - Hides the labels of any pie slice that is smaller than the specified percentage (ranging from 0 to 1) i.e. a value of '0.03' will hide all slices 3% or less of the total.</li>
+ <li><b>formatter:</b> <i>[function]</i> - This function specifies how the positioned labels should be formatted, and is applied after the legend's labelFormatter function. The labels can also still be styled using the class "pieLabel" (i.e. ".pieLabel" or "#graph1 .pieLabel").</li>
+ <li><b>radius:</b> <i>1</i> - Sets the radius at which to place the labels. If value is between 0 and 1 (inclusive) then it will use that as a percentage of the available space (size of the container), otherwise it will use the value as a direct pixel length.</li>
+ <li><b>background:</b> <ul>
+ <li><b>color:</b> <i>null</i> - Backgound color of the positioned labels. If null, the plugin will automatically use the color of the slice.</li>
+ <li><b>opacity:</b> <i>0</i> - Opacity of the background for the positioned labels. Acceptable values range from 0 to 1, where 0 is completely transparent and 1 is completely opaque.</li>
+ </ul>
+ </ul>
+ <li><b>combine:</b> <ul>
+ <li><b>threshold:</b> <i>0</i> - Combines all slices that are smaller than the specified percentage (ranging from 0 to 1) i.e. a value of '0.03' will combine all slices 3% or less into one slice).</li>
+ <li><b>color:</b> <i>null</i> - Backgound color of the positioned labels. If null, the plugin will automatically use the color of the first slice to be combined.</li>
+ <li><b>label:</b> <i>'Other'</i> - Label text for the combined slice.</li>
+ </ul>
+ <li><b>highlight:</b> <ul>
+ <li><b>opacity:</b> <i>0.5</i> - Opacity of the highlight overlay on top of the current pie slice. Currently this just uses a white overlay, but support for changing the color of the overlay will also be added at a later date.
+ </ul>
+ </ul>
+
+ <h2>Changes/Features</h2>
+ <ul>
+ <li style="list-style: none;"><i>v1.0 - November 20th, 2009 - Brian Medendorp</i></li>
+ <li>The pie plug-in is now part of the Flot repository! This should make it a lot easier to deal with.</li>
+ <li>Added a new option (innerRadius) to add a "donut hole" to the center of the pie, based on comtributions from Anthony Aragues. I was a little reluctant to add this feature because it doesn't work very well with the shadow created for the tilted pie, but figured it was worthwhile for non-tilted pies. Also, excanvas apparently doesn't support compositing, so it will fall back to using the stroke color to fill in the center (but I recommend setting the stroke color to the background color anyway).</li>
+ <li>Changed the lineJoin for the border of the pie slices to use the 'round' option. This should make the center of the pie look better, particularly when there are numerous thin slices.</li>
+ <li>Included a bug fix submitted by btburnett3 to display a slightly smaller slice in the event that the slice is 100% and being rendered with Internet Explorer. I haven't experienced this bug myself, but it doesn't seem to hurt anything so I've included it.</li>
+ <li>The tilt value is now used when calculating the maximum radius of the pie in relation to the height of the container. This should prevent the pie from being smaller than it needed to in some cases, as well as reducing the amount of extra white space generated above and below the pie.</li>
+ <li><b>Hover and Click functionality are now availabe!</b><ul>
+ <li>Thanks to btburnett3 for the original hover functionality and Anthony Aragues for the modification that makes it compatable with excanvas, this was a huge help!</li>
+ <li>Added a new option (highlight opacity) to modify the highlight created when mousing over a slice. Currently this just uses a white overlay, but an option to change the hightlight color will be added when the appropriate functionality becomes available.
+ <li>I had a major setback that required me to practically rebuild the hover/click events from scratch one piece at a time (I discovered that it only worked with a single pie on a page at a time), but the end result ended up being virtually identical to the original, so I'm not quite sure what exactly made it work.</li>
+ <li><span style="color: red;">Warning:</span> There are some minor issues with using this functionality in conjuction with some of the other more advanced features (tilt and donut). When using a donut hole, the inner portion still triggers the events even though that portion of the pie is no longer visible. When tilted, the interactive portions still use the original, untilted version of the pie when determining mouse position (this is because the isPointInPath function apparently doesn't work with transformations), however hover and click both work this way, so the appropriate slice is still highlighted when clicking, and it isn't as noticable of a problem.</li>
+ </ul></li>
+ <li>Included a bug fix submitted by Xavi Ivars to fix array issues when other javascript libraries are included in addition to jQuery</li>
+ <br/>
+ <li style="list-style: none;"><i>v0.4 - July 1st, 2009 - Brian Medendorp</i></li>
+ <li>Each series will now be shown in the legend, even if it's value is zero. The series will not get a positioned label because it will overlap with the other labels present and often makes them unreadable.</li>
+ <li>Data can now be passed in using the standard Flot method using an array of datapoints, the pie plugin will simply use the first y-value that it finds for each series in this case. The plugin uses this datastructure internally, but you can still use the old method of passing in a single numerical value for each series (the plugin will convert it as necessary). This should make it easier to transition from other types of graphs (such as a stacked bar graph) to a pie.</li>
+ <li>The pie can now be tilted at an angle with a new "tilt" option. Acceptable values range from 0-1, where 1 has no change (fully vertical) and 0 is completely flat (fully horizontal -- in which case nothing actually gets drawn). If the plugin determines that it will fit within the canvas, a drop shadow will be drawn under the tilted pie (this also requires a tilt value of 0.8 or less).</li>
+ <br/>
+ <li style="list-style: none;"><i>v0.3.2 - June 25th, 2009 - Brian Medendorp</i></li>
+ <li>Fixed a bug that was causing the pie to be shifted too far left or right when the legend is showing in some cases.</li>
+ <br/>
+ <li style="list-style: none;"><i>v0.3.1 - June 24th, 2009 - Brian Medendorp</i></li>
+ <li>Fixed a bug that was causing nothing to be drawn and generating a javascript error if any of the data values were set to zero.</li>
+ <br/>
+ <li style="list-style: none;"><i>v0.3 - June 23rd, 2009 - Brian Medendorp</i></li>
+ <li>The legend now works without any modifications! Because of changes made to flot and the plugin system (thanks Ole Laursen!) I was able to simplify a number of things and am now able to use the legend without the direct access hack that was required in the previous version.</li>
+ <br/>
+ <li style="list-style: none;"><i>v0.2 - June 22nd, 2009 - Brian Medendorp</i></li>
+ <li>The legend now works but only if you make the necessary changes to jquery.flot.js. Because of this, I changed the default values for pie.radius and pie.label.show to new 'auto' settings that change the default behavior of the size and labels depending on whether the legend functionality is available or not.</li>
+ <br/>
+ <li style="list-style: none;"><i>v0.1 - June 18th, 2009 - Brian Medendorp</i></li>
+ <li>Rewrote the entire pie code into a flot plugin (since that is now an option), so it should be much easier to use and the code is cleaned up a bit. However, the (standard flot) legend is no longer available because the only way to prevent the grid lines from being displayed also prevents the legend from being displayed. Hopefully this can be fixed at a later date.</li>
+ <li>Restructured and combined some of the options. It should be much easier to deal with now.</li>
+ <li>Added the ability to change the starting point of the pie (still defaults to the top).</li>
+ <li>Modified the default options to show the labels to compensate for the lack of a legend.</li>
+ <li>Modified this page to use a random dataset. <span style="color: red">Note: you may need to refresh the page to see the effects of some of the examples.</span></li>
+ <br/>
+ <li style="list-style: none;"><i>May 21st, 2009 - Brian Medendorp</i></li>
+ <li>Merged original pie modifications by Sergey Nosenko into the latest SVN version <i>(as of May 15th, 2009)</i> so that it will work with ie8.</li>
+ <li>Pie graph will now be centered in the canvas unless moved because of the legend or manually via the options. Additionally it prevents the pie from being moved beyond the edge of the canvas.</li>
+ <li>Modified the code related to the labelFormatter option to apply flot's legend labelFormatter first. This is so that the labels will be consistent, but still provide extra formatting for the positioned labels (such as adding the percentage value).</li>
+ <li>Positioned labels now have their backgrounds applied as a seperate element (much like the legend background) so that the opacity value can be set independently from the label itself (foreground). Additionally, the background color defaults to that of the matching slice.</li>
+ <li>As long as the labelOffset and radiusLimit are not set to hard values, the pie will be shrunk if the labels will extend outside the edge of the canvas</li>
+ <li>Added new options "radiusLimitFactor" and "radiusLimit" which limits how large the (visual) radius of the pie is in relation to the full radius (as calculated from the canvas dimensions) or a hard-pixel value (respectively). This allows for pushing the labels "outside" the pie.</li>
+ <li>Added a new option "labelHidePercent" that does not show the positioned labels of slices smaller than the specified percentage. This is to help prevent a bunch of overlapping labels from small slices.</li>
+ <li>Added a new option "sliceCombinePercent" that combines all slices smaller than the specified percentage into one larger slice. This is to help make the pie more attractive when there are a number of tiny slices. The options "sliceCombineColor" and "sliceCombineLabel" have also been added to change the color and name of the new slice if desired.</li>
+ <li>Tested in Firefox (3.0.10, 3.5b4), Internet Explorer (6.0.2900, 7.0.5730, 8.0.6001), Chrome (1.0.154), Opera (9.64), and Safari (3.1.1, 4 beta 5528.16).
+ </ul>
+
+
+ </body>
+</html>
+
diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/realtime.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/realtime.html new file mode 100644 index 0000000..3b427e1 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/realtime.html @@ -0,0 +1,83 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px;"></div> + + <p>You can update a chart periodically to get a real-time effect + by using a timer to insert the new data in the plot and redraw it.</p> + + <p>Time between updates: <input id="updateInterval" type="text" value="" style="text-align: right; width:5em"> milliseconds</p> + +<script type="text/javascript"> +$(function () { + // we use an inline data source in the example, usually data would + // be fetched from a server + var data = [], totalPoints = 300; + function getRandomData() { + if (data.length > 0) + data = data.slice(1); + + // do a random walk + while (data.length < totalPoints) { + var prev = data.length > 0 ? data[data.length - 1] : 50; + var y = prev + Math.random() * 10 - 5; + if (y < 0) + y = 0; + if (y > 100) + y = 100; + data.push(y); + } + + // zip the generated y values with the x values + var res = []; + for (var i = 0; i < data.length; ++i) + res.push([i, data[i]]) + return res; + } + + // setup control widget + var updateInterval = 30; + $("#updateInterval").val(updateInterval).change(function () { + var v = $(this).val(); + if (v && !isNaN(+v)) { + updateInterval = +v; + if (updateInterval < 1) + updateInterval = 1; + if (updateInterval > 2000) + updateInterval = 2000; + $(this).val("" + updateInterval); + } + }); + + // setup plot + var options = { + series: { shadowSize: 0 }, // drawing is faster without shadows + yaxis: { min: 0, max: 100 }, + xaxis: { show: false } + }; + var plot = $.plot($("#placeholder"), [ getRandomData() ], options); + + function update() { + plot.setData([ getRandomData() ]); + // since the axes don't change, we don't need to call plot.setupGrid() + plot.draw(); + + setTimeout(update, updateInterval); + } + + update(); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/resize.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/resize.html new file mode 100644 index 0000000..d1e18c3 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/resize.html @@ -0,0 +1,61 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.resize.js"></script> + <style type="text/css"> + html, body { + height: 100%; /* make the percentage height on placeholder work */ + } + .message { + padding-left: 50px; + font-size: smaller; + } + </style> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:80%;height:40%;"></div> + + <p class="message"></p> + + <p>Sometimes it makes more sense to just let the plot take up the + available space. In that case, we need to redraw the plot each + time the placeholder changes its size. If you include the resize + plugin, this is handled automatically.</p> + + <p>Try resizing the window.</p> + + +<script type="text/javascript"> +$(function () { + var d1 = []; + for (var i = 0; i < 14; i += 0.5) + d1.push([i, Math.sin(i)]); + + var d2 = [[0, 3], [4, 8], [8, 5], [9, 13]]; + var d3 = [[0, 12], [7, 12], null, [7, 2.5], [12, 2.5]]; + + var placeholder = $("#placeholder"); + + var plot = $.plot(placeholder, [d1, d2, d3]); + + // the plugin includes a jQuery plugin for adding resize events to + // any element, let's just add a callback so we can display the + // placeholder size + placeholder.resize(function () { + $(".message").text("Placeholder is now " + + $(this).width() + "x" + $(this).height() + + " pixels"); + }); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/selection.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/selection.html new file mode 100644 index 0000000..1646f5a --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/selection.html @@ -0,0 +1,114 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.selection.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px"></div> + + <p>1000 kg. CO<sub>2</sub> emissions per year per capita for various countries (source: <a href="http://en.wikipedia.org/wiki/List_of_countries_by_carbon_dioxide_emissions_per_capita">Wikipedia</a>).</p> + + <p>Flot supports selections through the selection plugin. + You can enable rectangular selection + or one-dimensional selection if the user should only be able to + select on one axis. Try left-click and drag on the plot above + where selection on the x axis is enabled.</p> + + <p>You selected: <span id="selection"></span></p> + + <p>The plot command returns a plot object you can use to control + the selection. Click the buttons below.</p> + + <p><input id="clearSelection" type="button" value="Clear selection" /> + <input id="setSelection" type="button" value="Select year 1994" /></p> + + <p>Selections are really useful for zooming. Just replot the + chart with min and max values for the axes set to the values + in the "plotselected" event triggered. Enable the checkbox + below and select a region again.</p> + + <p><label><input id="zoom" type="checkbox" />Zoom to selection.</label></p> + +<script type="text/javascript"> +$(function () { + var data = [ + { + label: "United States", + data: [[1990, 18.9], [1991, 18.7], [1992, 18.4], [1993, 19.3], [1994, 19.5], [1995, 19.3], [1996, 19.4], [1997, 20.2], [1998, 19.8], [1999, 19.9], [2000, 20.4], [2001, 20.1], [2002, 20.0], [2003, 19.8], [2004, 20.4]] + }, + { + label: "Russia", + data: [[1992, 13.4], [1993, 12.2], [1994, 10.6], [1995, 10.2], [1996, 10.1], [1997, 9.7], [1998, 9.5], [1999, 9.7], [2000, 9.9], [2001, 9.9], [2002, 9.9], [2003, 10.3], [2004, 10.5]] + }, + { + label: "United Kingdom", + data: [[1990, 10.0], [1991, 11.3], [1992, 9.9], [1993, 9.6], [1994, 9.5], [1995, 9.5], [1996, 9.9], [1997, 9.3], [1998, 9.2], [1999, 9.2], [2000, 9.5], [2001, 9.6], [2002, 9.3], [2003, 9.4], [2004, 9.79]] + }, + { + label: "Germany", + data: [[1990, 12.4], [1991, 11.2], [1992, 10.8], [1993, 10.5], [1994, 10.4], [1995, 10.2], [1996, 10.5], [1997, 10.2], [1998, 10.1], [1999, 9.6], [2000, 9.7], [2001, 10.0], [2002, 9.7], [2003, 9.8], [2004, 9.79]] + }, + { + label: "Denmark", + data: [[1990, 9.7], [1991, 12.1], [1992, 10.3], [1993, 11.3], [1994, 11.7], [1995, 10.6], [1996, 12.8], [1997, 10.8], [1998, 10.3], [1999, 9.4], [2000, 8.7], [2001, 9.0], [2002, 8.9], [2003, 10.1], [2004, 9.80]] + }, + { + label: "Sweden", + data: [[1990, 5.8], [1991, 6.0], [1992, 5.9], [1993, 5.5], [1994, 5.7], [1995, 5.3], [1996, 6.1], [1997, 5.4], [1998, 5.4], [1999, 5.1], [2000, 5.2], [2001, 5.4], [2002, 6.2], [2003, 5.9], [2004, 5.89]] + }, + { + label: "Norway", + data: [[1990, 8.3], [1991, 8.3], [1992, 7.8], [1993, 8.3], [1994, 8.4], [1995, 5.9], [1996, 6.4], [1997, 6.7], [1998, 6.9], [1999, 7.6], [2000, 7.4], [2001, 8.1], [2002, 12.5], [2003, 9.9], [2004, 19.0]] + } + ]; + + var options = { + series: { + lines: { show: true }, + points: { show: true } + }, + legend: { noColumns: 2 }, + xaxis: { tickDecimals: 0 }, + yaxis: { min: 0 }, + selection: { mode: "x" } + }; + + var placeholder = $("#placeholder"); + + placeholder.bind("plotselected", function (event, ranges) { + $("#selection").text(ranges.xaxis.from.toFixed(1) + " to " + ranges.xaxis.to.toFixed(1)); + + var zoom = $("#zoom").attr("checked"); + if (zoom) + plot = $.plot(placeholder, data, + $.extend(true, {}, options, { + xaxis: { min: ranges.xaxis.from, max: ranges.xaxis.to } + })); + }); + + placeholder.bind("plotunselected", function (event) { + $("#selection").text(""); + }); + + var plot = $.plot(placeholder, data, options); + + $("#clearSelection").click(function () { + plot.clearSelection(); + }); + + $("#setSelection").click(function () { + plot.setSelection({ xaxis: { from: 1994, to: 1995 } }); + }); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/setting-options.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/setting-options.html new file mode 100644 index 0000000..8d1967e --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/setting-options.html @@ -0,0 +1,61 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px"></div> + + <p>There are plenty of options you can set to control the precise + looks of your plot. You can control the ticks on the axes, the + legend, the graph type, etc. The idea is that Flot goes to great + lengths to provide sensible defaults so that you don't have to + customize much for a good result.</p> + +<script type="text/javascript"> +$(function () { + var d1 = []; + for (var i = 0; i < Math.PI * 2; i += 0.25) + d1.push([i, Math.sin(i)]); + + var d2 = []; + for (var i = 0; i < Math.PI * 2; i += 0.25) + d2.push([i, Math.cos(i)]); + + var d3 = []; + for (var i = 0; i < Math.PI * 2; i += 0.1) + d3.push([i, Math.tan(i)]); + + $.plot($("#placeholder"), [ + { label: "sin(x)", data: d1}, + { label: "cos(x)", data: d2}, + { label: "tan(x)", data: d3} + ], { + series: { + lines: { show: true }, + points: { show: true } + }, + xaxis: { + ticks: [0, [Math.PI/2, "\u03c0/2"], [Math.PI, "\u03c0"], [Math.PI * 3/2, "3\u03c0/2"], [Math.PI * 2, "2\u03c0"]] + }, + yaxis: { + ticks: 10, + min: -2, + max: 2 + }, + grid: { + backgroundColor: { colors: ["#fff", "#eee"] } + } + }); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/stacking.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/stacking.html new file mode 100644 index 0000000..b7de391 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/stacking.html @@ -0,0 +1,77 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.stack.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px;"></div> + + <p>With the stack plugin, you can have Flot stack the + series. This is useful if you wish to display both a total and the + constituents it is made of. The only requirement is that you provide + the input sorted on x.</p> + + <p class="stackControls"> + <input type="button" value="With stacking"> + <input type="button" value="Without stacking"> + </p> + + <p class="graphControls"> + <input type="button" value="Bars"> + <input type="button" value="Lines"> + <input type="button" value="Lines with steps"> + </p> + +<script id="source"> +$(function () { + var d1 = []; + for (var i = 0; i <= 10; i += 1) + d1.push([i, parseInt(Math.random() * 30)]); + + var d2 = []; + for (var i = 0; i <= 10; i += 1) + d2.push([i, parseInt(Math.random() * 30)]); + + var d3 = []; + for (var i = 0; i <= 10; i += 1) + d3.push([i, parseInt(Math.random() * 30)]); + + var stack = 0, bars = true, lines = false, steps = false; + + function plotWithOptions() { + $.plot($("#placeholder"), [ d1, d2, d3 ], { + series: { + stack: stack, + lines: { show: lines, fill: true, steps: steps }, + bars: { show: bars, barWidth: 0.6 } + } + }); + } + + plotWithOptions(); + + $(".stackControls input").click(function (e) { + e.preventDefault(); + stack = $(this).val() == "With stacking" ? true : null; + plotWithOptions(); + }); + $(".graphControls input").click(function (e) { + e.preventDefault(); + bars = $(this).val().indexOf("Bars") != -1; + lines = $(this).val().indexOf("Lines") != -1; + steps = $(this).val().indexOf("steps") != -1; + plotWithOptions(); + }); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/symbols.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/symbols.html new file mode 100644 index 0000000..e71b1aa --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/symbols.html @@ -0,0 +1,49 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.symbol.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px"></div> + + <p>Various point types. Circles are built-in. For other + point types, you can define a little callback function to draw the + symbol; some common ones are available in the symbol plugin.</p> + +<script type="text/javascript"> +$(function () { + function generate(offset, amplitude) { + var res = []; + var start = 0, end = 10; + for (var i = 0; i <= 50; ++i) { + var x = start + i / 50 * (end - start); + res.push([x, amplitude * Math.sin(x + offset)]); + } + return res; + } + + var data = [ + { data: generate(2, 1.8), points: { symbol: "circle" } }, + { data: generate(3, 1.5), points: { symbol: "square" } }, + { data: generate(4, 0.9), points: { symbol: "diamond" } }, + { data: generate(6, 1.4), points: { symbol: "triangle" } }, + { data: generate(7, 1.1), points: { symbol: "cross" } } + ]; + + $.plot($("#placeholder"), data, { + series: { points: { show: true, radius: 3 } }, + grid: { hoverable: true } + }); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/thresholding.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/thresholding.html new file mode 100644 index 0000000..f10144a --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/thresholding.html @@ -0,0 +1,54 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.threshold.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px;"></div> + + <p>With the threshold plugin, you can apply a specific color to + the part of a data series below a threshold. This is can be useful + for highlighting negative values, e.g. when displaying net results + or what's in stock.</p> + + <p class="controls"> + <input type="button" value="Threshold at 5"> + <input type="button" value="Threshold at 0"> + <input type="button" value="Threshold at -2.5"> + </p> + +<script type="text/javascript"> +$(function () { + var d1 = []; + for (var i = 0; i <= 60; i += 1) + d1.push([i, parseInt(Math.random() * 30 - 10)]); + + function plotWithOptions(t) { + $.plot($("#placeholder"), [ { + data: d1, + color: "rgb(30, 180, 20)", + threshold: { below: t, color: "rgb(200, 20, 30)" }, + lines: { steps: true } + } ]); + } + + plotWithOptions(0); + + $(".controls input").click(function (e) { + e.preventDefault(); + var t = parseFloat($(this).val().replace('Threshold at ', '')); + plotWithOptions(t); + }); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/time.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/time.html new file mode 100644 index 0000000..da62347 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/time.html @@ -0,0 +1,71 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px;"></div> + + <p>Monthly mean atmospheric CO<sub>2</sub> in PPM at Mauna Loa, Hawaii (source: <a href="http://www.esrl.noaa.gov/gmd/ccgg/trends/">NOAA/ESRL</a>).</p> + + <p>If you tell Flot that an axis represents time, the data will + be interpreted as timestamps and the ticks adjusted and + formatted accordingly.</p> + + <p>Zoom to: <button id="whole">Whole period</button> + <button id="nineties">1990-2000</button> + <button id="ninetynine">1999</button></p> + + <p>The timestamps must be specified as Javascript timestamps, as + milliseconds since January 1, 1970 00:00. This is like Unix + timestamps, but in milliseconds instead of seconds (remember to + multiply with 1000!).</p> + + <p>As an extra caveat, the timestamps are interpreted according to + UTC to avoid having the graph shift with each visitor's local + time zone. So you might have to add your local time zone offset + to the timestamps or simply pretend that the data was produced + in UTC instead of your local time zone.</p> + +<script id="source"> +$(function () { + var d = [[-373597200000, 315.71], [-370918800000, 317.45], [-368326800000, 317.50], [-363056400000, 315.86], [-360378000000, 314.93], [-357699600000, 313.19], [-352429200000, 313.34], [-349837200000, 314.67], [-347158800000, 315.58], [-344480400000, 316.47], [-342061200000, 316.65], [-339382800000, 317.71], [-336790800000, 318.29], [-334112400000, 318.16], [-331520400000, 316.55], [-328842000000, 314.80], [-326163600000, 313.84], [-323571600000, 313.34], [-320893200000, 314.81], [-318301200000, 315.59], [-315622800000, 316.43], [-312944400000, 316.97], [-310438800000, 317.58], [-307760400000, 319.03], [-305168400000, 320.03], [-302490000000, 319.59], [-299898000000, 318.18], [-297219600000, 315.91], [-294541200000, 314.16], [-291949200000, 313.83], [-289270800000, 315.00], [-286678800000, 316.19], [-284000400000, 316.89], [-281322000000, 317.70], [-278902800000, 318.54], [-276224400000, 319.48], [-273632400000, 320.58], [-270954000000, 319.78], [-268362000000, 318.58], [-265683600000, 316.79], [-263005200000, 314.99], [-260413200000, 315.31], [-257734800000, 316.10], [-255142800000, 317.01], [-252464400000, 317.94], [-249786000000, 318.56], [-247366800000, 319.69], [-244688400000, 320.58], [-242096400000, 321.01], [-239418000000, 320.61], [-236826000000, 319.61], [-234147600000, 317.40], [-231469200000, 316.26], [-228877200000, 315.42], [-226198800000, 316.69], [-223606800000, 317.69], [-220928400000, 318.74], [-218250000000, 319.08], [-215830800000, 319.86], [-213152400000, 321.39], [-210560400000, 322.24], [-207882000000, 321.47], [-205290000000, 319.74], [-202611600000, 317.77], [-199933200000, 316.21], [-197341200000, 315.99], [-194662800000, 317.07], [-192070800000, 318.36], [-189392400000, 319.57], [-178938000000, 322.23], [-176259600000, 321.89], [-173667600000, 320.44], [-170989200000, 318.70], [-168310800000, 316.70], [-165718800000, 316.87], [-163040400000, 317.68], [-160448400000, 318.71], [-157770000000, 319.44], [-155091600000, 320.44], [-152672400000, 320.89], [-149994000000, 322.13], [-147402000000, 322.16], [-144723600000, 321.87], [-142131600000, 321.21], [-139453200000, 318.87], [-136774800000, 317.81], [-134182800000, 317.30], [-131504400000, 318.87], [-128912400000, 319.42], [-126234000000, 320.62], [-123555600000, 321.59], [-121136400000, 322.39], [-118458000000, 323.70], [-115866000000, 324.07], [-113187600000, 323.75], [-110595600000, 322.40], [-107917200000, 320.37], [-105238800000, 318.64], [-102646800000, 318.10], [-99968400000, 319.79], [-97376400000, 321.03], [-94698000000, 322.33], [-92019600000, 322.50], [-89600400000, 323.04], [-86922000000, 324.42], [-84330000000, 325.00], [-81651600000, 324.09], [-79059600000, 322.55], [-76381200000, 320.92], [-73702800000, 319.26], [-71110800000, 319.39], [-68432400000, 320.72], [-65840400000, 321.96], [-63162000000, 322.57], [-60483600000, 323.15], [-57978000000, 323.89], [-55299600000, 325.02], [-52707600000, 325.57], [-50029200000, 325.36], [-47437200000, 324.14], [-44758800000, 322.11], [-42080400000, 320.33], [-39488400000, 320.25], [-36810000000, 321.32], [-34218000000, 322.90], [-31539600000, 324.00], [-28861200000, 324.42], [-26442000000, 325.64], [-23763600000, 326.66], [-21171600000, 327.38], [-18493200000, 326.70], [-15901200000, 325.89], [-13222800000, 323.67], [-10544400000, 322.38], [-7952400000, 321.78], [-5274000000, 322.85], [-2682000000, 324.12], [-3600000, 325.06], [2674800000, 325.98], [5094000000, 326.93], [7772400000, 328.13], [10364400000, 328.07], [13042800000, 327.66], [15634800000, 326.35], [18313200000, 324.69], [20991600000, 323.10], [23583600000, 323.07], [26262000000, 324.01], [28854000000, 325.13], [31532400000, 326.17], [34210800000, 326.68], [36630000000, 327.18], [39308400000, 327.78], [41900400000, 328.92], [44578800000, 328.57], [47170800000, 327.37], [49849200000, 325.43], [52527600000, 323.36], [55119600000, 323.56], [57798000000, 324.80], [60390000000, 326.01], [63068400000, 326.77], [65746800000, 327.63], [68252400000, 327.75], [70930800000, 329.72], [73522800000, 330.07], [76201200000, 329.09], [78793200000, 328.05], [81471600000, 326.32], [84150000000, 324.84], [86742000000, 325.20], [89420400000, 326.50], [92012400000, 327.55], [94690800000, 328.54], [97369200000, 329.56], [99788400000, 330.30], [102466800000, 331.50], [105058800000, 332.48], [107737200000, 332.07], [110329200000, 330.87], [113007600000, 329.31], [115686000000, 327.51], [118278000000, 327.18], [120956400000, 328.16], [123548400000, 328.64], [126226800000, 329.35], [128905200000, 330.71], [131324400000, 331.48], [134002800000, 332.65], [136594800000, 333.16], [139273200000, 332.06], [141865200000, 330.99], [144543600000, 329.17], [147222000000, 327.41], [149814000000, 327.20], [152492400000, 328.33], [155084400000, 329.50], [157762800000, 330.68], [160441200000, 331.41], [162860400000, 331.85], [165538800000, 333.29], [168130800000, 333.91], [170809200000, 333.40], [173401200000, 331.78], [176079600000, 329.88], [178758000000, 328.57], [181350000000, 328.46], [184028400000, 329.26], [189298800000, 331.71], [191977200000, 332.76], [194482800000, 333.48], [197161200000, 334.78], [199753200000, 334.78], [202431600000, 334.17], [205023600000, 332.78], [207702000000, 330.64], [210380400000, 328.95], [212972400000, 328.77], [215650800000, 330.23], [218242800000, 331.69], [220921200000, 332.70], [223599600000, 333.24], [226018800000, 334.96], [228697200000, 336.04], [231289200000, 336.82], [233967600000, 336.13], [236559600000, 334.73], [239238000000, 332.52], [241916400000, 331.19], [244508400000, 331.19], [247186800000, 332.35], [249778800000, 333.47], [252457200000, 335.11], [255135600000, 335.26], [257554800000, 336.60], [260233200000, 337.77], [262825200000, 338.00], [265503600000, 337.99], [268095600000, 336.48], [270774000000, 334.37], [273452400000, 332.27], [276044400000, 332.41], [278722800000, 333.76], [281314800000, 334.83], [283993200000, 336.21], [286671600000, 336.64], [289090800000, 338.12], [291769200000, 339.02], [294361200000, 339.02], [297039600000, 339.20], [299631600000, 337.58], [302310000000, 335.55], [304988400000, 333.89], [307580400000, 334.14], [310258800000, 335.26], [312850800000, 336.71], [315529200000, 337.81], [318207600000, 338.29], [320713200000, 340.04], [323391600000, 340.86], [325980000000, 341.47], [328658400000, 341.26], [331250400000, 339.29], [333928800000, 337.60], [336607200000, 336.12], [339202800000, 336.08], [341881200000, 337.22], [344473200000, 338.34], [347151600000, 339.36], [349830000000, 340.51], [352249200000, 341.57], [354924000000, 342.56], [357516000000, 343.01], [360194400000, 342.47], [362786400000, 340.71], [365464800000, 338.52], [368143200000, 336.96], [370738800000, 337.13], [373417200000, 338.58], [376009200000, 339.89], [378687600000, 340.93], [381366000000, 341.69], [383785200000, 342.69], [389052000000, 344.30], [391730400000, 343.43], [394322400000, 341.88], [397000800000, 339.89], [399679200000, 337.95], [402274800000, 338.10], [404953200000, 339.27], [407545200000, 340.67], [410223600000, 341.42], [412902000000, 342.68], [415321200000, 343.46], [417996000000, 345.10], [420588000000, 345.76], [423266400000, 345.36], [425858400000, 343.91], [428536800000, 342.05], [431215200000, 340.00], [433810800000, 340.12], [436489200000, 341.33], [439081200000, 342.94], [441759600000, 343.87], [444438000000, 344.60], [446943600000, 345.20], [452210400000, 347.36], [454888800000, 346.74], [457480800000, 345.41], [460159200000, 343.01], [462837600000, 341.23], [465433200000, 341.52], [468111600000, 342.86], [470703600000, 344.41], [473382000000, 345.09], [476060400000, 345.89], [478479600000, 347.49], [481154400000, 348.00], [483746400000, 348.75], [486424800000, 348.19], [489016800000, 346.54], [491695200000, 344.63], [494373600000, 343.03], [496969200000, 342.92], [499647600000, 344.24], [502239600000, 345.62], [504918000000, 346.43], [507596400000, 346.94], [510015600000, 347.88], [512690400000, 349.57], [515282400000, 350.35], [517960800000, 349.72], [520552800000, 347.78], [523231200000, 345.86], [525909600000, 344.84], [528505200000, 344.32], [531183600000, 345.67], [533775600000, 346.88], [536454000000, 348.19], [539132400000, 348.55], [541551600000, 349.52], [544226400000, 351.12], [546818400000, 351.84], [549496800000, 351.49], [552088800000, 349.82], [554767200000, 347.63], [557445600000, 346.38], [560041200000, 346.49], [562719600000, 347.75], [565311600000, 349.03], [567990000000, 350.20], [570668400000, 351.61], [573174000000, 352.22], [575848800000, 353.53], [578440800000, 354.14], [581119200000, 353.62], [583711200000, 352.53], [586389600000, 350.41], [589068000000, 348.84], [591663600000, 348.94], [594342000000, 350.04], [596934000000, 351.29], [599612400000, 352.72], [602290800000, 353.10], [604710000000, 353.65], [607384800000, 355.43], [609976800000, 355.70], [612655200000, 355.11], [615247200000, 353.79], [617925600000, 351.42], [620604000000, 349.81], [623199600000, 350.11], [625878000000, 351.26], [628470000000, 352.63], [631148400000, 353.64], [633826800000, 354.72], [636246000000, 355.49], [638920800000, 356.09], [641512800000, 357.08], [644191200000, 356.11], [646783200000, 354.70], [649461600000, 352.68], [652140000000, 351.05], [654735600000, 351.36], [657414000000, 352.81], [660006000000, 354.22], [662684400000, 354.85], [665362800000, 355.66], [667782000000, 357.04], [670456800000, 358.40], [673048800000, 359.00], [675727200000, 357.99], [678319200000, 356.00], [680997600000, 353.78], [683676000000, 352.20], [686271600000, 352.22], [688950000000, 353.70], [691542000000, 354.98], [694220400000, 356.09], [696898800000, 356.85], [699404400000, 357.73], [702079200000, 358.91], [704671200000, 359.45], [707349600000, 359.19], [709941600000, 356.72], [712620000000, 354.79], [715298400000, 352.79], [717894000000, 353.20], [720572400000, 354.15], [723164400000, 355.39], [725842800000, 356.77], [728521200000, 357.17], [730940400000, 358.26], [733615200000, 359.16], [736207200000, 360.07], [738885600000, 359.41], [741477600000, 357.44], [744156000000, 355.30], [746834400000, 353.87], [749430000000, 354.04], [752108400000, 355.27], [754700400000, 356.70], [757378800000, 358.00], [760057200000, 358.81], [762476400000, 359.68], [765151200000, 361.13], [767743200000, 361.48], [770421600000, 360.60], [773013600000, 359.20], [775692000000, 357.23], [778370400000, 355.42], [780966000000, 355.89], [783644400000, 357.41], [786236400000, 358.74], [788914800000, 359.73], [791593200000, 360.61], [794012400000, 361.58], [796687200000, 363.05], [799279200000, 363.62], [801957600000, 363.03], [804549600000, 361.55], [807228000000, 358.94], [809906400000, 357.93], [812502000000, 357.80], [815180400000, 359.22], [817772400000, 360.44], [820450800000, 361.83], [823129200000, 362.95], [825634800000, 363.91], [828309600000, 364.28], [830901600000, 364.94], [833580000000, 364.70], [836172000000, 363.31], [838850400000, 361.15], [841528800000, 359.40], [844120800000, 359.34], [846802800000, 360.62], [849394800000, 361.96], [852073200000, 362.81], [854751600000, 363.87], [857170800000, 364.25], [859845600000, 366.02], [862437600000, 366.46], [865116000000, 365.32], [867708000000, 364.07], [870386400000, 361.95], [873064800000, 360.06], [875656800000, 360.49], [878338800000, 362.19], [880930800000, 364.12], [883609200000, 364.99], [886287600000, 365.82], [888706800000, 366.95], [891381600000, 368.42], [893973600000, 369.33], [896652000000, 368.78], [899244000000, 367.59], [901922400000, 365.84], [904600800000, 363.83], [907192800000, 364.18], [909874800000, 365.34], [912466800000, 366.93], [915145200000, 367.94], [917823600000, 368.82], [920242800000, 369.46], [922917600000, 370.77], [925509600000, 370.66], [928188000000, 370.10], [930780000000, 369.08], [933458400000, 366.66], [936136800000, 364.60], [938728800000, 365.17], [941410800000, 366.51], [944002800000, 367.89], [946681200000, 369.04], [949359600000, 369.35], [951865200000, 370.38], [954540000000, 371.63], [957132000000, 371.32], [959810400000, 371.53], [962402400000, 369.75], [965080800000, 368.23], [967759200000, 366.87], [970351200000, 366.94], [973033200000, 368.27], [975625200000, 369.64], [978303600000, 370.46], [980982000000, 371.44], [983401200000, 372.37], [986076000000, 373.33], [988668000000, 373.77], [991346400000, 373.09], [993938400000, 371.51], [996616800000, 369.55], [999295200000, 368.12], [1001887200000, 368.38], [1004569200000, 369.66], [1007161200000, 371.11], [1009839600000, 372.36], [1012518000000, 373.09], [1014937200000, 373.81], [1017612000000, 374.93], [1020204000000, 375.58], [1022882400000, 375.44], [1025474400000, 373.86], [1028152800000, 371.77], [1030831200000, 370.73], [1033423200000, 370.50], [1036105200000, 372.18], [1038697200000, 373.70], [1041375600000, 374.92], [1044054000000, 375.62], [1046473200000, 376.51], [1049148000000, 377.75], [1051740000000, 378.54], [1054418400000, 378.20], [1057010400000, 376.68], [1059688800000, 374.43], [1062367200000, 373.11], [1064959200000, 373.10], [1067641200000, 374.77], [1070233200000, 375.97], [1072911600000, 377.03], [1075590000000, 377.87], [1078095600000, 378.88], [1080770400000, 380.42], [1083362400000, 380.62], [1086040800000, 379.70], [1088632800000, 377.43], [1091311200000, 376.32], [1093989600000, 374.19], [1096581600000, 374.47], [1099263600000, 376.15], [1101855600000, 377.51], [1104534000000, 378.43], [1107212400000, 379.70], [1109631600000, 380.92], [1112306400000, 382.18], [1114898400000, 382.45], [1117576800000, 382.14], [1120168800000, 380.60], [1122847200000, 378.64], [1125525600000, 376.73], [1128117600000, 376.84], [1130799600000, 378.29], [1133391600000, 380.06], [1136070000000, 381.40], [1138748400000, 382.20], [1141167600000, 382.66], [1143842400000, 384.69], [1146434400000, 384.94], [1149112800000, 384.01], [1151704800000, 382.14], [1154383200000, 380.31], [1157061600000, 378.81], [1159653600000, 379.03], [1162335600000, 380.17], [1164927600000, 381.85], [1167606000000, 382.94], [1170284400000, 383.86], [1172703600000, 384.49], [1175378400000, 386.37], [1177970400000, 386.54], [1180648800000, 385.98], [1183240800000, 384.36], [1185919200000, 381.85], [1188597600000, 380.74], [1191189600000, 381.15], [1193871600000, 382.38], [1196463600000, 383.94], [1199142000000, 385.44]]; + + $.plot($("#placeholder"), [d], { xaxis: { mode: "time" } }); + + $("#whole").click(function () { + $.plot($("#placeholder"), [d], { xaxis: { mode: "time" } }); + }); + + $("#nineties").click(function () { + $.plot($("#placeholder"), [d], { + xaxis: { + mode: "time", + min: (new Date(1990, 1, 1)).getTime(), + max: (new Date(2000, 1, 1)).getTime() + } + }); + }); + + $("#ninetynine").click(function () { + $.plot($("#placeholder"), [d], { + xaxis: { + mode: "time", + minTickSize: [1, "month"], + min: (new Date(1999, 1, 1)).getTime(), + max: (new Date(2000, 1, 1)).getTime() + } + }); + }); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/tracking.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/tracking.html new file mode 100644 index 0000000..c116159 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/tracking.html @@ -0,0 +1,95 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.crosshair.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px"></div> + + <p>You can add crosshairs that'll track the mouse position, either + on both axes or as here on only one.</p> + + <p>If you combine it with listening on hover events, you can use + it to track the intersection on the curves by interpolating + the data points (look at the legend).</p> + + <p id="hoverdata"></p> + +<script type="text/javascript"> +var plot; +$(function () { + var sin = [], cos = []; + for (var i = 0; i < 14; i += 0.1) { + sin.push([i, Math.sin(i)]); + cos.push([i, Math.cos(i)]); + } + + plot = $.plot($("#placeholder"), + [ { data: sin, label: "sin(x) = -0.00"}, + { data: cos, label: "cos(x) = -0.00" } ], { + series: { + lines: { show: true } + }, + crosshair: { mode: "x" }, + grid: { hoverable: true, autoHighlight: false }, + yaxis: { min: -1.2, max: 1.2 } + }); + var legends = $("#placeholder .legendLabel"); + legends.each(function () { + // fix the widths so they don't jump around + $(this).css('width', $(this).width()); + }); + + var updateLegendTimeout = null; + var latestPosition = null; + + function updateLegend() { + updateLegendTimeout = null; + + var pos = latestPosition; + + var axes = plot.getAxes(); + if (pos.x < axes.xaxis.min || pos.x > axes.xaxis.max || + pos.y < axes.yaxis.min || pos.y > axes.yaxis.max) + return; + + var i, j, dataset = plot.getData(); + for (i = 0; i < dataset.length; ++i) { + var series = dataset[i]; + + // find the nearest points, x-wise + for (j = 0; j < series.data.length; ++j) + if (series.data[j][0] > pos.x) + break; + + // now interpolate + var y, p1 = series.data[j - 1], p2 = series.data[j]; + if (p1 == null) + y = p2[1]; + else if (p2 == null) + y = p1[1]; + else + y = p1[1] + (p2[1] - p1[1]) * (pos.x - p1[0]) / (p2[0] - p1[0]); + + legends.eq(i).text(series.label.replace(/=.*/, "= " + y.toFixed(2))); + } + } + + $("#placeholder").bind("plothover", function (event, pos, item) { + latestPosition = pos; + if (!updateLegendTimeout) + updateLegendTimeout = setTimeout(updateLegend, 50); + }); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/turning-series.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/turning-series.html new file mode 100644 index 0000000..bc6fd9f --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/turning-series.html @@ -0,0 +1,98 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px;"></div> + + <p>Here is an example with real data: military budgets for + various countries in constant (2005) million US dollars (source: <a href="http://www.sipri.org/">SIPRI</a>).</p> + + <p>Since all data is available client-side, it's pretty easy to + make the plot interactive. Try turning countries on/off with the + checkboxes below.</p> + + <p id="choices">Show:</p> + +<script type="text/javascript"> +$(function () { + var datasets = { + "usa": { + label: "USA", + data: [[1988, 483994], [1989, 479060], [1990, 457648], [1991, 401949], [1992, 424705], [1993, 402375], [1994, 377867], [1995, 357382], [1996, 337946], [1997, 336185], [1998, 328611], [1999, 329421], [2000, 342172], [2001, 344932], [2002, 387303], [2003, 440813], [2004, 480451], [2005, 504638], [2006, 528692]] + }, + "russia": { + label: "Russia", + data: [[1988, 218000], [1989, 203000], [1990, 171000], [1992, 42500], [1993, 37600], [1994, 36600], [1995, 21700], [1996, 19200], [1997, 21300], [1998, 13600], [1999, 14000], [2000, 19100], [2001, 21300], [2002, 23600], [2003, 25100], [2004, 26100], [2005, 31100], [2006, 34700]] + }, + "uk": { + label: "UK", + data: [[1988, 62982], [1989, 62027], [1990, 60696], [1991, 62348], [1992, 58560], [1993, 56393], [1994, 54579], [1995, 50818], [1996, 50554], [1997, 48276], [1998, 47691], [1999, 47529], [2000, 47778], [2001, 48760], [2002, 50949], [2003, 57452], [2004, 60234], [2005, 60076], [2006, 59213]] + }, + "germany": { + label: "Germany", + data: [[1988, 55627], [1989, 55475], [1990, 58464], [1991, 55134], [1992, 52436], [1993, 47139], [1994, 43962], [1995, 43238], [1996, 42395], [1997, 40854], [1998, 40993], [1999, 41822], [2000, 41147], [2001, 40474], [2002, 40604], [2003, 40044], [2004, 38816], [2005, 38060], [2006, 36984]] + }, + "denmark": { + label: "Denmark", + data: [[1988, 3813], [1989, 3719], [1990, 3722], [1991, 3789], [1992, 3720], [1993, 3730], [1994, 3636], [1995, 3598], [1996, 3610], [1997, 3655], [1998, 3695], [1999, 3673], [2000, 3553], [2001, 3774], [2002, 3728], [2003, 3618], [2004, 3638], [2005, 3467], [2006, 3770]] + }, + "sweden": { + label: "Sweden", + data: [[1988, 6402], [1989, 6474], [1990, 6605], [1991, 6209], [1992, 6035], [1993, 6020], [1994, 6000], [1995, 6018], [1996, 3958], [1997, 5780], [1998, 5954], [1999, 6178], [2000, 6411], [2001, 5993], [2002, 5833], [2003, 5791], [2004, 5450], [2005, 5521], [2006, 5271]] + }, + "norway": { + label: "Norway", + data: [[1988, 4382], [1989, 4498], [1990, 4535], [1991, 4398], [1992, 4766], [1993, 4441], [1994, 4670], [1995, 4217], [1996, 4275], [1997, 4203], [1998, 4482], [1999, 4506], [2000, 4358], [2001, 4385], [2002, 5269], [2003, 5066], [2004, 5194], [2005, 4887], [2006, 4891]] + } + }; + + // hard-code color indices to prevent them from shifting as + // countries are turned on/off + var i = 0; + $.each(datasets, function(key, val) { + val.color = i; + ++i; + }); + + // insert checkboxes + var choiceContainer = $("#choices"); + $.each(datasets, function(key, val) { + choiceContainer.append('<br/><input type="checkbox" name="' + key + + '" checked="checked" id="id' + key + '">' + + '<label for="id' + key + '">' + + val.label + '</label>'); + }); + choiceContainer.find("input").click(plotAccordingToChoices); + + + function plotAccordingToChoices() { + var data = []; + + choiceContainer.find("input:checked").each(function () { + var key = $(this).attr("name"); + if (key && datasets[key]) + data.push(datasets[key]); + }); + + if (data.length > 0) + $.plot($("#placeholder"), data, { + yaxis: { min: 0 }, + xaxis: { tickDecimals: 0 } + }); + } + + plotAccordingToChoices(); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/visitors.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/visitors.html new file mode 100644 index 0000000..8a9d4d7 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/visitors.html @@ -0,0 +1,90 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.selection.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div id="placeholder" style="width:600px;height:300px;"></div> + + <p>Visitors per day to the Flot homepage. Weekends are colored. Try zooming. + The plot below shows an overview.</p> + + <div id="overview" style="margin-left:50px;margin-top:20px;width:400px;height:50px"></div> + +<script id="source"> +$(function () { + var d = [[1196463600000, 0], [1196550000000, 0], [1196636400000, 0], [1196722800000, 77], [1196809200000, 3636], [1196895600000, 3575], [1196982000000, 2736], [1197068400000, 1086], [1197154800000, 676], [1197241200000, 1205], [1197327600000, 906], [1197414000000, 710], [1197500400000, 639], [1197586800000, 540], [1197673200000, 435], [1197759600000, 301], [1197846000000, 575], [1197932400000, 481], [1198018800000, 591], [1198105200000, 608], [1198191600000, 459], [1198278000000, 234], [1198364400000, 1352], [1198450800000, 686], [1198537200000, 279], [1198623600000, 449], [1198710000000, 468], [1198796400000, 392], [1198882800000, 282], [1198969200000, 208], [1199055600000, 229], [1199142000000, 177], [1199228400000, 374], [1199314800000, 436], [1199401200000, 404], [1199487600000, 253], [1199574000000, 218], [1199660400000, 476], [1199746800000, 462], [1199833200000, 448], [1199919600000, 442], [1200006000000, 403], [1200092400000, 204], [1200178800000, 194], [1200265200000, 327], [1200351600000, 374], [1200438000000, 507], [1200524400000, 546], [1200610800000, 482], [1200697200000, 283], [1200783600000, 221], [1200870000000, 483], [1200956400000, 523], [1201042800000, 528], [1201129200000, 483], [1201215600000, 452], [1201302000000, 270], [1201388400000, 222], [1201474800000, 439], [1201561200000, 559], [1201647600000, 521], [1201734000000, 477], [1201820400000, 442], [1201906800000, 252], [1201993200000, 236], [1202079600000, 525], [1202166000000, 477], [1202252400000, 386], [1202338800000, 409], [1202425200000, 408], [1202511600000, 237], [1202598000000, 193], [1202684400000, 357], [1202770800000, 414], [1202857200000, 393], [1202943600000, 353], [1203030000000, 364], [1203116400000, 215], [1203202800000, 214], [1203289200000, 356], [1203375600000, 399], [1203462000000, 334], [1203548400000, 348], [1203634800000, 243], [1203721200000, 126], [1203807600000, 157], [1203894000000, 288]]; + + // first correct the timestamps - they are recorded as the daily + // midnights in UTC+0100, but Flot always displays dates in UTC + // so we have to add one hour to hit the midnights in the plot + for (var i = 0; i < d.length; ++i) + d[i][0] += 60 * 60 * 1000; + + // helper for returning the weekends in a period + function weekendAreas(axes) { + var markings = []; + var d = new Date(axes.xaxis.min); + // go to the first Saturday + d.setUTCDate(d.getUTCDate() - ((d.getUTCDay() + 1) % 7)) + d.setUTCSeconds(0); + d.setUTCMinutes(0); + d.setUTCHours(0); + var i = d.getTime(); + do { + // when we don't set yaxis, the rectangle automatically + // extends to infinity upwards and downwards + markings.push({ xaxis: { from: i, to: i + 2 * 24 * 60 * 60 * 1000 } }); + i += 7 * 24 * 60 * 60 * 1000; + } while (i < axes.xaxis.max); + + return markings; + } + + var options = { + xaxis: { mode: "time", tickLength: 5 }, + selection: { mode: "x" }, + grid: { markings: weekendAreas } + }; + + var plot = $.plot($("#placeholder"), [d], options); + + var overview = $.plot($("#overview"), [d], { + series: { + lines: { show: true, lineWidth: 1 }, + shadowSize: 0 + }, + xaxis: { ticks: [], mode: "time" }, + yaxis: { ticks: [], min: 0, autoscaleMargin: 0.1 }, + selection: { mode: "x" } + }); + + // now connect the two + + $("#placeholder").bind("plotselected", function (event, ranges) { + // do the zooming + plot = $.plot($("#placeholder"), [d], + $.extend(true, {}, options, { + xaxis: { min: ranges.xaxis.from, max: ranges.xaxis.to } + })); + + // don't fire event on the overview to prevent eternal loop + overview.setSelection(ranges, true); + }); + + $("#overview").bind("plotselected", function (event, ranges) { + plot.setSelection(ranges); + }); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/zooming.html b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/zooming.html new file mode 100644 index 0000000..9a4ef22 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/examples/zooming.html @@ -0,0 +1,98 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + <title>Flot Examples</title> + <link href="layout.css" rel="stylesheet" type="text/css"> + <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../excanvas.min.js"></script><![endif]--> + <script language="javascript" type="text/javascript" src="../jquery.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.js"></script> + <script language="javascript" type="text/javascript" src="../jquery.flot.selection.js"></script> + </head> + <body> + <h1>Flot Examples</h1> + + <div style="float:left"> + <div id="placeholder" style="width:500px;height:300px"></div> + </div> + + <div id="miniature" style="float:left;margin-left:20px"> + <div id="overview" style="width:166px;height:100px"></div> + + <p id="overviewLegend" style="margin-left:10px"></p> + </div> + + <p style="clear:left">The selection support makes it easy to + construct flexible zooming schemes. With a few lines of code, the + small overview plot to the right has been connected to the large + plot. Try selecting a rectangle on either of them.</p> + +<script id="source"> +$(function () { + // setup plot + function getData(x1, x2) { + var d = []; + for (var i = 0; i <= 100; ++i) { + var x = x1 + i * (x2 - x1) / 100; + d.push([x, Math.sin(x * Math.sin(x))]); + } + + return [ + { label: "sin(x sin(x))", data: d } + ]; + } + + var options = { + legend: { show: false }, + series: { + lines: { show: true }, + points: { show: true } + }, + yaxis: { ticks: 10 }, + selection: { mode: "xy" } + }; + + var startData = getData(0, 3 * Math.PI); + + var plot = $.plot($("#placeholder"), startData, options); + + // setup overview + var overview = $.plot($("#overview"), startData, { + legend: { show: true, container: $("#overviewLegend") }, + series: { + lines: { show: true, lineWidth: 1 }, + shadowSize: 0 + }, + xaxis: { ticks: 4 }, + yaxis: { ticks: 3, min: -2, max: 2 }, + grid: { color: "#999" }, + selection: { mode: "xy" } + }); + + // now connect the two + + $("#placeholder").bind("plotselected", function (event, ranges) { + // clamp the zooming to prevent eternal zoom + if (ranges.xaxis.to - ranges.xaxis.from < 0.00001) + ranges.xaxis.to = ranges.xaxis.from + 0.00001; + if (ranges.yaxis.to - ranges.yaxis.from < 0.00001) + ranges.yaxis.to = ranges.yaxis.from + 0.00001; + + // do the zooming + plot = $.plot($("#placeholder"), getData(ranges.xaxis.from, ranges.xaxis.to), + $.extend(true, {}, options, { + xaxis: { min: ranges.xaxis.from, max: ranges.xaxis.to }, + yaxis: { min: ranges.yaxis.from, max: ranges.yaxis.to } + })); + + // don't fire event on the overview to prevent eternal loop + overview.setSelection(ranges, true); + }); + $("#overview").bind("plotselected", function (event, ranges) { + plot.setSelection(ranges); + }); +}); +</script> + + </body> +</html> diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/excanvas.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/excanvas.js new file mode 100644 index 0000000..c40d6f7 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/excanvas.js @@ -0,0 +1,1427 @@ +// Copyright 2006 Google Inc. +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + + +// Known Issues: +// +// * Patterns only support repeat. +// * Radial gradient are not implemented. The VML version of these look very +// different from the canvas one. +// * Clipping paths are not implemented. +// * Coordsize. The width and height attribute have higher priority than the +// width and height style values which isn't correct. +// * Painting mode isn't implemented. +// * Canvas width/height should is using content-box by default. IE in +// Quirks mode will draw the canvas using border-box. Either change your +// doctype to HTML5 +// (http://www.whatwg.org/specs/web-apps/current-work/#the-doctype) +// or use Box Sizing Behavior from WebFX +// (http://webfx.eae.net/dhtml/boxsizing/boxsizing.html) +// * Non uniform scaling does not correctly scale strokes. +// * Filling very large shapes (above 5000 points) is buggy. +// * Optimize. There is always room for speed improvements. + +// Only add this code if we do not already have a canvas implementation +if (!document.createElement('canvas').getContext) { + +(function() { + + // alias some functions to make (compiled) code shorter + var m = Math; + var mr = m.round; + var ms = m.sin; + var mc = m.cos; + var abs = m.abs; + var sqrt = m.sqrt; + + // this is used for sub pixel precision + var Z = 10; + var Z2 = Z / 2; + + /** + * This funtion is assigned to the <canvas> elements as element.getContext(). + * @this {HTMLElement} + * @return {CanvasRenderingContext2D_} + */ + function getContext() { + return this.context_ || + (this.context_ = new CanvasRenderingContext2D_(this)); + } + + var slice = Array.prototype.slice; + + /** + * Binds a function to an object. The returned function will always use the + * passed in {@code obj} as {@code this}. + * + * Example: + * + * g = bind(f, obj, a, b) + * g(c, d) // will do f.call(obj, a, b, c, d) + * + * @param {Function} f The function to bind the object to + * @param {Object} obj The object that should act as this when the function + * is called + * @param {*} var_args Rest arguments that will be used as the initial + * arguments when the function is called + * @return {Function} A new function that has bound this + */ + function bind(f, obj, var_args) { + var a = slice.call(arguments, 2); + return function() { + return f.apply(obj, a.concat(slice.call(arguments))); + }; + } + + function encodeHtmlAttribute(s) { + return String(s).replace(/&/g, '&').replace(/"/g, '"'); + } + + function addNamespacesAndStylesheet(doc) { + // create xmlns + if (!doc.namespaces['g_vml_']) { + doc.namespaces.add('g_vml_', 'urn:schemas-microsoft-com:vml', + '#default#VML'); + + } + if (!doc.namespaces['g_o_']) { + doc.namespaces.add('g_o_', 'urn:schemas-microsoft-com:office:office', + '#default#VML'); + } + + // Setup default CSS. Only add one style sheet per document + if (!doc.styleSheets['ex_canvas_']) { + var ss = doc.createStyleSheet(); + ss.owningElement.id = 'ex_canvas_'; + ss.cssText = 'canvas{display:inline-block;overflow:hidden;' + + // default size is 300x150 in Gecko and Opera + 'text-align:left;width:300px;height:150px}'; + } + } + + // Add namespaces and stylesheet at startup. + addNamespacesAndStylesheet(document); + + var G_vmlCanvasManager_ = { + init: function(opt_doc) { + if (/MSIE/.test(navigator.userAgent) && !window.opera) { + var doc = opt_doc || document; + // Create a dummy element so that IE will allow canvas elements to be + // recognized. + doc.createElement('canvas'); + doc.attachEvent('onreadystatechange', bind(this.init_, this, doc)); + } + }, + + init_: function(doc) { + // find all canvas elements + var els = doc.getElementsByTagName('canvas'); + for (var i = 0; i < els.length; i++) { + this.initElement(els[i]); + } + }, + + /** + * Public initializes a canvas element so that it can be used as canvas + * element from now on. This is called automatically before the page is + * loaded but if you are creating elements using createElement you need to + * make sure this is called on the element. + * @param {HTMLElement} el The canvas element to initialize. + * @return {HTMLElement} the element that was created. + */ + initElement: function(el) { + if (!el.getContext) { + el.getContext = getContext; + + // Add namespaces and stylesheet to document of the element. + addNamespacesAndStylesheet(el.ownerDocument); + + // Remove fallback content. There is no way to hide text nodes so we + // just remove all childNodes. We could hide all elements and remove + // text nodes but who really cares about the fallback content. + el.innerHTML = ''; + + // do not use inline function because that will leak memory + el.attachEvent('onpropertychange', onPropertyChange); + el.attachEvent('onresize', onResize); + + var attrs = el.attributes; + if (attrs.width && attrs.width.specified) { + // TODO: use runtimeStyle and coordsize + // el.getContext().setWidth_(attrs.width.nodeValue); + el.style.width = attrs.width.nodeValue + 'px'; + } else { + el.width = el.clientWidth; + } + if (attrs.height && attrs.height.specified) { + // TODO: use runtimeStyle and coordsize + // el.getContext().setHeight_(attrs.height.nodeValue); + el.style.height = attrs.height.nodeValue + 'px'; + } else { + el.height = el.clientHeight; + } + //el.getContext().setCoordsize_() + } + return el; + } + }; + + function onPropertyChange(e) { + var el = e.srcElement; + + switch (e.propertyName) { + case 'width': + el.getContext().clearRect(); + el.style.width = el.attributes.width.nodeValue + 'px'; + // In IE8 this does not trigger onresize. + el.firstChild.style.width = el.clientWidth + 'px'; + break; + case 'height': + el.getContext().clearRect(); + el.style.height = el.attributes.height.nodeValue + 'px'; + el.firstChild.style.height = el.clientHeight + 'px'; + break; + } + } + + function onResize(e) { + var el = e.srcElement; + if (el.firstChild) { + el.firstChild.style.width = el.clientWidth + 'px'; + el.firstChild.style.height = el.clientHeight + 'px'; + } + } + + G_vmlCanvasManager_.init(); + + // precompute "00" to "FF" + var decToHex = []; + for (var i = 0; i < 16; i++) { + for (var j = 0; j < 16; j++) { + decToHex[i * 16 + j] = i.toString(16) + j.toString(16); + } + } + + function createMatrixIdentity() { + return [ + [1, 0, 0], + [0, 1, 0], + [0, 0, 1] + ]; + } + + function matrixMultiply(m1, m2) { + var result = createMatrixIdentity(); + + for (var x = 0; x < 3; x++) { + for (var y = 0; y < 3; y++) { + var sum = 0; + + for (var z = 0; z < 3; z++) { + sum += m1[x][z] * m2[z][y]; + } + + result[x][y] = sum; + } + } + return result; + } + + function copyState(o1, o2) { + o2.fillStyle = o1.fillStyle; + o2.lineCap = o1.lineCap; + o2.lineJoin = o1.lineJoin; + o2.lineWidth = o1.lineWidth; + o2.miterLimit = o1.miterLimit; + o2.shadowBlur = o1.shadowBlur; + o2.shadowColor = o1.shadowColor; + o2.shadowOffsetX = o1.shadowOffsetX; + o2.shadowOffsetY = o1.shadowOffsetY; + o2.strokeStyle = o1.strokeStyle; + o2.globalAlpha = o1.globalAlpha; + o2.font = o1.font; + o2.textAlign = o1.textAlign; + o2.textBaseline = o1.textBaseline; + o2.arcScaleX_ = o1.arcScaleX_; + o2.arcScaleY_ = o1.arcScaleY_; + o2.lineScale_ = o1.lineScale_; + } + + var colorData = { + aliceblue: '#F0F8FF', + antiquewhite: '#FAEBD7', + aquamarine: '#7FFFD4', + azure: '#F0FFFF', + beige: '#F5F5DC', + bisque: '#FFE4C4', + black: '#000000', + blanchedalmond: '#FFEBCD', + blueviolet: '#8A2BE2', + brown: '#A52A2A', + burlywood: '#DEB887', + cadetblue: '#5F9EA0', + chartreuse: '#7FFF00', + chocolate: '#D2691E', + coral: '#FF7F50', + cornflowerblue: '#6495ED', + cornsilk: '#FFF8DC', + crimson: '#DC143C', + cyan: '#00FFFF', + darkblue: '#00008B', + darkcyan: '#008B8B', + darkgoldenrod: '#B8860B', + darkgray: '#A9A9A9', + darkgreen: '#006400', + darkgrey: '#A9A9A9', + darkkhaki: '#BDB76B', + darkmagenta: '#8B008B', + darkolivegreen: '#556B2F', + darkorange: '#FF8C00', + darkorchid: '#9932CC', + darkred: '#8B0000', + darksalmon: '#E9967A', + darkseagreen: '#8FBC8F', + darkslateblue: '#483D8B', + darkslategray: '#2F4F4F', + darkslategrey: '#2F4F4F', + darkturquoise: '#00CED1', + darkviolet: '#9400D3', + deeppink: '#FF1493', + deepskyblue: '#00BFFF', + dimgray: '#696969', + dimgrey: '#696969', + dodgerblue: '#1E90FF', + firebrick: '#B22222', + floralwhite: '#FFFAF0', + forestgreen: '#228B22', + gainsboro: '#DCDCDC', + ghostwhite: '#F8F8FF', + gold: '#FFD700', + goldenrod: '#DAA520', + grey: '#808080', + greenyellow: '#ADFF2F', + honeydew: '#F0FFF0', + hotpink: '#FF69B4', + indianred: '#CD5C5C', + indigo: '#4B0082', + ivory: '#FFFFF0', + khaki: '#F0E68C', + lavender: '#E6E6FA', + lavenderblush: '#FFF0F5', + lawngreen: '#7CFC00', + lemonchiffon: '#FFFACD', + lightblue: '#ADD8E6', + lightcoral: '#F08080', + lightcyan: '#E0FFFF', + lightgoldenrodyellow: '#FAFAD2', + lightgreen: '#90EE90', + lightgrey: '#D3D3D3', + lightpink: '#FFB6C1', + lightsalmon: '#FFA07A', + lightseagreen: '#20B2AA', + lightskyblue: '#87CEFA', + lightslategray: '#778899', + lightslategrey: '#778899', + lightsteelblue: '#B0C4DE', + lightyellow: '#FFFFE0', + limegreen: '#32CD32', + linen: '#FAF0E6', + magenta: '#FF00FF', + mediumaquamarine: '#66CDAA', + mediumblue: '#0000CD', + mediumorchid: '#BA55D3', + mediumpurple: '#9370DB', + mediumseagreen: '#3CB371', + mediumslateblue: '#7B68EE', + mediumspringgreen: '#00FA9A', + mediumturquoise: '#48D1CC', + mediumvioletred: '#C71585', + midnightblue: '#191970', + mintcream: '#F5FFFA', + mistyrose: '#FFE4E1', + moccasin: '#FFE4B5', + navajowhite: '#FFDEAD', + oldlace: '#FDF5E6', + olivedrab: '#6B8E23', + orange: '#FFA500', + orangered: '#FF4500', + orchid: '#DA70D6', + palegoldenrod: '#EEE8AA', + palegreen: '#98FB98', + paleturquoise: '#AFEEEE', + palevioletred: '#DB7093', + papayawhip: '#FFEFD5', + peachpuff: '#FFDAB9', + peru: '#CD853F', + pink: '#FFC0CB', + plum: '#DDA0DD', + powderblue: '#B0E0E6', + rosybrown: '#BC8F8F', + royalblue: '#4169E1', + saddlebrown: '#8B4513', + salmon: '#FA8072', + sandybrown: '#F4A460', + seagreen: '#2E8B57', + seashell: '#FFF5EE', + sienna: '#A0522D', + skyblue: '#87CEEB', + slateblue: '#6A5ACD', + slategray: '#708090', + slategrey: '#708090', + snow: '#FFFAFA', + springgreen: '#00FF7F', + steelblue: '#4682B4', + tan: '#D2B48C', + thistle: '#D8BFD8', + tomato: '#FF6347', + turquoise: '#40E0D0', + violet: '#EE82EE', + wheat: '#F5DEB3', + whitesmoke: '#F5F5F5', + yellowgreen: '#9ACD32' + }; + + + function getRgbHslContent(styleString) { + var start = styleString.indexOf('(', 3); + var end = styleString.indexOf(')', start + 1); + var parts = styleString.substring(start + 1, end).split(','); + // add alpha if needed + if (parts.length == 4 && styleString.substr(3, 1) == 'a') { + alpha = Number(parts[3]); + } else { + parts[3] = 1; + } + return parts; + } + + function percent(s) { + return parseFloat(s) / 100; + } + + function clamp(v, min, max) { + return Math.min(max, Math.max(min, v)); + } + + function hslToRgb(parts){ + var r, g, b; + h = parseFloat(parts[0]) / 360 % 360; + if (h < 0) + h++; + s = clamp(percent(parts[1]), 0, 1); + l = clamp(percent(parts[2]), 0, 1); + if (s == 0) { + r = g = b = l; // achromatic + } else { + var q = l < 0.5 ? l * (1 + s) : l + s - l * s; + var p = 2 * l - q; + r = hueToRgb(p, q, h + 1 / 3); + g = hueToRgb(p, q, h); + b = hueToRgb(p, q, h - 1 / 3); + } + + return '#' + decToHex[Math.floor(r * 255)] + + decToHex[Math.floor(g * 255)] + + decToHex[Math.floor(b * 255)]; + } + + function hueToRgb(m1, m2, h) { + if (h < 0) + h++; + if (h > 1) + h--; + + if (6 * h < 1) + return m1 + (m2 - m1) * 6 * h; + else if (2 * h < 1) + return m2; + else if (3 * h < 2) + return m1 + (m2 - m1) * (2 / 3 - h) * 6; + else + return m1; + } + + function processStyle(styleString) { + var str, alpha = 1; + + styleString = String(styleString); + if (styleString.charAt(0) == '#') { + str = styleString; + } else if (/^rgb/.test(styleString)) { + var parts = getRgbHslContent(styleString); + var str = '#', n; + for (var i = 0; i < 3; i++) { + if (parts[i].indexOf('%') != -1) { + n = Math.floor(percent(parts[i]) * 255); + } else { + n = Number(parts[i]); + } + str += decToHex[clamp(n, 0, 255)]; + } + alpha = parts[3]; + } else if (/^hsl/.test(styleString)) { + var parts = getRgbHslContent(styleString); + str = hslToRgb(parts); + alpha = parts[3]; + } else { + str = colorData[styleString] || styleString; + } + return {color: str, alpha: alpha}; + } + + var DEFAULT_STYLE = { + style: 'normal', + variant: 'normal', + weight: 'normal', + size: 10, + family: 'sans-serif' + }; + + // Internal text style cache + var fontStyleCache = {}; + + function processFontStyle(styleString) { + if (fontStyleCache[styleString]) { + return fontStyleCache[styleString]; + } + + var el = document.createElement('div'); + var style = el.style; + try { + style.font = styleString; + } catch (ex) { + // Ignore failures to set to invalid font. + } + + return fontStyleCache[styleString] = { + style: style.fontStyle || DEFAULT_STYLE.style, + variant: style.fontVariant || DEFAULT_STYLE.variant, + weight: style.fontWeight || DEFAULT_STYLE.weight, + size: style.fontSize || DEFAULT_STYLE.size, + family: style.fontFamily || DEFAULT_STYLE.family + }; + } + + function getComputedStyle(style, element) { + var computedStyle = {}; + + for (var p in style) { + computedStyle[p] = style[p]; + } + + // Compute the size + var canvasFontSize = parseFloat(element.currentStyle.fontSize), + fontSize = parseFloat(style.size); + + if (typeof style.size == 'number') { + computedStyle.size = style.size; + } else if (style.size.indexOf('px') != -1) { + computedStyle.size = fontSize; + } else if (style.size.indexOf('em') != -1) { + computedStyle.size = canvasFontSize * fontSize; + } else if(style.size.indexOf('%') != -1) { + computedStyle.size = (canvasFontSize / 100) * fontSize; + } else if (style.size.indexOf('pt') != -1) { + computedStyle.size = fontSize / .75; + } else { + computedStyle.size = canvasFontSize; + } + + // Different scaling between normal text and VML text. This was found using + // trial and error to get the same size as non VML text. + computedStyle.size *= 0.981; + + return computedStyle; + } + + function buildStyle(style) { + return style.style + ' ' + style.variant + ' ' + style.weight + ' ' + + style.size + 'px ' + style.family; + } + + function processLineCap(lineCap) { + switch (lineCap) { + case 'butt': + return 'flat'; + case 'round': + return 'round'; + case 'square': + default: + return 'square'; + } + } + + /** + * This class implements CanvasRenderingContext2D interface as described by + * the WHATWG. + * @param {HTMLElement} surfaceElement The element that the 2D context should + * be associated with + */ + function CanvasRenderingContext2D_(surfaceElement) { + this.m_ = createMatrixIdentity(); + + this.mStack_ = []; + this.aStack_ = []; + this.currentPath_ = []; + + // Canvas context properties + this.strokeStyle = '#000'; + this.fillStyle = '#000'; + + this.lineWidth = 1; + this.lineJoin = 'miter'; + this.lineCap = 'butt'; + this.miterLimit = Z * 1; + this.globalAlpha = 1; + this.font = '10px sans-serif'; + this.textAlign = 'left'; + this.textBaseline = 'alphabetic'; + this.canvas = surfaceElement; + + var el = surfaceElement.ownerDocument.createElement('div'); + el.style.width = surfaceElement.clientWidth + 'px'; + el.style.height = surfaceElement.clientHeight + 'px'; + el.style.overflow = 'hidden'; + el.style.position = 'absolute'; + surfaceElement.appendChild(el); + + this.element_ = el; + this.arcScaleX_ = 1; + this.arcScaleY_ = 1; + this.lineScale_ = 1; + } + + var contextPrototype = CanvasRenderingContext2D_.prototype; + contextPrototype.clearRect = function() { + if (this.textMeasureEl_) { + this.textMeasureEl_.removeNode(true); + this.textMeasureEl_ = null; + } + this.element_.innerHTML = ''; + }; + + contextPrototype.beginPath = function() { + // TODO: Branch current matrix so that save/restore has no effect + // as per safari docs. + this.currentPath_ = []; + }; + + contextPrototype.moveTo = function(aX, aY) { + var p = this.getCoords_(aX, aY); + this.currentPath_.push({type: 'moveTo', x: p.x, y: p.y}); + this.currentX_ = p.x; + this.currentY_ = p.y; + }; + + contextPrototype.lineTo = function(aX, aY) { + var p = this.getCoords_(aX, aY); + this.currentPath_.push({type: 'lineTo', x: p.x, y: p.y}); + + this.currentX_ = p.x; + this.currentY_ = p.y; + }; + + contextPrototype.bezierCurveTo = function(aCP1x, aCP1y, + aCP2x, aCP2y, + aX, aY) { + var p = this.getCoords_(aX, aY); + var cp1 = this.getCoords_(aCP1x, aCP1y); + var cp2 = this.getCoords_(aCP2x, aCP2y); + bezierCurveTo(this, cp1, cp2, p); + }; + + // Helper function that takes the already fixed cordinates. + function bezierCurveTo(self, cp1, cp2, p) { + self.currentPath_.push({ + type: 'bezierCurveTo', + cp1x: cp1.x, + cp1y: cp1.y, + cp2x: cp2.x, + cp2y: cp2.y, + x: p.x, + y: p.y + }); + self.currentX_ = p.x; + self.currentY_ = p.y; + } + + contextPrototype.quadraticCurveTo = function(aCPx, aCPy, aX, aY) { + // the following is lifted almost directly from + // http://developer.mozilla.org/en/docs/Canvas_tutorial:Drawing_shapes + + var cp = this.getCoords_(aCPx, aCPy); + var p = this.getCoords_(aX, aY); + + var cp1 = { + x: this.currentX_ + 2.0 / 3.0 * (cp.x - this.currentX_), + y: this.currentY_ + 2.0 / 3.0 * (cp.y - this.currentY_) + }; + var cp2 = { + x: cp1.x + (p.x - this.currentX_) / 3.0, + y: cp1.y + (p.y - this.currentY_) / 3.0 + }; + + bezierCurveTo(this, cp1, cp2, p); + }; + + contextPrototype.arc = function(aX, aY, aRadius, + aStartAngle, aEndAngle, aClockwise) { + aRadius *= Z; + var arcType = aClockwise ? 'at' : 'wa'; + + var xStart = aX + mc(aStartAngle) * aRadius - Z2; + var yStart = aY + ms(aStartAngle) * aRadius - Z2; + + var xEnd = aX + mc(aEndAngle) * aRadius - Z2; + var yEnd = aY + ms(aEndAngle) * aRadius - Z2; + + // IE won't render arches drawn counter clockwise if xStart == xEnd. + if (xStart == xEnd && !aClockwise) { + xStart += 0.125; // Offset xStart by 1/80 of a pixel. Use something + // that can be represented in binary + } + + var p = this.getCoords_(aX, aY); + var pStart = this.getCoords_(xStart, yStart); + var pEnd = this.getCoords_(xEnd, yEnd); + + this.currentPath_.push({type: arcType, + x: p.x, + y: p.y, + radius: aRadius, + xStart: pStart.x, + yStart: pStart.y, + xEnd: pEnd.x, + yEnd: pEnd.y}); + + }; + + contextPrototype.rect = function(aX, aY, aWidth, aHeight) { + this.moveTo(aX, aY); + this.lineTo(aX + aWidth, aY); + this.lineTo(aX + aWidth, aY + aHeight); + this.lineTo(aX, aY + aHeight); + this.closePath(); + }; + + contextPrototype.strokeRect = function(aX, aY, aWidth, aHeight) { + var oldPath = this.currentPath_; + this.beginPath(); + + this.moveTo(aX, aY); + this.lineTo(aX + aWidth, aY); + this.lineTo(aX + aWidth, aY + aHeight); + this.lineTo(aX, aY + aHeight); + this.closePath(); + this.stroke(); + + this.currentPath_ = oldPath; + }; + + contextPrototype.fillRect = function(aX, aY, aWidth, aHeight) { + var oldPath = this.currentPath_; + this.beginPath(); + + this.moveTo(aX, aY); + this.lineTo(aX + aWidth, aY); + this.lineTo(aX + aWidth, aY + aHeight); + this.lineTo(aX, aY + aHeight); + this.closePath(); + this.fill(); + + this.currentPath_ = oldPath; + }; + + contextPrototype.createLinearGradient = function(aX0, aY0, aX1, aY1) { + var gradient = new CanvasGradient_('gradient'); + gradient.x0_ = aX0; + gradient.y0_ = aY0; + gradient.x1_ = aX1; + gradient.y1_ = aY1; + return gradient; + }; + + contextPrototype.createRadialGradient = function(aX0, aY0, aR0, + aX1, aY1, aR1) { + var gradient = new CanvasGradient_('gradientradial'); + gradient.x0_ = aX0; + gradient.y0_ = aY0; + gradient.r0_ = aR0; + gradient.x1_ = aX1; + gradient.y1_ = aY1; + gradient.r1_ = aR1; + return gradient; + }; + + contextPrototype.drawImage = function(image, var_args) { + var dx, dy, dw, dh, sx, sy, sw, sh; + + // to find the original width we overide the width and height + var oldRuntimeWidth = image.runtimeStyle.width; + var oldRuntimeHeight = image.runtimeStyle.height; + image.runtimeStyle.width = 'auto'; + image.runtimeStyle.height = 'auto'; + + // get the original size + var w = image.width; + var h = image.height; + + // and remove overides + image.runtimeStyle.width = oldRuntimeWidth; + image.runtimeStyle.height = oldRuntimeHeight; + + if (arguments.length == 3) { + dx = arguments[1]; + dy = arguments[2]; + sx = sy = 0; + sw = dw = w; + sh = dh = h; + } else if (arguments.length == 5) { + dx = arguments[1]; + dy = arguments[2]; + dw = arguments[3]; + dh = arguments[4]; + sx = sy = 0; + sw = w; + sh = h; + } else if (arguments.length == 9) { + sx = arguments[1]; + sy = arguments[2]; + sw = arguments[3]; + sh = arguments[4]; + dx = arguments[5]; + dy = arguments[6]; + dw = arguments[7]; + dh = arguments[8]; + } else { + throw Error('Invalid number of arguments'); + } + + var d = this.getCoords_(dx, dy); + + var w2 = sw / 2; + var h2 = sh / 2; + + var vmlStr = []; + + var W = 10; + var H = 10; + + // For some reason that I've now forgotten, using divs didn't work + vmlStr.push(' <g_vml_:group', + ' coordsize="', Z * W, ',', Z * H, '"', + ' coordorigin="0,0"' , + ' style="width:', W, 'px;height:', H, 'px;position:absolute;'); + + // If filters are necessary (rotation exists), create them + // filters are bog-slow, so only create them if abbsolutely necessary + // The following check doesn't account for skews (which don't exist + // in the canvas spec (yet) anyway. + + if (this.m_[0][0] != 1 || this.m_[0][1] || + this.m_[1][1] != 1 || this.m_[1][0]) { + var filter = []; + + // Note the 12/21 reversal + filter.push('M11=', this.m_[0][0], ',', + 'M12=', this.m_[1][0], ',', + 'M21=', this.m_[0][1], ',', + 'M22=', this.m_[1][1], ',', + 'Dx=', mr(d.x / Z), ',', + 'Dy=', mr(d.y / Z), ''); + + // Bounding box calculation (need to minimize displayed area so that + // filters don't waste time on unused pixels. + var max = d; + var c2 = this.getCoords_(dx + dw, dy); + var c3 = this.getCoords_(dx, dy + dh); + var c4 = this.getCoords_(dx + dw, dy + dh); + + max.x = m.max(max.x, c2.x, c3.x, c4.x); + max.y = m.max(max.y, c2.y, c3.y, c4.y); + + vmlStr.push('padding:0 ', mr(max.x / Z), 'px ', mr(max.y / Z), + 'px 0;filter:progid:DXImageTransform.Microsoft.Matrix(', + filter.join(''), ", sizingmethod='clip');"); + + } else { + vmlStr.push('top:', mr(d.y / Z), 'px;left:', mr(d.x / Z), 'px;'); + } + + vmlStr.push(' ">' , + '<g_vml_:image src="', image.src, '"', + ' style="width:', Z * dw, 'px;', + ' height:', Z * dh, 'px"', + ' cropleft="', sx / w, '"', + ' croptop="', sy / h, '"', + ' cropright="', (w - sx - sw) / w, '"', + ' cropbottom="', (h - sy - sh) / h, '"', + ' />', + '</g_vml_:group>'); + + this.element_.insertAdjacentHTML('BeforeEnd', vmlStr.join('')); + }; + + contextPrototype.stroke = function(aFill) { + var W = 10; + var H = 10; + // Divide the shape into chunks if it's too long because IE has a limit + // somewhere for how long a VML shape can be. This simple division does + // not work with fills, only strokes, unfortunately. + var chunkSize = 5000; + + var min = {x: null, y: null}; + var max = {x: null, y: null}; + + for (var j = 0; j < this.currentPath_.length; j += chunkSize) { + var lineStr = []; + var lineOpen = false; + + lineStr.push('<g_vml_:shape', + ' filled="', !!aFill, '"', + ' style="position:absolute;width:', W, 'px;height:', H, 'px;"', + ' coordorigin="0,0"', + ' coordsize="', Z * W, ',', Z * H, '"', + ' stroked="', !aFill, '"', + ' path="'); + + var newSeq = false; + + for (var i = j; i < Math.min(j + chunkSize, this.currentPath_.length); i++) { + if (i % chunkSize == 0 && i > 0) { // move into position for next chunk + lineStr.push(' m ', mr(this.currentPath_[i-1].x), ',', mr(this.currentPath_[i-1].y)); + } + + var p = this.currentPath_[i]; + var c; + + switch (p.type) { + case 'moveTo': + c = p; + lineStr.push(' m ', mr(p.x), ',', mr(p.y)); + break; + case 'lineTo': + lineStr.push(' l ', mr(p.x), ',', mr(p.y)); + break; + case 'close': + lineStr.push(' x '); + p = null; + break; + case 'bezierCurveTo': + lineStr.push(' c ', + mr(p.cp1x), ',', mr(p.cp1y), ',', + mr(p.cp2x), ',', mr(p.cp2y), ',', + mr(p.x), ',', mr(p.y)); + break; + case 'at': + case 'wa': + lineStr.push(' ', p.type, ' ', + mr(p.x - this.arcScaleX_ * p.radius), ',', + mr(p.y - this.arcScaleY_ * p.radius), ' ', + mr(p.x + this.arcScaleX_ * p.radius), ',', + mr(p.y + this.arcScaleY_ * p.radius), ' ', + mr(p.xStart), ',', mr(p.yStart), ' ', + mr(p.xEnd), ',', mr(p.yEnd)); + break; + } + + + // TODO: Following is broken for curves due to + // move to proper paths. + + // Figure out dimensions so we can do gradient fills + // properly + if (p) { + if (min.x == null || p.x < min.x) { + min.x = p.x; + } + if (max.x == null || p.x > max.x) { + max.x = p.x; + } + if (min.y == null || p.y < min.y) { + min.y = p.y; + } + if (max.y == null || p.y > max.y) { + max.y = p.y; + } + } + } + lineStr.push(' ">'); + + if (!aFill) { + appendStroke(this, lineStr); + } else { + appendFill(this, lineStr, min, max); + } + + lineStr.push('</g_vml_:shape>'); + + this.element_.insertAdjacentHTML('beforeEnd', lineStr.join('')); + } + }; + + function appendStroke(ctx, lineStr) { + var a = processStyle(ctx.strokeStyle); + var color = a.color; + var opacity = a.alpha * ctx.globalAlpha; + var lineWidth = ctx.lineScale_ * ctx.lineWidth; + + // VML cannot correctly render a line if the width is less than 1px. + // In that case, we dilute the color to make the line look thinner. + if (lineWidth < 1) { + opacity *= lineWidth; + } + + lineStr.push( + '<g_vml_:stroke', + ' opacity="', opacity, '"', + ' joinstyle="', ctx.lineJoin, '"', + ' miterlimit="', ctx.miterLimit, '"', + ' endcap="', processLineCap(ctx.lineCap), '"', + ' weight="', lineWidth, 'px"', + ' color="', color, '" />' + ); + } + + function appendFill(ctx, lineStr, min, max) { + var fillStyle = ctx.fillStyle; + var arcScaleX = ctx.arcScaleX_; + var arcScaleY = ctx.arcScaleY_; + var width = max.x - min.x; + var height = max.y - min.y; + if (fillStyle instanceof CanvasGradient_) { + // TODO: Gradients transformed with the transformation matrix. + var angle = 0; + var focus = {x: 0, y: 0}; + + // additional offset + var shift = 0; + // scale factor for offset + var expansion = 1; + + if (fillStyle.type_ == 'gradient') { + var x0 = fillStyle.x0_ / arcScaleX; + var y0 = fillStyle.y0_ / arcScaleY; + var x1 = fillStyle.x1_ / arcScaleX; + var y1 = fillStyle.y1_ / arcScaleY; + var p0 = ctx.getCoords_(x0, y0); + var p1 = ctx.getCoords_(x1, y1); + var dx = p1.x - p0.x; + var dy = p1.y - p0.y; + angle = Math.atan2(dx, dy) * 180 / Math.PI; + + // The angle should be a non-negative number. + if (angle < 0) { + angle += 360; + } + + // Very small angles produce an unexpected result because they are + // converted to a scientific notation string. + if (angle < 1e-6) { + angle = 0; + } + } else { + var p0 = ctx.getCoords_(fillStyle.x0_, fillStyle.y0_); + focus = { + x: (p0.x - min.x) / width, + y: (p0.y - min.y) / height + }; + + width /= arcScaleX * Z; + height /= arcScaleY * Z; + var dimension = m.max(width, height); + shift = 2 * fillStyle.r0_ / dimension; + expansion = 2 * fillStyle.r1_ / dimension - shift; + } + + // We need to sort the color stops in ascending order by offset, + // otherwise IE won't interpret it correctly. + var stops = fillStyle.colors_; + stops.sort(function(cs1, cs2) { + return cs1.offset - cs2.offset; + }); + + var length = stops.length; + var color1 = stops[0].color; + var color2 = stops[length - 1].color; + var opacity1 = stops[0].alpha * ctx.globalAlpha; + var opacity2 = stops[length - 1].alpha * ctx.globalAlpha; + + var colors = []; + for (var i = 0; i < length; i++) { + var stop = stops[i]; + colors.push(stop.offset * expansion + shift + ' ' + stop.color); + } + + // When colors attribute is used, the meanings of opacity and o:opacity2 + // are reversed. + lineStr.push('<g_vml_:fill type="', fillStyle.type_, '"', + ' method="none" focus="100%"', + ' color="', color1, '"', + ' color2="', color2, '"', + ' colors="', colors.join(','), '"', + ' opacity="', opacity2, '"', + ' g_o_:opacity2="', opacity1, '"', + ' angle="', angle, '"', + ' focusposition="', focus.x, ',', focus.y, '" />'); + } else if (fillStyle instanceof CanvasPattern_) { + if (width && height) { + var deltaLeft = -min.x; + var deltaTop = -min.y; + lineStr.push('<g_vml_:fill', + ' position="', + deltaLeft / width * arcScaleX * arcScaleX, ',', + deltaTop / height * arcScaleY * arcScaleY, '"', + ' type="tile"', + // TODO: Figure out the correct size to fit the scale. + //' size="', w, 'px ', h, 'px"', + ' src="', fillStyle.src_, '" />'); + } + } else { + var a = processStyle(ctx.fillStyle); + var color = a.color; + var opacity = a.alpha * ctx.globalAlpha; + lineStr.push('<g_vml_:fill color="', color, '" opacity="', opacity, + '" />'); + } + } + + contextPrototype.fill = function() { + this.stroke(true); + }; + + contextPrototype.closePath = function() { + this.currentPath_.push({type: 'close'}); + }; + + /** + * @private + */ + contextPrototype.getCoords_ = function(aX, aY) { + var m = this.m_; + return { + x: Z * (aX * m[0][0] + aY * m[1][0] + m[2][0]) - Z2, + y: Z * (aX * m[0][1] + aY * m[1][1] + m[2][1]) - Z2 + }; + }; + + contextPrototype.save = function() { + var o = {}; + copyState(this, o); + this.aStack_.push(o); + this.mStack_.push(this.m_); + this.m_ = matrixMultiply(createMatrixIdentity(), this.m_); + }; + + contextPrototype.restore = function() { + if (this.aStack_.length) { + copyState(this.aStack_.pop(), this); + this.m_ = this.mStack_.pop(); + } + }; + + function matrixIsFinite(m) { + return isFinite(m[0][0]) && isFinite(m[0][1]) && + isFinite(m[1][0]) && isFinite(m[1][1]) && + isFinite(m[2][0]) && isFinite(m[2][1]); + } + + function setM(ctx, m, updateLineScale) { + if (!matrixIsFinite(m)) { + return; + } + ctx.m_ = m; + + if (updateLineScale) { + // Get the line scale. + // Determinant of this.m_ means how much the area is enlarged by the + // transformation. So its square root can be used as a scale factor + // for width. + var det = m[0][0] * m[1][1] - m[0][1] * m[1][0]; + ctx.lineScale_ = sqrt(abs(det)); + } + } + + contextPrototype.translate = function(aX, aY) { + var m1 = [ + [1, 0, 0], + [0, 1, 0], + [aX, aY, 1] + ]; + + setM(this, matrixMultiply(m1, this.m_), false); + }; + + contextPrototype.rotate = function(aRot) { + var c = mc(aRot); + var s = ms(aRot); + + var m1 = [ + [c, s, 0], + [-s, c, 0], + [0, 0, 1] + ]; + + setM(this, matrixMultiply(m1, this.m_), false); + }; + + contextPrototype.scale = function(aX, aY) { + this.arcScaleX_ *= aX; + this.arcScaleY_ *= aY; + var m1 = [ + [aX, 0, 0], + [0, aY, 0], + [0, 0, 1] + ]; + + setM(this, matrixMultiply(m1, this.m_), true); + }; + + contextPrototype.transform = function(m11, m12, m21, m22, dx, dy) { + var m1 = [ + [m11, m12, 0], + [m21, m22, 0], + [dx, dy, 1] + ]; + + setM(this, matrixMultiply(m1, this.m_), true); + }; + + contextPrototype.setTransform = function(m11, m12, m21, m22, dx, dy) { + var m = [ + [m11, m12, 0], + [m21, m22, 0], + [dx, dy, 1] + ]; + + setM(this, m, true); + }; + + /** + * The text drawing function. + * The maxWidth argument isn't taken in account, since no browser supports + * it yet. + */ + contextPrototype.drawText_ = function(text, x, y, maxWidth, stroke) { + var m = this.m_, + delta = 1000, + left = 0, + right = delta, + offset = {x: 0, y: 0}, + lineStr = []; + + var fontStyle = getComputedStyle(processFontStyle(this.font), + this.element_); + + var fontStyleString = buildStyle(fontStyle); + + var elementStyle = this.element_.currentStyle; + var textAlign = this.textAlign.toLowerCase(); + switch (textAlign) { + case 'left': + case 'center': + case 'right': + break; + case 'end': + textAlign = elementStyle.direction == 'ltr' ? 'right' : 'left'; + break; + case 'start': + textAlign = elementStyle.direction == 'rtl' ? 'right' : 'left'; + break; + default: + textAlign = 'left'; + } + + // 1.75 is an arbitrary number, as there is no info about the text baseline + switch (this.textBaseline) { + case 'hanging': + case 'top': + offset.y = fontStyle.size / 1.75; + break; + case 'middle': + break; + default: + case null: + case 'alphabetic': + case 'ideographic': + case 'bottom': + offset.y = -fontStyle.size / 2.25; + break; + } + + switch(textAlign) { + case 'right': + left = delta; + right = 0.05; + break; + case 'center': + left = right = delta / 2; + break; + } + + var d = this.getCoords_(x + offset.x, y + offset.y); + + lineStr.push('<g_vml_:line from="', -left ,' 0" to="', right ,' 0.05" ', + ' coordsize="100 100" coordorigin="0 0"', + ' filled="', !stroke, '" stroked="', !!stroke, + '" style="position:absolute;width:1px;height:1px;">'); + + if (stroke) { + appendStroke(this, lineStr); + } else { + // TODO: Fix the min and max params. + appendFill(this, lineStr, {x: -left, y: 0}, + {x: right, y: fontStyle.size}); + } + + var skewM = m[0][0].toFixed(3) + ',' + m[1][0].toFixed(3) + ',' + + m[0][1].toFixed(3) + ',' + m[1][1].toFixed(3) + ',0,0'; + + var skewOffset = mr(d.x / Z) + ',' + mr(d.y / Z); + + lineStr.push('<g_vml_:skew on="t" matrix="', skewM ,'" ', + ' offset="', skewOffset, '" origin="', left ,' 0" />', + '<g_vml_:path textpathok="true" />', + '<g_vml_:textpath on="true" string="', + encodeHtmlAttribute(text), + '" style="v-text-align:', textAlign, + ';font:', encodeHtmlAttribute(fontStyleString), + '" /></g_vml_:line>'); + + this.element_.insertAdjacentHTML('beforeEnd', lineStr.join('')); + }; + + contextPrototype.fillText = function(text, x, y, maxWidth) { + this.drawText_(text, x, y, maxWidth, false); + }; + + contextPrototype.strokeText = function(text, x, y, maxWidth) { + this.drawText_(text, x, y, maxWidth, true); + }; + + contextPrototype.measureText = function(text) { + if (!this.textMeasureEl_) { + var s = '<span style="position:absolute;' + + 'top:-20000px;left:0;padding:0;margin:0;border:none;' + + 'white-space:pre;"></span>'; + this.element_.insertAdjacentHTML('beforeEnd', s); + this.textMeasureEl_ = this.element_.lastChild; + } + var doc = this.element_.ownerDocument; + this.textMeasureEl_.innerHTML = ''; + this.textMeasureEl_.style.font = this.font; + // Don't use innerHTML or innerText because they allow markup/whitespace. + this.textMeasureEl_.appendChild(doc.createTextNode(text)); + return {width: this.textMeasureEl_.offsetWidth}; + }; + + /******** STUBS ********/ + contextPrototype.clip = function() { + // TODO: Implement + }; + + contextPrototype.arcTo = function() { + // TODO: Implement + }; + + contextPrototype.createPattern = function(image, repetition) { + return new CanvasPattern_(image, repetition); + }; + + // Gradient / Pattern Stubs + function CanvasGradient_(aType) { + this.type_ = aType; + this.x0_ = 0; + this.y0_ = 0; + this.r0_ = 0; + this.x1_ = 0; + this.y1_ = 0; + this.r1_ = 0; + this.colors_ = []; + } + + CanvasGradient_.prototype.addColorStop = function(aOffset, aColor) { + aColor = processStyle(aColor); + this.colors_.push({offset: aOffset, + color: aColor.color, + alpha: aColor.alpha}); + }; + + function CanvasPattern_(image, repetition) { + assertImageIsValid(image); + switch (repetition) { + case 'repeat': + case null: + case '': + this.repetition_ = 'repeat'; + break + case 'repeat-x': + case 'repeat-y': + case 'no-repeat': + this.repetition_ = repetition; + break; + default: + throwException('SYNTAX_ERR'); + } + + this.src_ = image.src; + this.width_ = image.width; + this.height_ = image.height; + } + + function throwException(s) { + throw new DOMException_(s); + } + + function assertImageIsValid(img) { + if (!img || img.nodeType != 1 || img.tagName != 'IMG') { + throwException('TYPE_MISMATCH_ERR'); + } + if (img.readyState != 'complete') { + throwException('INVALID_STATE_ERR'); + } + } + + function DOMException_(s) { + this.code = this[s]; + this.message = s +': DOM Exception ' + this.code; + } + var p = DOMException_.prototype = new Error; + p.INDEX_SIZE_ERR = 1; + p.DOMSTRING_SIZE_ERR = 2; + p.HIERARCHY_REQUEST_ERR = 3; + p.WRONG_DOCUMENT_ERR = 4; + p.INVALID_CHARACTER_ERR = 5; + p.NO_DATA_ALLOWED_ERR = 6; + p.NO_MODIFICATION_ALLOWED_ERR = 7; + p.NOT_FOUND_ERR = 8; + p.NOT_SUPPORTED_ERR = 9; + p.INUSE_ATTRIBUTE_ERR = 10; + p.INVALID_STATE_ERR = 11; + p.SYNTAX_ERR = 12; + p.INVALID_MODIFICATION_ERR = 13; + p.NAMESPACE_ERR = 14; + p.INVALID_ACCESS_ERR = 15; + p.VALIDATION_ERR = 16; + p.TYPE_MISMATCH_ERR = 17; + + // set up externs + G_vmlCanvasManager = G_vmlCanvasManager_; + CanvasRenderingContext2D = CanvasRenderingContext2D_; + CanvasGradient = CanvasGradient_; + CanvasPattern = CanvasPattern_; + DOMException = DOMException_; +})(); + +} // if diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/excanvas.min.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/excanvas.min.js new file mode 100644 index 0000000..12c74f7 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/excanvas.min.js @@ -0,0 +1 @@ +if(!document.createElement("canvas").getContext){(function(){var z=Math;var K=z.round;var J=z.sin;var U=z.cos;var b=z.abs;var k=z.sqrt;var D=10;var F=D/2;function T(){return this.context_||(this.context_=new W(this))}var O=Array.prototype.slice;function G(i,j,m){var Z=O.call(arguments,2);return function(){return i.apply(j,Z.concat(O.call(arguments)))}}function AD(Z){return String(Z).replace(/&/g,"&").replace(/"/g,""")}function r(i){if(!i.namespaces.g_vml_){i.namespaces.add("g_vml_","urn:schemas-microsoft-com:vml","#default#VML")}if(!i.namespaces.g_o_){i.namespaces.add("g_o_","urn:schemas-microsoft-com:office:office","#default#VML")}if(!i.styleSheets.ex_canvas_){var Z=i.createStyleSheet();Z.owningElement.id="ex_canvas_";Z.cssText="canvas{display:inline-block;overflow:hidden;text-align:left;width:300px;height:150px}"}}r(document);var E={init:function(Z){if(/MSIE/.test(navigator.userAgent)&&!window.opera){var i=Z||document;i.createElement("canvas");i.attachEvent("onreadystatechange",G(this.init_,this,i))}},init_:function(m){var j=m.getElementsByTagName("canvas");for(var Z=0;Z<j.length;Z++){this.initElement(j[Z])}},initElement:function(i){if(!i.getContext){i.getContext=T;r(i.ownerDocument);i.innerHTML="";i.attachEvent("onpropertychange",S);i.attachEvent("onresize",w);var Z=i.attributes;if(Z.width&&Z.width.specified){i.style.width=Z.width.nodeValue+"px"}else{i.width=i.clientWidth}if(Z.height&&Z.height.specified){i.style.height=Z.height.nodeValue+"px"}else{i.height=i.clientHeight}}return i}};function S(i){var Z=i.srcElement;switch(i.propertyName){case"width":Z.getContext().clearRect();Z.style.width=Z.attributes.width.nodeValue+"px";Z.firstChild.style.width=Z.clientWidth+"px";break;case"height":Z.getContext().clearRect();Z.style.height=Z.attributes.height.nodeValue+"px";Z.firstChild.style.height=Z.clientHeight+"px";break}}function w(i){var Z=i.srcElement;if(Z.firstChild){Z.firstChild.style.width=Z.clientWidth+"px";Z.firstChild.style.height=Z.clientHeight+"px"}}E.init();var I=[];for(var AC=0;AC<16;AC++){for(var AB=0;AB<16;AB++){I[AC*16+AB]=AC.toString(16)+AB.toString(16)}}function V(){return[[1,0,0],[0,1,0],[0,0,1]]}function d(m,j){var i=V();for(var Z=0;Z<3;Z++){for(var AF=0;AF<3;AF++){var p=0;for(var AE=0;AE<3;AE++){p+=m[Z][AE]*j[AE][AF]}i[Z][AF]=p}}return i}function Q(i,Z){Z.fillStyle=i.fillStyle;Z.lineCap=i.lineCap;Z.lineJoin=i.lineJoin;Z.lineWidth=i.lineWidth;Z.miterLimit=i.miterLimit;Z.shadowBlur=i.shadowBlur;Z.shadowColor=i.shadowColor;Z.shadowOffsetX=i.shadowOffsetX;Z.shadowOffsetY=i.shadowOffsetY;Z.strokeStyle=i.strokeStyle;Z.globalAlpha=i.globalAlpha;Z.font=i.font;Z.textAlign=i.textAlign;Z.textBaseline=i.textBaseline;Z.arcScaleX_=i.arcScaleX_;Z.arcScaleY_=i.arcScaleY_;Z.lineScale_=i.lineScale_}var B={aliceblue:"#F0F8FF",antiquewhite:"#FAEBD7",aquamarine:"#7FFFD4",azure:"#F0FFFF",beige:"#F5F5DC",bisque:"#FFE4C4",black:"#000000",blanchedalmond:"#FFEBCD",blueviolet:"#8A2BE2",brown:"#A52A2A",burlywood:"#DEB887",cadetblue:"#5F9EA0",chartreuse:"#7FFF00",chocolate:"#D2691E",coral:"#FF7F50",cornflowerblue:"#6495ED",cornsilk:"#FFF8DC",crimson:"#DC143C",cyan:"#00FFFF",darkblue:"#00008B",darkcyan:"#008B8B",darkgoldenrod:"#B8860B",darkgray:"#A9A9A9",darkgreen:"#006400",darkgrey:"#A9A9A9",darkkhaki:"#BDB76B",darkmagenta:"#8B008B",darkolivegreen:"#556B2F",darkorange:"#FF8C00",darkorchid:"#9932CC",darkred:"#8B0000",darksalmon:"#E9967A",darkseagreen:"#8FBC8F",darkslateblue:"#483D8B",darkslategray:"#2F4F4F",darkslategrey:"#2F4F4F",darkturquoise:"#00CED1",darkviolet:"#9400D3",deeppink:"#FF1493",deepskyblue:"#00BFFF",dimgray:"#696969",dimgrey:"#696969",dodgerblue:"#1E90FF",firebrick:"#B22222",floralwhite:"#FFFAF0",forestgreen:"#228B22",gainsboro:"#DCDCDC",ghostwhite:"#F8F8FF",gold:"#FFD700",goldenrod:"#DAA520",grey:"#808080",greenyellow:"#ADFF2F",honeydew:"#F0FFF0",hotpink:"#FF69B4",indianred:"#CD5C5C",indigo:"#4B0082",ivory:"#FFFFF0",khaki:"#F0E68C",lavender:"#E6E6FA",lavenderblush:"#FFF0F5",lawngreen:"#7CFC00",lemonchiffon:"#FFFACD",lightblue:"#ADD8E6",lightcoral:"#F08080",lightcyan:"#E0FFFF",lightgoldenrodyellow:"#FAFAD2",lightgreen:"#90EE90",lightgrey:"#D3D3D3",lightpink:"#FFB6C1",lightsalmon:"#FFA07A",lightseagreen:"#20B2AA",lightskyblue:"#87CEFA",lightslategray:"#778899",lightslategrey:"#778899",lightsteelblue:"#B0C4DE",lightyellow:"#FFFFE0",limegreen:"#32CD32",linen:"#FAF0E6",magenta:"#FF00FF",mediumaquamarine:"#66CDAA",mediumblue:"#0000CD",mediumorchid:"#BA55D3",mediumpurple:"#9370DB",mediumseagreen:"#3CB371",mediumslateblue:"#7B68EE",mediumspringgreen:"#00FA9A",mediumturquoise:"#48D1CC",mediumvioletred:"#C71585",midnightblue:"#191970",mintcream:"#F5FFFA",mistyrose:"#FFE4E1",moccasin:"#FFE4B5",navajowhite:"#FFDEAD",oldlace:"#FDF5E6",olivedrab:"#6B8E23",orange:"#FFA500",orangered:"#FF4500",orchid:"#DA70D6",palegoldenrod:"#EEE8AA",palegreen:"#98FB98",paleturquoise:"#AFEEEE",palevioletred:"#DB7093",papayawhip:"#FFEFD5",peachpuff:"#FFDAB9",peru:"#CD853F",pink:"#FFC0CB",plum:"#DDA0DD",powderblue:"#B0E0E6",rosybrown:"#BC8F8F",royalblue:"#4169E1",saddlebrown:"#8B4513",salmon:"#FA8072",sandybrown:"#F4A460",seagreen:"#2E8B57",seashell:"#FFF5EE",sienna:"#A0522D",skyblue:"#87CEEB",slateblue:"#6A5ACD",slategray:"#708090",slategrey:"#708090",snow:"#FFFAFA",springgreen:"#00FF7F",steelblue:"#4682B4",tan:"#D2B48C",thistle:"#D8BFD8",tomato:"#FF6347",turquoise:"#40E0D0",violet:"#EE82EE",wheat:"#F5DEB3",whitesmoke:"#F5F5F5",yellowgreen:"#9ACD32"};function g(i){var m=i.indexOf("(",3);var Z=i.indexOf(")",m+1);var j=i.substring(m+1,Z).split(",");if(j.length==4&&i.substr(3,1)=="a"){alpha=Number(j[3])}else{j[3]=1}return j}function C(Z){return parseFloat(Z)/100}function N(i,j,Z){return Math.min(Z,Math.max(j,i))}function c(AF){var j,i,Z;h=parseFloat(AF[0])/360%360;if(h<0){h++}s=N(C(AF[1]),0,1);l=N(C(AF[2]),0,1);if(s==0){j=i=Z=l}else{var m=l<0.5?l*(1+s):l+s-l*s;var AE=2*l-m;j=A(AE,m,h+1/3);i=A(AE,m,h);Z=A(AE,m,h-1/3)}return"#"+I[Math.floor(j*255)]+I[Math.floor(i*255)]+I[Math.floor(Z*255)]}function A(i,Z,j){if(j<0){j++}if(j>1){j--}if(6*j<1){return i+(Z-i)*6*j}else{if(2*j<1){return Z}else{if(3*j<2){return i+(Z-i)*(2/3-j)*6}else{return i}}}}function Y(Z){var AE,p=1;Z=String(Z);if(Z.charAt(0)=="#"){AE=Z}else{if(/^rgb/.test(Z)){var m=g(Z);var AE="#",AF;for(var j=0;j<3;j++){if(m[j].indexOf("%")!=-1){AF=Math.floor(C(m[j])*255)}else{AF=Number(m[j])}AE+=I[N(AF,0,255)]}p=m[3]}else{if(/^hsl/.test(Z)){var m=g(Z);AE=c(m);p=m[3]}else{AE=B[Z]||Z}}}return{color:AE,alpha:p}}var L={style:"normal",variant:"normal",weight:"normal",size:10,family:"sans-serif"};var f={};function X(Z){if(f[Z]){return f[Z]}var m=document.createElement("div");var j=m.style;try{j.font=Z}catch(i){}return f[Z]={style:j.fontStyle||L.style,variant:j.fontVariant||L.variant,weight:j.fontWeight||L.weight,size:j.fontSize||L.size,family:j.fontFamily||L.family}}function P(j,i){var Z={};for(var AF in j){Z[AF]=j[AF]}var AE=parseFloat(i.currentStyle.fontSize),m=parseFloat(j.size);if(typeof j.size=="number"){Z.size=j.size}else{if(j.size.indexOf("px")!=-1){Z.size=m}else{if(j.size.indexOf("em")!=-1){Z.size=AE*m}else{if(j.size.indexOf("%")!=-1){Z.size=(AE/100)*m}else{if(j.size.indexOf("pt")!=-1){Z.size=m/0.75}else{Z.size=AE}}}}}Z.size*=0.981;return Z}function AA(Z){return Z.style+" "+Z.variant+" "+Z.weight+" "+Z.size+"px "+Z.family}function t(Z){switch(Z){case"butt":return"flat";case"round":return"round";case"square":default:return"square"}}function W(i){this.m_=V();this.mStack_=[];this.aStack_=[];this.currentPath_=[];this.strokeStyle="#000";this.fillStyle="#000";this.lineWidth=1;this.lineJoin="miter";this.lineCap="butt";this.miterLimit=D*1;this.globalAlpha=1;this.font="10px sans-serif";this.textAlign="left";this.textBaseline="alphabetic";this.canvas=i;var Z=i.ownerDocument.createElement("div");Z.style.width=i.clientWidth+"px";Z.style.height=i.clientHeight+"px";Z.style.overflow="hidden";Z.style.position="absolute";i.appendChild(Z);this.element_=Z;this.arcScaleX_=1;this.arcScaleY_=1;this.lineScale_=1}var M=W.prototype;M.clearRect=function(){if(this.textMeasureEl_){this.textMeasureEl_.removeNode(true);this.textMeasureEl_=null}this.element_.innerHTML=""};M.beginPath=function(){this.currentPath_=[]};M.moveTo=function(i,Z){var j=this.getCoords_(i,Z);this.currentPath_.push({type:"moveTo",x:j.x,y:j.y});this.currentX_=j.x;this.currentY_=j.y};M.lineTo=function(i,Z){var j=this.getCoords_(i,Z);this.currentPath_.push({type:"lineTo",x:j.x,y:j.y});this.currentX_=j.x;this.currentY_=j.y};M.bezierCurveTo=function(j,i,AI,AH,AG,AE){var Z=this.getCoords_(AG,AE);var AF=this.getCoords_(j,i);var m=this.getCoords_(AI,AH);e(this,AF,m,Z)};function e(Z,m,j,i){Z.currentPath_.push({type:"bezierCurveTo",cp1x:m.x,cp1y:m.y,cp2x:j.x,cp2y:j.y,x:i.x,y:i.y});Z.currentX_=i.x;Z.currentY_=i.y}M.quadraticCurveTo=function(AG,j,i,Z){var AF=this.getCoords_(AG,j);var AE=this.getCoords_(i,Z);var AH={x:this.currentX_+2/3*(AF.x-this.currentX_),y:this.currentY_+2/3*(AF.y-this.currentY_)};var m={x:AH.x+(AE.x-this.currentX_)/3,y:AH.y+(AE.y-this.currentY_)/3};e(this,AH,m,AE)};M.arc=function(AJ,AH,AI,AE,i,j){AI*=D;var AN=j?"at":"wa";var AK=AJ+U(AE)*AI-F;var AM=AH+J(AE)*AI-F;var Z=AJ+U(i)*AI-F;var AL=AH+J(i)*AI-F;if(AK==Z&&!j){AK+=0.125}var m=this.getCoords_(AJ,AH);var AG=this.getCoords_(AK,AM);var AF=this.getCoords_(Z,AL);this.currentPath_.push({type:AN,x:m.x,y:m.y,radius:AI,xStart:AG.x,yStart:AG.y,xEnd:AF.x,yEnd:AF.y})};M.rect=function(j,i,Z,m){this.moveTo(j,i);this.lineTo(j+Z,i);this.lineTo(j+Z,i+m);this.lineTo(j,i+m);this.closePath()};M.strokeRect=function(j,i,Z,m){var p=this.currentPath_;this.beginPath();this.moveTo(j,i);this.lineTo(j+Z,i);this.lineTo(j+Z,i+m);this.lineTo(j,i+m);this.closePath();this.stroke();this.currentPath_=p};M.fillRect=function(j,i,Z,m){var p=this.currentPath_;this.beginPath();this.moveTo(j,i);this.lineTo(j+Z,i);this.lineTo(j+Z,i+m);this.lineTo(j,i+m);this.closePath();this.fill();this.currentPath_=p};M.createLinearGradient=function(i,m,Z,j){var p=new v("gradient");p.x0_=i;p.y0_=m;p.x1_=Z;p.y1_=j;return p};M.createRadialGradient=function(m,AE,j,i,p,Z){var AF=new v("gradientradial");AF.x0_=m;AF.y0_=AE;AF.r0_=j;AF.x1_=i;AF.y1_=p;AF.r1_=Z;return AF};M.drawImage=function(AO,j){var AH,AF,AJ,AV,AM,AK,AQ,AX;var AI=AO.runtimeStyle.width;var AN=AO.runtimeStyle.height;AO.runtimeStyle.width="auto";AO.runtimeStyle.height="auto";var AG=AO.width;var AT=AO.height;AO.runtimeStyle.width=AI;AO.runtimeStyle.height=AN;if(arguments.length==3){AH=arguments[1];AF=arguments[2];AM=AK=0;AQ=AJ=AG;AX=AV=AT}else{if(arguments.length==5){AH=arguments[1];AF=arguments[2];AJ=arguments[3];AV=arguments[4];AM=AK=0;AQ=AG;AX=AT}else{if(arguments.length==9){AM=arguments[1];AK=arguments[2];AQ=arguments[3];AX=arguments[4];AH=arguments[5];AF=arguments[6];AJ=arguments[7];AV=arguments[8]}else{throw Error("Invalid number of arguments")}}}var AW=this.getCoords_(AH,AF);var m=AQ/2;var i=AX/2;var AU=[];var Z=10;var AE=10;AU.push(" <g_vml_:group",' coordsize="',D*Z,",",D*AE,'"',' coordorigin="0,0"',' style="width:',Z,"px;height:",AE,"px;position:absolute;");if(this.m_[0][0]!=1||this.m_[0][1]||this.m_[1][1]!=1||this.m_[1][0]){var p=[];p.push("M11=",this.m_[0][0],",","M12=",this.m_[1][0],",","M21=",this.m_[0][1],",","M22=",this.m_[1][1],",","Dx=",K(AW.x/D),",","Dy=",K(AW.y/D),"");var AS=AW;var AR=this.getCoords_(AH+AJ,AF);var AP=this.getCoords_(AH,AF+AV);var AL=this.getCoords_(AH+AJ,AF+AV);AS.x=z.max(AS.x,AR.x,AP.x,AL.x);AS.y=z.max(AS.y,AR.y,AP.y,AL.y);AU.push("padding:0 ",K(AS.x/D),"px ",K(AS.y/D),"px 0;filter:progid:DXImageTransform.Microsoft.Matrix(",p.join(""),", sizingmethod='clip');")}else{AU.push("top:",K(AW.y/D),"px;left:",K(AW.x/D),"px;")}AU.push(' ">','<g_vml_:image src="',AO.src,'"',' style="width:',D*AJ,"px;"," height:",D*AV,'px"',' cropleft="',AM/AG,'"',' croptop="',AK/AT,'"',' cropright="',(AG-AM-AQ)/AG,'"',' cropbottom="',(AT-AK-AX)/AT,'"'," />","</g_vml_:group>");this.element_.insertAdjacentHTML("BeforeEnd",AU.join(""))};M.stroke=function(AM){var m=10;var AN=10;var AE=5000;var AG={x:null,y:null};var AL={x:null,y:null};for(var AH=0;AH<this.currentPath_.length;AH+=AE){var AK=[];var AF=false;AK.push("<g_vml_:shape",' filled="',!!AM,'"',' style="position:absolute;width:',m,"px;height:",AN,'px;"',' coordorigin="0,0"',' coordsize="',D*m,",",D*AN,'"',' stroked="',!AM,'"',' path="');var AO=false;for(var AI=AH;AI<Math.min(AH+AE,this.currentPath_.length);AI++){if(AI%AE==0&&AI>0){AK.push(" m ",K(this.currentPath_[AI-1].x),",",K(this.currentPath_[AI-1].y))}var Z=this.currentPath_[AI];var AJ;switch(Z.type){case"moveTo":AJ=Z;AK.push(" m ",K(Z.x),",",K(Z.y));break;case"lineTo":AK.push(" l ",K(Z.x),",",K(Z.y));break;case"close":AK.push(" x ");Z=null;break;case"bezierCurveTo":AK.push(" c ",K(Z.cp1x),",",K(Z.cp1y),",",K(Z.cp2x),",",K(Z.cp2y),",",K(Z.x),",",K(Z.y));break;case"at":case"wa":AK.push(" ",Z.type," ",K(Z.x-this.arcScaleX_*Z.radius),",",K(Z.y-this.arcScaleY_*Z.radius)," ",K(Z.x+this.arcScaleX_*Z.radius),",",K(Z.y+this.arcScaleY_*Z.radius)," ",K(Z.xStart),",",K(Z.yStart)," ",K(Z.xEnd),",",K(Z.yEnd));break}if(Z){if(AG.x==null||Z.x<AG.x){AG.x=Z.x}if(AL.x==null||Z.x>AL.x){AL.x=Z.x}if(AG.y==null||Z.y<AG.y){AG.y=Z.y}if(AL.y==null||Z.y>AL.y){AL.y=Z.y}}}AK.push(' ">');if(!AM){R(this,AK)}else{a(this,AK,AG,AL)}AK.push("</g_vml_:shape>");this.element_.insertAdjacentHTML("beforeEnd",AK.join(""))}};function R(j,AE){var i=Y(j.strokeStyle);var m=i.color;var p=i.alpha*j.globalAlpha;var Z=j.lineScale_*j.lineWidth;if(Z<1){p*=Z}AE.push("<g_vml_:stroke",' opacity="',p,'"',' joinstyle="',j.lineJoin,'"',' miterlimit="',j.miterLimit,'"',' endcap="',t(j.lineCap),'"',' weight="',Z,'px"',' color="',m,'" />')}function a(AO,AG,Ah,AP){var AH=AO.fillStyle;var AY=AO.arcScaleX_;var AX=AO.arcScaleY_;var Z=AP.x-Ah.x;var m=AP.y-Ah.y;if(AH instanceof v){var AL=0;var Ac={x:0,y:0};var AU=0;var AK=1;if(AH.type_=="gradient"){var AJ=AH.x0_/AY;var j=AH.y0_/AX;var AI=AH.x1_/AY;var Aj=AH.y1_/AX;var Ag=AO.getCoords_(AJ,j);var Af=AO.getCoords_(AI,Aj);var AE=Af.x-Ag.x;var p=Af.y-Ag.y;AL=Math.atan2(AE,p)*180/Math.PI;if(AL<0){AL+=360}if(AL<0.000001){AL=0}}else{var Ag=AO.getCoords_(AH.x0_,AH.y0_);Ac={x:(Ag.x-Ah.x)/Z,y:(Ag.y-Ah.y)/m};Z/=AY*D;m/=AX*D;var Aa=z.max(Z,m);AU=2*AH.r0_/Aa;AK=2*AH.r1_/Aa-AU}var AS=AH.colors_;AS.sort(function(Ak,i){return Ak.offset-i.offset});var AN=AS.length;var AR=AS[0].color;var AQ=AS[AN-1].color;var AW=AS[0].alpha*AO.globalAlpha;var AV=AS[AN-1].alpha*AO.globalAlpha;var Ab=[];for(var Ae=0;Ae<AN;Ae++){var AM=AS[Ae];Ab.push(AM.offset*AK+AU+" "+AM.color)}AG.push('<g_vml_:fill type="',AH.type_,'"',' method="none" focus="100%"',' color="',AR,'"',' color2="',AQ,'"',' colors="',Ab.join(","),'"',' opacity="',AV,'"',' g_o_:opacity2="',AW,'"',' angle="',AL,'"',' focusposition="',Ac.x,",",Ac.y,'" />')}else{if(AH instanceof u){if(Z&&m){var AF=-Ah.x;var AZ=-Ah.y;AG.push("<g_vml_:fill",' position="',AF/Z*AY*AY,",",AZ/m*AX*AX,'"',' type="tile"',' src="',AH.src_,'" />')}}else{var Ai=Y(AO.fillStyle);var AT=Ai.color;var Ad=Ai.alpha*AO.globalAlpha;AG.push('<g_vml_:fill color="',AT,'" opacity="',Ad,'" />')}}}M.fill=function(){this.stroke(true)};M.closePath=function(){this.currentPath_.push({type:"close"})};M.getCoords_=function(j,i){var Z=this.m_;return{x:D*(j*Z[0][0]+i*Z[1][0]+Z[2][0])-F,y:D*(j*Z[0][1]+i*Z[1][1]+Z[2][1])-F}};M.save=function(){var Z={};Q(this,Z);this.aStack_.push(Z);this.mStack_.push(this.m_);this.m_=d(V(),this.m_)};M.restore=function(){if(this.aStack_.length){Q(this.aStack_.pop(),this);this.m_=this.mStack_.pop()}};function H(Z){return isFinite(Z[0][0])&&isFinite(Z[0][1])&&isFinite(Z[1][0])&&isFinite(Z[1][1])&&isFinite(Z[2][0])&&isFinite(Z[2][1])}function y(i,Z,j){if(!H(Z)){return }i.m_=Z;if(j){var p=Z[0][0]*Z[1][1]-Z[0][1]*Z[1][0];i.lineScale_=k(b(p))}}M.translate=function(j,i){var Z=[[1,0,0],[0,1,0],[j,i,1]];y(this,d(Z,this.m_),false)};M.rotate=function(i){var m=U(i);var j=J(i);var Z=[[m,j,0],[-j,m,0],[0,0,1]];y(this,d(Z,this.m_),false)};M.scale=function(j,i){this.arcScaleX_*=j;this.arcScaleY_*=i;var Z=[[j,0,0],[0,i,0],[0,0,1]];y(this,d(Z,this.m_),true)};M.transform=function(p,m,AF,AE,i,Z){var j=[[p,m,0],[AF,AE,0],[i,Z,1]];y(this,d(j,this.m_),true)};M.setTransform=function(AE,p,AG,AF,j,i){var Z=[[AE,p,0],[AG,AF,0],[j,i,1]];y(this,Z,true)};M.drawText_=function(AK,AI,AH,AN,AG){var AM=this.m_,AQ=1000,i=0,AP=AQ,AF={x:0,y:0},AE=[];var Z=P(X(this.font),this.element_);var j=AA(Z);var AR=this.element_.currentStyle;var p=this.textAlign.toLowerCase();switch(p){case"left":case"center":case"right":break;case"end":p=AR.direction=="ltr"?"right":"left";break;case"start":p=AR.direction=="rtl"?"right":"left";break;default:p="left"}switch(this.textBaseline){case"hanging":case"top":AF.y=Z.size/1.75;break;case"middle":break;default:case null:case"alphabetic":case"ideographic":case"bottom":AF.y=-Z.size/2.25;break}switch(p){case"right":i=AQ;AP=0.05;break;case"center":i=AP=AQ/2;break}var AO=this.getCoords_(AI+AF.x,AH+AF.y);AE.push('<g_vml_:line from="',-i,' 0" to="',AP,' 0.05" ',' coordsize="100 100" coordorigin="0 0"',' filled="',!AG,'" stroked="',!!AG,'" style="position:absolute;width:1px;height:1px;">');if(AG){R(this,AE)}else{a(this,AE,{x:-i,y:0},{x:AP,y:Z.size})}var AL=AM[0][0].toFixed(3)+","+AM[1][0].toFixed(3)+","+AM[0][1].toFixed(3)+","+AM[1][1].toFixed(3)+",0,0";var AJ=K(AO.x/D)+","+K(AO.y/D);AE.push('<g_vml_:skew on="t" matrix="',AL,'" ',' offset="',AJ,'" origin="',i,' 0" />','<g_vml_:path textpathok="true" />','<g_vml_:textpath on="true" string="',AD(AK),'" style="v-text-align:',p,";font:",AD(j),'" /></g_vml_:line>');this.element_.insertAdjacentHTML("beforeEnd",AE.join(""))};M.fillText=function(j,Z,m,i){this.drawText_(j,Z,m,i,false)};M.strokeText=function(j,Z,m,i){this.drawText_(j,Z,m,i,true)};M.measureText=function(j){if(!this.textMeasureEl_){var Z='<span style="position:absolute;top:-20000px;left:0;padding:0;margin:0;border:none;white-space:pre;"></span>';this.element_.insertAdjacentHTML("beforeEnd",Z);this.textMeasureEl_=this.element_.lastChild}var i=this.element_.ownerDocument;this.textMeasureEl_.innerHTML="";this.textMeasureEl_.style.font=this.font;this.textMeasureEl_.appendChild(i.createTextNode(j));return{width:this.textMeasureEl_.offsetWidth}};M.clip=function(){};M.arcTo=function(){};M.createPattern=function(i,Z){return new u(i,Z)};function v(Z){this.type_=Z;this.x0_=0;this.y0_=0;this.r0_=0;this.x1_=0;this.y1_=0;this.r1_=0;this.colors_=[]}v.prototype.addColorStop=function(i,Z){Z=Y(Z);this.colors_.push({offset:i,color:Z.color,alpha:Z.alpha})};function u(i,Z){q(i);switch(Z){case"repeat":case null:case"":this.repetition_="repeat";break;case"repeat-x":case"repeat-y":case"no-repeat":this.repetition_=Z;break;default:n("SYNTAX_ERR")}this.src_=i.src;this.width_=i.width;this.height_=i.height}function n(Z){throw new o(Z)}function q(Z){if(!Z||Z.nodeType!=1||Z.tagName!="IMG"){n("TYPE_MISMATCH_ERR")}if(Z.readyState!="complete"){n("INVALID_STATE_ERR")}}function o(Z){this.code=this[Z];this.message=Z+": DOM Exception "+this.code}var x=o.prototype=new Error;x.INDEX_SIZE_ERR=1;x.DOMSTRING_SIZE_ERR=2;x.HIERARCHY_REQUEST_ERR=3;x.WRONG_DOCUMENT_ERR=4;x.INVALID_CHARACTER_ERR=5;x.NO_DATA_ALLOWED_ERR=6;x.NO_MODIFICATION_ALLOWED_ERR=7;x.NOT_FOUND_ERR=8;x.NOT_SUPPORTED_ERR=9;x.INUSE_ATTRIBUTE_ERR=10;x.INVALID_STATE_ERR=11;x.SYNTAX_ERR=12;x.INVALID_MODIFICATION_ERR=13;x.NAMESPACE_ERR=14;x.INVALID_ACCESS_ERR=15;x.VALIDATION_ERR=16;x.TYPE_MISMATCH_ERR=17;G_vmlCanvasManager=E;CanvasRenderingContext2D=W;CanvasGradient=v;CanvasPattern=u;DOMException=o})()};
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.colorhelpers.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.colorhelpers.js new file mode 100644 index 0000000..d3524d7 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.colorhelpers.js @@ -0,0 +1,179 @@ +/* Plugin for jQuery for working with colors. + * + * Version 1.1. + * + * Inspiration from jQuery color animation plugin by John Resig. + * + * Released under the MIT license by Ole Laursen, October 2009. + * + * Examples: + * + * $.color.parse("#fff").scale('rgb', 0.25).add('a', -0.5).toString() + * var c = $.color.extract($("#mydiv"), 'background-color'); + * console.log(c.r, c.g, c.b, c.a); + * $.color.make(100, 50, 25, 0.4).toString() // returns "rgba(100,50,25,0.4)" + * + * Note that .scale() and .add() return the same modified object + * instead of making a new one. + * + * V. 1.1: Fix error handling so e.g. parsing an empty string does + * produce a color rather than just crashing. + */ + +(function($) { + $.color = {}; + + // construct color object with some convenient chainable helpers + $.color.make = function (r, g, b, a) { + var o = {}; + o.r = r || 0; + o.g = g || 0; + o.b = b || 0; + o.a = a != null ? a : 1; + + o.add = function (c, d) { + for (var i = 0; i < c.length; ++i) + o[c.charAt(i)] += d; + return o.normalize(); + }; + + o.scale = function (c, f) { + for (var i = 0; i < c.length; ++i) + o[c.charAt(i)] *= f; + return o.normalize(); + }; + + o.toString = function () { + if (o.a >= 1.0) { + return "rgb("+[o.r, o.g, o.b].join(",")+")"; + } else { + return "rgba("+[o.r, o.g, o.b, o.a].join(",")+")"; + } + }; + + o.normalize = function () { + function clamp(min, value, max) { + return value < min ? min: (value > max ? max: value); + } + + o.r = clamp(0, parseInt(o.r), 255); + o.g = clamp(0, parseInt(o.g), 255); + o.b = clamp(0, parseInt(o.b), 255); + o.a = clamp(0, o.a, 1); + return o; + }; + + o.clone = function () { + return $.color.make(o.r, o.b, o.g, o.a); + }; + + return o.normalize(); + } + + // extract CSS color property from element, going up in the DOM + // if it's "transparent" + $.color.extract = function (elem, css) { + var c; + do { + c = elem.css(css).toLowerCase(); + // keep going until we find an element that has color, or + // we hit the body + if (c != '' && c != 'transparent') + break; + elem = elem.parent(); + } while (!$.nodeName(elem.get(0), "body")); + + // catch Safari's way of signalling transparent + if (c == "rgba(0, 0, 0, 0)") + c = "transparent"; + + return $.color.parse(c); + } + + // parse CSS color string (like "rgb(10, 32, 43)" or "#fff"), + // returns color object, if parsing failed, you get black (0, 0, + // 0) out + $.color.parse = function (str) { + var res, m = $.color.make; + + // Look for rgb(num,num,num) + if (res = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(str)) + return m(parseInt(res[1], 10), parseInt(res[2], 10), parseInt(res[3], 10)); + + // Look for rgba(num,num,num,num) + if (res = /rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str)) + return m(parseInt(res[1], 10), parseInt(res[2], 10), parseInt(res[3], 10), parseFloat(res[4])); + + // Look for rgb(num%,num%,num%) + if (res = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(str)) + return m(parseFloat(res[1])*2.55, parseFloat(res[2])*2.55, parseFloat(res[3])*2.55); + + // Look for rgba(num%,num%,num%,num) + if (res = /rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str)) + return m(parseFloat(res[1])*2.55, parseFloat(res[2])*2.55, parseFloat(res[3])*2.55, parseFloat(res[4])); + + // Look for #a0b1c2 + if (res = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(str)) + return m(parseInt(res[1], 16), parseInt(res[2], 16), parseInt(res[3], 16)); + + // Look for #fff + if (res = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(str)) + return m(parseInt(res[1]+res[1], 16), parseInt(res[2]+res[2], 16), parseInt(res[3]+res[3], 16)); + + // Otherwise, we're most likely dealing with a named color + var name = $.trim(str).toLowerCase(); + if (name == "transparent") + return m(255, 255, 255, 0); + else { + // default to black + res = lookupColors[name] || [0, 0, 0]; + return m(res[0], res[1], res[2]); + } + } + + var lookupColors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0] + }; +})(jQuery); diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.colorhelpers.min.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.colorhelpers.min.js new file mode 100644 index 0000000..7f44c57 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.colorhelpers.min.js @@ -0,0 +1 @@ +(function(b){b.color={};b.color.make=function(f,e,c,d){var h={};h.r=f||0;h.g=e||0;h.b=c||0;h.a=d!=null?d:1;h.add=function(k,j){for(var g=0;g<k.length;++g){h[k.charAt(g)]+=j}return h.normalize()};h.scale=function(k,j){for(var g=0;g<k.length;++g){h[k.charAt(g)]*=j}return h.normalize()};h.toString=function(){if(h.a>=1){return"rgb("+[h.r,h.g,h.b].join(",")+")"}else{return"rgba("+[h.r,h.g,h.b,h.a].join(",")+")"}};h.normalize=function(){function g(j,k,i){return k<j?j:(k>i?i:k)}h.r=g(0,parseInt(h.r),255);h.g=g(0,parseInt(h.g),255);h.b=g(0,parseInt(h.b),255);h.a=g(0,h.a,1);return h};h.clone=function(){return b.color.make(h.r,h.b,h.g,h.a)};return h.normalize()};b.color.extract=function(e,d){var f;do{f=e.css(d).toLowerCase();if(f!=""&&f!="transparent"){break}e=e.parent()}while(!b.nodeName(e.get(0),"body"));if(f=="rgba(0, 0, 0, 0)"){f="transparent"}return b.color.parse(f)};b.color.parse=function(f){var e,c=b.color.make;if(e=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(f)){return c(parseInt(e[1],10),parseInt(e[2],10),parseInt(e[3],10))}if(e=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(f)){return c(parseInt(e[1],10),parseInt(e[2],10),parseInt(e[3],10),parseFloat(e[4]))}if(e=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(f)){return c(parseFloat(e[1])*2.55,parseFloat(e[2])*2.55,parseFloat(e[3])*2.55)}if(e=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(f)){return c(parseFloat(e[1])*2.55,parseFloat(e[2])*2.55,parseFloat(e[3])*2.55,parseFloat(e[4]))}if(e=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(f)){return c(parseInt(e[1],16),parseInt(e[2],16),parseInt(e[3],16))}if(e=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(f)){return c(parseInt(e[1]+e[1],16),parseInt(e[2]+e[2],16),parseInt(e[3]+e[3],16))}var d=b.trim(f).toLowerCase();if(d=="transparent"){return c(255,255,255,0)}else{e=a[d]||[0,0,0];return c(e[0],e[1],e[2])}};var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery);
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.crosshair.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.crosshair.js new file mode 100644 index 0000000..1d433f0 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.crosshair.js @@ -0,0 +1,167 @@ +/* +Flot plugin for showing crosshairs, thin lines, when the mouse hovers +over the plot. + + crosshair: { + mode: null or "x" or "y" or "xy" + color: color + lineWidth: number + } + +Set the mode to one of "x", "y" or "xy". The "x" mode enables a +vertical crosshair that lets you trace the values on the x axis, "y" +enables a horizontal crosshair and "xy" enables them both. "color" is +the color of the crosshair (default is "rgba(170, 0, 0, 0.80)"), +"lineWidth" is the width of the drawn lines (default is 1). + +The plugin also adds four public methods: + + - setCrosshair(pos) + + Set the position of the crosshair. Note that this is cleared if + the user moves the mouse. "pos" is in coordinates of the plot and + should be on the form { x: xpos, y: ypos } (you can use x2/x3/... + if you're using multiple axes), which is coincidentally the same + format as what you get from a "plothover" event. If "pos" is null, + the crosshair is cleared. + + - clearCrosshair() + + Clear the crosshair. + + - lockCrosshair(pos) + + Cause the crosshair to lock to the current location, no longer + updating if the user moves the mouse. Optionally supply a position + (passed on to setCrosshair()) to move it to. + + Example usage: + var myFlot = $.plot( $("#graph"), ..., { crosshair: { mode: "x" } } }; + $("#graph").bind("plothover", function (evt, position, item) { + if (item) { + // Lock the crosshair to the data point being hovered + myFlot.lockCrosshair({ x: item.datapoint[0], y: item.datapoint[1] }); + } + else { + // Return normal crosshair operation + myFlot.unlockCrosshair(); + } + }); + + - unlockCrosshair() + + Free the crosshair to move again after locking it. +*/ + +(function ($) { + var options = { + crosshair: { + mode: null, // one of null, "x", "y" or "xy", + color: "rgba(170, 0, 0, 0.80)", + lineWidth: 1 + } + }; + + function init(plot) { + // position of crosshair in pixels + var crosshair = { x: -1, y: -1, locked: false }; + + plot.setCrosshair = function setCrosshair(pos) { + if (!pos) + crosshair.x = -1; + else { + var o = plot.p2c(pos); + crosshair.x = Math.max(0, Math.min(o.left, plot.width())); + crosshair.y = Math.max(0, Math.min(o.top, plot.height())); + } + + plot.triggerRedrawOverlay(); + }; + + plot.clearCrosshair = plot.setCrosshair; // passes null for pos + + plot.lockCrosshair = function lockCrosshair(pos) { + if (pos) + plot.setCrosshair(pos); + crosshair.locked = true; + } + + plot.unlockCrosshair = function unlockCrosshair() { + crosshair.locked = false; + } + + function onMouseOut(e) { + if (crosshair.locked) + return; + + if (crosshair.x != -1) { + crosshair.x = -1; + plot.triggerRedrawOverlay(); + } + } + + function onMouseMove(e) { + if (crosshair.locked) + return; + + if (plot.getSelection && plot.getSelection()) { + crosshair.x = -1; // hide the crosshair while selecting + return; + } + + var offset = plot.offset(); + crosshair.x = Math.max(0, Math.min(e.pageX - offset.left, plot.width())); + crosshair.y = Math.max(0, Math.min(e.pageY - offset.top, plot.height())); + plot.triggerRedrawOverlay(); + } + + plot.hooks.bindEvents.push(function (plot, eventHolder) { + if (!plot.getOptions().crosshair.mode) + return; + + eventHolder.mouseout(onMouseOut); + eventHolder.mousemove(onMouseMove); + }); + + plot.hooks.drawOverlay.push(function (plot, ctx) { + var c = plot.getOptions().crosshair; + if (!c.mode) + return; + + var plotOffset = plot.getPlotOffset(); + + ctx.save(); + ctx.translate(plotOffset.left, plotOffset.top); + + if (crosshair.x != -1) { + ctx.strokeStyle = c.color; + ctx.lineWidth = c.lineWidth; + ctx.lineJoin = "round"; + + ctx.beginPath(); + if (c.mode.indexOf("x") != -1) { + ctx.moveTo(crosshair.x, 0); + ctx.lineTo(crosshair.x, plot.height()); + } + if (c.mode.indexOf("y") != -1) { + ctx.moveTo(0, crosshair.y); + ctx.lineTo(plot.width(), crosshair.y); + } + ctx.stroke(); + } + ctx.restore(); + }); + + plot.hooks.shutdown.push(function (plot, eventHolder) { + eventHolder.unbind("mouseout", onMouseOut); + eventHolder.unbind("mousemove", onMouseMove); + }); + } + + $.plot.plugins.push({ + init: init, + options: options, + name: 'crosshair', + version: '1.0' + }); +})(jQuery); diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.crosshair.min.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.crosshair.min.js new file mode 100644 index 0000000..ccaf240 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.crosshair.min.js @@ -0,0 +1 @@ +(function(b){var a={crosshair:{mode:null,color:"rgba(170, 0, 0, 0.80)",lineWidth:1}};function c(h){var j={x:-1,y:-1,locked:false};h.setCrosshair=function e(l){if(!l){j.x=-1}else{var k=h.p2c(l);j.x=Math.max(0,Math.min(k.left,h.width()));j.y=Math.max(0,Math.min(k.top,h.height()))}h.triggerRedrawOverlay()};h.clearCrosshair=h.setCrosshair;h.lockCrosshair=function f(k){if(k){h.setCrosshair(k)}j.locked=true};h.unlockCrosshair=function g(){j.locked=false};function d(k){if(j.locked){return}if(j.x!=-1){j.x=-1;h.triggerRedrawOverlay()}}function i(k){if(j.locked){return}if(h.getSelection&&h.getSelection()){j.x=-1;return}var l=h.offset();j.x=Math.max(0,Math.min(k.pageX-l.left,h.width()));j.y=Math.max(0,Math.min(k.pageY-l.top,h.height()));h.triggerRedrawOverlay()}h.hooks.bindEvents.push(function(l,k){if(!l.getOptions().crosshair.mode){return}k.mouseout(d);k.mousemove(i)});h.hooks.drawOverlay.push(function(m,k){var n=m.getOptions().crosshair;if(!n.mode){return}var l=m.getPlotOffset();k.save();k.translate(l.left,l.top);if(j.x!=-1){k.strokeStyle=n.color;k.lineWidth=n.lineWidth;k.lineJoin="round";k.beginPath();if(n.mode.indexOf("x")!=-1){k.moveTo(j.x,0);k.lineTo(j.x,m.height())}if(n.mode.indexOf("y")!=-1){k.moveTo(0,j.y);k.lineTo(m.width(),j.y)}k.stroke()}k.restore()});h.hooks.shutdown.push(function(l,k){k.unbind("mouseout",d);k.unbind("mousemove",i)})}b.plot.plugins.push({init:c,options:a,name:"crosshair",version:"1.0"})})(jQuery);
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.fillbetween.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.fillbetween.js new file mode 100644 index 0000000..69700e7 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.fillbetween.js @@ -0,0 +1,183 @@ +/* +Flot plugin for computing bottoms for filled line and bar charts. + +The case: you've got two series that you want to fill the area +between. In Flot terms, you need to use one as the fill bottom of the +other. You can specify the bottom of each data point as the third +coordinate manually, or you can use this plugin to compute it for you. + +In order to name the other series, you need to give it an id, like this + + var dataset = [ + { data: [ ... ], id: "foo" } , // use default bottom + { data: [ ... ], fillBetween: "foo" }, // use first dataset as bottom + ]; + + $.plot($("#placeholder"), dataset, { line: { show: true, fill: true }}); + +As a convenience, if the id given is a number that doesn't appear as +an id in the series, it is interpreted as the index in the array +instead (so fillBetween: 0 can also mean the first series). + +Internally, the plugin modifies the datapoints in each series. For +line series, extra data points might be inserted through +interpolation. Note that at points where the bottom line is not +defined (due to a null point or start/end of line), the current line +will show a gap too. The algorithm comes from the jquery.flot.stack.js +plugin, possibly some code could be shared. +*/ + +(function ($) { + var options = { + series: { fillBetween: null } // or number + }; + + function init(plot) { + function findBottomSeries(s, allseries) { + var i; + for (i = 0; i < allseries.length; ++i) { + if (allseries[i].id == s.fillBetween) + return allseries[i]; + } + + if (typeof s.fillBetween == "number") { + i = s.fillBetween; + + if (i < 0 || i >= allseries.length) + return null; + + return allseries[i]; + } + + return null; + } + + function computeFillBottoms(plot, s, datapoints) { + if (s.fillBetween == null) + return; + + var other = findBottomSeries(s, plot.getData()); + if (!other) + return; + + var ps = datapoints.pointsize, + points = datapoints.points, + otherps = other.datapoints.pointsize, + otherpoints = other.datapoints.points, + newpoints = [], + px, py, intery, qx, qy, bottom, + withlines = s.lines.show, + withbottom = ps > 2 && datapoints.format[2].y, + withsteps = withlines && s.lines.steps, + fromgap = true, + i = 0, j = 0, l; + + while (true) { + if (i >= points.length) + break; + + l = newpoints.length; + + if (points[i] == null) { + // copy gaps + for (m = 0; m < ps; ++m) + newpoints.push(points[i + m]); + i += ps; + } + else if (j >= otherpoints.length) { + // for lines, we can't use the rest of the points + if (!withlines) { + for (m = 0; m < ps; ++m) + newpoints.push(points[i + m]); + } + i += ps; + } + else if (otherpoints[j] == null) { + // oops, got a gap + for (m = 0; m < ps; ++m) + newpoints.push(null); + fromgap = true; + j += otherps; + } + else { + // cases where we actually got two points + px = points[i]; + py = points[i + 1]; + qx = otherpoints[j]; + qy = otherpoints[j + 1]; + bottom = 0; + + if (px == qx) { + for (m = 0; m < ps; ++m) + newpoints.push(points[i + m]); + + //newpoints[l + 1] += qy; + bottom = qy; + + i += ps; + j += otherps; + } + else if (px > qx) { + // we got past point below, might need to + // insert interpolated extra point + if (withlines && i > 0 && points[i - ps] != null) { + intery = py + (points[i - ps + 1] - py) * (qx - px) / (points[i - ps] - px); + newpoints.push(qx); + newpoints.push(intery) + for (m = 2; m < ps; ++m) + newpoints.push(points[i + m]); + bottom = qy; + } + + j += otherps; + } + else { // px < qx + if (fromgap && withlines) { + // if we come from a gap, we just skip this point + i += ps; + continue; + } + + for (m = 0; m < ps; ++m) + newpoints.push(points[i + m]); + + // we might be able to interpolate a point below, + // this can give us a better y + if (withlines && j > 0 && otherpoints[j - otherps] != null) + bottom = qy + (otherpoints[j - otherps + 1] - qy) * (px - qx) / (otherpoints[j - otherps] - qx); + + //newpoints[l + 1] += bottom; + + i += ps; + } + + fromgap = false; + + if (l != newpoints.length && withbottom) + newpoints[l + 2] = bottom; + } + + // maintain the line steps invariant + if (withsteps && l != newpoints.length && l > 0 + && newpoints[l] != null + && newpoints[l] != newpoints[l - ps] + && newpoints[l + 1] != newpoints[l - ps + 1]) { + for (m = 0; m < ps; ++m) + newpoints[l + ps + m] = newpoints[l + m]; + newpoints[l + 1] = newpoints[l - ps + 1]; + } + } + + datapoints.points = newpoints; + } + + plot.hooks.processDatapoints.push(computeFillBottoms); + } + + $.plot.plugins.push({ + init: init, + options: options, + name: 'fillbetween', + version: '1.0' + }); +})(jQuery); diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.fillbetween.min.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.fillbetween.min.js new file mode 100644 index 0000000..47f3dfb --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.fillbetween.min.js @@ -0,0 +1 @@ +(function(b){var a={series:{fillBetween:null}};function c(f){function d(j,h){var g;for(g=0;g<h.length;++g){if(h[g].id==j.fillBetween){return h[g]}}if(typeof j.fillBetween=="number"){g=j.fillBetween;if(g<0||g>=h.length){return null}return h[g]}return null}function e(B,u,g){if(u.fillBetween==null){return}var p=d(u,B.getData());if(!p){return}var y=g.pointsize,E=g.points,h=p.datapoints.pointsize,x=p.datapoints.points,r=[],w,v,k,G,F,q,t=u.lines.show,o=y>2&&g.format[2].y,n=t&&u.lines.steps,D=true,C=0,A=0,z;while(true){if(C>=E.length){break}z=r.length;if(E[C]==null){for(m=0;m<y;++m){r.push(E[C+m])}C+=y}else{if(A>=x.length){if(!t){for(m=0;m<y;++m){r.push(E[C+m])}}C+=y}else{if(x[A]==null){for(m=0;m<y;++m){r.push(null)}D=true;A+=h}else{w=E[C];v=E[C+1];G=x[A];F=x[A+1];q=0;if(w==G){for(m=0;m<y;++m){r.push(E[C+m])}q=F;C+=y;A+=h}else{if(w>G){if(t&&C>0&&E[C-y]!=null){k=v+(E[C-y+1]-v)*(G-w)/(E[C-y]-w);r.push(G);r.push(k);for(m=2;m<y;++m){r.push(E[C+m])}q=F}A+=h}else{if(D&&t){C+=y;continue}for(m=0;m<y;++m){r.push(E[C+m])}if(t&&A>0&&x[A-h]!=null){q=F+(x[A-h+1]-F)*(w-G)/(x[A-h]-G)}C+=y}}D=false;if(z!=r.length&&o){r[z+2]=q}}}}if(n&&z!=r.length&&z>0&&r[z]!=null&&r[z]!=r[z-y]&&r[z+1]!=r[z-y+1]){for(m=0;m<y;++m){r[z+y+m]=r[z+m]}r[z+1]=r[z-y+1]}}g.points=r}f.hooks.processDatapoints.push(e)}b.plot.plugins.push({init:c,options:a,name:"fillbetween",version:"1.0"})})(jQuery);
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.image.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.image.js new file mode 100644 index 0000000..29ccb12 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.image.js @@ -0,0 +1,238 @@ +/* +Flot plugin for plotting images, e.g. useful for putting ticks on a +prerendered complex visualization. + +The data syntax is [[image, x1, y1, x2, y2], ...] where (x1, y1) and +(x2, y2) are where you intend the two opposite corners of the image to +end up in the plot. Image must be a fully loaded Javascript image (you +can make one with new Image()). If the image is not complete, it's +skipped when plotting. + +There are two helpers included for retrieving images. The easiest work +the way that you put in URLs instead of images in the data (like +["myimage.png", 0, 0, 10, 10]), then call $.plot.image.loadData(data, +options, callback) where data and options are the same as you pass in +to $.plot. This loads the images, replaces the URLs in the data with +the corresponding images and calls "callback" when all images are +loaded (or failed loading). In the callback, you can then call $.plot +with the data set. See the included example. + +A more low-level helper, $.plot.image.load(urls, callback) is also +included. Given a list of URLs, it calls callback with an object +mapping from URL to Image object when all images are loaded or have +failed loading. + +Options for the plugin are + + series: { + images: { + show: boolean + anchor: "corner" or "center" + alpha: [0,1] + } + } + +which can be specified for a specific series + + $.plot($("#placeholder"), [{ data: [ ... ], images: { ... } ]) + +Note that because the data format is different from usual data points, +you can't use images with anything else in a specific data series. + +Setting "anchor" to "center" causes the pixels in the image to be +anchored at the corner pixel centers inside of at the pixel corners, +effectively letting half a pixel stick out to each side in the plot. + + +A possible future direction could be support for tiling for large +images (like Google Maps). + +*/ + +(function ($) { + var options = { + series: { + images: { + show: false, + alpha: 1, + anchor: "corner" // or "center" + } + } + }; + + $.plot.image = {}; + + $.plot.image.loadDataImages = function (series, options, callback) { + var urls = [], points = []; + + var defaultShow = options.series.images.show; + + $.each(series, function (i, s) { + if (!(defaultShow || s.images.show)) + return; + + if (s.data) + s = s.data; + + $.each(s, function (i, p) { + if (typeof p[0] == "string") { + urls.push(p[0]); + points.push(p); + } + }); + }); + + $.plot.image.load(urls, function (loadedImages) { + $.each(points, function (i, p) { + var url = p[0]; + if (loadedImages[url]) + p[0] = loadedImages[url]; + }); + + callback(); + }); + } + + $.plot.image.load = function (urls, callback) { + var missing = urls.length, loaded = {}; + if (missing == 0) + callback({}); + + $.each(urls, function (i, url) { + var handler = function () { + --missing; + + loaded[url] = this; + + if (missing == 0) + callback(loaded); + }; + + $('<img />').load(handler).error(handler).attr('src', url); + }); + } + + function drawSeries(plot, ctx, series) { + var plotOffset = plot.getPlotOffset(); + + if (!series.images || !series.images.show) + return; + + var points = series.datapoints.points, + ps = series.datapoints.pointsize; + + for (var i = 0; i < points.length; i += ps) { + var img = points[i], + x1 = points[i + 1], y1 = points[i + 2], + x2 = points[i + 3], y2 = points[i + 4], + xaxis = series.xaxis, yaxis = series.yaxis, + tmp; + + // actually we should check img.complete, but it + // appears to be a somewhat unreliable indicator in + // IE6 (false even after load event) + if (!img || img.width <= 0 || img.height <= 0) + continue; + + if (x1 > x2) { + tmp = x2; + x2 = x1; + x1 = tmp; + } + if (y1 > y2) { + tmp = y2; + y2 = y1; + y1 = tmp; + } + + // if the anchor is at the center of the pixel, expand the + // image by 1/2 pixel in each direction + if (series.images.anchor == "center") { + tmp = 0.5 * (x2-x1) / (img.width - 1); + x1 -= tmp; + x2 += tmp; + tmp = 0.5 * (y2-y1) / (img.height - 1); + y1 -= tmp; + y2 += tmp; + } + + // clip + if (x1 == x2 || y1 == y2 || + x1 >= xaxis.max || x2 <= xaxis.min || + y1 >= yaxis.max || y2 <= yaxis.min) + continue; + + var sx1 = 0, sy1 = 0, sx2 = img.width, sy2 = img.height; + if (x1 < xaxis.min) { + sx1 += (sx2 - sx1) * (xaxis.min - x1) / (x2 - x1); + x1 = xaxis.min; + } + + if (x2 > xaxis.max) { + sx2 += (sx2 - sx1) * (xaxis.max - x2) / (x2 - x1); + x2 = xaxis.max; + } + + if (y1 < yaxis.min) { + sy2 += (sy1 - sy2) * (yaxis.min - y1) / (y2 - y1); + y1 = yaxis.min; + } + + if (y2 > yaxis.max) { + sy1 += (sy1 - sy2) * (yaxis.max - y2) / (y2 - y1); + y2 = yaxis.max; + } + + x1 = xaxis.p2c(x1); + x2 = xaxis.p2c(x2); + y1 = yaxis.p2c(y1); + y2 = yaxis.p2c(y2); + + // the transformation may have swapped us + if (x1 > x2) { + tmp = x2; + x2 = x1; + x1 = tmp; + } + if (y1 > y2) { + tmp = y2; + y2 = y1; + y1 = tmp; + } + + tmp = ctx.globalAlpha; + ctx.globalAlpha *= series.images.alpha; + ctx.drawImage(img, + sx1, sy1, sx2 - sx1, sy2 - sy1, + x1 + plotOffset.left, y1 + plotOffset.top, + x2 - x1, y2 - y1); + ctx.globalAlpha = tmp; + } + } + + function processRawData(plot, series, data, datapoints) { + if (!series.images.show) + return; + + // format is Image, x1, y1, x2, y2 (opposite corners) + datapoints.format = [ + { required: true }, + { x: true, number: true, required: true }, + { y: true, number: true, required: true }, + { x: true, number: true, required: true }, + { y: true, number: true, required: true } + ]; + } + + function init(plot) { + plot.hooks.processRawData.push(processRawData); + plot.hooks.drawSeries.push(drawSeries); + } + + $.plot.plugins.push({ + init: init, + options: options, + name: 'image', + version: '1.1' + }); +})(jQuery); diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.image.min.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.image.min.js new file mode 100644 index 0000000..9480c1e --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.image.min.js @@ -0,0 +1 @@ +(function(c){var a={series:{images:{show:false,alpha:1,anchor:"corner"}}};c.plot.image={};c.plot.image.loadDataImages=function(g,f,k){var j=[],h=[];var i=f.series.images.show;c.each(g,function(l,m){if(!(i||m.images.show)){return}if(m.data){m=m.data}c.each(m,function(n,o){if(typeof o[0]=="string"){j.push(o[0]);h.push(o)}})});c.plot.image.load(j,function(l){c.each(h,function(n,o){var m=o[0];if(l[m]){o[0]=l[m]}});k()})};c.plot.image.load=function(h,i){var g=h.length,f={};if(g==0){i({})}c.each(h,function(k,j){var l=function(){--g;f[j]=this;if(g==0){i(f)}};c("<img />").load(l).error(l).attr("src",j)})};function d(q,o,l){var m=q.getPlotOffset();if(!l.images||!l.images.show){return}var r=l.datapoints.points,n=l.datapoints.pointsize;for(var t=0;t<r.length;t+=n){var y=r[t],w=r[t+1],g=r[t+2],v=r[t+3],f=r[t+4],h=l.xaxis,u=l.yaxis,x;if(!y||y.width<=0||y.height<=0){continue}if(w>v){x=v;v=w;w=x}if(g>f){x=f;f=g;g=x}if(l.images.anchor=="center"){x=0.5*(v-w)/(y.width-1);w-=x;v+=x;x=0.5*(f-g)/(y.height-1);g-=x;f+=x}if(w==v||g==f||w>=h.max||v<=h.min||g>=u.max||f<=u.min){continue}var k=0,s=0,j=y.width,p=y.height;if(w<h.min){k+=(j-k)*(h.min-w)/(v-w);w=h.min}if(v>h.max){j+=(j-k)*(h.max-v)/(v-w);v=h.max}if(g<u.min){p+=(s-p)*(u.min-g)/(f-g);g=u.min}if(f>u.max){s+=(s-p)*(u.max-f)/(f-g);f=u.max}w=h.p2c(w);v=h.p2c(v);g=u.p2c(g);f=u.p2c(f);if(w>v){x=v;v=w;w=x}if(g>f){x=f;f=g;g=x}x=o.globalAlpha;o.globalAlpha*=l.images.alpha;o.drawImage(y,k,s,j-k,p-s,w+m.left,g+m.top,v-w,f-g);o.globalAlpha=x}}function b(i,f,g,h){if(!f.images.show){return}h.format=[{required:true},{x:true,number:true,required:true},{y:true,number:true,required:true},{x:true,number:true,required:true},{y:true,number:true,required:true}]}function e(f){f.hooks.processRawData.push(b);f.hooks.drawSeries.push(d)}c.plot.plugins.push({init:e,options:a,name:"image",version:"1.1"})})(jQuery);
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.js new file mode 100644 index 0000000..aabc544 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.js @@ -0,0 +1,2599 @@ +/*! Javascript plotting library for jQuery, v. 0.7. + * + * Released under the MIT license by IOLA, December 2007. + * + */ + +// first an inline dependency, jquery.colorhelpers.js, we inline it here +// for convenience + +/* Plugin for jQuery for working with colors. + * + * Version 1.1. + * + * Inspiration from jQuery color animation plugin by John Resig. + * + * Released under the MIT license by Ole Laursen, October 2009. + * + * Examples: + * + * $.color.parse("#fff").scale('rgb', 0.25).add('a', -0.5).toString() + * var c = $.color.extract($("#mydiv"), 'background-color'); + * console.log(c.r, c.g, c.b, c.a); + * $.color.make(100, 50, 25, 0.4).toString() // returns "rgba(100,50,25,0.4)" + * + * Note that .scale() and .add() return the same modified object + * instead of making a new one. + * + * V. 1.1: Fix error handling so e.g. parsing an empty string does + * produce a color rather than just crashing. + */ +(function(B){B.color={};B.color.make=function(F,E,C,D){var G={};G.r=F||0;G.g=E||0;G.b=C||0;G.a=D!=null?D:1;G.add=function(J,I){for(var H=0;H<J.length;++H){G[J.charAt(H)]+=I}return G.normalize()};G.scale=function(J,I){for(var H=0;H<J.length;++H){G[J.charAt(H)]*=I}return G.normalize()};G.toString=function(){if(G.a>=1){return"rgb("+[G.r,G.g,G.b].join(",")+")"}else{return"rgba("+[G.r,G.g,G.b,G.a].join(",")+")"}};G.normalize=function(){function H(J,K,I){return K<J?J:(K>I?I:K)}G.r=H(0,parseInt(G.r),255);G.g=H(0,parseInt(G.g),255);G.b=H(0,parseInt(G.b),255);G.a=H(0,G.a,1);return G};G.clone=function(){return B.color.make(G.r,G.b,G.g,G.a)};return G.normalize()};B.color.extract=function(D,C){var E;do{E=D.css(C).toLowerCase();if(E!=""&&E!="transparent"){break}D=D.parent()}while(!B.nodeName(D.get(0),"body"));if(E=="rgba(0, 0, 0, 0)"){E="transparent"}return B.color.parse(E)};B.color.parse=function(F){var E,C=B.color.make;if(E=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(F)){return C(parseInt(E[1],10),parseInt(E[2],10),parseInt(E[3],10))}if(E=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(F)){return C(parseInt(E[1],10),parseInt(E[2],10),parseInt(E[3],10),parseFloat(E[4]))}if(E=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(F)){return C(parseFloat(E[1])*2.55,parseFloat(E[2])*2.55,parseFloat(E[3])*2.55)}if(E=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(F)){return C(parseFloat(E[1])*2.55,parseFloat(E[2])*2.55,parseFloat(E[3])*2.55,parseFloat(E[4]))}if(E=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(F)){return C(parseInt(E[1],16),parseInt(E[2],16),parseInt(E[3],16))}if(E=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(F)){return C(parseInt(E[1]+E[1],16),parseInt(E[2]+E[2],16),parseInt(E[3]+E[3],16))}var D=B.trim(F).toLowerCase();if(D=="transparent"){return C(255,255,255,0)}else{E=A[D]||[0,0,0];return C(E[0],E[1],E[2])}};var A={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery); + +// the actual Flot code +(function($) { + function Plot(placeholder, data_, options_, plugins) { + // data is on the form: + // [ series1, series2 ... ] + // where series is either just the data as [ [x1, y1], [x2, y2], ... ] + // or { data: [ [x1, y1], [x2, y2], ... ], label: "some label", ... } + + var series = [], + options = { + // the color theme used for graphs + colors: ["#edc240", "#afd8f8", "#cb4b4b", "#4da74d", "#9440ed"], + legend: { + show: true, + noColumns: 1, // number of colums in legend table + labelFormatter: null, // fn: string -> string + labelBoxBorderColor: "#ccc", // border color for the little label boxes + container: null, // container (as jQuery object) to put legend in, null means default on top of graph + position: "ne", // position of default legend container within plot + margin: 5, // distance from grid edge to default legend container within plot + backgroundColor: null, // null means auto-detect + backgroundOpacity: 0.85 // set to 0 to avoid background + }, + xaxis: { + show: null, // null = auto-detect, true = always, false = never + position: "bottom", // or "top" + mode: null, // null or "time" + color: null, // base color, labels, ticks + tickColor: null, // possibly different color of ticks, e.g. "rgba(0,0,0,0.15)" + transform: null, // null or f: number -> number to transform axis + inverseTransform: null, // if transform is set, this should be the inverse function + min: null, // min. value to show, null means set automatically + max: null, // max. value to show, null means set automatically + autoscaleMargin: null, // margin in % to add if auto-setting min/max + ticks: null, // either [1, 3] or [[1, "a"], 3] or (fn: axis info -> ticks) or app. number of ticks for auto-ticks + tickFormatter: null, // fn: number -> string + labelWidth: null, // size of tick labels in pixels + labelHeight: null, + reserveSpace: null, // whether to reserve space even if axis isn't shown + tickLength: null, // size in pixels of ticks, or "full" for whole line + alignTicksWithAxis: null, // axis number or null for no sync + + // mode specific options + tickDecimals: null, // no. of decimals, null means auto + tickSize: null, // number or [number, "unit"] + minTickSize: null, // number or [number, "unit"] + monthNames: null, // list of names of months + timeformat: null, // format string to use + twelveHourClock: false // 12 or 24 time in time mode + }, + yaxis: { + autoscaleMargin: 0.02, + position: "left" // or "right" + }, + xaxes: [], + yaxes: [], + series: { + points: { + show: false, + radius: 3, + lineWidth: 2, // in pixels + fill: true, + fillColor: "#ffffff", + symbol: "circle" // or callback + }, + lines: { + // we don't put in show: false so we can see + // whether lines were actively disabled + lineWidth: 2, // in pixels + fill: false, + fillColor: null, + steps: false + }, + bars: { + show: false, + lineWidth: 2, // in pixels + barWidth: 1, // in units of the x axis + fill: true, + fillColor: null, + align: "left", // or "center" + horizontal: false + }, + shadowSize: 3 + }, + grid: { + show: true, + aboveData: false, + color: "#545454", // primary color used for outline and labels + backgroundColor: null, // null for transparent, else color + borderColor: null, // set if different from the grid color + tickColor: null, // color for the ticks, e.g. "rgba(0,0,0,0.15)" + labelMargin: 5, // in pixels + axisMargin: 8, // in pixels + borderWidth: 2, // in pixels + minBorderMargin: null, // in pixels, null means taken from points radius + markings: null, // array of ranges or fn: axes -> array of ranges + markingsColor: "#f4f4f4", + markingsLineWidth: 2, + // interactive stuff + clickable: false, + hoverable: false, + autoHighlight: true, // highlight in case mouse is near + mouseActiveRadius: 10 // how far the mouse can be away to activate an item + }, + hooks: {} + }, + canvas = null, // the canvas for the plot itself + overlay = null, // canvas for interactive stuff on top of plot + eventHolder = null, // jQuery object that events should be bound to + ctx = null, octx = null, + xaxes = [], yaxes = [], + plotOffset = { left: 0, right: 0, top: 0, bottom: 0}, + canvasWidth = 0, canvasHeight = 0, + plotWidth = 0, plotHeight = 0, + hooks = { + processOptions: [], + processRawData: [], + processDatapoints: [], + drawSeries: [], + draw: [], + bindEvents: [], + drawOverlay: [], + shutdown: [] + }, + plot = this; + + // public functions + plot.setData = setData; + plot.setupGrid = setupGrid; + plot.draw = draw; + plot.getPlaceholder = function() { return placeholder; }; + plot.getCanvas = function() { return canvas; }; + plot.getPlotOffset = function() { return plotOffset; }; + plot.width = function () { return plotWidth; }; + plot.height = function () { return plotHeight; }; + plot.offset = function () { + var o = eventHolder.offset(); + o.left += plotOffset.left; + o.top += plotOffset.top; + return o; + }; + plot.getData = function () { return series; }; + plot.getAxes = function () { + var res = {}, i; + $.each(xaxes.concat(yaxes), function (_, axis) { + if (axis) + res[axis.direction + (axis.n != 1 ? axis.n : "") + "axis"] = axis; + }); + return res; + }; + plot.getXAxes = function () { return xaxes; }; + plot.getYAxes = function () { return yaxes; }; + plot.c2p = canvasToAxisCoords; + plot.p2c = axisToCanvasCoords; + plot.getOptions = function () { return options; }; + plot.highlight = highlight; + plot.unhighlight = unhighlight; + plot.triggerRedrawOverlay = triggerRedrawOverlay; + plot.pointOffset = function(point) { + return { + left: parseInt(xaxes[axisNumber(point, "x") - 1].p2c(+point.x) + plotOffset.left), + top: parseInt(yaxes[axisNumber(point, "y") - 1].p2c(+point.y) + plotOffset.top) + }; + }; + plot.shutdown = shutdown; + plot.resize = function () { + getCanvasDimensions(); + resizeCanvas(canvas); + resizeCanvas(overlay); + }; + + // public attributes + plot.hooks = hooks; + + // initialize + initPlugins(plot); + parseOptions(options_); + setupCanvases(); + setData(data_); + setupGrid(); + draw(); + bindEvents(); + + + function executeHooks(hook, args) { + args = [plot].concat(args); + for (var i = 0; i < hook.length; ++i) + hook[i].apply(this, args); + } + + function initPlugins() { + for (var i = 0; i < plugins.length; ++i) { + var p = plugins[i]; + p.init(plot); + if (p.options) + $.extend(true, options, p.options); + } + } + + function parseOptions(opts) { + var i; + + $.extend(true, options, opts); + + if (options.xaxis.color == null) + options.xaxis.color = options.grid.color; + if (options.yaxis.color == null) + options.yaxis.color = options.grid.color; + + if (options.xaxis.tickColor == null) // backwards-compatibility + options.xaxis.tickColor = options.grid.tickColor; + if (options.yaxis.tickColor == null) // backwards-compatibility + options.yaxis.tickColor = options.grid.tickColor; + + if (options.grid.borderColor == null) + options.grid.borderColor = options.grid.color; + if (options.grid.tickColor == null) + options.grid.tickColor = $.color.parse(options.grid.color).scale('a', 0.22).toString(); + + // fill in defaults in axes, copy at least always the + // first as the rest of the code assumes it'll be there + for (i = 0; i < Math.max(1, options.xaxes.length); ++i) + options.xaxes[i] = $.extend(true, {}, options.xaxis, options.xaxes[i]); + for (i = 0; i < Math.max(1, options.yaxes.length); ++i) + options.yaxes[i] = $.extend(true, {}, options.yaxis, options.yaxes[i]); + + // backwards compatibility, to be removed in future + if (options.xaxis.noTicks && options.xaxis.ticks == null) + options.xaxis.ticks = options.xaxis.noTicks; + if (options.yaxis.noTicks && options.yaxis.ticks == null) + options.yaxis.ticks = options.yaxis.noTicks; + if (options.x2axis) { + options.xaxes[1] = $.extend(true, {}, options.xaxis, options.x2axis); + options.xaxes[1].position = "top"; + } + if (options.y2axis) { + options.yaxes[1] = $.extend(true, {}, options.yaxis, options.y2axis); + options.yaxes[1].position = "right"; + } + if (options.grid.coloredAreas) + options.grid.markings = options.grid.coloredAreas; + if (options.grid.coloredAreasColor) + options.grid.markingsColor = options.grid.coloredAreasColor; + if (options.lines) + $.extend(true, options.series.lines, options.lines); + if (options.points) + $.extend(true, options.series.points, options.points); + if (options.bars) + $.extend(true, options.series.bars, options.bars); + if (options.shadowSize != null) + options.series.shadowSize = options.shadowSize; + + // save options on axes for future reference + for (i = 0; i < options.xaxes.length; ++i) + getOrCreateAxis(xaxes, i + 1).options = options.xaxes[i]; + for (i = 0; i < options.yaxes.length; ++i) + getOrCreateAxis(yaxes, i + 1).options = options.yaxes[i]; + + // add hooks from options + for (var n in hooks) + if (options.hooks[n] && options.hooks[n].length) + hooks[n] = hooks[n].concat(options.hooks[n]); + + executeHooks(hooks.processOptions, [options]); + } + + function setData(d) { + series = parseData(d); + fillInSeriesOptions(); + processData(); + } + + function parseData(d) { + var res = []; + for (var i = 0; i < d.length; ++i) { + var s = $.extend(true, {}, options.series); + + if (d[i].data != null) { + s.data = d[i].data; // move the data instead of deep-copy + delete d[i].data; + + $.extend(true, s, d[i]); + + d[i].data = s.data; + } + else + s.data = d[i]; + res.push(s); + } + + return res; + } + + function axisNumber(obj, coord) { + var a = obj[coord + "axis"]; + if (typeof a == "object") // if we got a real axis, extract number + a = a.n; + if (typeof a != "number") + a = 1; // default to first axis + return a; + } + + function allAxes() { + // return flat array without annoying null entries + return $.grep(xaxes.concat(yaxes), function (a) { return a; }); + } + + function canvasToAxisCoords(pos) { + // return an object with x/y corresponding to all used axes + var res = {}, i, axis; + for (i = 0; i < xaxes.length; ++i) { + axis = xaxes[i]; + if (axis && axis.used) + res["x" + axis.n] = axis.c2p(pos.left); + } + + for (i = 0; i < yaxes.length; ++i) { + axis = yaxes[i]; + if (axis && axis.used) + res["y" + axis.n] = axis.c2p(pos.top); + } + + if (res.x1 !== undefined) + res.x = res.x1; + if (res.y1 !== undefined) + res.y = res.y1; + + return res; + } + + function axisToCanvasCoords(pos) { + // get canvas coords from the first pair of x/y found in pos + var res = {}, i, axis, key; + + for (i = 0; i < xaxes.length; ++i) { + axis = xaxes[i]; + if (axis && axis.used) { + key = "x" + axis.n; + if (pos[key] == null && axis.n == 1) + key = "x"; + + if (pos[key] != null) { + res.left = axis.p2c(pos[key]); + break; + } + } + } + + for (i = 0; i < yaxes.length; ++i) { + axis = yaxes[i]; + if (axis && axis.used) { + key = "y" + axis.n; + if (pos[key] == null && axis.n == 1) + key = "y"; + + if (pos[key] != null) { + res.top = axis.p2c(pos[key]); + break; + } + } + } + + return res; + } + + function getOrCreateAxis(axes, number) { + if (!axes[number - 1]) + axes[number - 1] = { + n: number, // save the number for future reference + direction: axes == xaxes ? "x" : "y", + options: $.extend(true, {}, axes == xaxes ? options.xaxis : options.yaxis) + }; + + return axes[number - 1]; + } + + function fillInSeriesOptions() { + var i; + + // collect what we already got of colors + var neededColors = series.length, + usedColors = [], + assignedColors = []; + for (i = 0; i < series.length; ++i) { + var sc = series[i].color; + if (sc != null) { + --neededColors; + if (typeof sc == "number") + assignedColors.push(sc); + else + usedColors.push($.color.parse(series[i].color)); + } + } + + // we might need to generate more colors if higher indices + // are assigned + for (i = 0; i < assignedColors.length; ++i) { + neededColors = Math.max(neededColors, assignedColors[i] + 1); + } + + // produce colors as needed + var colors = [], variation = 0; + i = 0; + while (colors.length < neededColors) { + var c; + if (options.colors.length == i) // check degenerate case + c = $.color.make(100, 100, 100); + else + c = $.color.parse(options.colors[i]); + + // vary color if needed + var sign = variation % 2 == 1 ? -1 : 1; + c.scale('rgb', 1 + sign * Math.ceil(variation / 2) * 0.2) + + // FIXME: if we're getting to close to something else, + // we should probably skip this one + colors.push(c); + + ++i; + if (i >= options.colors.length) { + i = 0; + ++variation; + } + } + + // fill in the options + var colori = 0, s; + for (i = 0; i < series.length; ++i) { + s = series[i]; + + // assign colors + if (s.color == null) { + s.color = colors[colori].toString(); + ++colori; + } + else if (typeof s.color == "number") + s.color = colors[s.color].toString(); + + // turn on lines automatically in case nothing is set + if (s.lines.show == null) { + var v, show = true; + for (v in s) + if (s[v] && s[v].show) { + show = false; + break; + } + if (show) + s.lines.show = true; + } + + // setup axes + s.xaxis = getOrCreateAxis(xaxes, axisNumber(s, "x")); + s.yaxis = getOrCreateAxis(yaxes, axisNumber(s, "y")); + } + } + + function processData() { + var topSentry = Number.POSITIVE_INFINITY, + bottomSentry = Number.NEGATIVE_INFINITY, + fakeInfinity = Number.MAX_VALUE, + i, j, k, m, length, + s, points, ps, x, y, axis, val, f, p; + + function updateAxis(axis, min, max) { + if (min < axis.datamin && min != -fakeInfinity) + axis.datamin = min; + if (max > axis.datamax && max != fakeInfinity) + axis.datamax = max; + } + + $.each(allAxes(), function (_, axis) { + // init axis + axis.datamin = topSentry; + axis.datamax = bottomSentry; + axis.used = false; + }); + + for (i = 0; i < series.length; ++i) { + s = series[i]; + s.datapoints = { points: [] }; + + executeHooks(hooks.processRawData, [ s, s.data, s.datapoints ]); + } + + // first pass: clean and copy data + for (i = 0; i < series.length; ++i) { + s = series[i]; + + var data = s.data, format = s.datapoints.format; + + if (!format) { + format = []; + // find out how to copy + format.push({ x: true, number: true, required: true }); + format.push({ y: true, number: true, required: true }); + + if (s.bars.show || (s.lines.show && s.lines.fill)) { + format.push({ y: true, number: true, required: false, defaultValue: 0 }); + if (s.bars.horizontal) { + delete format[format.length - 1].y; + format[format.length - 1].x = true; + } + } + + s.datapoints.format = format; + } + + if (s.datapoints.pointsize != null) + continue; // already filled in + + s.datapoints.pointsize = format.length; + + ps = s.datapoints.pointsize; + points = s.datapoints.points; + + insertSteps = s.lines.show && s.lines.steps; + s.xaxis.used = s.yaxis.used = true; + + for (j = k = 0; j < data.length; ++j, k += ps) { + p = data[j]; + + var nullify = p == null; + if (!nullify) { + for (m = 0; m < ps; ++m) { + val = p[m]; + f = format[m]; + + if (f) { + if (f.number && val != null) { + val = +val; // convert to number + if (isNaN(val)) + val = null; + else if (val == Infinity) + val = fakeInfinity; + else if (val == -Infinity) + val = -fakeInfinity; + } + + if (val == null) { + if (f.required) + nullify = true; + + if (f.defaultValue != null) + val = f.defaultValue; + } + } + + points[k + m] = val; + } + } + + if (nullify) { + for (m = 0; m < ps; ++m) { + val = points[k + m]; + if (val != null) { + f = format[m]; + // extract min/max info + if (f.x) + updateAxis(s.xaxis, val, val); + if (f.y) + updateAxis(s.yaxis, val, val); + } + points[k + m] = null; + } + } + else { + // a little bit of line specific stuff that + // perhaps shouldn't be here, but lacking + // better means... + if (insertSteps && k > 0 + && points[k - ps] != null + && points[k - ps] != points[k] + && points[k - ps + 1] != points[k + 1]) { + // copy the point to make room for a middle point + for (m = 0; m < ps; ++m) + points[k + ps + m] = points[k + m]; + + // middle point has same y + points[k + 1] = points[k - ps + 1]; + + // we've added a point, better reflect that + k += ps; + } + } + } + } + + // give the hooks a chance to run + for (i = 0; i < series.length; ++i) { + s = series[i]; + + executeHooks(hooks.processDatapoints, [ s, s.datapoints]); + } + + // second pass: find datamax/datamin for auto-scaling + for (i = 0; i < series.length; ++i) { + s = series[i]; + points = s.datapoints.points, + ps = s.datapoints.pointsize; + + var xmin = topSentry, ymin = topSentry, + xmax = bottomSentry, ymax = bottomSentry; + + for (j = 0; j < points.length; j += ps) { + if (points[j] == null) + continue; + + for (m = 0; m < ps; ++m) { + val = points[j + m]; + f = format[m]; + if (!f || val == fakeInfinity || val == -fakeInfinity) + continue; + + if (f.x) { + if (val < xmin) + xmin = val; + if (val > xmax) + xmax = val; + } + if (f.y) { + if (val < ymin) + ymin = val; + if (val > ymax) + ymax = val; + } + } + } + + if (s.bars.show) { + // make sure we got room for the bar on the dancing floor + var delta = s.bars.align == "left" ? 0 : -s.bars.barWidth/2; + if (s.bars.horizontal) { + ymin += delta; + ymax += delta + s.bars.barWidth; + } + else { + xmin += delta; + xmax += delta + s.bars.barWidth; + } + } + + updateAxis(s.xaxis, xmin, xmax); + updateAxis(s.yaxis, ymin, ymax); + } + + $.each(allAxes(), function (_, axis) { + if (axis.datamin == topSentry) + axis.datamin = null; + if (axis.datamax == bottomSentry) + axis.datamax = null; + }); + } + + function makeCanvas(skipPositioning, cls) { + var c = document.createElement('canvas'); + c.className = cls; + c.width = canvasWidth; + c.height = canvasHeight; + + if (!skipPositioning) + $(c).css({ position: 'absolute', left: 0, top: 0 }); + + $(c).appendTo(placeholder); + + if (!c.getContext) // excanvas hack + c = window.G_vmlCanvasManager.initElement(c); + + // used for resetting in case we get replotted + c.getContext("2d").save(); + + return c; + } + + function getCanvasDimensions() { + canvasWidth = placeholder.width(); + canvasHeight = placeholder.height(); + + if (canvasWidth <= 0 || canvasHeight <= 0) + throw "Invalid dimensions for plot, width = " + canvasWidth + ", height = " + canvasHeight; + } + + function resizeCanvas(c) { + // resizing should reset the state (excanvas seems to be + // buggy though) + if (c.width != canvasWidth) + c.width = canvasWidth; + + if (c.height != canvasHeight) + c.height = canvasHeight; + + // so try to get back to the initial state (even if it's + // gone now, this should be safe according to the spec) + var cctx = c.getContext("2d"); + cctx.restore(); + + // and save again + cctx.save(); + } + + function setupCanvases() { + var reused, + existingCanvas = placeholder.children("canvas.base"), + existingOverlay = placeholder.children("canvas.overlay"); + + if (existingCanvas.length == 0 || existingOverlay == 0) { + // init everything + + placeholder.html(""); // make sure placeholder is clear + + placeholder.css({ padding: 0 }); // padding messes up the positioning + + if (placeholder.css("position") == 'static') + placeholder.css("position", "relative"); // for positioning labels and overlay + + getCanvasDimensions(); + + canvas = makeCanvas(true, "base"); + overlay = makeCanvas(false, "overlay"); // overlay canvas for interactive features + + reused = false; + } + else { + // reuse existing elements + + canvas = existingCanvas.get(0); + overlay = existingOverlay.get(0); + + reused = true; + } + + ctx = canvas.getContext("2d"); + octx = overlay.getContext("2d"); + + // we include the canvas in the event holder too, because IE 7 + // sometimes has trouble with the stacking order + eventHolder = $([overlay, canvas]); + + if (reused) { + // run shutdown in the old plot object + placeholder.data("plot").shutdown(); + + // reset reused canvases + plot.resize(); + + // make sure overlay pixels are cleared (canvas is cleared when we redraw) + octx.clearRect(0, 0, canvasWidth, canvasHeight); + + // then whack any remaining obvious garbage left + eventHolder.unbind(); + placeholder.children().not([canvas, overlay]).remove(); + } + + // save in case we get replotted + placeholder.data("plot", plot); + } + + function bindEvents() { + // bind events + if (options.grid.hoverable) { + eventHolder.mousemove(onMouseMove); + eventHolder.mouseleave(onMouseLeave); + } + + if (options.grid.clickable) + eventHolder.click(onClick); + + executeHooks(hooks.bindEvents, [eventHolder]); + } + + function shutdown() { + if (redrawTimeout) + clearTimeout(redrawTimeout); + + eventHolder.unbind("mousemove", onMouseMove); + eventHolder.unbind("mouseleave", onMouseLeave); + eventHolder.unbind("click", onClick); + + executeHooks(hooks.shutdown, [eventHolder]); + } + + function setTransformationHelpers(axis) { + // set helper functions on the axis, assumes plot area + // has been computed already + + function identity(x) { return x; } + + var s, m, t = axis.options.transform || identity, + it = axis.options.inverseTransform; + + // precompute how much the axis is scaling a point + // in canvas space + if (axis.direction == "x") { + s = axis.scale = plotWidth / Math.abs(t(axis.max) - t(axis.min)); + m = Math.min(t(axis.max), t(axis.min)); + } + else { + s = axis.scale = plotHeight / Math.abs(t(axis.max) - t(axis.min)); + s = -s; + m = Math.max(t(axis.max), t(axis.min)); + } + + // data point to canvas coordinate + if (t == identity) // slight optimization + axis.p2c = function (p) { return (p - m) * s; }; + else + axis.p2c = function (p) { return (t(p) - m) * s; }; + // canvas coordinate to data point + if (!it) + axis.c2p = function (c) { return m + c / s; }; + else + axis.c2p = function (c) { return it(m + c / s); }; + } + + function measureTickLabels(axis) { + var opts = axis.options, i, ticks = axis.ticks || [], labels = [], + l, w = opts.labelWidth, h = opts.labelHeight, dummyDiv; + + function makeDummyDiv(labels, width) { + return $('<div style="position:absolute;top:-10000px;' + width + 'font-size:smaller">' + + '<div class="' + axis.direction + 'Axis ' + axis.direction + axis.n + 'Axis">' + + labels.join("") + '</div></div>') + .appendTo(placeholder); + } + + if (axis.direction == "x") { + // to avoid measuring the widths of the labels (it's slow), we + // construct fixed-size boxes and put the labels inside + // them, we don't need the exact figures and the + // fixed-size box content is easy to center + if (w == null) + w = Math.floor(canvasWidth / (ticks.length > 0 ? ticks.length : 1)); + + // measure x label heights + if (h == null) { + labels = []; + for (i = 0; i < ticks.length; ++i) { + l = ticks[i].label; + if (l) + labels.push('<div class="tickLabel" style="float:left;width:' + w + 'px">' + l + '</div>'); + } + + if (labels.length > 0) { + // stick them all in the same div and measure + // collective height + labels.push('<div style="clear:left"></div>'); + dummyDiv = makeDummyDiv(labels, "width:10000px;"); + h = dummyDiv.height(); + dummyDiv.remove(); + } + } + } + else if (w == null || h == null) { + // calculate y label dimensions + for (i = 0; i < ticks.length; ++i) { + l = ticks[i].label; + if (l) + labels.push('<div class="tickLabel">' + l + '</div>'); + } + + if (labels.length > 0) { + dummyDiv = makeDummyDiv(labels, ""); + if (w == null) + w = dummyDiv.children().width(); + if (h == null) + h = dummyDiv.find("div.tickLabel").height(); + dummyDiv.remove(); + } + } + + if (w == null) + w = 0; + if (h == null) + h = 0; + + axis.labelWidth = w; + axis.labelHeight = h; + } + + function allocateAxisBoxFirstPhase(axis) { + // find the bounding box of the axis by looking at label + // widths/heights and ticks, make room by diminishing the + // plotOffset + + var lw = axis.labelWidth, + lh = axis.labelHeight, + pos = axis.options.position, + tickLength = axis.options.tickLength, + axismargin = options.grid.axisMargin, + padding = options.grid.labelMargin, + all = axis.direction == "x" ? xaxes : yaxes, + index; + + // determine axis margin + var samePosition = $.grep(all, function (a) { + return a && a.options.position == pos && a.reserveSpace; + }); + if ($.inArray(axis, samePosition) == samePosition.length - 1) + axismargin = 0; // outermost + + // determine tick length - if we're innermost, we can use "full" + if (tickLength == null) + tickLength = "full"; + + var sameDirection = $.grep(all, function (a) { + return a && a.reserveSpace; + }); + + var innermost = $.inArray(axis, sameDirection) == 0; + if (!innermost && tickLength == "full") + tickLength = 5; + + if (!isNaN(+tickLength)) + padding += +tickLength; + + // compute box + if (axis.direction == "x") { + lh += padding; + + if (pos == "bottom") { + plotOffset.bottom += lh + axismargin; + axis.box = { top: canvasHeight - plotOffset.bottom, height: lh }; + } + else { + axis.box = { top: plotOffset.top + axismargin, height: lh }; + plotOffset.top += lh + axismargin; + } + } + else { + lw += padding; + + if (pos == "left") { + axis.box = { left: plotOffset.left + axismargin, width: lw }; + plotOffset.left += lw + axismargin; + } + else { + plotOffset.right += lw + axismargin; + axis.box = { left: canvasWidth - plotOffset.right, width: lw }; + } + } + + // save for future reference + axis.position = pos; + axis.tickLength = tickLength; + axis.box.padding = padding; + axis.innermost = innermost; + } + + function allocateAxisBoxSecondPhase(axis) { + // set remaining bounding box coordinates + if (axis.direction == "x") { + axis.box.left = plotOffset.left; + axis.box.width = plotWidth; + } + else { + axis.box.top = plotOffset.top; + axis.box.height = plotHeight; + } + } + + function setupGrid() { + var i, axes = allAxes(); + + // first calculate the plot and axis box dimensions + + $.each(axes, function (_, axis) { + axis.show = axis.options.show; + if (axis.show == null) + axis.show = axis.used; // by default an axis is visible if it's got data + + axis.reserveSpace = axis.show || axis.options.reserveSpace; + + setRange(axis); + }); + + allocatedAxes = $.grep(axes, function (axis) { return axis.reserveSpace; }); + + plotOffset.left = plotOffset.right = plotOffset.top = plotOffset.bottom = 0; + if (options.grid.show) { + $.each(allocatedAxes, function (_, axis) { + // make the ticks + setupTickGeneration(axis); + setTicks(axis); + snapRangeToTicks(axis, axis.ticks); + + // find labelWidth/Height for axis + measureTickLabels(axis); + }); + + // with all dimensions in house, we can compute the + // axis boxes, start from the outside (reverse order) + for (i = allocatedAxes.length - 1; i >= 0; --i) + allocateAxisBoxFirstPhase(allocatedAxes[i]); + + // make sure we've got enough space for things that + // might stick out + var minMargin = options.grid.minBorderMargin; + if (minMargin == null) { + minMargin = 0; + for (i = 0; i < series.length; ++i) + minMargin = Math.max(minMargin, series[i].points.radius + series[i].points.lineWidth/2); + } + + for (var a in plotOffset) { + plotOffset[a] += options.grid.borderWidth; + plotOffset[a] = Math.max(minMargin, plotOffset[a]); + } + } + + plotWidth = canvasWidth - plotOffset.left - plotOffset.right; + plotHeight = canvasHeight - plotOffset.bottom - plotOffset.top; + + // now we got the proper plotWidth/Height, we can compute the scaling + $.each(axes, function (_, axis) { + setTransformationHelpers(axis); + }); + + if (options.grid.show) { + $.each(allocatedAxes, function (_, axis) { + allocateAxisBoxSecondPhase(axis); + }); + + insertAxisLabels(); + } + + insertLegend(); + } + + function setRange(axis) { + var opts = axis.options, + min = +(opts.min != null ? opts.min : axis.datamin), + max = +(opts.max != null ? opts.max : axis.datamax), + delta = max - min; + + if (delta == 0.0) { + // degenerate case + var widen = max == 0 ? 1 : 0.01; + + if (opts.min == null) + min -= widen; + // always widen max if we couldn't widen min to ensure we + // don't fall into min == max which doesn't work + if (opts.max == null || opts.min != null) + max += widen; + } + else { + // consider autoscaling + var margin = opts.autoscaleMargin; + if (margin != null) { + if (opts.min == null) { + min -= delta * margin; + // make sure we don't go below zero if all values + // are positive + if (min < 0 && axis.datamin != null && axis.datamin >= 0) + min = 0; + } + if (opts.max == null) { + max += delta * margin; + if (max > 0 && axis.datamax != null && axis.datamax <= 0) + max = 0; + } + } + } + axis.min = min; + axis.max = max; + } + + function setupTickGeneration(axis) { + var opts = axis.options; + + // estimate number of ticks + var noTicks; + if (typeof opts.ticks == "number" && opts.ticks > 0) + noTicks = opts.ticks; + else + // heuristic based on the model a*sqrt(x) fitted to + // some data points that seemed reasonable + noTicks = 0.3 * Math.sqrt(axis.direction == "x" ? canvasWidth : canvasHeight); + + var delta = (axis.max - axis.min) / noTicks, + size, generator, unit, formatter, i, magn, norm; + + if (opts.mode == "time") { + // pretty handling of time + + // map of app. size of time units in milliseconds + var timeUnitSize = { + "second": 1000, + "minute": 60 * 1000, + "hour": 60 * 60 * 1000, + "day": 24 * 60 * 60 * 1000, + "month": 30 * 24 * 60 * 60 * 1000, + "year": 365.2425 * 24 * 60 * 60 * 1000 + }; + + + // the allowed tick sizes, after 1 year we use + // an integer algorithm + var spec = [ + [1, "second"], [2, "second"], [5, "second"], [10, "second"], + [30, "second"], + [1, "minute"], [2, "minute"], [5, "minute"], [10, "minute"], + [30, "minute"], + [1, "hour"], [2, "hour"], [4, "hour"], + [8, "hour"], [12, "hour"], + [1, "day"], [2, "day"], [3, "day"], + [0.25, "month"], [0.5, "month"], [1, "month"], + [2, "month"], [3, "month"], [6, "month"], + [1, "year"] + ]; + + var minSize = 0; + if (opts.minTickSize != null) { + if (typeof opts.tickSize == "number") + minSize = opts.tickSize; + else + minSize = opts.minTickSize[0] * timeUnitSize[opts.minTickSize[1]]; + } + + for (var i = 0; i < spec.length - 1; ++i) + if (delta < (spec[i][0] * timeUnitSize[spec[i][1]] + + spec[i + 1][0] * timeUnitSize[spec[i + 1][1]]) / 2 + && spec[i][0] * timeUnitSize[spec[i][1]] >= minSize) + break; + size = spec[i][0]; + unit = spec[i][1]; + + // special-case the possibility of several years + if (unit == "year") { + magn = Math.pow(10, Math.floor(Math.log(delta / timeUnitSize.year) / Math.LN10)); + norm = (delta / timeUnitSize.year) / magn; + if (norm < 1.5) + size = 1; + else if (norm < 3) + size = 2; + else if (norm < 7.5) + size = 5; + else + size = 10; + + size *= magn; + } + + axis.tickSize = opts.tickSize || [size, unit]; + + generator = function(axis) { + var ticks = [], + tickSize = axis.tickSize[0], unit = axis.tickSize[1], + d = new Date(axis.min); + + var step = tickSize * timeUnitSize[unit]; + + if (unit == "second") + d.setUTCSeconds(floorInBase(d.getUTCSeconds(), tickSize)); + if (unit == "minute") + d.setUTCMinutes(floorInBase(d.getUTCMinutes(), tickSize)); + if (unit == "hour") + d.setUTCHours(floorInBase(d.getUTCHours(), tickSize)); + if (unit == "month") + d.setUTCMonth(floorInBase(d.getUTCMonth(), tickSize)); + if (unit == "year") + d.setUTCFullYear(floorInBase(d.getUTCFullYear(), tickSize)); + + // reset smaller components + d.setUTCMilliseconds(0); + if (step >= timeUnitSize.minute) + d.setUTCSeconds(0); + if (step >= timeUnitSize.hour) + d.setUTCMinutes(0); + if (step >= timeUnitSize.day) + d.setUTCHours(0); + if (step >= timeUnitSize.day * 4) + d.setUTCDate(1); + if (step >= timeUnitSize.year) + d.setUTCMonth(0); + + + var carry = 0, v = Number.NaN, prev; + do { + prev = v; + v = d.getTime(); + ticks.push(v); + if (unit == "month") { + if (tickSize < 1) { + // a bit complicated - we'll divide the month + // up but we need to take care of fractions + // so we don't end up in the middle of a day + d.setUTCDate(1); + var start = d.getTime(); + d.setUTCMonth(d.getUTCMonth() + 1); + var end = d.getTime(); + d.setTime(v + carry * timeUnitSize.hour + (end - start) * tickSize); + carry = d.getUTCHours(); + d.setUTCHours(0); + } + else + d.setUTCMonth(d.getUTCMonth() + tickSize); + } + else if (unit == "year") { + d.setUTCFullYear(d.getUTCFullYear() + tickSize); + } + else + d.setTime(v + step); + } while (v < axis.max && v != prev); + + return ticks; + }; + + formatter = function (v, axis) { + var d = new Date(v); + + // first check global format + if (opts.timeformat != null) + return $.plot.formatDate(d, opts.timeformat, opts.monthNames); + + var t = axis.tickSize[0] * timeUnitSize[axis.tickSize[1]]; + var span = axis.max - axis.min; + var suffix = (opts.twelveHourClock) ? " %p" : ""; + + if (t < timeUnitSize.minute) + fmt = "%h:%M:%S" + suffix; + else if (t < timeUnitSize.day) { + if (span < 2 * timeUnitSize.day) + fmt = "%h:%M" + suffix; + else + fmt = "%b %d %h:%M" + suffix; + } + else if (t < timeUnitSize.month) + fmt = "%b %d"; + else if (t < timeUnitSize.year) { + if (span < timeUnitSize.year) + fmt = "%b"; + else + fmt = "%b %y"; + } + else + fmt = "%y"; + + return $.plot.formatDate(d, fmt, opts.monthNames); + }; + } + else { + // pretty rounding of base-10 numbers + var maxDec = opts.tickDecimals; + var dec = -Math.floor(Math.log(delta) / Math.LN10); + if (maxDec != null && dec > maxDec) + dec = maxDec; + + magn = Math.pow(10, -dec); + norm = delta / magn; // norm is between 1.0 and 10.0 + + if (norm < 1.5) + size = 1; + else if (norm < 3) { + size = 2; + // special case for 2.5, requires an extra decimal + if (norm > 2.25 && (maxDec == null || dec + 1 <= maxDec)) { + size = 2.5; + ++dec; + } + } + else if (norm < 7.5) + size = 5; + else + size = 10; + + size *= magn; + + if (opts.minTickSize != null && size < opts.minTickSize) + size = opts.minTickSize; + + axis.tickDecimals = Math.max(0, maxDec != null ? maxDec : dec); + axis.tickSize = opts.tickSize || size; + + generator = function (axis) { + var ticks = []; + + // spew out all possible ticks + var start = floorInBase(axis.min, axis.tickSize), + i = 0, v = Number.NaN, prev; + do { + prev = v; + v = start + i * axis.tickSize; + ticks.push(v); + ++i; + } while (v < axis.max && v != prev); + return ticks; + }; + + formatter = function (v, axis) { + return v.toFixed(axis.tickDecimals); + }; + } + + if (opts.alignTicksWithAxis != null) { + var otherAxis = (axis.direction == "x" ? xaxes : yaxes)[opts.alignTicksWithAxis - 1]; + if (otherAxis && otherAxis.used && otherAxis != axis) { + // consider snapping min/max to outermost nice ticks + var niceTicks = generator(axis); + if (niceTicks.length > 0) { + if (opts.min == null) + axis.min = Math.min(axis.min, niceTicks[0]); + if (opts.max == null && niceTicks.length > 1) + axis.max = Math.max(axis.max, niceTicks[niceTicks.length - 1]); + } + + generator = function (axis) { + // copy ticks, scaled to this axis + var ticks = [], v, i; + for (i = 0; i < otherAxis.ticks.length; ++i) { + v = (otherAxis.ticks[i].v - otherAxis.min) / (otherAxis.max - otherAxis.min); + v = axis.min + v * (axis.max - axis.min); + ticks.push(v); + } + return ticks; + }; + + // we might need an extra decimal since forced + // ticks don't necessarily fit naturally + if (axis.mode != "time" && opts.tickDecimals == null) { + var extraDec = Math.max(0, -Math.floor(Math.log(delta) / Math.LN10) + 1), + ts = generator(axis); + + // only proceed if the tick interval rounded + // with an extra decimal doesn't give us a + // zero at end + if (!(ts.length > 1 && /\..*0$/.test((ts[1] - ts[0]).toFixed(extraDec)))) + axis.tickDecimals = extraDec; + } + } + } + + axis.tickGenerator = generator; + if ($.isFunction(opts.tickFormatter)) + axis.tickFormatter = function (v, axis) { return "" + opts.tickFormatter(v, axis); }; + else + axis.tickFormatter = formatter; + } + + function setTicks(axis) { + var oticks = axis.options.ticks, ticks = []; + if (oticks == null || (typeof oticks == "number" && oticks > 0)) + ticks = axis.tickGenerator(axis); + else if (oticks) { + if ($.isFunction(oticks)) + // generate the ticks + ticks = oticks({ min: axis.min, max: axis.max }); + else + ticks = oticks; + } + + // clean up/labelify the supplied ticks, copy them over + var i, v; + axis.ticks = []; + for (i = 0; i < ticks.length; ++i) { + var label = null; + var t = ticks[i]; + if (typeof t == "object") { + v = +t[0]; + if (t.length > 1) + label = t[1]; + } + else + v = +t; + if (label == null) + label = axis.tickFormatter(v, axis); + if (!isNaN(v)) + axis.ticks.push({ v: v, label: label }); + } + } + + function snapRangeToTicks(axis, ticks) { + if (axis.options.autoscaleMargin && ticks.length > 0) { + // snap to ticks + if (axis.options.min == null) + axis.min = Math.min(axis.min, ticks[0].v); + if (axis.options.max == null && ticks.length > 1) + axis.max = Math.max(axis.max, ticks[ticks.length - 1].v); + } + } + + function draw() { + ctx.clearRect(0, 0, canvasWidth, canvasHeight); + + var grid = options.grid; + + // draw background, if any + if (grid.show && grid.backgroundColor) + drawBackground(); + + if (grid.show && !grid.aboveData) + drawGrid(); + + for (var i = 0; i < series.length; ++i) { + executeHooks(hooks.drawSeries, [ctx, series[i]]); + drawSeries(series[i]); + } + + executeHooks(hooks.draw, [ctx]); + + if (grid.show && grid.aboveData) + drawGrid(); + } + + function extractRange(ranges, coord) { + var axis, from, to, key, axes = allAxes(); + + for (i = 0; i < axes.length; ++i) { + axis = axes[i]; + if (axis.direction == coord) { + key = coord + axis.n + "axis"; + if (!ranges[key] && axis.n == 1) + key = coord + "axis"; // support x1axis as xaxis + if (ranges[key]) { + from = ranges[key].from; + to = ranges[key].to; + break; + } + } + } + + // backwards-compat stuff - to be removed in future + if (!ranges[key]) { + axis = coord == "x" ? xaxes[0] : yaxes[0]; + from = ranges[coord + "1"]; + to = ranges[coord + "2"]; + } + + // auto-reverse as an added bonus + if (from != null && to != null && from > to) { + var tmp = from; + from = to; + to = tmp; + } + + return { from: from, to: to, axis: axis }; + } + + function drawBackground() { + ctx.save(); + ctx.translate(plotOffset.left, plotOffset.top); + + ctx.fillStyle = getColorOrGradient(options.grid.backgroundColor, plotHeight, 0, "rgba(255, 255, 255, 0)"); + ctx.fillRect(0, 0, plotWidth, plotHeight); + ctx.restore(); + } + + function drawGrid() { + var i; + + ctx.save(); + ctx.translate(plotOffset.left, plotOffset.top); + + // draw markings + var markings = options.grid.markings; + if (markings) { + if ($.isFunction(markings)) { + var axes = plot.getAxes(); + // xmin etc. is backwards compatibility, to be + // removed in the future + axes.xmin = axes.xaxis.min; + axes.xmax = axes.xaxis.max; + axes.ymin = axes.yaxis.min; + axes.ymax = axes.yaxis.max; + + markings = markings(axes); + } + + for (i = 0; i < markings.length; ++i) { + var m = markings[i], + xrange = extractRange(m, "x"), + yrange = extractRange(m, "y"); + + // fill in missing + if (xrange.from == null) + xrange.from = xrange.axis.min; + if (xrange.to == null) + xrange.to = xrange.axis.max; + if (yrange.from == null) + yrange.from = yrange.axis.min; + if (yrange.to == null) + yrange.to = yrange.axis.max; + + // clip + if (xrange.to < xrange.axis.min || xrange.from > xrange.axis.max || + yrange.to < yrange.axis.min || yrange.from > yrange.axis.max) + continue; + + xrange.from = Math.max(xrange.from, xrange.axis.min); + xrange.to = Math.min(xrange.to, xrange.axis.max); + yrange.from = Math.max(yrange.from, yrange.axis.min); + yrange.to = Math.min(yrange.to, yrange.axis.max); + + if (xrange.from == xrange.to && yrange.from == yrange.to) + continue; + + // then draw + xrange.from = xrange.axis.p2c(xrange.from); + xrange.to = xrange.axis.p2c(xrange.to); + yrange.from = yrange.axis.p2c(yrange.from); + yrange.to = yrange.axis.p2c(yrange.to); + + if (xrange.from == xrange.to || yrange.from == yrange.to) { + // draw line + ctx.beginPath(); + ctx.strokeStyle = m.color || options.grid.markingsColor; + ctx.lineWidth = m.lineWidth || options.grid.markingsLineWidth; + ctx.moveTo(xrange.from, yrange.from); + ctx.lineTo(xrange.to, yrange.to); + ctx.stroke(); + } + else { + // fill area + ctx.fillStyle = m.color || options.grid.markingsColor; + ctx.fillRect(xrange.from, yrange.to, + xrange.to - xrange.from, + yrange.from - yrange.to); + } + } + } + + // draw the ticks + var axes = allAxes(), bw = options.grid.borderWidth; + + for (var j = 0; j < axes.length; ++j) { + var axis = axes[j], box = axis.box, + t = axis.tickLength, x, y, xoff, yoff; + if (!axis.show || axis.ticks.length == 0) + continue + + ctx.strokeStyle = axis.options.tickColor || $.color.parse(axis.options.color).scale('a', 0.22).toString(); + ctx.lineWidth = 1; + + // find the edges + if (axis.direction == "x") { + x = 0; + if (t == "full") + y = (axis.position == "top" ? 0 : plotHeight); + else + y = box.top - plotOffset.top + (axis.position == "top" ? box.height : 0); + } + else { + y = 0; + if (t == "full") + x = (axis.position == "left" ? 0 : plotWidth); + else + x = box.left - plotOffset.left + (axis.position == "left" ? box.width : 0); + } + + // draw tick bar + if (!axis.innermost) { + ctx.beginPath(); + xoff = yoff = 0; + if (axis.direction == "x") + xoff = plotWidth; + else + yoff = plotHeight; + + if (ctx.lineWidth == 1) { + x = Math.floor(x) + 0.5; + y = Math.floor(y) + 0.5; + } + + ctx.moveTo(x, y); + ctx.lineTo(x + xoff, y + yoff); + ctx.stroke(); + } + + // draw ticks + ctx.beginPath(); + for (i = 0; i < axis.ticks.length; ++i) { + var v = axis.ticks[i].v; + + xoff = yoff = 0; + + if (v < axis.min || v > axis.max + // skip those lying on the axes if we got a border + || (t == "full" && bw > 0 + && (v == axis.min || v == axis.max))) + continue; + + if (axis.direction == "x") { + x = axis.p2c(v); + yoff = t == "full" ? -plotHeight : t; + + if (axis.position == "top") + yoff = -yoff; + } + else { + y = axis.p2c(v); + xoff = t == "full" ? -plotWidth : t; + + if (axis.position == "left") + xoff = -xoff; + } + + if (ctx.lineWidth == 1) { + if (axis.direction == "x") + x = Math.floor(x) + 0.5; + else + y = Math.floor(y) + 0.5; + } + + ctx.moveTo(x, y); + ctx.lineTo(x + xoff, y + yoff); + } + + ctx.stroke(); + } + + + // draw border + if (bw) { + ctx.lineWidth = bw; + ctx.strokeStyle = options.grid.borderColor; + ctx.strokeRect(-bw/2, -bw/2, plotWidth + bw, plotHeight + bw); + } + + ctx.restore(); + } + + function insertAxisLabels() { + placeholder.find(".tickLabels").remove(); + + var html = ['<div class="tickLabels" style="font-size:smaller">']; + + var axes = allAxes(); + for (var j = 0; j < axes.length; ++j) { + var axis = axes[j], box = axis.box; + if (!axis.show) + continue; + //debug: html.push('<div style="position:absolute;opacity:0.10;background-color:red;left:' + box.left + 'px;top:' + box.top + 'px;width:' + box.width + 'px;height:' + box.height + 'px"></div>') + html.push('<div class="' + axis.direction + 'Axis ' + axis.direction + axis.n + 'Axis" style="color:' + axis.options.color + '">'); + for (var i = 0; i < axis.ticks.length; ++i) { + var tick = axis.ticks[i]; + if (!tick.label || tick.v < axis.min || tick.v > axis.max) + continue; + + var pos = {}, align; + + if (axis.direction == "x") { + align = "center"; + pos.left = Math.round(plotOffset.left + axis.p2c(tick.v) - axis.labelWidth/2); + if (axis.position == "bottom") + pos.top = box.top + box.padding; + else + pos.bottom = canvasHeight - (box.top + box.height - box.padding); + } + else { + pos.top = Math.round(plotOffset.top + axis.p2c(tick.v) - axis.labelHeight/2); + if (axis.position == "left") { + pos.right = canvasWidth - (box.left + box.width - box.padding) + align = "right"; + } + else { + pos.left = box.left + box.padding; + align = "left"; + } + } + + pos.width = axis.labelWidth; + + var style = ["position:absolute", "text-align:" + align ]; + for (var a in pos) + style.push(a + ":" + pos[a] + "px") + + html.push('<div class="tickLabel" style="' + style.join(';') + '">' + tick.label + '</div>'); + } + html.push('</div>'); + } + + html.push('</div>'); + + placeholder.append(html.join("")); + } + + function drawSeries(series) { + if (series.lines.show) + drawSeriesLines(series); + if (series.bars.show) + drawSeriesBars(series); + if (series.points.show) + drawSeriesPoints(series); + } + + function drawSeriesLines(series) { + function plotLine(datapoints, xoffset, yoffset, axisx, axisy) { + var points = datapoints.points, + ps = datapoints.pointsize, + prevx = null, prevy = null; + + ctx.beginPath(); + for (var i = ps; i < points.length; i += ps) { + var x1 = points[i - ps], y1 = points[i - ps + 1], + x2 = points[i], y2 = points[i + 1]; + + if (x1 == null || x2 == null) + continue; + + // clip with ymin + if (y1 <= y2 && y1 < axisy.min) { + if (y2 < axisy.min) + continue; // line segment is outside + // compute new intersection point + x1 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1; + y1 = axisy.min; + } + else if (y2 <= y1 && y2 < axisy.min) { + if (y1 < axisy.min) + continue; + x2 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1; + y2 = axisy.min; + } + + // clip with ymax + if (y1 >= y2 && y1 > axisy.max) { + if (y2 > axisy.max) + continue; + x1 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1; + y1 = axisy.max; + } + else if (y2 >= y1 && y2 > axisy.max) { + if (y1 > axisy.max) + continue; + x2 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1; + y2 = axisy.max; + } + + // clip with xmin + if (x1 <= x2 && x1 < axisx.min) { + if (x2 < axisx.min) + continue; + y1 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1; + x1 = axisx.min; + } + else if (x2 <= x1 && x2 < axisx.min) { + if (x1 < axisx.min) + continue; + y2 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1; + x2 = axisx.min; + } + + // clip with xmax + if (x1 >= x2 && x1 > axisx.max) { + if (x2 > axisx.max) + continue; + y1 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1; + x1 = axisx.max; + } + else if (x2 >= x1 && x2 > axisx.max) { + if (x1 > axisx.max) + continue; + y2 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1; + x2 = axisx.max; + } + + if (x1 != prevx || y1 != prevy) + ctx.moveTo(axisx.p2c(x1) + xoffset, axisy.p2c(y1) + yoffset); + + prevx = x2; + prevy = y2; + ctx.lineTo(axisx.p2c(x2) + xoffset, axisy.p2c(y2) + yoffset); + } + ctx.stroke(); + } + + function plotLineArea(datapoints, axisx, axisy) { + var points = datapoints.points, + ps = datapoints.pointsize, + bottom = Math.min(Math.max(0, axisy.min), axisy.max), + i = 0, top, areaOpen = false, + ypos = 1, segmentStart = 0, segmentEnd = 0; + + // we process each segment in two turns, first forward + // direction to sketch out top, then once we hit the + // end we go backwards to sketch the bottom + while (true) { + if (ps > 0 && i > points.length + ps) + break; + + i += ps; // ps is negative if going backwards + + var x1 = points[i - ps], + y1 = points[i - ps + ypos], + x2 = points[i], y2 = points[i + ypos]; + + if (areaOpen) { + if (ps > 0 && x1 != null && x2 == null) { + // at turning point + segmentEnd = i; + ps = -ps; + ypos = 2; + continue; + } + + if (ps < 0 && i == segmentStart + ps) { + // done with the reverse sweep + ctx.fill(); + areaOpen = false; + ps = -ps; + ypos = 1; + i = segmentStart = segmentEnd + ps; + continue; + } + } + + if (x1 == null || x2 == null) + continue; + + // clip x values + + // clip with xmin + if (x1 <= x2 && x1 < axisx.min) { + if (x2 < axisx.min) + continue; + y1 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1; + x1 = axisx.min; + } + else if (x2 <= x1 && x2 < axisx.min) { + if (x1 < axisx.min) + continue; + y2 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1; + x2 = axisx.min; + } + + // clip with xmax + if (x1 >= x2 && x1 > axisx.max) { + if (x2 > axisx.max) + continue; + y1 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1; + x1 = axisx.max; + } + else if (x2 >= x1 && x2 > axisx.max) { + if (x1 > axisx.max) + continue; + y2 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1; + x2 = axisx.max; + } + + if (!areaOpen) { + // open area + ctx.beginPath(); + ctx.moveTo(axisx.p2c(x1), axisy.p2c(bottom)); + areaOpen = true; + } + + // now first check the case where both is outside + if (y1 >= axisy.max && y2 >= axisy.max) { + ctx.lineTo(axisx.p2c(x1), axisy.p2c(axisy.max)); + ctx.lineTo(axisx.p2c(x2), axisy.p2c(axisy.max)); + continue; + } + else if (y1 <= axisy.min && y2 <= axisy.min) { + ctx.lineTo(axisx.p2c(x1), axisy.p2c(axisy.min)); + ctx.lineTo(axisx.p2c(x2), axisy.p2c(axisy.min)); + continue; + } + + // else it's a bit more complicated, there might + // be a flat maxed out rectangle first, then a + // triangular cutout or reverse; to find these + // keep track of the current x values + var x1old = x1, x2old = x2; + + // clip the y values, without shortcutting, we + // go through all cases in turn + + // clip with ymin + if (y1 <= y2 && y1 < axisy.min && y2 >= axisy.min) { + x1 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1; + y1 = axisy.min; + } + else if (y2 <= y1 && y2 < axisy.min && y1 >= axisy.min) { + x2 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1; + y2 = axisy.min; + } + + // clip with ymax + if (y1 >= y2 && y1 > axisy.max && y2 <= axisy.max) { + x1 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1; + y1 = axisy.max; + } + else if (y2 >= y1 && y2 > axisy.max && y1 <= axisy.max) { + x2 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1; + y2 = axisy.max; + } + + // if the x value was changed we got a rectangle + // to fill + if (x1 != x1old) { + ctx.lineTo(axisx.p2c(x1old), axisy.p2c(y1)); + // it goes to (x1, y1), but we fill that below + } + + // fill triangular section, this sometimes result + // in redundant points if (x1, y1) hasn't changed + // from previous line to, but we just ignore that + ctx.lineTo(axisx.p2c(x1), axisy.p2c(y1)); + ctx.lineTo(axisx.p2c(x2), axisy.p2c(y2)); + + // fill the other rectangle if it's there + if (x2 != x2old) { + ctx.lineTo(axisx.p2c(x2), axisy.p2c(y2)); + ctx.lineTo(axisx.p2c(x2old), axisy.p2c(y2)); + } + } + } + + ctx.save(); + ctx.translate(plotOffset.left, plotOffset.top); + ctx.lineJoin = "round"; + + var lw = series.lines.lineWidth, + sw = series.shadowSize; + // FIXME: consider another form of shadow when filling is turned on + if (lw > 0 && sw > 0) { + // draw shadow as a thick and thin line with transparency + ctx.lineWidth = sw; + ctx.strokeStyle = "rgba(0,0,0,0.1)"; + // position shadow at angle from the mid of line + var angle = Math.PI/18; + plotLine(series.datapoints, Math.sin(angle) * (lw/2 + sw/2), Math.cos(angle) * (lw/2 + sw/2), series.xaxis, series.yaxis); + ctx.lineWidth = sw/2; + plotLine(series.datapoints, Math.sin(angle) * (lw/2 + sw/4), Math.cos(angle) * (lw/2 + sw/4), series.xaxis, series.yaxis); + } + + ctx.lineWidth = lw; + ctx.strokeStyle = series.color; + var fillStyle = getFillStyle(series.lines, series.color, 0, plotHeight); + if (fillStyle) { + ctx.fillStyle = fillStyle; + plotLineArea(series.datapoints, series.xaxis, series.yaxis); + } + + if (lw > 0) + plotLine(series.datapoints, 0, 0, series.xaxis, series.yaxis); + ctx.restore(); + } + + function drawSeriesPoints(series) { + function plotPoints(datapoints, radius, fillStyle, offset, shadow, axisx, axisy, symbol) { + var points = datapoints.points, ps = datapoints.pointsize; + + for (var i = 0; i < points.length; i += ps) { + var x = points[i], y = points[i + 1]; + if (x == null || x < axisx.min || x > axisx.max || y < axisy.min || y > axisy.max) + continue; + + ctx.beginPath(); + x = axisx.p2c(x); + y = axisy.p2c(y) + offset; + if (symbol == "circle") + ctx.arc(x, y, radius, 0, shadow ? Math.PI : Math.PI * 2, false); + else + symbol(ctx, x, y, radius, shadow); + ctx.closePath(); + + if (fillStyle) { + ctx.fillStyle = fillStyle; + ctx.fill(); + } + ctx.stroke(); + } + } + + ctx.save(); + ctx.translate(plotOffset.left, plotOffset.top); + + var lw = series.points.lineWidth, + sw = series.shadowSize, + radius = series.points.radius, + symbol = series.points.symbol; + if (lw > 0 && sw > 0) { + // draw shadow in two steps + var w = sw / 2; + ctx.lineWidth = w; + ctx.strokeStyle = "rgba(0,0,0,0.1)"; + plotPoints(series.datapoints, radius, null, w + w/2, true, + series.xaxis, series.yaxis, symbol); + + ctx.strokeStyle = "rgba(0,0,0,0.2)"; + plotPoints(series.datapoints, radius, null, w/2, true, + series.xaxis, series.yaxis, symbol); + } + + ctx.lineWidth = lw; + ctx.strokeStyle = series.color; + plotPoints(series.datapoints, radius, + getFillStyle(series.points, series.color), 0, false, + series.xaxis, series.yaxis, symbol); + ctx.restore(); + } + + function drawBar(x, y, b, barLeft, barRight, offset, fillStyleCallback, axisx, axisy, c, horizontal, lineWidth) { + var left, right, bottom, top, + drawLeft, drawRight, drawTop, drawBottom, + tmp; + + // in horizontal mode, we start the bar from the left + // instead of from the bottom so it appears to be + // horizontal rather than vertical + if (horizontal) { + drawBottom = drawRight = drawTop = true; + drawLeft = false; + left = b; + right = x; + top = y + barLeft; + bottom = y + barRight; + + // account for negative bars + if (right < left) { + tmp = right; + right = left; + left = tmp; + drawLeft = true; + drawRight = false; + } + } + else { + drawLeft = drawRight = drawTop = true; + drawBottom = false; + left = x + barLeft; + right = x + barRight; + bottom = b; + top = y; + + // account for negative bars + if (top < bottom) { + tmp = top; + top = bottom; + bottom = tmp; + drawBottom = true; + drawTop = false; + } + } + + // clip + if (right < axisx.min || left > axisx.max || + top < axisy.min || bottom > axisy.max) + return; + + if (left < axisx.min) { + left = axisx.min; + drawLeft = false; + } + + if (right > axisx.max) { + right = axisx.max; + drawRight = false; + } + + if (bottom < axisy.min) { + bottom = axisy.min; + drawBottom = false; + } + + if (top > axisy.max) { + top = axisy.max; + drawTop = false; + } + + left = axisx.p2c(left); + bottom = axisy.p2c(bottom); + right = axisx.p2c(right); + top = axisy.p2c(top); + + // fill the bar + if (fillStyleCallback) { + c.beginPath(); + c.moveTo(left, bottom); + c.lineTo(left, top); + c.lineTo(right, top); + c.lineTo(right, bottom); + c.fillStyle = fillStyleCallback(bottom, top); + c.fill(); + } + + // draw outline + if (lineWidth > 0 && (drawLeft || drawRight || drawTop || drawBottom)) { + c.beginPath(); + + // FIXME: inline moveTo is buggy with excanvas + c.moveTo(left, bottom + offset); + if (drawLeft) + c.lineTo(left, top + offset); + else + c.moveTo(left, top + offset); + if (drawTop) + c.lineTo(right, top + offset); + else + c.moveTo(right, top + offset); + if (drawRight) + c.lineTo(right, bottom + offset); + else + c.moveTo(right, bottom + offset); + if (drawBottom) + c.lineTo(left, bottom + offset); + else + c.moveTo(left, bottom + offset); + c.stroke(); + } + } + + function drawSeriesBars(series) { + function plotBars(datapoints, barLeft, barRight, offset, fillStyleCallback, axisx, axisy) { + var points = datapoints.points, ps = datapoints.pointsize; + + for (var i = 0; i < points.length; i += ps) { + if (points[i] == null) + continue; + drawBar(points[i], points[i + 1], points[i + 2], barLeft, barRight, offset, fillStyleCallback, axisx, axisy, ctx, series.bars.horizontal, series.bars.lineWidth); + } + } + + ctx.save(); + ctx.translate(plotOffset.left, plotOffset.top); + + // FIXME: figure out a way to add shadows (for instance along the right edge) + ctx.lineWidth = series.bars.lineWidth; + ctx.strokeStyle = series.color; + var barLeft = series.bars.align == "left" ? 0 : -series.bars.barWidth/2; + var fillStyleCallback = series.bars.fill ? function (bottom, top) { return getFillStyle(series.bars, series.color, bottom, top); } : null; + plotBars(series.datapoints, barLeft, barLeft + series.bars.barWidth, 0, fillStyleCallback, series.xaxis, series.yaxis); + ctx.restore(); + } + + function getFillStyle(filloptions, seriesColor, bottom, top) { + var fill = filloptions.fill; + if (!fill) + return null; + + if (filloptions.fillColor) + return getColorOrGradient(filloptions.fillColor, bottom, top, seriesColor); + + var c = $.color.parse(seriesColor); + c.a = typeof fill == "number" ? fill : 0.4; + c.normalize(); + return c.toString(); + } + + function insertLegend() { + placeholder.find(".legend").remove(); + + if (!options.legend.show) + return; + + var fragments = [], rowStarted = false, + lf = options.legend.labelFormatter, s, label; + for (var i = 0; i < series.length; ++i) { + s = series[i]; + label = s.label; + if (!label) + continue; + + if (i % options.legend.noColumns == 0) { + if (rowStarted) + fragments.push('</tr>'); + fragments.push('<tr>'); + rowStarted = true; + } + + if (lf) + label = lf(label, s); + + fragments.push( + '<td class="legendColorBox"><div style="border:1px solid ' + options.legend.labelBoxBorderColor + ';padding:1px"><div style="width:4px;height:0;border:5px solid ' + s.color + ';overflow:hidden"></div></div></td>' + + '<td class="legendLabel">' + label + '</td>'); + } + if (rowStarted) + fragments.push('</tr>'); + + if (fragments.length == 0) + return; + + var table = '<table style="font-size:smaller;color:' + options.grid.color + '">' + fragments.join("") + '</table>'; + if (options.legend.container != null) + $(options.legend.container).html(table); + else { + var pos = "", + p = options.legend.position, + m = options.legend.margin; + if (m[0] == null) + m = [m, m]; + if (p.charAt(0) == "n") + pos += 'top:' + (m[1] + plotOffset.top) + 'px;'; + else if (p.charAt(0) == "s") + pos += 'bottom:' + (m[1] + plotOffset.bottom) + 'px;'; + if (p.charAt(1) == "e") + pos += 'right:' + (m[0] + plotOffset.right) + 'px;'; + else if (p.charAt(1) == "w") + pos += 'left:' + (m[0] + plotOffset.left) + 'px;'; + var legend = $('<div class="legend">' + table.replace('style="', 'style="position:absolute;' + pos +';') + '</div>').appendTo(placeholder); + if (options.legend.backgroundOpacity != 0.0) { + // put in the transparent background + // separately to avoid blended labels and + // label boxes + var c = options.legend.backgroundColor; + if (c == null) { + c = options.grid.backgroundColor; + if (c && typeof c == "string") + c = $.color.parse(c); + else + c = $.color.extract(legend, 'background-color'); + c.a = 1; + c = c.toString(); + } + var div = legend.children(); + $('<div style="position:absolute;width:' + div.width() + 'px;height:' + div.height() + 'px;' + pos +'background-color:' + c + ';"> </div>').prependTo(legend).css('opacity', options.legend.backgroundOpacity); + } + } + } + + + // interactive features + + var highlights = [], + redrawTimeout = null; + + // returns the data item the mouse is over, or null if none is found + function findNearbyItem(mouseX, mouseY, seriesFilter) { + var maxDistance = options.grid.mouseActiveRadius, + smallestDistance = maxDistance * maxDistance + 1, + item = null, foundPoint = false, i, j; + + for (i = series.length - 1; i >= 0; --i) { + if (!seriesFilter(series[i])) + continue; + + var s = series[i], + axisx = s.xaxis, + axisy = s.yaxis, + points = s.datapoints.points, + ps = s.datapoints.pointsize, + mx = axisx.c2p(mouseX), // precompute some stuff to make the loop faster + my = axisy.c2p(mouseY), + maxx = maxDistance / axisx.scale, + maxy = maxDistance / axisy.scale; + + // with inverse transforms, we can't use the maxx/maxy + // optimization, sadly + if (axisx.options.inverseTransform) + maxx = Number.MAX_VALUE; + if (axisy.options.inverseTransform) + maxy = Number.MAX_VALUE; + + if (s.lines.show || s.points.show) { + for (j = 0; j < points.length; j += ps) { + var x = points[j], y = points[j + 1]; + if (x == null) + continue; + + // For points and lines, the cursor must be within a + // certain distance to the data point + if (x - mx > maxx || x - mx < -maxx || + y - my > maxy || y - my < -maxy) + continue; + + // We have to calculate distances in pixels, not in + // data units, because the scales of the axes may be different + var dx = Math.abs(axisx.p2c(x) - mouseX), + dy = Math.abs(axisy.p2c(y) - mouseY), + dist = dx * dx + dy * dy; // we save the sqrt + + // use <= to ensure last point takes precedence + // (last generally means on top of) + if (dist < smallestDistance) { + smallestDistance = dist; + item = [i, j / ps]; + } + } + } + + if (s.bars.show && !item) { // no other point can be nearby + var barLeft = s.bars.align == "left" ? 0 : -s.bars.barWidth/2, + barRight = barLeft + s.bars.barWidth; + + for (j = 0; j < points.length; j += ps) { + var x = points[j], y = points[j + 1], b = points[j + 2]; + if (x == null) + continue; + + // for a bar graph, the cursor must be inside the bar + if (series[i].bars.horizontal ? + (mx <= Math.max(b, x) && mx >= Math.min(b, x) && + my >= y + barLeft && my <= y + barRight) : + (mx >= x + barLeft && mx <= x + barRight && + my >= Math.min(b, y) && my <= Math.max(b, y))) + item = [i, j / ps]; + } + } + } + + if (item) { + i = item[0]; + j = item[1]; + ps = series[i].datapoints.pointsize; + + return { datapoint: series[i].datapoints.points.slice(j * ps, (j + 1) * ps), + dataIndex: j, + series: series[i], + seriesIndex: i }; + } + + return null; + } + + function onMouseMove(e) { + if (options.grid.hoverable) + triggerClickHoverEvent("plothover", e, + function (s) { return s["hoverable"] != false; }); + } + + function onMouseLeave(e) { + if (options.grid.hoverable) + triggerClickHoverEvent("plothover", e, + function (s) { return false; }); + } + + function onClick(e) { + triggerClickHoverEvent("plotclick", e, + function (s) { return s["clickable"] != false; }); + } + + // trigger click or hover event (they send the same parameters + // so we share their code) + function triggerClickHoverEvent(eventname, event, seriesFilter) { + var offset = eventHolder.offset(), + canvasX = event.pageX - offset.left - plotOffset.left, + canvasY = event.pageY - offset.top - plotOffset.top, + pos = canvasToAxisCoords({ left: canvasX, top: canvasY }); + + pos.pageX = event.pageX; + pos.pageY = event.pageY; + + var item = findNearbyItem(canvasX, canvasY, seriesFilter); + + if (item) { + // fill in mouse pos for any listeners out there + item.pageX = parseInt(item.series.xaxis.p2c(item.datapoint[0]) + offset.left + plotOffset.left); + item.pageY = parseInt(item.series.yaxis.p2c(item.datapoint[1]) + offset.top + plotOffset.top); + } + + if (options.grid.autoHighlight) { + // clear auto-highlights + for (var i = 0; i < highlights.length; ++i) { + var h = highlights[i]; + if (h.auto == eventname && + !(item && h.series == item.series && + h.point[0] == item.datapoint[0] && + h.point[1] == item.datapoint[1])) + unhighlight(h.series, h.point); + } + + if (item) + highlight(item.series, item.datapoint, eventname); + } + + placeholder.trigger(eventname, [ pos, item ]); + } + + function triggerRedrawOverlay() { + if (!redrawTimeout) + redrawTimeout = setTimeout(drawOverlay, 30); + } + + function drawOverlay() { + redrawTimeout = null; + + // draw highlights + octx.save(); + octx.clearRect(0, 0, canvasWidth, canvasHeight); + octx.translate(plotOffset.left, plotOffset.top); + + var i, hi; + for (i = 0; i < highlights.length; ++i) { + hi = highlights[i]; + + if (hi.series.bars.show) + drawBarHighlight(hi.series, hi.point); + else + drawPointHighlight(hi.series, hi.point); + } + octx.restore(); + + executeHooks(hooks.drawOverlay, [octx]); + } + + function highlight(s, point, auto) { + if (typeof s == "number") + s = series[s]; + + if (typeof point == "number") { + var ps = s.datapoints.pointsize; + point = s.datapoints.points.slice(ps * point, ps * (point + 1)); + } + + var i = indexOfHighlight(s, point); + if (i == -1) { + highlights.push({ series: s, point: point, auto: auto }); + + triggerRedrawOverlay(); + } + else if (!auto) + highlights[i].auto = false; + } + + function unhighlight(s, point) { + if (s == null && point == null) { + highlights = []; + triggerRedrawOverlay(); + } + + if (typeof s == "number") + s = series[s]; + + if (typeof point == "number") + point = s.data[point]; + + var i = indexOfHighlight(s, point); + if (i != -1) { + highlights.splice(i, 1); + + triggerRedrawOverlay(); + } + } + + function indexOfHighlight(s, p) { + for (var i = 0; i < highlights.length; ++i) { + var h = highlights[i]; + if (h.series == s && h.point[0] == p[0] + && h.point[1] == p[1]) + return i; + } + return -1; + } + + function drawPointHighlight(series, point) { + var x = point[0], y = point[1], + axisx = series.xaxis, axisy = series.yaxis; + + if (x < axisx.min || x > axisx.max || y < axisy.min || y > axisy.max) + return; + + var pointRadius = series.points.radius + series.points.lineWidth / 2; + octx.lineWidth = pointRadius; + octx.strokeStyle = $.color.parse(series.color).scale('a', 0.5).toString(); + var radius = 1.5 * pointRadius, + x = axisx.p2c(x), + y = axisy.p2c(y); + + octx.beginPath(); + if (series.points.symbol == "circle") + octx.arc(x, y, radius, 0, 2 * Math.PI, false); + else + series.points.symbol(octx, x, y, radius, false); + octx.closePath(); + octx.stroke(); + } + + function drawBarHighlight(series, point) { + octx.lineWidth = series.bars.lineWidth; + octx.strokeStyle = $.color.parse(series.color).scale('a', 0.5).toString(); + var fillStyle = $.color.parse(series.color).scale('a', 0.5).toString(); + var barLeft = series.bars.align == "left" ? 0 : -series.bars.barWidth/2; + drawBar(point[0], point[1], point[2] || 0, barLeft, barLeft + series.bars.barWidth, + 0, function () { return fillStyle; }, series.xaxis, series.yaxis, octx, series.bars.horizontal, series.bars.lineWidth); + } + + function getColorOrGradient(spec, bottom, top, defaultColor) { + if (typeof spec == "string") + return spec; + else { + // assume this is a gradient spec; IE currently only + // supports a simple vertical gradient properly, so that's + // what we support too + var gradient = ctx.createLinearGradient(0, top, 0, bottom); + + for (var i = 0, l = spec.colors.length; i < l; ++i) { + var c = spec.colors[i]; + if (typeof c != "string") { + var co = $.color.parse(defaultColor); + if (c.brightness != null) + co = co.scale('rgb', c.brightness) + if (c.opacity != null) + co.a *= c.opacity; + c = co.toString(); + } + gradient.addColorStop(i / (l - 1), c); + } + + return gradient; + } + } + } + + $.plot = function(placeholder, data, options) { + //var t0 = new Date(); + var plot = new Plot($(placeholder), data, options, $.plot.plugins); + //(window.console ? console.log : alert)("time used (msecs): " + ((new Date()).getTime() - t0.getTime())); + return plot; + }; + + $.plot.version = "0.7"; + + $.plot.plugins = []; + + // returns a string with the date d formatted according to fmt + $.plot.formatDate = function(d, fmt, monthNames) { + var leftPad = function(n) { + n = "" + n; + return n.length == 1 ? "0" + n : n; + }; + + var r = []; + var escape = false, padNext = false; + var hours = d.getUTCHours(); + var isAM = hours < 12; + if (monthNames == null) + monthNames = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; + + if (fmt.search(/%p|%P/) != -1) { + if (hours > 12) { + hours = hours - 12; + } else if (hours == 0) { + hours = 12; + } + } + for (var i = 0; i < fmt.length; ++i) { + var c = fmt.charAt(i); + + if (escape) { + switch (c) { + case 'h': c = "" + hours; break; + case 'H': c = leftPad(hours); break; + case 'M': c = leftPad(d.getUTCMinutes()); break; + case 'S': c = leftPad(d.getUTCSeconds()); break; + case 'd': c = "" + d.getUTCDate(); break; + case 'm': c = "" + (d.getUTCMonth() + 1); break; + case 'y': c = "" + d.getUTCFullYear(); break; + case 'b': c = "" + monthNames[d.getUTCMonth()]; break; + case 'p': c = (isAM) ? ("" + "am") : ("" + "pm"); break; + case 'P': c = (isAM) ? ("" + "AM") : ("" + "PM"); break; + case '0': c = ""; padNext = true; break; + } + if (c && padNext) { + c = leftPad(c); + padNext = false; + } + r.push(c); + if (!padNext) + escape = false; + } + else { + if (c == "%") + escape = true; + else + r.push(c); + } + } + return r.join(""); + }; + + // round to nearby lower multiple of base + function floorInBase(n, base) { + return base * Math.floor(n / base); + } + +})(jQuery); diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.min.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.min.js new file mode 100644 index 0000000..4467fc5 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.min.js @@ -0,0 +1,6 @@ +/* Javascript plotting library for jQuery, v. 0.7. + * + * Released under the MIT license by IOLA, December 2007. + * + */ +(function(b){b.color={};b.color.make=function(d,e,g,f){var c={};c.r=d||0;c.g=e||0;c.b=g||0;c.a=f!=null?f:1;c.add=function(h,j){for(var k=0;k<h.length;++k){c[h.charAt(k)]+=j}return c.normalize()};c.scale=function(h,j){for(var k=0;k<h.length;++k){c[h.charAt(k)]*=j}return c.normalize()};c.toString=function(){if(c.a>=1){return"rgb("+[c.r,c.g,c.b].join(",")+")"}else{return"rgba("+[c.r,c.g,c.b,c.a].join(",")+")"}};c.normalize=function(){function h(k,j,l){return j<k?k:(j>l?l:j)}c.r=h(0,parseInt(c.r),255);c.g=h(0,parseInt(c.g),255);c.b=h(0,parseInt(c.b),255);c.a=h(0,c.a,1);return c};c.clone=function(){return b.color.make(c.r,c.b,c.g,c.a)};return c.normalize()};b.color.extract=function(d,e){var c;do{c=d.css(e).toLowerCase();if(c!=""&&c!="transparent"){break}d=d.parent()}while(!b.nodeName(d.get(0),"body"));if(c=="rgba(0, 0, 0, 0)"){c="transparent"}return b.color.parse(c)};b.color.parse=function(c){var d,f=b.color.make;if(d=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c)){return f(parseInt(d[1],10),parseInt(d[2],10),parseInt(d[3],10))}if(d=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(c)){return f(parseInt(d[1],10),parseInt(d[2],10),parseInt(d[3],10),parseFloat(d[4]))}if(d=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c)){return f(parseFloat(d[1])*2.55,parseFloat(d[2])*2.55,parseFloat(d[3])*2.55)}if(d=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(c)){return f(parseFloat(d[1])*2.55,parseFloat(d[2])*2.55,parseFloat(d[3])*2.55,parseFloat(d[4]))}if(d=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c)){return f(parseInt(d[1],16),parseInt(d[2],16),parseInt(d[3],16))}if(d=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c)){return f(parseInt(d[1]+d[1],16),parseInt(d[2]+d[2],16),parseInt(d[3]+d[3],16))}var e=b.trim(c).toLowerCase();if(e=="transparent"){return f(255,255,255,0)}else{d=a[e]||[0,0,0];return f(d[0],d[1],d[2])}};var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery);(function(c){function b(av,ai,J,af){var Q=[],O={colors:["#edc240","#afd8f8","#cb4b4b","#4da74d","#9440ed"],legend:{show:true,noColumns:1,labelFormatter:null,labelBoxBorderColor:"#ccc",container:null,position:"ne",margin:5,backgroundColor:null,backgroundOpacity:0.85},xaxis:{show:null,position:"bottom",mode:null,color:null,tickColor:null,transform:null,inverseTransform:null,min:null,max:null,autoscaleMargin:null,ticks:null,tickFormatter:null,labelWidth:null,labelHeight:null,reserveSpace:null,tickLength:null,alignTicksWithAxis:null,tickDecimals:null,tickSize:null,minTickSize:null,monthNames:null,timeformat:null,twelveHourClock:false},yaxis:{autoscaleMargin:0.02,position:"left"},xaxes:[],yaxes:[],series:{points:{show:false,radius:3,lineWidth:2,fill:true,fillColor:"#ffffff",symbol:"circle"},lines:{lineWidth:2,fill:false,fillColor:null,steps:false},bars:{show:false,lineWidth:2,barWidth:1,fill:true,fillColor:null,align:"left",horizontal:false},shadowSize:3},grid:{show:true,aboveData:false,color:"#545454",backgroundColor:null,borderColor:null,tickColor:null,labelMargin:5,axisMargin:8,borderWidth:2,minBorderMargin:null,markings:null,markingsColor:"#f4f4f4",markingsLineWidth:2,clickable:false,hoverable:false,autoHighlight:true,mouseActiveRadius:10},hooks:{}},az=null,ad=null,y=null,H=null,A=null,p=[],aw=[],q={left:0,right:0,top:0,bottom:0},G=0,I=0,h=0,w=0,ak={processOptions:[],processRawData:[],processDatapoints:[],drawSeries:[],draw:[],bindEvents:[],drawOverlay:[],shutdown:[]},aq=this;aq.setData=aj;aq.setupGrid=t;aq.draw=W;aq.getPlaceholder=function(){return av};aq.getCanvas=function(){return az};aq.getPlotOffset=function(){return q};aq.width=function(){return h};aq.height=function(){return w};aq.offset=function(){var aB=y.offset();aB.left+=q.left;aB.top+=q.top;return aB};aq.getData=function(){return Q};aq.getAxes=function(){var aC={},aB;c.each(p.concat(aw),function(aD,aE){if(aE){aC[aE.direction+(aE.n!=1?aE.n:"")+"axis"]=aE}});return aC};aq.getXAxes=function(){return p};aq.getYAxes=function(){return aw};aq.c2p=C;aq.p2c=ar;aq.getOptions=function(){return O};aq.highlight=x;aq.unhighlight=T;aq.triggerRedrawOverlay=f;aq.pointOffset=function(aB){return{left:parseInt(p[aA(aB,"x")-1].p2c(+aB.x)+q.left),top:parseInt(aw[aA(aB,"y")-1].p2c(+aB.y)+q.top)}};aq.shutdown=ag;aq.resize=function(){B();g(az);g(ad)};aq.hooks=ak;F(aq);Z(J);X();aj(ai);t();W();ah();function an(aD,aB){aB=[aq].concat(aB);for(var aC=0;aC<aD.length;++aC){aD[aC].apply(this,aB)}}function F(){for(var aB=0;aB<af.length;++aB){var aC=af[aB];aC.init(aq);if(aC.options){c.extend(true,O,aC.options)}}}function Z(aC){var aB;c.extend(true,O,aC);if(O.xaxis.color==null){O.xaxis.color=O.grid.color}if(O.yaxis.color==null){O.yaxis.color=O.grid.color}if(O.xaxis.tickColor==null){O.xaxis.tickColor=O.grid.tickColor}if(O.yaxis.tickColor==null){O.yaxis.tickColor=O.grid.tickColor}if(O.grid.borderColor==null){O.grid.borderColor=O.grid.color}if(O.grid.tickColor==null){O.grid.tickColor=c.color.parse(O.grid.color).scale("a",0.22).toString()}for(aB=0;aB<Math.max(1,O.xaxes.length);++aB){O.xaxes[aB]=c.extend(true,{},O.xaxis,O.xaxes[aB])}for(aB=0;aB<Math.max(1,O.yaxes.length);++aB){O.yaxes[aB]=c.extend(true,{},O.yaxis,O.yaxes[aB])}if(O.xaxis.noTicks&&O.xaxis.ticks==null){O.xaxis.ticks=O.xaxis.noTicks}if(O.yaxis.noTicks&&O.yaxis.ticks==null){O.yaxis.ticks=O.yaxis.noTicks}if(O.x2axis){O.xaxes[1]=c.extend(true,{},O.xaxis,O.x2axis);O.xaxes[1].position="top"}if(O.y2axis){O.yaxes[1]=c.extend(true,{},O.yaxis,O.y2axis);O.yaxes[1].position="right"}if(O.grid.coloredAreas){O.grid.markings=O.grid.coloredAreas}if(O.grid.coloredAreasColor){O.grid.markingsColor=O.grid.coloredAreasColor}if(O.lines){c.extend(true,O.series.lines,O.lines)}if(O.points){c.extend(true,O.series.points,O.points)}if(O.bars){c.extend(true,O.series.bars,O.bars)}if(O.shadowSize!=null){O.series.shadowSize=O.shadowSize}for(aB=0;aB<O.xaxes.length;++aB){V(p,aB+1).options=O.xaxes[aB]}for(aB=0;aB<O.yaxes.length;++aB){V(aw,aB+1).options=O.yaxes[aB]}for(var aD in ak){if(O.hooks[aD]&&O.hooks[aD].length){ak[aD]=ak[aD].concat(O.hooks[aD])}}an(ak.processOptions,[O])}function aj(aB){Q=Y(aB);ax();z()}function Y(aE){var aC=[];for(var aB=0;aB<aE.length;++aB){var aD=c.extend(true,{},O.series);if(aE[aB].data!=null){aD.data=aE[aB].data;delete aE[aB].data;c.extend(true,aD,aE[aB]);aE[aB].data=aD.data}else{aD.data=aE[aB]}aC.push(aD)}return aC}function aA(aC,aD){var aB=aC[aD+"axis"];if(typeof aB=="object"){aB=aB.n}if(typeof aB!="number"){aB=1}return aB}function m(){return c.grep(p.concat(aw),function(aB){return aB})}function C(aE){var aC={},aB,aD;for(aB=0;aB<p.length;++aB){aD=p[aB];if(aD&&aD.used){aC["x"+aD.n]=aD.c2p(aE.left)}}for(aB=0;aB<aw.length;++aB){aD=aw[aB];if(aD&&aD.used){aC["y"+aD.n]=aD.c2p(aE.top)}}if(aC.x1!==undefined){aC.x=aC.x1}if(aC.y1!==undefined){aC.y=aC.y1}return aC}function ar(aF){var aD={},aC,aE,aB;for(aC=0;aC<p.length;++aC){aE=p[aC];if(aE&&aE.used){aB="x"+aE.n;if(aF[aB]==null&&aE.n==1){aB="x"}if(aF[aB]!=null){aD.left=aE.p2c(aF[aB]);break}}}for(aC=0;aC<aw.length;++aC){aE=aw[aC];if(aE&&aE.used){aB="y"+aE.n;if(aF[aB]==null&&aE.n==1){aB="y"}if(aF[aB]!=null){aD.top=aE.p2c(aF[aB]);break}}}return aD}function V(aC,aB){if(!aC[aB-1]){aC[aB-1]={n:aB,direction:aC==p?"x":"y",options:c.extend(true,{},aC==p?O.xaxis:O.yaxis)}}return aC[aB-1]}function ax(){var aG;var aM=Q.length,aB=[],aE=[];for(aG=0;aG<Q.length;++aG){var aJ=Q[aG].color;if(aJ!=null){--aM;if(typeof aJ=="number"){aE.push(aJ)}else{aB.push(c.color.parse(Q[aG].color))}}}for(aG=0;aG<aE.length;++aG){aM=Math.max(aM,aE[aG]+1)}var aC=[],aF=0;aG=0;while(aC.length<aM){var aI;if(O.colors.length==aG){aI=c.color.make(100,100,100)}else{aI=c.color.parse(O.colors[aG])}var aD=aF%2==1?-1:1;aI.scale("rgb",1+aD*Math.ceil(aF/2)*0.2);aC.push(aI);++aG;if(aG>=O.colors.length){aG=0;++aF}}var aH=0,aN;for(aG=0;aG<Q.length;++aG){aN=Q[aG];if(aN.color==null){aN.color=aC[aH].toString();++aH}else{if(typeof aN.color=="number"){aN.color=aC[aN.color].toString()}}if(aN.lines.show==null){var aL,aK=true;for(aL in aN){if(aN[aL]&&aN[aL].show){aK=false;break}}if(aK){aN.lines.show=true}}aN.xaxis=V(p,aA(aN,"x"));aN.yaxis=V(aw,aA(aN,"y"))}}function z(){var aO=Number.POSITIVE_INFINITY,aI=Number.NEGATIVE_INFINITY,aB=Number.MAX_VALUE,aU,aS,aR,aN,aD,aJ,aT,aP,aH,aG,aC,a0,aX,aL;function aF(a3,a2,a1){if(a2<a3.datamin&&a2!=-aB){a3.datamin=a2}if(a1>a3.datamax&&a1!=aB){a3.datamax=a1}}c.each(m(),function(a1,a2){a2.datamin=aO;a2.datamax=aI;a2.used=false});for(aU=0;aU<Q.length;++aU){aJ=Q[aU];aJ.datapoints={points:[]};an(ak.processRawData,[aJ,aJ.data,aJ.datapoints])}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];var aZ=aJ.data,aW=aJ.datapoints.format;if(!aW){aW=[];aW.push({x:true,number:true,required:true});aW.push({y:true,number:true,required:true});if(aJ.bars.show||(aJ.lines.show&&aJ.lines.fill)){aW.push({y:true,number:true,required:false,defaultValue:0});if(aJ.bars.horizontal){delete aW[aW.length-1].y;aW[aW.length-1].x=true}}aJ.datapoints.format=aW}if(aJ.datapoints.pointsize!=null){continue}aJ.datapoints.pointsize=aW.length;aP=aJ.datapoints.pointsize;aT=aJ.datapoints.points;insertSteps=aJ.lines.show&&aJ.lines.steps;aJ.xaxis.used=aJ.yaxis.used=true;for(aS=aR=0;aS<aZ.length;++aS,aR+=aP){aL=aZ[aS];var aE=aL==null;if(!aE){for(aN=0;aN<aP;++aN){a0=aL[aN];aX=aW[aN];if(aX){if(aX.number&&a0!=null){a0=+a0;if(isNaN(a0)){a0=null}else{if(a0==Infinity){a0=aB}else{if(a0==-Infinity){a0=-aB}}}}if(a0==null){if(aX.required){aE=true}if(aX.defaultValue!=null){a0=aX.defaultValue}}}aT[aR+aN]=a0}}if(aE){for(aN=0;aN<aP;++aN){a0=aT[aR+aN];if(a0!=null){aX=aW[aN];if(aX.x){aF(aJ.xaxis,a0,a0)}if(aX.y){aF(aJ.yaxis,a0,a0)}}aT[aR+aN]=null}}else{if(insertSteps&&aR>0&&aT[aR-aP]!=null&&aT[aR-aP]!=aT[aR]&&aT[aR-aP+1]!=aT[aR+1]){for(aN=0;aN<aP;++aN){aT[aR+aP+aN]=aT[aR+aN]}aT[aR+1]=aT[aR-aP+1];aR+=aP}}}}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];an(ak.processDatapoints,[aJ,aJ.datapoints])}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];aT=aJ.datapoints.points,aP=aJ.datapoints.pointsize;var aK=aO,aQ=aO,aM=aI,aV=aI;for(aS=0;aS<aT.length;aS+=aP){if(aT[aS]==null){continue}for(aN=0;aN<aP;++aN){a0=aT[aS+aN];aX=aW[aN];if(!aX||a0==aB||a0==-aB){continue}if(aX.x){if(a0<aK){aK=a0}if(a0>aM){aM=a0}}if(aX.y){if(a0<aQ){aQ=a0}if(a0>aV){aV=a0}}}}if(aJ.bars.show){var aY=aJ.bars.align=="left"?0:-aJ.bars.barWidth/2;if(aJ.bars.horizontal){aQ+=aY;aV+=aY+aJ.bars.barWidth}else{aK+=aY;aM+=aY+aJ.bars.barWidth}}aF(aJ.xaxis,aK,aM);aF(aJ.yaxis,aQ,aV)}c.each(m(),function(a1,a2){if(a2.datamin==aO){a2.datamin=null}if(a2.datamax==aI){a2.datamax=null}})}function j(aB,aC){var aD=document.createElement("canvas");aD.className=aC;aD.width=G;aD.height=I;if(!aB){c(aD).css({position:"absolute",left:0,top:0})}c(aD).appendTo(av);if(!aD.getContext){aD=window.G_vmlCanvasManager.initElement(aD)}aD.getContext("2d").save();return aD}function B(){G=av.width();I=av.height();if(G<=0||I<=0){throw"Invalid dimensions for plot, width = "+G+", height = "+I}}function g(aC){if(aC.width!=G){aC.width=G}if(aC.height!=I){aC.height=I}var aB=aC.getContext("2d");aB.restore();aB.save()}function X(){var aC,aB=av.children("canvas.base"),aD=av.children("canvas.overlay");if(aB.length==0||aD==0){av.html("");av.css({padding:0});if(av.css("position")=="static"){av.css("position","relative")}B();az=j(true,"base");ad=j(false,"overlay");aC=false}else{az=aB.get(0);ad=aD.get(0);aC=true}H=az.getContext("2d");A=ad.getContext("2d");y=c([ad,az]);if(aC){av.data("plot").shutdown();aq.resize();A.clearRect(0,0,G,I);y.unbind();av.children().not([az,ad]).remove()}av.data("plot",aq)}function ah(){if(O.grid.hoverable){y.mousemove(aa);y.mouseleave(l)}if(O.grid.clickable){y.click(R)}an(ak.bindEvents,[y])}function ag(){if(M){clearTimeout(M)}y.unbind("mousemove",aa);y.unbind("mouseleave",l);y.unbind("click",R);an(ak.shutdown,[y])}function r(aG){function aC(aH){return aH}var aF,aB,aD=aG.options.transform||aC,aE=aG.options.inverseTransform;if(aG.direction=="x"){aF=aG.scale=h/Math.abs(aD(aG.max)-aD(aG.min));aB=Math.min(aD(aG.max),aD(aG.min))}else{aF=aG.scale=w/Math.abs(aD(aG.max)-aD(aG.min));aF=-aF;aB=Math.max(aD(aG.max),aD(aG.min))}if(aD==aC){aG.p2c=function(aH){return(aH-aB)*aF}}else{aG.p2c=function(aH){return(aD(aH)-aB)*aF}}if(!aE){aG.c2p=function(aH){return aB+aH/aF}}else{aG.c2p=function(aH){return aE(aB+aH/aF)}}}function L(aD){var aB=aD.options,aF,aJ=aD.ticks||[],aI=[],aE,aK=aB.labelWidth,aG=aB.labelHeight,aC;function aH(aM,aL){return c('<div style="position:absolute;top:-10000px;'+aL+'font-size:smaller"><div class="'+aD.direction+"Axis "+aD.direction+aD.n+'Axis">'+aM.join("")+"</div></div>").appendTo(av)}if(aD.direction=="x"){if(aK==null){aK=Math.floor(G/(aJ.length>0?aJ.length:1))}if(aG==null){aI=[];for(aF=0;aF<aJ.length;++aF){aE=aJ[aF].label;if(aE){aI.push('<div class="tickLabel" style="float:left;width:'+aK+'px">'+aE+"</div>")}}if(aI.length>0){aI.push('<div style="clear:left"></div>');aC=aH(aI,"width:10000px;");aG=aC.height();aC.remove()}}}else{if(aK==null||aG==null){for(aF=0;aF<aJ.length;++aF){aE=aJ[aF].label;if(aE){aI.push('<div class="tickLabel">'+aE+"</div>")}}if(aI.length>0){aC=aH(aI,"");if(aK==null){aK=aC.children().width()}if(aG==null){aG=aC.find("div.tickLabel").height()}aC.remove()}}}if(aK==null){aK=0}if(aG==null){aG=0}aD.labelWidth=aK;aD.labelHeight=aG}function au(aD){var aC=aD.labelWidth,aL=aD.labelHeight,aH=aD.options.position,aF=aD.options.tickLength,aG=O.grid.axisMargin,aJ=O.grid.labelMargin,aK=aD.direction=="x"?p:aw,aE;var aB=c.grep(aK,function(aN){return aN&&aN.options.position==aH&&aN.reserveSpace});if(c.inArray(aD,aB)==aB.length-1){aG=0}if(aF==null){aF="full"}var aI=c.grep(aK,function(aN){return aN&&aN.reserveSpace});var aM=c.inArray(aD,aI)==0;if(!aM&&aF=="full"){aF=5}if(!isNaN(+aF)){aJ+=+aF}if(aD.direction=="x"){aL+=aJ;if(aH=="bottom"){q.bottom+=aL+aG;aD.box={top:I-q.bottom,height:aL}}else{aD.box={top:q.top+aG,height:aL};q.top+=aL+aG}}else{aC+=aJ;if(aH=="left"){aD.box={left:q.left+aG,width:aC};q.left+=aC+aG}else{q.right+=aC+aG;aD.box={left:G-q.right,width:aC}}}aD.position=aH;aD.tickLength=aF;aD.box.padding=aJ;aD.innermost=aM}function U(aB){if(aB.direction=="x"){aB.box.left=q.left;aB.box.width=h}else{aB.box.top=q.top;aB.box.height=w}}function t(){var aC,aE=m();c.each(aE,function(aF,aG){aG.show=aG.options.show;if(aG.show==null){aG.show=aG.used}aG.reserveSpace=aG.show||aG.options.reserveSpace;n(aG)});allocatedAxes=c.grep(aE,function(aF){return aF.reserveSpace});q.left=q.right=q.top=q.bottom=0;if(O.grid.show){c.each(allocatedAxes,function(aF,aG){S(aG);P(aG);ap(aG,aG.ticks);L(aG)});for(aC=allocatedAxes.length-1;aC>=0;--aC){au(allocatedAxes[aC])}var aD=O.grid.minBorderMargin;if(aD==null){aD=0;for(aC=0;aC<Q.length;++aC){aD=Math.max(aD,Q[aC].points.radius+Q[aC].points.lineWidth/2)}}for(var aB in q){q[aB]+=O.grid.borderWidth;q[aB]=Math.max(aD,q[aB])}}h=G-q.left-q.right;w=I-q.bottom-q.top;c.each(aE,function(aF,aG){r(aG)});if(O.grid.show){c.each(allocatedAxes,function(aF,aG){U(aG)});k()}o()}function n(aE){var aF=aE.options,aD=+(aF.min!=null?aF.min:aE.datamin),aB=+(aF.max!=null?aF.max:aE.datamax),aH=aB-aD;if(aH==0){var aC=aB==0?1:0.01;if(aF.min==null){aD-=aC}if(aF.max==null||aF.min!=null){aB+=aC}}else{var aG=aF.autoscaleMargin;if(aG!=null){if(aF.min==null){aD-=aH*aG;if(aD<0&&aE.datamin!=null&&aE.datamin>=0){aD=0}}if(aF.max==null){aB+=aH*aG;if(aB>0&&aE.datamax!=null&&aE.datamax<=0){aB=0}}}}aE.min=aD;aE.max=aB}function S(aG){var aM=aG.options;var aH;if(typeof aM.ticks=="number"&&aM.ticks>0){aH=aM.ticks}else{aH=0.3*Math.sqrt(aG.direction=="x"?G:I)}var aT=(aG.max-aG.min)/aH,aO,aB,aN,aR,aS,aQ,aI;if(aM.mode=="time"){var aJ={second:1000,minute:60*1000,hour:60*60*1000,day:24*60*60*1000,month:30*24*60*60*1000,year:365.2425*24*60*60*1000};var aK=[[1,"second"],[2,"second"],[5,"second"],[10,"second"],[30,"second"],[1,"minute"],[2,"minute"],[5,"minute"],[10,"minute"],[30,"minute"],[1,"hour"],[2,"hour"],[4,"hour"],[8,"hour"],[12,"hour"],[1,"day"],[2,"day"],[3,"day"],[0.25,"month"],[0.5,"month"],[1,"month"],[2,"month"],[3,"month"],[6,"month"],[1,"year"]];var aC=0;if(aM.minTickSize!=null){if(typeof aM.tickSize=="number"){aC=aM.tickSize}else{aC=aM.minTickSize[0]*aJ[aM.minTickSize[1]]}}for(var aS=0;aS<aK.length-1;++aS){if(aT<(aK[aS][0]*aJ[aK[aS][1]]+aK[aS+1][0]*aJ[aK[aS+1][1]])/2&&aK[aS][0]*aJ[aK[aS][1]]>=aC){break}}aO=aK[aS][0];aN=aK[aS][1];if(aN=="year"){aQ=Math.pow(10,Math.floor(Math.log(aT/aJ.year)/Math.LN10));aI=(aT/aJ.year)/aQ;if(aI<1.5){aO=1}else{if(aI<3){aO=2}else{if(aI<7.5){aO=5}else{aO=10}}}aO*=aQ}aG.tickSize=aM.tickSize||[aO,aN];aB=function(aX){var a2=[],a0=aX.tickSize[0],a3=aX.tickSize[1],a1=new Date(aX.min);var aW=a0*aJ[a3];if(a3=="second"){a1.setUTCSeconds(a(a1.getUTCSeconds(),a0))}if(a3=="minute"){a1.setUTCMinutes(a(a1.getUTCMinutes(),a0))}if(a3=="hour"){a1.setUTCHours(a(a1.getUTCHours(),a0))}if(a3=="month"){a1.setUTCMonth(a(a1.getUTCMonth(),a0))}if(a3=="year"){a1.setUTCFullYear(a(a1.getUTCFullYear(),a0))}a1.setUTCMilliseconds(0);if(aW>=aJ.minute){a1.setUTCSeconds(0)}if(aW>=aJ.hour){a1.setUTCMinutes(0)}if(aW>=aJ.day){a1.setUTCHours(0)}if(aW>=aJ.day*4){a1.setUTCDate(1)}if(aW>=aJ.year){a1.setUTCMonth(0)}var a5=0,a4=Number.NaN,aY;do{aY=a4;a4=a1.getTime();a2.push(a4);if(a3=="month"){if(a0<1){a1.setUTCDate(1);var aV=a1.getTime();a1.setUTCMonth(a1.getUTCMonth()+1);var aZ=a1.getTime();a1.setTime(a4+a5*aJ.hour+(aZ-aV)*a0);a5=a1.getUTCHours();a1.setUTCHours(0)}else{a1.setUTCMonth(a1.getUTCMonth()+a0)}}else{if(a3=="year"){a1.setUTCFullYear(a1.getUTCFullYear()+a0)}else{a1.setTime(a4+aW)}}}while(a4<aX.max&&a4!=aY);return a2};aR=function(aV,aY){var a0=new Date(aV);if(aM.timeformat!=null){return c.plot.formatDate(a0,aM.timeformat,aM.monthNames)}var aW=aY.tickSize[0]*aJ[aY.tickSize[1]];var aX=aY.max-aY.min;var aZ=(aM.twelveHourClock)?" %p":"";if(aW<aJ.minute){fmt="%h:%M:%S"+aZ}else{if(aW<aJ.day){if(aX<2*aJ.day){fmt="%h:%M"+aZ}else{fmt="%b %d %h:%M"+aZ}}else{if(aW<aJ.month){fmt="%b %d"}else{if(aW<aJ.year){if(aX<aJ.year){fmt="%b"}else{fmt="%b %y"}}else{fmt="%y"}}}}return c.plot.formatDate(a0,fmt,aM.monthNames)}}else{var aU=aM.tickDecimals;var aP=-Math.floor(Math.log(aT)/Math.LN10);if(aU!=null&&aP>aU){aP=aU}aQ=Math.pow(10,-aP);aI=aT/aQ;if(aI<1.5){aO=1}else{if(aI<3){aO=2;if(aI>2.25&&(aU==null||aP+1<=aU)){aO=2.5;++aP}}else{if(aI<7.5){aO=5}else{aO=10}}}aO*=aQ;if(aM.minTickSize!=null&&aO<aM.minTickSize){aO=aM.minTickSize}aG.tickDecimals=Math.max(0,aU!=null?aU:aP);aG.tickSize=aM.tickSize||aO;aB=function(aX){var aZ=[];var a0=a(aX.min,aX.tickSize),aW=0,aV=Number.NaN,aY;do{aY=aV;aV=a0+aW*aX.tickSize;aZ.push(aV);++aW}while(aV<aX.max&&aV!=aY);return aZ};aR=function(aV,aW){return aV.toFixed(aW.tickDecimals)}}if(aM.alignTicksWithAxis!=null){var aF=(aG.direction=="x"?p:aw)[aM.alignTicksWithAxis-1];if(aF&&aF.used&&aF!=aG){var aL=aB(aG);if(aL.length>0){if(aM.min==null){aG.min=Math.min(aG.min,aL[0])}if(aM.max==null&&aL.length>1){aG.max=Math.max(aG.max,aL[aL.length-1])}}aB=function(aX){var aY=[],aV,aW;for(aW=0;aW<aF.ticks.length;++aW){aV=(aF.ticks[aW].v-aF.min)/(aF.max-aF.min);aV=aX.min+aV*(aX.max-aX.min);aY.push(aV)}return aY};if(aG.mode!="time"&&aM.tickDecimals==null){var aE=Math.max(0,-Math.floor(Math.log(aT)/Math.LN10)+1),aD=aB(aG);if(!(aD.length>1&&/\..*0$/.test((aD[1]-aD[0]).toFixed(aE)))){aG.tickDecimals=aE}}}}aG.tickGenerator=aB;if(c.isFunction(aM.tickFormatter)){aG.tickFormatter=function(aV,aW){return""+aM.tickFormatter(aV,aW)}}else{aG.tickFormatter=aR}}function P(aF){var aH=aF.options.ticks,aG=[];if(aH==null||(typeof aH=="number"&&aH>0)){aG=aF.tickGenerator(aF)}else{if(aH){if(c.isFunction(aH)){aG=aH({min:aF.min,max:aF.max})}else{aG=aH}}}var aE,aB;aF.ticks=[];for(aE=0;aE<aG.length;++aE){var aC=null;var aD=aG[aE];if(typeof aD=="object"){aB=+aD[0];if(aD.length>1){aC=aD[1]}}else{aB=+aD}if(aC==null){aC=aF.tickFormatter(aB,aF)}if(!isNaN(aB)){aF.ticks.push({v:aB,label:aC})}}}function ap(aB,aC){if(aB.options.autoscaleMargin&&aC.length>0){if(aB.options.min==null){aB.min=Math.min(aB.min,aC[0].v)}if(aB.options.max==null&&aC.length>1){aB.max=Math.max(aB.max,aC[aC.length-1].v)}}}function W(){H.clearRect(0,0,G,I);var aC=O.grid;if(aC.show&&aC.backgroundColor){N()}if(aC.show&&!aC.aboveData){ac()}for(var aB=0;aB<Q.length;++aB){an(ak.drawSeries,[H,Q[aB]]);d(Q[aB])}an(ak.draw,[H]);if(aC.show&&aC.aboveData){ac()}}function D(aB,aI){var aE,aH,aG,aD,aF=m();for(i=0;i<aF.length;++i){aE=aF[i];if(aE.direction==aI){aD=aI+aE.n+"axis";if(!aB[aD]&&aE.n==1){aD=aI+"axis"}if(aB[aD]){aH=aB[aD].from;aG=aB[aD].to;break}}}if(!aB[aD]){aE=aI=="x"?p[0]:aw[0];aH=aB[aI+"1"];aG=aB[aI+"2"]}if(aH!=null&&aG!=null&&aH>aG){var aC=aH;aH=aG;aG=aC}return{from:aH,to:aG,axis:aE}}function N(){H.save();H.translate(q.left,q.top);H.fillStyle=am(O.grid.backgroundColor,w,0,"rgba(255, 255, 255, 0)");H.fillRect(0,0,h,w);H.restore()}function ac(){var aF;H.save();H.translate(q.left,q.top);var aH=O.grid.markings;if(aH){if(c.isFunction(aH)){var aK=aq.getAxes();aK.xmin=aK.xaxis.min;aK.xmax=aK.xaxis.max;aK.ymin=aK.yaxis.min;aK.ymax=aK.yaxis.max;aH=aH(aK)}for(aF=0;aF<aH.length;++aF){var aD=aH[aF],aC=D(aD,"x"),aI=D(aD,"y");if(aC.from==null){aC.from=aC.axis.min}if(aC.to==null){aC.to=aC.axis.max}if(aI.from==null){aI.from=aI.axis.min}if(aI.to==null){aI.to=aI.axis.max}if(aC.to<aC.axis.min||aC.from>aC.axis.max||aI.to<aI.axis.min||aI.from>aI.axis.max){continue}aC.from=Math.max(aC.from,aC.axis.min);aC.to=Math.min(aC.to,aC.axis.max);aI.from=Math.max(aI.from,aI.axis.min);aI.to=Math.min(aI.to,aI.axis.max);if(aC.from==aC.to&&aI.from==aI.to){continue}aC.from=aC.axis.p2c(aC.from);aC.to=aC.axis.p2c(aC.to);aI.from=aI.axis.p2c(aI.from);aI.to=aI.axis.p2c(aI.to);if(aC.from==aC.to||aI.from==aI.to){H.beginPath();H.strokeStyle=aD.color||O.grid.markingsColor;H.lineWidth=aD.lineWidth||O.grid.markingsLineWidth;H.moveTo(aC.from,aI.from);H.lineTo(aC.to,aI.to);H.stroke()}else{H.fillStyle=aD.color||O.grid.markingsColor;H.fillRect(aC.from,aI.to,aC.to-aC.from,aI.from-aI.to)}}}var aK=m(),aM=O.grid.borderWidth;for(var aE=0;aE<aK.length;++aE){var aB=aK[aE],aG=aB.box,aQ=aB.tickLength,aN,aL,aP,aJ;if(!aB.show||aB.ticks.length==0){continue}H.strokeStyle=aB.options.tickColor||c.color.parse(aB.options.color).scale("a",0.22).toString();H.lineWidth=1;if(aB.direction=="x"){aN=0;if(aQ=="full"){aL=(aB.position=="top"?0:w)}else{aL=aG.top-q.top+(aB.position=="top"?aG.height:0)}}else{aL=0;if(aQ=="full"){aN=(aB.position=="left"?0:h)}else{aN=aG.left-q.left+(aB.position=="left"?aG.width:0)}}if(!aB.innermost){H.beginPath();aP=aJ=0;if(aB.direction=="x"){aP=h}else{aJ=w}if(H.lineWidth==1){aN=Math.floor(aN)+0.5;aL=Math.floor(aL)+0.5}H.moveTo(aN,aL);H.lineTo(aN+aP,aL+aJ);H.stroke()}H.beginPath();for(aF=0;aF<aB.ticks.length;++aF){var aO=aB.ticks[aF].v;aP=aJ=0;if(aO<aB.min||aO>aB.max||(aQ=="full"&&aM>0&&(aO==aB.min||aO==aB.max))){continue}if(aB.direction=="x"){aN=aB.p2c(aO);aJ=aQ=="full"?-w:aQ;if(aB.position=="top"){aJ=-aJ}}else{aL=aB.p2c(aO);aP=aQ=="full"?-h:aQ;if(aB.position=="left"){aP=-aP}}if(H.lineWidth==1){if(aB.direction=="x"){aN=Math.floor(aN)+0.5}else{aL=Math.floor(aL)+0.5}}H.moveTo(aN,aL);H.lineTo(aN+aP,aL+aJ)}H.stroke()}if(aM){H.lineWidth=aM;H.strokeStyle=O.grid.borderColor;H.strokeRect(-aM/2,-aM/2,h+aM,w+aM)}H.restore()}function k(){av.find(".tickLabels").remove();var aG=['<div class="tickLabels" style="font-size:smaller">'];var aJ=m();for(var aD=0;aD<aJ.length;++aD){var aC=aJ[aD],aF=aC.box;if(!aC.show){continue}aG.push('<div class="'+aC.direction+"Axis "+aC.direction+aC.n+'Axis" style="color:'+aC.options.color+'">');for(var aE=0;aE<aC.ticks.length;++aE){var aH=aC.ticks[aE];if(!aH.label||aH.v<aC.min||aH.v>aC.max){continue}var aK={},aI;if(aC.direction=="x"){aI="center";aK.left=Math.round(q.left+aC.p2c(aH.v)-aC.labelWidth/2);if(aC.position=="bottom"){aK.top=aF.top+aF.padding}else{aK.bottom=I-(aF.top+aF.height-aF.padding)}}else{aK.top=Math.round(q.top+aC.p2c(aH.v)-aC.labelHeight/2);if(aC.position=="left"){aK.right=G-(aF.left+aF.width-aF.padding);aI="right"}else{aK.left=aF.left+aF.padding;aI="left"}}aK.width=aC.labelWidth;var aB=["position:absolute","text-align:"+aI];for(var aL in aK){aB.push(aL+":"+aK[aL]+"px")}aG.push('<div class="tickLabel" style="'+aB.join(";")+'">'+aH.label+"</div>")}aG.push("</div>")}aG.push("</div>");av.append(aG.join(""))}function d(aB){if(aB.lines.show){at(aB)}if(aB.bars.show){e(aB)}if(aB.points.show){ao(aB)}}function at(aE){function aD(aP,aQ,aI,aU,aT){var aV=aP.points,aJ=aP.pointsize,aN=null,aM=null;H.beginPath();for(var aO=aJ;aO<aV.length;aO+=aJ){var aL=aV[aO-aJ],aS=aV[aO-aJ+1],aK=aV[aO],aR=aV[aO+1];if(aL==null||aK==null){continue}if(aS<=aR&&aS<aT.min){if(aR<aT.min){continue}aL=(aT.min-aS)/(aR-aS)*(aK-aL)+aL;aS=aT.min}else{if(aR<=aS&&aR<aT.min){if(aS<aT.min){continue}aK=(aT.min-aS)/(aR-aS)*(aK-aL)+aL;aR=aT.min}}if(aS>=aR&&aS>aT.max){if(aR>aT.max){continue}aL=(aT.max-aS)/(aR-aS)*(aK-aL)+aL;aS=aT.max}else{if(aR>=aS&&aR>aT.max){if(aS>aT.max){continue}aK=(aT.max-aS)/(aR-aS)*(aK-aL)+aL;aR=aT.max}}if(aL<=aK&&aL<aU.min){if(aK<aU.min){continue}aS=(aU.min-aL)/(aK-aL)*(aR-aS)+aS;aL=aU.min}else{if(aK<=aL&&aK<aU.min){if(aL<aU.min){continue}aR=(aU.min-aL)/(aK-aL)*(aR-aS)+aS;aK=aU.min}}if(aL>=aK&&aL>aU.max){if(aK>aU.max){continue}aS=(aU.max-aL)/(aK-aL)*(aR-aS)+aS;aL=aU.max}else{if(aK>=aL&&aK>aU.max){if(aL>aU.max){continue}aR=(aU.max-aL)/(aK-aL)*(aR-aS)+aS;aK=aU.max}}if(aL!=aN||aS!=aM){H.moveTo(aU.p2c(aL)+aQ,aT.p2c(aS)+aI)}aN=aK;aM=aR;H.lineTo(aU.p2c(aK)+aQ,aT.p2c(aR)+aI)}H.stroke()}function aF(aI,aQ,aP){var aW=aI.points,aV=aI.pointsize,aN=Math.min(Math.max(0,aP.min),aP.max),aX=0,aU,aT=false,aM=1,aL=0,aR=0;while(true){if(aV>0&&aX>aW.length+aV){break}aX+=aV;var aZ=aW[aX-aV],aK=aW[aX-aV+aM],aY=aW[aX],aJ=aW[aX+aM];if(aT){if(aV>0&&aZ!=null&&aY==null){aR=aX;aV=-aV;aM=2;continue}if(aV<0&&aX==aL+aV){H.fill();aT=false;aV=-aV;aM=1;aX=aL=aR+aV;continue}}if(aZ==null||aY==null){continue}if(aZ<=aY&&aZ<aQ.min){if(aY<aQ.min){continue}aK=(aQ.min-aZ)/(aY-aZ)*(aJ-aK)+aK;aZ=aQ.min}else{if(aY<=aZ&&aY<aQ.min){if(aZ<aQ.min){continue}aJ=(aQ.min-aZ)/(aY-aZ)*(aJ-aK)+aK;aY=aQ.min}}if(aZ>=aY&&aZ>aQ.max){if(aY>aQ.max){continue}aK=(aQ.max-aZ)/(aY-aZ)*(aJ-aK)+aK;aZ=aQ.max}else{if(aY>=aZ&&aY>aQ.max){if(aZ>aQ.max){continue}aJ=(aQ.max-aZ)/(aY-aZ)*(aJ-aK)+aK;aY=aQ.max}}if(!aT){H.beginPath();H.moveTo(aQ.p2c(aZ),aP.p2c(aN));aT=true}if(aK>=aP.max&&aJ>=aP.max){H.lineTo(aQ.p2c(aZ),aP.p2c(aP.max));H.lineTo(aQ.p2c(aY),aP.p2c(aP.max));continue}else{if(aK<=aP.min&&aJ<=aP.min){H.lineTo(aQ.p2c(aZ),aP.p2c(aP.min));H.lineTo(aQ.p2c(aY),aP.p2c(aP.min));continue}}var aO=aZ,aS=aY;if(aK<=aJ&&aK<aP.min&&aJ>=aP.min){aZ=(aP.min-aK)/(aJ-aK)*(aY-aZ)+aZ;aK=aP.min}else{if(aJ<=aK&&aJ<aP.min&&aK>=aP.min){aY=(aP.min-aK)/(aJ-aK)*(aY-aZ)+aZ;aJ=aP.min}}if(aK>=aJ&&aK>aP.max&&aJ<=aP.max){aZ=(aP.max-aK)/(aJ-aK)*(aY-aZ)+aZ;aK=aP.max}else{if(aJ>=aK&&aJ>aP.max&&aK<=aP.max){aY=(aP.max-aK)/(aJ-aK)*(aY-aZ)+aZ;aJ=aP.max}}if(aZ!=aO){H.lineTo(aQ.p2c(aO),aP.p2c(aK))}H.lineTo(aQ.p2c(aZ),aP.p2c(aK));H.lineTo(aQ.p2c(aY),aP.p2c(aJ));if(aY!=aS){H.lineTo(aQ.p2c(aY),aP.p2c(aJ));H.lineTo(aQ.p2c(aS),aP.p2c(aJ))}}}H.save();H.translate(q.left,q.top);H.lineJoin="round";var aG=aE.lines.lineWidth,aB=aE.shadowSize;if(aG>0&&aB>0){H.lineWidth=aB;H.strokeStyle="rgba(0,0,0,0.1)";var aH=Math.PI/18;aD(aE.datapoints,Math.sin(aH)*(aG/2+aB/2),Math.cos(aH)*(aG/2+aB/2),aE.xaxis,aE.yaxis);H.lineWidth=aB/2;aD(aE.datapoints,Math.sin(aH)*(aG/2+aB/4),Math.cos(aH)*(aG/2+aB/4),aE.xaxis,aE.yaxis)}H.lineWidth=aG;H.strokeStyle=aE.color;var aC=ae(aE.lines,aE.color,0,w);if(aC){H.fillStyle=aC;aF(aE.datapoints,aE.xaxis,aE.yaxis)}if(aG>0){aD(aE.datapoints,0,0,aE.xaxis,aE.yaxis)}H.restore()}function ao(aE){function aH(aN,aM,aU,aK,aS,aT,aQ,aJ){var aR=aN.points,aI=aN.pointsize;for(var aL=0;aL<aR.length;aL+=aI){var aP=aR[aL],aO=aR[aL+1];if(aP==null||aP<aT.min||aP>aT.max||aO<aQ.min||aO>aQ.max){continue}H.beginPath();aP=aT.p2c(aP);aO=aQ.p2c(aO)+aK;if(aJ=="circle"){H.arc(aP,aO,aM,0,aS?Math.PI:Math.PI*2,false)}else{aJ(H,aP,aO,aM,aS)}H.closePath();if(aU){H.fillStyle=aU;H.fill()}H.stroke()}}H.save();H.translate(q.left,q.top);var aG=aE.points.lineWidth,aC=aE.shadowSize,aB=aE.points.radius,aF=aE.points.symbol;if(aG>0&&aC>0){var aD=aC/2;H.lineWidth=aD;H.strokeStyle="rgba(0,0,0,0.1)";aH(aE.datapoints,aB,null,aD+aD/2,true,aE.xaxis,aE.yaxis,aF);H.strokeStyle="rgba(0,0,0,0.2)";aH(aE.datapoints,aB,null,aD/2,true,aE.xaxis,aE.yaxis,aF)}H.lineWidth=aG;H.strokeStyle=aE.color;aH(aE.datapoints,aB,ae(aE.points,aE.color),0,false,aE.xaxis,aE.yaxis,aF);H.restore()}function E(aN,aM,aV,aI,aQ,aF,aD,aL,aK,aU,aR,aC){var aE,aT,aJ,aP,aG,aB,aO,aH,aS;if(aR){aH=aB=aO=true;aG=false;aE=aV;aT=aN;aP=aM+aI;aJ=aM+aQ;if(aT<aE){aS=aT;aT=aE;aE=aS;aG=true;aB=false}}else{aG=aB=aO=true;aH=false;aE=aN+aI;aT=aN+aQ;aJ=aV;aP=aM;if(aP<aJ){aS=aP;aP=aJ;aJ=aS;aH=true;aO=false}}if(aT<aL.min||aE>aL.max||aP<aK.min||aJ>aK.max){return}if(aE<aL.min){aE=aL.min;aG=false}if(aT>aL.max){aT=aL.max;aB=false}if(aJ<aK.min){aJ=aK.min;aH=false}if(aP>aK.max){aP=aK.max;aO=false}aE=aL.p2c(aE);aJ=aK.p2c(aJ);aT=aL.p2c(aT);aP=aK.p2c(aP);if(aD){aU.beginPath();aU.moveTo(aE,aJ);aU.lineTo(aE,aP);aU.lineTo(aT,aP);aU.lineTo(aT,aJ);aU.fillStyle=aD(aJ,aP);aU.fill()}if(aC>0&&(aG||aB||aO||aH)){aU.beginPath();aU.moveTo(aE,aJ+aF);if(aG){aU.lineTo(aE,aP+aF)}else{aU.moveTo(aE,aP+aF)}if(aO){aU.lineTo(aT,aP+aF)}else{aU.moveTo(aT,aP+aF)}if(aB){aU.lineTo(aT,aJ+aF)}else{aU.moveTo(aT,aJ+aF)}if(aH){aU.lineTo(aE,aJ+aF)}else{aU.moveTo(aE,aJ+aF)}aU.stroke()}}function e(aD){function aC(aJ,aI,aL,aG,aK,aN,aM){var aO=aJ.points,aF=aJ.pointsize;for(var aH=0;aH<aO.length;aH+=aF){if(aO[aH]==null){continue}E(aO[aH],aO[aH+1],aO[aH+2],aI,aL,aG,aK,aN,aM,H,aD.bars.horizontal,aD.bars.lineWidth)}}H.save();H.translate(q.left,q.top);H.lineWidth=aD.bars.lineWidth;H.strokeStyle=aD.color;var aB=aD.bars.align=="left"?0:-aD.bars.barWidth/2;var aE=aD.bars.fill?function(aF,aG){return ae(aD.bars,aD.color,aF,aG)}:null;aC(aD.datapoints,aB,aB+aD.bars.barWidth,0,aE,aD.xaxis,aD.yaxis);H.restore()}function ae(aD,aB,aC,aF){var aE=aD.fill;if(!aE){return null}if(aD.fillColor){return am(aD.fillColor,aC,aF,aB)}var aG=c.color.parse(aB);aG.a=typeof aE=="number"?aE:0.4;aG.normalize();return aG.toString()}function o(){av.find(".legend").remove();if(!O.legend.show){return}var aH=[],aF=false,aN=O.legend.labelFormatter,aM,aJ;for(var aE=0;aE<Q.length;++aE){aM=Q[aE];aJ=aM.label;if(!aJ){continue}if(aE%O.legend.noColumns==0){if(aF){aH.push("</tr>")}aH.push("<tr>");aF=true}if(aN){aJ=aN(aJ,aM)}aH.push('<td class="legendColorBox"><div style="border:1px solid '+O.legend.labelBoxBorderColor+';padding:1px"><div style="width:4px;height:0;border:5px solid '+aM.color+';overflow:hidden"></div></div></td><td class="legendLabel">'+aJ+"</td>")}if(aF){aH.push("</tr>")}if(aH.length==0){return}var aL='<table style="font-size:smaller;color:'+O.grid.color+'">'+aH.join("")+"</table>";if(O.legend.container!=null){c(O.legend.container).html(aL)}else{var aI="",aC=O.legend.position,aD=O.legend.margin;if(aD[0]==null){aD=[aD,aD]}if(aC.charAt(0)=="n"){aI+="top:"+(aD[1]+q.top)+"px;"}else{if(aC.charAt(0)=="s"){aI+="bottom:"+(aD[1]+q.bottom)+"px;"}}if(aC.charAt(1)=="e"){aI+="right:"+(aD[0]+q.right)+"px;"}else{if(aC.charAt(1)=="w"){aI+="left:"+(aD[0]+q.left)+"px;"}}var aK=c('<div class="legend">'+aL.replace('style="','style="position:absolute;'+aI+";")+"</div>").appendTo(av);if(O.legend.backgroundOpacity!=0){var aG=O.legend.backgroundColor;if(aG==null){aG=O.grid.backgroundColor;if(aG&&typeof aG=="string"){aG=c.color.parse(aG)}else{aG=c.color.extract(aK,"background-color")}aG.a=1;aG=aG.toString()}var aB=aK.children();c('<div style="position:absolute;width:'+aB.width()+"px;height:"+aB.height()+"px;"+aI+"background-color:"+aG+';"> </div>').prependTo(aK).css("opacity",O.legend.backgroundOpacity)}}}var ab=[],M=null;function K(aI,aG,aD){var aO=O.grid.mouseActiveRadius,a0=aO*aO+1,aY=null,aR=false,aW,aU;for(aW=Q.length-1;aW>=0;--aW){if(!aD(Q[aW])){continue}var aP=Q[aW],aH=aP.xaxis,aF=aP.yaxis,aV=aP.datapoints.points,aT=aP.datapoints.pointsize,aQ=aH.c2p(aI),aN=aF.c2p(aG),aC=aO/aH.scale,aB=aO/aF.scale;if(aH.options.inverseTransform){aC=Number.MAX_VALUE}if(aF.options.inverseTransform){aB=Number.MAX_VALUE}if(aP.lines.show||aP.points.show){for(aU=0;aU<aV.length;aU+=aT){var aK=aV[aU],aJ=aV[aU+1];if(aK==null){continue}if(aK-aQ>aC||aK-aQ<-aC||aJ-aN>aB||aJ-aN<-aB){continue}var aM=Math.abs(aH.p2c(aK)-aI),aL=Math.abs(aF.p2c(aJ)-aG),aS=aM*aM+aL*aL;if(aS<a0){a0=aS;aY=[aW,aU/aT]}}}if(aP.bars.show&&!aY){var aE=aP.bars.align=="left"?0:-aP.bars.barWidth/2,aX=aE+aP.bars.barWidth;for(aU=0;aU<aV.length;aU+=aT){var aK=aV[aU],aJ=aV[aU+1],aZ=aV[aU+2];if(aK==null){continue}if(Q[aW].bars.horizontal?(aQ<=Math.max(aZ,aK)&&aQ>=Math.min(aZ,aK)&&aN>=aJ+aE&&aN<=aJ+aX):(aQ>=aK+aE&&aQ<=aK+aX&&aN>=Math.min(aZ,aJ)&&aN<=Math.max(aZ,aJ))){aY=[aW,aU/aT]}}}}if(aY){aW=aY[0];aU=aY[1];aT=Q[aW].datapoints.pointsize;return{datapoint:Q[aW].datapoints.points.slice(aU*aT,(aU+1)*aT),dataIndex:aU,series:Q[aW],seriesIndex:aW}}return null}function aa(aB){if(O.grid.hoverable){u("plothover",aB,function(aC){return aC.hoverable!=false})}}function l(aB){if(O.grid.hoverable){u("plothover",aB,function(aC){return false})}}function R(aB){u("plotclick",aB,function(aC){return aC.clickable!=false})}function u(aC,aB,aD){var aE=y.offset(),aH=aB.pageX-aE.left-q.left,aF=aB.pageY-aE.top-q.top,aJ=C({left:aH,top:aF});aJ.pageX=aB.pageX;aJ.pageY=aB.pageY;var aK=K(aH,aF,aD);if(aK){aK.pageX=parseInt(aK.series.xaxis.p2c(aK.datapoint[0])+aE.left+q.left);aK.pageY=parseInt(aK.series.yaxis.p2c(aK.datapoint[1])+aE.top+q.top)}if(O.grid.autoHighlight){for(var aG=0;aG<ab.length;++aG){var aI=ab[aG];if(aI.auto==aC&&!(aK&&aI.series==aK.series&&aI.point[0]==aK.datapoint[0]&&aI.point[1]==aK.datapoint[1])){T(aI.series,aI.point)}}if(aK){x(aK.series,aK.datapoint,aC)}}av.trigger(aC,[aJ,aK])}function f(){if(!M){M=setTimeout(s,30)}}function s(){M=null;A.save();A.clearRect(0,0,G,I);A.translate(q.left,q.top);var aC,aB;for(aC=0;aC<ab.length;++aC){aB=ab[aC];if(aB.series.bars.show){v(aB.series,aB.point)}else{ay(aB.series,aB.point)}}A.restore();an(ak.drawOverlay,[A])}function x(aD,aB,aF){if(typeof aD=="number"){aD=Q[aD]}if(typeof aB=="number"){var aE=aD.datapoints.pointsize;aB=aD.datapoints.points.slice(aE*aB,aE*(aB+1))}var aC=al(aD,aB);if(aC==-1){ab.push({series:aD,point:aB,auto:aF});f()}else{if(!aF){ab[aC].auto=false}}}function T(aD,aB){if(aD==null&&aB==null){ab=[];f()}if(typeof aD=="number"){aD=Q[aD]}if(typeof aB=="number"){aB=aD.data[aB]}var aC=al(aD,aB);if(aC!=-1){ab.splice(aC,1);f()}}function al(aD,aE){for(var aB=0;aB<ab.length;++aB){var aC=ab[aB];if(aC.series==aD&&aC.point[0]==aE[0]&&aC.point[1]==aE[1]){return aB}}return -1}function ay(aE,aD){var aC=aD[0],aI=aD[1],aH=aE.xaxis,aG=aE.yaxis;if(aC<aH.min||aC>aH.max||aI<aG.min||aI>aG.max){return}var aF=aE.points.radius+aE.points.lineWidth/2;A.lineWidth=aF;A.strokeStyle=c.color.parse(aE.color).scale("a",0.5).toString();var aB=1.5*aF,aC=aH.p2c(aC),aI=aG.p2c(aI);A.beginPath();if(aE.points.symbol=="circle"){A.arc(aC,aI,aB,0,2*Math.PI,false)}else{aE.points.symbol(A,aC,aI,aB,false)}A.closePath();A.stroke()}function v(aE,aB){A.lineWidth=aE.bars.lineWidth;A.strokeStyle=c.color.parse(aE.color).scale("a",0.5).toString();var aD=c.color.parse(aE.color).scale("a",0.5).toString();var aC=aE.bars.align=="left"?0:-aE.bars.barWidth/2;E(aB[0],aB[1],aB[2]||0,aC,aC+aE.bars.barWidth,0,function(){return aD},aE.xaxis,aE.yaxis,A,aE.bars.horizontal,aE.bars.lineWidth)}function am(aJ,aB,aH,aC){if(typeof aJ=="string"){return aJ}else{var aI=H.createLinearGradient(0,aH,0,aB);for(var aE=0,aD=aJ.colors.length;aE<aD;++aE){var aF=aJ.colors[aE];if(typeof aF!="string"){var aG=c.color.parse(aC);if(aF.brightness!=null){aG=aG.scale("rgb",aF.brightness)}if(aF.opacity!=null){aG.a*=aF.opacity}aF=aG.toString()}aI.addColorStop(aE/(aD-1),aF)}return aI}}}c.plot=function(g,e,d){var f=new b(c(g),e,d,c.plot.plugins);return f};c.plot.version="0.7";c.plot.plugins=[];c.plot.formatDate=function(l,f,h){var o=function(d){d=""+d;return d.length==1?"0"+d:d};var e=[];var p=false,j=false;var n=l.getUTCHours();var k=n<12;if(h==null){h=["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"]}if(f.search(/%p|%P/)!=-1){if(n>12){n=n-12}else{if(n==0){n=12}}}for(var g=0;g<f.length;++g){var m=f.charAt(g);if(p){switch(m){case"h":m=""+n;break;case"H":m=o(n);break;case"M":m=o(l.getUTCMinutes());break;case"S":m=o(l.getUTCSeconds());break;case"d":m=""+l.getUTCDate();break;case"m":m=""+(l.getUTCMonth()+1);break;case"y":m=""+l.getUTCFullYear();break;case"b":m=""+h[l.getUTCMonth()];break;case"p":m=(k)?("am"):("pm");break;case"P":m=(k)?("AM"):("PM");break;case"0":m="";j=true;break}if(m&&j){m=o(m);j=false}e.push(m);if(!j){p=false}}else{if(m=="%"){p=true}else{e.push(m)}}}return e.join("")};function a(e,d){return d*Math.floor(e/d)}})(jQuery);
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.navigate.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.navigate.js new file mode 100644 index 0000000..f2b9760 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.navigate.js @@ -0,0 +1,336 @@ +/* +Flot plugin for adding panning and zooming capabilities to a plot. + +The default behaviour is double click and scrollwheel up/down to zoom +in, drag to pan. The plugin defines plot.zoom({ center }), +plot.zoomOut() and plot.pan(offset) so you easily can add custom +controls. It also fires a "plotpan" and "plotzoom" event when +something happens, useful for synchronizing plots. + +Options: + + zoom: { + interactive: false + trigger: "dblclick" // or "click" for single click + amount: 1.5 // 2 = 200% (zoom in), 0.5 = 50% (zoom out) + } + + pan: { + interactive: false + cursor: "move" // CSS mouse cursor value used when dragging, e.g. "pointer" + frameRate: 20 + } + + xaxis, yaxis, x2axis, y2axis: { + zoomRange: null // or [number, number] (min range, max range) or false + panRange: null // or [number, number] (min, max) or false + } + +"interactive" enables the built-in drag/click behaviour. If you enable +interactive for pan, then you'll have a basic plot that supports +moving around; the same for zoom. + +"amount" specifies the default amount to zoom in (so 1.5 = 150%) +relative to the current viewport. + +"cursor" is a standard CSS mouse cursor string used for visual +feedback to the user when dragging. + +"frameRate" specifies the maximum number of times per second the plot +will update itself while the user is panning around on it (set to null +to disable intermediate pans, the plot will then not update until the +mouse button is released). + +"zoomRange" is the interval in which zooming can happen, e.g. with +zoomRange: [1, 100] the zoom will never scale the axis so that the +difference between min and max is smaller than 1 or larger than 100. +You can set either end to null to ignore, e.g. [1, null]. If you set +zoomRange to false, zooming on that axis will be disabled. + +"panRange" confines the panning to stay within a range, e.g. with +panRange: [-10, 20] panning stops at -10 in one end and at 20 in the +other. Either can be null, e.g. [-10, null]. If you set +panRange to false, panning on that axis will be disabled. + +Example API usage: + + plot = $.plot(...); + + // zoom default amount in on the pixel (10, 20) + plot.zoom({ center: { left: 10, top: 20 } }); + + // zoom out again + plot.zoomOut({ center: { left: 10, top: 20 } }); + + // zoom 200% in on the pixel (10, 20) + plot.zoom({ amount: 2, center: { left: 10, top: 20 } }); + + // pan 100 pixels to the left and 20 down + plot.pan({ left: -100, top: 20 }) + +Here, "center" specifies where the center of the zooming should +happen. Note that this is defined in pixel space, not the space of the +data points (you can use the p2c helpers on the axes in Flot to help +you convert between these). + +"amount" is the amount to zoom the viewport relative to the current +range, so 1 is 100% (i.e. no change), 1.5 is 150% (zoom in), 0.7 is +70% (zoom out). You can set the default in the options. + +*/ + + +// First two dependencies, jquery.event.drag.js and +// jquery.mousewheel.js, we put them inline here to save people the +// effort of downloading them. + +/* +jquery.event.drag.js ~ v1.5 ~ Copyright (c) 2008, Three Dub Media (http://threedubmedia.com) +Licensed under the MIT License ~ http://threedubmedia.googlecode.com/files/MIT-LICENSE.txt +*/ +(function(E){E.fn.drag=function(L,K,J){if(K){this.bind("dragstart",L)}if(J){this.bind("dragend",J)}return !L?this.trigger("drag"):this.bind("drag",K?K:L)};var A=E.event,B=A.special,F=B.drag={not:":input",distance:0,which:1,dragging:false,setup:function(J){J=E.extend({distance:F.distance,which:F.which,not:F.not},J||{});J.distance=I(J.distance);A.add(this,"mousedown",H,J);if(this.attachEvent){this.attachEvent("ondragstart",D)}},teardown:function(){A.remove(this,"mousedown",H);if(this===F.dragging){F.dragging=F.proxy=false}G(this,true);if(this.detachEvent){this.detachEvent("ondragstart",D)}}};B.dragstart=B.dragend={setup:function(){},teardown:function(){}};function H(L){var K=this,J,M=L.data||{};if(M.elem){K=L.dragTarget=M.elem;L.dragProxy=F.proxy||K;L.cursorOffsetX=M.pageX-M.left;L.cursorOffsetY=M.pageY-M.top;L.offsetX=L.pageX-L.cursorOffsetX;L.offsetY=L.pageY-L.cursorOffsetY}else{if(F.dragging||(M.which>0&&L.which!=M.which)||E(L.target).is(M.not)){return }}switch(L.type){case"mousedown":E.extend(M,E(K).offset(),{elem:K,target:L.target,pageX:L.pageX,pageY:L.pageY});A.add(document,"mousemove mouseup",H,M);G(K,false);F.dragging=null;return false;case !F.dragging&&"mousemove":if(I(L.pageX-M.pageX)+I(L.pageY-M.pageY)<M.distance){break}L.target=M.target;J=C(L,"dragstart",K);if(J!==false){F.dragging=K;F.proxy=L.dragProxy=E(J||K)[0]}case"mousemove":if(F.dragging){J=C(L,"drag",K);if(B.drop){B.drop.allowed=(J!==false);B.drop.handler(L)}if(J!==false){break}L.type="mouseup"}case"mouseup":A.remove(document,"mousemove mouseup",H);if(F.dragging){if(B.drop){B.drop.handler(L)}C(L,"dragend",K)}G(K,true);F.dragging=F.proxy=M.elem=false;break}return true}function C(M,K,L){M.type=K;var J=E.event.handle.call(L,M);return J===false?false:J||M.result}function I(J){return Math.pow(J,2)}function D(){return(F.dragging===false)}function G(K,J){if(!K){return }K.unselectable=J?"off":"on";K.onselectstart=function(){return J};if(K.style){K.style.MozUserSelect=J?"":"none"}}})(jQuery); + + +/* jquery.mousewheel.min.js + * Copyright (c) 2009 Brandon Aaron (http://brandonaaron.net) + * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php) + * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses. + * Thanks to: http://adomas.org/javascript-mouse-wheel/ for some pointers. + * Thanks to: Mathias Bank(http://www.mathias-bank.de) for a scope bug fix. + * + * Version: 3.0.2 + * + * Requires: 1.2.2+ + */ +(function(c){var a=["DOMMouseScroll","mousewheel"];c.event.special.mousewheel={setup:function(){if(this.addEventListener){for(var d=a.length;d;){this.addEventListener(a[--d],b,false)}}else{this.onmousewheel=b}},teardown:function(){if(this.removeEventListener){for(var d=a.length;d;){this.removeEventListener(a[--d],b,false)}}else{this.onmousewheel=null}}};c.fn.extend({mousewheel:function(d){return d?this.bind("mousewheel",d):this.trigger("mousewheel")},unmousewheel:function(d){return this.unbind("mousewheel",d)}});function b(f){var d=[].slice.call(arguments,1),g=0,e=true;f=c.event.fix(f||window.event);f.type="mousewheel";if(f.wheelDelta){g=f.wheelDelta/120}if(f.detail){g=-f.detail/3}d.unshift(f,g);return c.event.handle.apply(this,d)}})(jQuery); + + + + +(function ($) { + var options = { + xaxis: { + zoomRange: null, // or [number, number] (min range, max range) + panRange: null // or [number, number] (min, max) + }, + zoom: { + interactive: false, + trigger: "dblclick", // or "click" for single click + amount: 1.5 // how much to zoom relative to current position, 2 = 200% (zoom in), 0.5 = 50% (zoom out) + }, + pan: { + interactive: false, + cursor: "move", + frameRate: 20 + } + }; + + function init(plot) { + function onZoomClick(e, zoomOut) { + var c = plot.offset(); + c.left = e.pageX - c.left; + c.top = e.pageY - c.top; + if (zoomOut) + plot.zoomOut({ center: c }); + else + plot.zoom({ center: c }); + } + + function onMouseWheel(e, delta) { + onZoomClick(e, delta < 0); + return false; + } + + var prevCursor = 'default', prevPageX = 0, prevPageY = 0, + panTimeout = null; + + function onDragStart(e) { + if (e.which != 1) // only accept left-click + return false; + var c = plot.getPlaceholder().css('cursor'); + if (c) + prevCursor = c; + plot.getPlaceholder().css('cursor', plot.getOptions().pan.cursor); + prevPageX = e.pageX; + prevPageY = e.pageY; + } + + function onDrag(e) { + var frameRate = plot.getOptions().pan.frameRate; + if (panTimeout || !frameRate) + return; + + panTimeout = setTimeout(function () { + plot.pan({ left: prevPageX - e.pageX, + top: prevPageY - e.pageY }); + prevPageX = e.pageX; + prevPageY = e.pageY; + + panTimeout = null; + }, 1 / frameRate * 1000); + } + + function onDragEnd(e) { + if (panTimeout) { + clearTimeout(panTimeout); + panTimeout = null; + } + + plot.getPlaceholder().css('cursor', prevCursor); + plot.pan({ left: prevPageX - e.pageX, + top: prevPageY - e.pageY }); + } + + function bindEvents(plot, eventHolder) { + var o = plot.getOptions(); + if (o.zoom.interactive) { + eventHolder[o.zoom.trigger](onZoomClick); + eventHolder.mousewheel(onMouseWheel); + } + + if (o.pan.interactive) { + eventHolder.bind("dragstart", { distance: 10 }, onDragStart); + eventHolder.bind("drag", onDrag); + eventHolder.bind("dragend", onDragEnd); + } + } + + plot.zoomOut = function (args) { + if (!args) + args = {}; + + if (!args.amount) + args.amount = plot.getOptions().zoom.amount + + args.amount = 1 / args.amount; + plot.zoom(args); + } + + plot.zoom = function (args) { + if (!args) + args = {}; + + var c = args.center, + amount = args.amount || plot.getOptions().zoom.amount, + w = plot.width(), h = plot.height(); + + if (!c) + c = { left: w / 2, top: h / 2 }; + + var xf = c.left / w, + yf = c.top / h, + minmax = { + x: { + min: c.left - xf * w / amount, + max: c.left + (1 - xf) * w / amount + }, + y: { + min: c.top - yf * h / amount, + max: c.top + (1 - yf) * h / amount + } + }; + + $.each(plot.getAxes(), function(_, axis) { + var opts = axis.options, + min = minmax[axis.direction].min, + max = minmax[axis.direction].max, + zr = opts.zoomRange; + + if (zr === false) // no zooming on this axis + return; + + min = axis.c2p(min); + max = axis.c2p(max); + if (min > max) { + // make sure min < max + var tmp = min; + min = max; + max = tmp; + } + + var range = max - min; + if (zr && + ((zr[0] != null && range < zr[0]) || + (zr[1] != null && range > zr[1]))) + return; + + opts.min = min; + opts.max = max; + }); + + plot.setupGrid(); + plot.draw(); + + if (!args.preventEvent) + plot.getPlaceholder().trigger("plotzoom", [ plot ]); + } + + plot.pan = function (args) { + var delta = { + x: +args.left, + y: +args.top + }; + + if (isNaN(delta.x)) + delta.x = 0; + if (isNaN(delta.y)) + delta.y = 0; + + $.each(plot.getAxes(), function (_, axis) { + var opts = axis.options, + min, max, d = delta[axis.direction]; + + min = axis.c2p(axis.p2c(axis.min) + d), + max = axis.c2p(axis.p2c(axis.max) + d); + + var pr = opts.panRange; + if (pr === false) // no panning on this axis + return; + + if (pr) { + // check whether we hit the wall + if (pr[0] != null && pr[0] > min) { + d = pr[0] - min; + min += d; + max += d; + } + + if (pr[1] != null && pr[1] < max) { + d = pr[1] - max; + min += d; + max += d; + } + } + + opts.min = min; + opts.max = max; + }); + + plot.setupGrid(); + plot.draw(); + + if (!args.preventEvent) + plot.getPlaceholder().trigger("plotpan", [ plot ]); + } + + function shutdown(plot, eventHolder) { + eventHolder.unbind(plot.getOptions().zoom.trigger, onZoomClick); + eventHolder.unbind("mousewheel", onMouseWheel); + eventHolder.unbind("dragstart", onDragStart); + eventHolder.unbind("drag", onDrag); + eventHolder.unbind("dragend", onDragEnd); + if (panTimeout) + clearTimeout(panTimeout); + } + + plot.hooks.bindEvents.push(bindEvents); + plot.hooks.shutdown.push(shutdown); + } + + $.plot.plugins.push({ + init: init, + options: options, + name: 'navigate', + version: '1.3' + }); +})(jQuery); diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.navigate.min.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.navigate.min.js new file mode 100644 index 0000000..ecf63c9 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.navigate.min.js @@ -0,0 +1 @@ +(function(i){i.fn.drag=function(j,k,l){if(k){this.bind("dragstart",j)}if(l){this.bind("dragend",l)}return !j?this.trigger("drag"):this.bind("drag",k?k:j)};var d=i.event,c=d.special,h=c.drag={not:":input",distance:0,which:1,dragging:false,setup:function(j){j=i.extend({distance:h.distance,which:h.which,not:h.not},j||{});j.distance=e(j.distance);d.add(this,"mousedown",f,j);if(this.attachEvent){this.attachEvent("ondragstart",a)}},teardown:function(){d.remove(this,"mousedown",f);if(this===h.dragging){h.dragging=h.proxy=false}g(this,true);if(this.detachEvent){this.detachEvent("ondragstart",a)}}};c.dragstart=c.dragend={setup:function(){},teardown:function(){}};function f(j){var k=this,l,m=j.data||{};if(m.elem){k=j.dragTarget=m.elem;j.dragProxy=h.proxy||k;j.cursorOffsetX=m.pageX-m.left;j.cursorOffsetY=m.pageY-m.top;j.offsetX=j.pageX-j.cursorOffsetX;j.offsetY=j.pageY-j.cursorOffsetY}else{if(h.dragging||(m.which>0&&j.which!=m.which)||i(j.target).is(m.not)){return}}switch(j.type){case"mousedown":i.extend(m,i(k).offset(),{elem:k,target:j.target,pageX:j.pageX,pageY:j.pageY});d.add(document,"mousemove mouseup",f,m);g(k,false);h.dragging=null;return false;case !h.dragging&&"mousemove":if(e(j.pageX-m.pageX)+e(j.pageY-m.pageY)<m.distance){break}j.target=m.target;l=b(j,"dragstart",k);if(l!==false){h.dragging=k;h.proxy=j.dragProxy=i(l||k)[0]}case"mousemove":if(h.dragging){l=b(j,"drag",k);if(c.drop){c.drop.allowed=(l!==false);c.drop.handler(j)}if(l!==false){break}j.type="mouseup"}case"mouseup":d.remove(document,"mousemove mouseup",f);if(h.dragging){if(c.drop){c.drop.handler(j)}b(j,"dragend",k)}g(k,true);h.dragging=h.proxy=m.elem=false;break}return true}function b(m,k,j){m.type=k;var l=i.event.handle.call(j,m);return l===false?false:l||m.result}function e(j){return Math.pow(j,2)}function a(){return(h.dragging===false)}function g(j,k){if(!j){return}j.unselectable=k?"off":"on";j.onselectstart=function(){return k};if(j.style){j.style.MozUserSelect=k?"":"none"}}})(jQuery);(function(f){var e=["DOMMouseScroll","mousewheel"];f.event.special.mousewheel={setup:function(){if(this.addEventListener){for(var a=e.length;a;){this.addEventListener(e[--a],d,false)}}else{this.onmousewheel=d}},teardown:function(){if(this.removeEventListener){for(var a=e.length;a;){this.removeEventListener(e[--a],d,false)}}else{this.onmousewheel=null}}};f.fn.extend({mousewheel:function(a){return a?this.bind("mousewheel",a):this.trigger("mousewheel")},unmousewheel:function(a){return this.unbind("mousewheel",a)}});function d(b){var h=[].slice.call(arguments,1),a=0,c=true;b=f.event.fix(b||window.event);b.type="mousewheel";if(b.wheelDelta){a=b.wheelDelta/120}if(b.detail){a=-b.detail/3}h.unshift(b,a);return f.event.handle.apply(this,h)}})(jQuery);(function(b){var a={xaxis:{zoomRange:null,panRange:null},zoom:{interactive:false,trigger:"dblclick",amount:1.5},pan:{interactive:false,cursor:"move",frameRate:20}};function c(o){function m(q,p){var r=o.offset();r.left=q.pageX-r.left;r.top=q.pageY-r.top;if(p){o.zoomOut({center:r})}else{o.zoom({center:r})}}function d(p,q){m(p,q<0);return false}var i="default",g=0,e=0,n=null;function f(p){if(p.which!=1){return false}var q=o.getPlaceholder().css("cursor");if(q){i=q}o.getPlaceholder().css("cursor",o.getOptions().pan.cursor);g=p.pageX;e=p.pageY}function j(q){var p=o.getOptions().pan.frameRate;if(n||!p){return}n=setTimeout(function(){o.pan({left:g-q.pageX,top:e-q.pageY});g=q.pageX;e=q.pageY;n=null},1/p*1000)}function h(p){if(n){clearTimeout(n);n=null}o.getPlaceholder().css("cursor",i);o.pan({left:g-p.pageX,top:e-p.pageY})}function l(q,p){var r=q.getOptions();if(r.zoom.interactive){p[r.zoom.trigger](m);p.mousewheel(d)}if(r.pan.interactive){p.bind("dragstart",{distance:10},f);p.bind("drag",j);p.bind("dragend",h)}}o.zoomOut=function(p){if(!p){p={}}if(!p.amount){p.amount=o.getOptions().zoom.amount}p.amount=1/p.amount;o.zoom(p)};o.zoom=function(q){if(!q){q={}}var x=q.center,r=q.amount||o.getOptions().zoom.amount,p=o.width(),t=o.height();if(!x){x={left:p/2,top:t/2}}var s=x.left/p,v=x.top/t,u={x:{min:x.left-s*p/r,max:x.left+(1-s)*p/r},y:{min:x.top-v*t/r,max:x.top+(1-v)*t/r}};b.each(o.getAxes(),function(z,C){var D=C.options,B=u[C.direction].min,w=u[C.direction].max,E=D.zoomRange;if(E===false){return}B=C.c2p(B);w=C.c2p(w);if(B>w){var A=B;B=w;w=A}var y=w-B;if(E&&((E[0]!=null&&y<E[0])||(E[1]!=null&&y>E[1]))){return}D.min=B;D.max=w});o.setupGrid();o.draw();if(!q.preventEvent){o.getPlaceholder().trigger("plotzoom",[o])}};o.pan=function(p){var q={x:+p.left,y:+p.top};if(isNaN(q.x)){q.x=0}if(isNaN(q.y)){q.y=0}b.each(o.getAxes(),function(s,u){var v=u.options,t,r,w=q[u.direction];t=u.c2p(u.p2c(u.min)+w),r=u.c2p(u.p2c(u.max)+w);var x=v.panRange;if(x===false){return}if(x){if(x[0]!=null&&x[0]>t){w=x[0]-t;t+=w;r+=w}if(x[1]!=null&&x[1]<r){w=x[1]-r;t+=w;r+=w}}v.min=t;v.max=r});o.setupGrid();o.draw();if(!p.preventEvent){o.getPlaceholder().trigger("plotpan",[o])}};function k(q,p){p.unbind(q.getOptions().zoom.trigger,m);p.unbind("mousewheel",d);p.unbind("dragstart",f);p.unbind("drag",j);p.unbind("dragend",h);if(n){clearTimeout(n)}}o.hooks.bindEvents.push(l);o.hooks.shutdown.push(k)}b.plot.plugins.push({init:c,options:a,name:"navigate",version:"1.3"})})(jQuery);
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.pie.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.pie.js new file mode 100644 index 0000000..70941dd --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.pie.js @@ -0,0 +1,750 @@ +/*
+Flot plugin for rendering pie charts. The plugin assumes the data is
+coming is as a single data value for each series, and each of those
+values is a positive value or zero (negative numbers don't make
+any sense and will cause strange effects). The data values do
+NOT need to be passed in as percentage values because it
+internally calculates the total and percentages.
+
+* Created by Brian Medendorp, June 2009
+* Updated November 2009 with contributions from: btburnett3, Anthony Aragues and Xavi Ivars
+
+* Changes:
+ 2009-10-22: lineJoin set to round
+ 2009-10-23: IE full circle fix, donut
+ 2009-11-11: Added basic hover from btburnett3 - does not work in IE, and center is off in Chrome and Opera
+ 2009-11-17: Added IE hover capability submitted by Anthony Aragues
+ 2009-11-18: Added bug fix submitted by Xavi Ivars (issues with arrays when other JS libraries are included as well)
+
+
+Available options are:
+series: {
+ pie: {
+ show: true/false
+ radius: 0-1 for percentage of fullsize, or a specified pixel length, or 'auto'
+ innerRadius: 0-1 for percentage of fullsize or a specified pixel length, for creating a donut effect
+ startAngle: 0-2 factor of PI used for starting angle (in radians) i.e 3/2 starts at the top, 0 and 2 have the same result
+ tilt: 0-1 for percentage to tilt the pie, where 1 is no tilt, and 0 is completely flat (nothing will show)
+ offset: {
+ top: integer value to move the pie up or down
+ left: integer value to move the pie left or right, or 'auto'
+ },
+ stroke: {
+ color: any hexidecimal color value (other formats may or may not work, so best to stick with something like '#FFF')
+ width: integer pixel width of the stroke
+ },
+ label: {
+ show: true/false, or 'auto'
+ formatter: a user-defined function that modifies the text/style of the label text
+ radius: 0-1 for percentage of fullsize, or a specified pixel length
+ background: {
+ color: any hexidecimal color value (other formats may or may not work, so best to stick with something like '#000')
+ opacity: 0-1
+ },
+ threshold: 0-1 for the percentage value at which to hide labels (if they're too small)
+ },
+ combine: {
+ threshold: 0-1 for the percentage value at which to combine slices (if they're too small)
+ color: any hexidecimal color value (other formats may or may not work, so best to stick with something like '#CCC'), if null, the plugin will automatically use the color of the first slice to be combined
+ label: any text value of what the combined slice should be labeled
+ }
+ highlight: {
+ opacity: 0-1
+ }
+ }
+}
+
+More detail and specific examples can be found in the included HTML file.
+
+*/
+
+(function ($)
+{
+ function init(plot) // this is the "body" of the plugin
+ {
+ var canvas = null;
+ var target = null;
+ var maxRadius = null;
+ var centerLeft = null;
+ var centerTop = null;
+ var total = 0;
+ var redraw = true;
+ var redrawAttempts = 10;
+ var shrink = 0.95;
+ var legendWidth = 0;
+ var processed = false;
+ var raw = false;
+
+ // interactive variables
+ var highlights = [];
+
+ // add hook to determine if pie plugin in enabled, and then perform necessary operations
+ plot.hooks.processOptions.push(checkPieEnabled);
+ plot.hooks.bindEvents.push(bindEvents);
+
+ // check to see if the pie plugin is enabled
+ function checkPieEnabled(plot, options)
+ {
+ if (options.series.pie.show)
+ {
+ //disable grid
+ options.grid.show = false;
+
+ // set labels.show
+ if (options.series.pie.label.show=='auto')
+ if (options.legend.show)
+ options.series.pie.label.show = false;
+ else
+ options.series.pie.label.show = true;
+
+ // set radius
+ if (options.series.pie.radius=='auto')
+ if (options.series.pie.label.show)
+ options.series.pie.radius = 3/4;
+ else
+ options.series.pie.radius = 1;
+
+ // ensure sane tilt
+ if (options.series.pie.tilt>1)
+ options.series.pie.tilt=1;
+ if (options.series.pie.tilt<0)
+ options.series.pie.tilt=0;
+
+ // add processData hook to do transformations on the data
+ plot.hooks.processDatapoints.push(processDatapoints);
+ plot.hooks.drawOverlay.push(drawOverlay);
+
+ // add draw hook
+ plot.hooks.draw.push(draw);
+ }
+ }
+
+ // bind hoverable events
+ function bindEvents(plot, eventHolder)
+ {
+ var options = plot.getOptions();
+
+ if (options.series.pie.show && options.grid.hoverable)
+ eventHolder.unbind('mousemove').mousemove(onMouseMove);
+
+ if (options.series.pie.show && options.grid.clickable)
+ eventHolder.unbind('click').click(onClick);
+ }
+
+
+ // debugging function that prints out an object
+ function alertObject(obj)
+ {
+ var msg = '';
+ function traverse(obj, depth)
+ {
+ if (!depth)
+ depth = 0;
+ for (var i = 0; i < obj.length; ++i)
+ {
+ for (var j=0; j<depth; j++)
+ msg += '\t';
+
+ if( typeof obj[i] == "object")
+ { // its an object
+ msg += ''+i+':\n';
+ traverse(obj[i], depth+1);
+ }
+ else
+ { // its a value
+ msg += ''+i+': '+obj[i]+'\n';
+ }
+ }
+ }
+ traverse(obj);
+ alert(msg);
+ }
+
+ function calcTotal(data)
+ {
+ for (var i = 0; i < data.length; ++i)
+ {
+ var item = parseFloat(data[i].data[0][1]);
+ if (item)
+ total += item;
+ }
+ }
+
+ function processDatapoints(plot, series, data, datapoints)
+ {
+ if (!processed)
+ {
+ processed = true;
+
+ canvas = plot.getCanvas();
+ target = $(canvas).parent();
+ options = plot.getOptions();
+
+ plot.setData(combine(plot.getData()));
+ }
+ }
+
+ function setupPie()
+ {
+ legendWidth = target.children().filter('.legend').children().width();
+
+ // calculate maximum radius and center point
+ maxRadius = Math.min(canvas.width,(canvas.height/options.series.pie.tilt))/2;
+ centerTop = (canvas.height/2)+options.series.pie.offset.top;
+ centerLeft = (canvas.width/2);
+
+ if (options.series.pie.offset.left=='auto')
+ if (options.legend.position.match('w'))
+ centerLeft += legendWidth/2;
+ else
+ centerLeft -= legendWidth/2;
+ else
+ centerLeft += options.series.pie.offset.left;
+
+ if (centerLeft<maxRadius)
+ centerLeft = maxRadius;
+ else if (centerLeft>canvas.width-maxRadius)
+ centerLeft = canvas.width-maxRadius;
+ }
+
+ function fixData(data)
+ {
+ for (var i = 0; i < data.length; ++i)
+ {
+ if (typeof(data[i].data)=='number')
+ data[i].data = [[1,data[i].data]];
+ else if (typeof(data[i].data)=='undefined' || typeof(data[i].data[0])=='undefined')
+ {
+ if (typeof(data[i].data)!='undefined' && typeof(data[i].data.label)!='undefined')
+ data[i].label = data[i].data.label; // fix weirdness coming from flot
+ data[i].data = [[1,0]];
+
+ }
+ }
+ return data;
+ }
+
+ function combine(data)
+ {
+ data = fixData(data);
+ calcTotal(data);
+ var combined = 0;
+ var numCombined = 0;
+ var color = options.series.pie.combine.color;
+
+ var newdata = [];
+ for (var i = 0; i < data.length; ++i)
+ {
+ // make sure its a number
+ data[i].data[0][1] = parseFloat(data[i].data[0][1]);
+ if (!data[i].data[0][1])
+ data[i].data[0][1] = 0;
+
+ if (data[i].data[0][1]/total<=options.series.pie.combine.threshold)
+ {
+ combined += data[i].data[0][1];
+ numCombined++;
+ if (!color)
+ color = data[i].color;
+ }
+ else
+ {
+ newdata.push({
+ data: [[1,data[i].data[0][1]]],
+ color: data[i].color,
+ label: data[i].label,
+ angle: (data[i].data[0][1]*(Math.PI*2))/total,
+ percent: (data[i].data[0][1]/total*100)
+ });
+ }
+ }
+ if (numCombined>0)
+ newdata.push({
+ data: [[1,combined]],
+ color: color,
+ label: options.series.pie.combine.label,
+ angle: (combined*(Math.PI*2))/total,
+ percent: (combined/total*100)
+ });
+ return newdata;
+ }
+
+ function draw(plot, newCtx)
+ {
+ if (!target) return; // if no series were passed
+ ctx = newCtx;
+
+ setupPie();
+ var slices = plot.getData();
+
+ var attempts = 0;
+ while (redraw && attempts<redrawAttempts)
+ {
+ redraw = false;
+ if (attempts>0)
+ maxRadius *= shrink;
+ attempts += 1;
+ clear();
+ if (options.series.pie.tilt<=0.8)
+ drawShadow();
+ drawPie();
+ }
+ if (attempts >= redrawAttempts) {
+ clear();
+ target.prepend('<div class="error">Could not draw pie with labels contained inside canvas</div>');
+ }
+
+ if ( plot.setSeries && plot.insertLegend )
+ {
+ plot.setSeries(slices);
+ plot.insertLegend();
+ }
+
+ // we're actually done at this point, just defining internal functions at this point
+
+ function clear()
+ {
+ ctx.clearRect(0,0,canvas.width,canvas.height);
+ target.children().filter('.pieLabel, .pieLabelBackground').remove();
+ }
+
+ function drawShadow()
+ {
+ var shadowLeft = 5;
+ var shadowTop = 15;
+ var edge = 10;
+ var alpha = 0.02;
+
+ // set radius
+ if (options.series.pie.radius>1)
+ var radius = options.series.pie.radius;
+ else
+ var radius = maxRadius * options.series.pie.radius;
+
+ if (radius>=(canvas.width/2)-shadowLeft || radius*options.series.pie.tilt>=(canvas.height/2)-shadowTop || radius<=edge)
+ return; // shadow would be outside canvas, so don't draw it
+
+ ctx.save();
+ ctx.translate(shadowLeft,shadowTop);
+ ctx.globalAlpha = alpha;
+ ctx.fillStyle = '#000';
+
+ // center and rotate to starting position
+ ctx.translate(centerLeft,centerTop);
+ ctx.scale(1, options.series.pie.tilt);
+
+ //radius -= edge;
+ for (var i=1; i<=edge; i++)
+ {
+ ctx.beginPath();
+ ctx.arc(0,0,radius,0,Math.PI*2,false);
+ ctx.fill();
+ radius -= i;
+ }
+
+ ctx.restore();
+ }
+
+ function drawPie()
+ {
+ startAngle = Math.PI*options.series.pie.startAngle;
+
+ // set radius
+ if (options.series.pie.radius>1)
+ var radius = options.series.pie.radius;
+ else
+ var radius = maxRadius * options.series.pie.radius;
+
+ // center and rotate to starting position
+ ctx.save();
+ ctx.translate(centerLeft,centerTop);
+ ctx.scale(1, options.series.pie.tilt);
+ //ctx.rotate(startAngle); // start at top; -- This doesn't work properly in Opera
+
+ // draw slices
+ ctx.save();
+ var currentAngle = startAngle;
+ for (var i = 0; i < slices.length; ++i)
+ {
+ slices[i].startAngle = currentAngle;
+ drawSlice(slices[i].angle, slices[i].color, true);
+ }
+ ctx.restore();
+
+ // draw slice outlines
+ ctx.save();
+ ctx.lineWidth = options.series.pie.stroke.width;
+ currentAngle = startAngle;
+ for (var i = 0; i < slices.length; ++i)
+ drawSlice(slices[i].angle, options.series.pie.stroke.color, false);
+ ctx.restore();
+
+ // draw donut hole
+ drawDonutHole(ctx);
+
+ // draw labels
+ if (options.series.pie.label.show)
+ drawLabels();
+
+ // restore to original state
+ ctx.restore();
+
+ function drawSlice(angle, color, fill)
+ {
+ if (angle<=0)
+ return;
+
+ if (fill)
+ ctx.fillStyle = color;
+ else
+ {
+ ctx.strokeStyle = color;
+ ctx.lineJoin = 'round';
+ }
+
+ ctx.beginPath();
+ if (Math.abs(angle - Math.PI*2) > 0.000000001)
+ ctx.moveTo(0,0); // Center of the pie
+ else if ($.browser.msie)
+ angle -= 0.0001;
+ //ctx.arc(0,0,radius,0,angle,false); // This doesn't work properly in Opera
+ ctx.arc(0,0,radius,currentAngle,currentAngle+angle,false);
+ ctx.closePath();
+ //ctx.rotate(angle); // This doesn't work properly in Opera
+ currentAngle += angle;
+
+ if (fill)
+ ctx.fill();
+ else
+ ctx.stroke();
+ }
+
+ function drawLabels()
+ {
+ var currentAngle = startAngle;
+
+ // set radius
+ if (options.series.pie.label.radius>1)
+ var radius = options.series.pie.label.radius;
+ else
+ var radius = maxRadius * options.series.pie.label.radius;
+
+ for (var i = 0; i < slices.length; ++i)
+ {
+ if (slices[i].percent >= options.series.pie.label.threshold*100)
+ drawLabel(slices[i], currentAngle, i);
+ currentAngle += slices[i].angle;
+ }
+
+ function drawLabel(slice, startAngle, index)
+ {
+ if (slice.data[0][1]==0)
+ return;
+
+ // format label text
+ var lf = options.legend.labelFormatter, text, plf = options.series.pie.label.formatter;
+ if (lf)
+ text = lf(slice.label, slice);
+ else
+ text = slice.label;
+ if (plf)
+ text = plf(text, slice);
+
+ var halfAngle = ((startAngle+slice.angle) + startAngle)/2;
+ var x = centerLeft + Math.round(Math.cos(halfAngle) * radius);
+ var y = centerTop + Math.round(Math.sin(halfAngle) * radius) * options.series.pie.tilt;
+
+ var html = '<span class="pieLabel" id="pieLabel'+index+'" style="position:absolute;top:' + y + 'px;left:' + x + 'px;">' + text + "</span>";
+ target.append(html);
+ var label = target.children('#pieLabel'+index);
+ var labelTop = (y - label.height()/2);
+ var labelLeft = (x - label.width()/2);
+ label.css('top', labelTop);
+ label.css('left', labelLeft);
+
+ // check to make sure that the label is not outside the canvas
+ if (0-labelTop>0 || 0-labelLeft>0 || canvas.height-(labelTop+label.height())<0 || canvas.width-(labelLeft+label.width())<0)
+ redraw = true;
+
+ if (options.series.pie.label.background.opacity != 0) {
+ // put in the transparent background separately to avoid blended labels and label boxes
+ var c = options.series.pie.label.background.color;
+ if (c == null) {
+ c = slice.color;
+ }
+ var pos = 'top:'+labelTop+'px;left:'+labelLeft+'px;';
+ $('<div class="pieLabelBackground" style="position:absolute;width:' + label.width() + 'px;height:' + label.height() + 'px;' + pos +'background-color:' + c + ';"> </div>').insertBefore(label).css('opacity', options.series.pie.label.background.opacity);
+ }
+ } // end individual label function
+ } // end drawLabels function
+ } // end drawPie function
+ } // end draw function
+
+ // Placed here because it needs to be accessed from multiple locations
+ function drawDonutHole(layer)
+ {
+ // draw donut hole
+ if(options.series.pie.innerRadius > 0)
+ {
+ // subtract the center
+ layer.save();
+ innerRadius = options.series.pie.innerRadius > 1 ? options.series.pie.innerRadius : maxRadius * options.series.pie.innerRadius;
+ layer.globalCompositeOperation = 'destination-out'; // this does not work with excanvas, but it will fall back to using the stroke color
+ layer.beginPath();
+ layer.fillStyle = options.series.pie.stroke.color;
+ layer.arc(0,0,innerRadius,0,Math.PI*2,false);
+ layer.fill();
+ layer.closePath();
+ layer.restore();
+
+ // add inner stroke
+ layer.save();
+ layer.beginPath();
+ layer.strokeStyle = options.series.pie.stroke.color;
+ layer.arc(0,0,innerRadius,0,Math.PI*2,false);
+ layer.stroke();
+ layer.closePath();
+ layer.restore();
+ // TODO: add extra shadow inside hole (with a mask) if the pie is tilted.
+ }
+ }
+
+ //-- Additional Interactive related functions --
+
+ function isPointInPoly(poly, pt)
+ {
+ for(var c = false, i = -1, l = poly.length, j = l - 1; ++i < l; j = i)
+ ((poly[i][1] <= pt[1] && pt[1] < poly[j][1]) || (poly[j][1] <= pt[1] && pt[1]< poly[i][1]))
+ && (pt[0] < (poly[j][0] - poly[i][0]) * (pt[1] - poly[i][1]) / (poly[j][1] - poly[i][1]) + poly[i][0])
+ && (c = !c);
+ return c;
+ }
+
+ function findNearbySlice(mouseX, mouseY)
+ {
+ var slices = plot.getData(),
+ options = plot.getOptions(),
+ radius = options.series.pie.radius > 1 ? options.series.pie.radius : maxRadius * options.series.pie.radius;
+
+ for (var i = 0; i < slices.length; ++i)
+ {
+ var s = slices[i];
+
+ if(s.pie.show)
+ {
+ ctx.save();
+ ctx.beginPath();
+ ctx.moveTo(0,0); // Center of the pie
+ //ctx.scale(1, options.series.pie.tilt); // this actually seems to break everything when here.
+ ctx.arc(0,0,radius,s.startAngle,s.startAngle+s.angle,false);
+ ctx.closePath();
+ x = mouseX-centerLeft;
+ y = mouseY-centerTop;
+ if(ctx.isPointInPath)
+ {
+ if (ctx.isPointInPath(mouseX-centerLeft, mouseY-centerTop))
+ {
+ //alert('found slice!');
+ ctx.restore();
+ return {datapoint: [s.percent, s.data], dataIndex: 0, series: s, seriesIndex: i};
+ }
+ }
+ else
+ {
+ // excanvas for IE doesn;t support isPointInPath, this is a workaround.
+ p1X = (radius * Math.cos(s.startAngle));
+ p1Y = (radius * Math.sin(s.startAngle));
+ p2X = (radius * Math.cos(s.startAngle+(s.angle/4)));
+ p2Y = (radius * Math.sin(s.startAngle+(s.angle/4)));
+ p3X = (radius * Math.cos(s.startAngle+(s.angle/2)));
+ p3Y = (radius * Math.sin(s.startAngle+(s.angle/2)));
+ p4X = (radius * Math.cos(s.startAngle+(s.angle/1.5)));
+ p4Y = (radius * Math.sin(s.startAngle+(s.angle/1.5)));
+ p5X = (radius * Math.cos(s.startAngle+s.angle));
+ p5Y = (radius * Math.sin(s.startAngle+s.angle));
+ arrPoly = [[0,0],[p1X,p1Y],[p2X,p2Y],[p3X,p3Y],[p4X,p4Y],[p5X,p5Y]];
+ arrPoint = [x,y];
+ // TODO: perhaps do some mathmatical trickery here with the Y-coordinate to compensate for pie tilt?
+ if(isPointInPoly(arrPoly, arrPoint))
+ {
+ ctx.restore();
+ return {datapoint: [s.percent, s.data], dataIndex: 0, series: s, seriesIndex: i};
+ }
+ }
+ ctx.restore();
+ }
+ }
+
+ return null;
+ }
+
+ function onMouseMove(e)
+ {
+ triggerClickHoverEvent('plothover', e);
+ }
+
+ function onClick(e)
+ {
+ triggerClickHoverEvent('plotclick', e);
+ }
+
+ // trigger click or hover event (they send the same parameters so we share their code)
+ function triggerClickHoverEvent(eventname, e)
+ {
+ var offset = plot.offset(),
+ canvasX = parseInt(e.pageX - offset.left),
+ canvasY = parseInt(e.pageY - offset.top),
+ item = findNearbySlice(canvasX, canvasY);
+
+ if (options.grid.autoHighlight)
+ {
+ // clear auto-highlights
+ for (var i = 0; i < highlights.length; ++i)
+ {
+ var h = highlights[i];
+ if (h.auto == eventname && !(item && h.series == item.series))
+ unhighlight(h.series);
+ }
+ }
+
+ // highlight the slice
+ if (item)
+ highlight(item.series, eventname);
+
+ // trigger any hover bind events
+ var pos = { pageX: e.pageX, pageY: e.pageY };
+ target.trigger(eventname, [ pos, item ]);
+ }
+
+ function highlight(s, auto)
+ {
+ if (typeof s == "number")
+ s = series[s];
+
+ var i = indexOfHighlight(s);
+ if (i == -1)
+ {
+ highlights.push({ series: s, auto: auto });
+ plot.triggerRedrawOverlay();
+ }
+ else if (!auto)
+ highlights[i].auto = false;
+ }
+
+ function unhighlight(s)
+ {
+ if (s == null)
+ {
+ highlights = [];
+ plot.triggerRedrawOverlay();
+ }
+
+ if (typeof s == "number")
+ s = series[s];
+
+ var i = indexOfHighlight(s);
+ if (i != -1)
+ {
+ highlights.splice(i, 1);
+ plot.triggerRedrawOverlay();
+ }
+ }
+
+ function indexOfHighlight(s)
+ {
+ for (var i = 0; i < highlights.length; ++i)
+ {
+ var h = highlights[i];
+ if (h.series == s)
+ return i;
+ }
+ return -1;
+ }
+
+ function drawOverlay(plot, octx)
+ {
+ //alert(options.series.pie.radius);
+ var options = plot.getOptions();
+ //alert(options.series.pie.radius);
+
+ var radius = options.series.pie.radius > 1 ? options.series.pie.radius : maxRadius * options.series.pie.radius;
+
+ octx.save();
+ octx.translate(centerLeft, centerTop);
+ octx.scale(1, options.series.pie.tilt);
+
+ for (i = 0; i < highlights.length; ++i)
+ drawHighlight(highlights[i].series);
+
+ drawDonutHole(octx);
+
+ octx.restore();
+
+ function drawHighlight(series)
+ {
+ if (series.angle < 0) return;
+
+ //octx.fillStyle = parseColor(options.series.pie.highlight.color).scale(null, null, null, options.series.pie.highlight.opacity).toString();
+ octx.fillStyle = "rgba(255, 255, 255, "+options.series.pie.highlight.opacity+")"; // this is temporary until we have access to parseColor
+
+ octx.beginPath();
+ if (Math.abs(series.angle - Math.PI*2) > 0.000000001)
+ octx.moveTo(0,0); // Center of the pie
+ octx.arc(0,0,radius,series.startAngle,series.startAngle+series.angle,false);
+ octx.closePath();
+ octx.fill();
+ }
+
+ }
+
+ } // end init (plugin body)
+
+ // define pie specific options and their default values
+ var options = {
+ series: {
+ pie: {
+ show: false,
+ radius: 'auto', // actual radius of the visible pie (based on full calculated radius if <=1, or hard pixel value)
+ innerRadius:0, /* for donut */
+ startAngle: 3/2,
+ tilt: 1,
+ offset: {
+ top: 0,
+ left: 'auto'
+ },
+ stroke: {
+ color: '#FFF',
+ width: 1
+ },
+ label: {
+ show: 'auto',
+ formatter: function(label, slice){
+ return '<div style="font-size:x-small;text-align:center;padding:2px;color:'+slice.color+';">'+label+'<br/>'+Math.round(slice.percent)+'%</div>';
+ }, // formatter function
+ radius: 1, // radius at which to place the labels (based on full calculated radius if <=1, or hard pixel value)
+ background: {
+ color: null,
+ opacity: 0
+ },
+ threshold: 0 // percentage at which to hide the label (i.e. the slice is too narrow)
+ },
+ combine: {
+ threshold: -1, // percentage at which to combine little slices into one larger slice
+ color: null, // color to give the new slice (auto-generated if null)
+ label: 'Other' // label to give the new slice
+ },
+ highlight: {
+ //color: '#FFF', // will add this functionality once parseColor is available
+ opacity: 0.5
+ }
+ }
+ }
+ };
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: "pie",
+ version: "1.0"
+ });
+})(jQuery);
diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.pie.min.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.pie.min.js new file mode 100644 index 0000000..b7bf870 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.pie.min.js @@ -0,0 +1 @@ +(function(b){function c(D){var h=null;var L=null;var n=null;var B=null;var p=null;var M=0;var F=true;var o=10;var w=0.95;var A=0;var d=false;var z=false;var j=[];D.hooks.processOptions.push(g);D.hooks.bindEvents.push(e);function g(O,N){if(N.series.pie.show){N.grid.show=false;if(N.series.pie.label.show=="auto"){if(N.legend.show){N.series.pie.label.show=false}else{N.series.pie.label.show=true}}if(N.series.pie.radius=="auto"){if(N.series.pie.label.show){N.series.pie.radius=3/4}else{N.series.pie.radius=1}}if(N.series.pie.tilt>1){N.series.pie.tilt=1}if(N.series.pie.tilt<0){N.series.pie.tilt=0}O.hooks.processDatapoints.push(E);O.hooks.drawOverlay.push(H);O.hooks.draw.push(r)}}function e(P,N){var O=P.getOptions();if(O.series.pie.show&&O.grid.hoverable){N.unbind("mousemove").mousemove(t)}if(O.series.pie.show&&O.grid.clickable){N.unbind("click").click(l)}}function G(O){var P="";function N(S,T){if(!T){T=0}for(var R=0;R<S.length;++R){for(var Q=0;Q<T;Q++){P+="\t"}if(typeof S[R]=="object"){P+=""+R+":\n";N(S[R],T+1)}else{P+=""+R+": "+S[R]+"\n"}}}N(O);alert(P)}function q(P){for(var N=0;N<P.length;++N){var O=parseFloat(P[N].data[0][1]);if(O){M+=O}}}function E(Q,N,O,P){if(!d){d=true;h=Q.getCanvas();L=b(h).parent();a=Q.getOptions();Q.setData(K(Q.getData()))}}function I(){A=L.children().filter(".legend").children().width();n=Math.min(h.width,(h.height/a.series.pie.tilt))/2;p=(h.height/2)+a.series.pie.offset.top;B=(h.width/2);if(a.series.pie.offset.left=="auto"){if(a.legend.position.match("w")){B+=A/2}else{B-=A/2}}else{B+=a.series.pie.offset.left}if(B<n){B=n}else{if(B>h.width-n){B=h.width-n}}}function v(O){for(var N=0;N<O.length;++N){if(typeof(O[N].data)=="number"){O[N].data=[[1,O[N].data]]}else{if(typeof(O[N].data)=="undefined"||typeof(O[N].data[0])=="undefined"){if(typeof(O[N].data)!="undefined"&&typeof(O[N].data.label)!="undefined"){O[N].label=O[N].data.label}O[N].data=[[1,0]]}}}return O}function K(Q){Q=v(Q);q(Q);var P=0;var S=0;var N=a.series.pie.combine.color;var R=[];for(var O=0;O<Q.length;++O){Q[O].data[0][1]=parseFloat(Q[O].data[0][1]);if(!Q[O].data[0][1]){Q[O].data[0][1]=0}if(Q[O].data[0][1]/M<=a.series.pie.combine.threshold){P+=Q[O].data[0][1];S++;if(!N){N=Q[O].color}}else{R.push({data:[[1,Q[O].data[0][1]]],color:Q[O].color,label:Q[O].label,angle:(Q[O].data[0][1]*(Math.PI*2))/M,percent:(Q[O].data[0][1]/M*100)})}}if(S>0){R.push({data:[[1,P]],color:N,label:a.series.pie.combine.label,angle:(P*(Math.PI*2))/M,percent:(P/M*100)})}return R}function r(S,Q){if(!L){return}ctx=Q;I();var T=S.getData();var P=0;while(F&&P<o){F=false;if(P>0){n*=w}P+=1;N();if(a.series.pie.tilt<=0.8){O()}R()}if(P>=o){N();L.prepend('<div class="error">Could not draw pie with labels contained inside canvas</div>')}if(S.setSeries&&S.insertLegend){S.setSeries(T);S.insertLegend()}function N(){ctx.clearRect(0,0,h.width,h.height);L.children().filter(".pieLabel, .pieLabelBackground").remove()}function O(){var Z=5;var Y=15;var W=10;var X=0.02;if(a.series.pie.radius>1){var U=a.series.pie.radius}else{var U=n*a.series.pie.radius}if(U>=(h.width/2)-Z||U*a.series.pie.tilt>=(h.height/2)-Y||U<=W){return}ctx.save();ctx.translate(Z,Y);ctx.globalAlpha=X;ctx.fillStyle="#000";ctx.translate(B,p);ctx.scale(1,a.series.pie.tilt);for(var V=1;V<=W;V++){ctx.beginPath();ctx.arc(0,0,U,0,Math.PI*2,false);ctx.fill();U-=V}ctx.restore()}function R(){startAngle=Math.PI*a.series.pie.startAngle;if(a.series.pie.radius>1){var U=a.series.pie.radius}else{var U=n*a.series.pie.radius}ctx.save();ctx.translate(B,p);ctx.scale(1,a.series.pie.tilt);ctx.save();var Y=startAngle;for(var W=0;W<T.length;++W){T[W].startAngle=Y;X(T[W].angle,T[W].color,true)}ctx.restore();ctx.save();ctx.lineWidth=a.series.pie.stroke.width;Y=startAngle;for(var W=0;W<T.length;++W){X(T[W].angle,a.series.pie.stroke.color,false)}ctx.restore();J(ctx);if(a.series.pie.label.show){V()}ctx.restore();function X(ab,Z,aa){if(ab<=0){return}if(aa){ctx.fillStyle=Z}else{ctx.strokeStyle=Z;ctx.lineJoin="round"}ctx.beginPath();if(Math.abs(ab-Math.PI*2)>1e-9){ctx.moveTo(0,0)}else{if(b.browser.msie){ab-=0.0001}}ctx.arc(0,0,U,Y,Y+ab,false);ctx.closePath();Y+=ab;if(aa){ctx.fill()}else{ctx.stroke()}}function V(){var ac=startAngle;if(a.series.pie.label.radius>1){var Z=a.series.pie.label.radius}else{var Z=n*a.series.pie.label.radius}for(var ab=0;ab<T.length;++ab){if(T[ab].percent>=a.series.pie.label.threshold*100){aa(T[ab],ac,ab)}ac+=T[ab].angle}function aa(ap,ai,ag){if(ap.data[0][1]==0){return}var ar=a.legend.labelFormatter,aq,ae=a.series.pie.label.formatter;if(ar){aq=ar(ap.label,ap)}else{aq=ap.label}if(ae){aq=ae(aq,ap)}var aj=((ai+ap.angle)+ai)/2;var ao=B+Math.round(Math.cos(aj)*Z);var am=p+Math.round(Math.sin(aj)*Z)*a.series.pie.tilt;var af='<span class="pieLabel" id="pieLabel'+ag+'" style="position:absolute;top:'+am+"px;left:"+ao+'px;">'+aq+"</span>";L.append(af);var an=L.children("#pieLabel"+ag);var ad=(am-an.height()/2);var ah=(ao-an.width()/2);an.css("top",ad);an.css("left",ah);if(0-ad>0||0-ah>0||h.height-(ad+an.height())<0||h.width-(ah+an.width())<0){F=true}if(a.series.pie.label.background.opacity!=0){var ak=a.series.pie.label.background.color;if(ak==null){ak=ap.color}var al="top:"+ad+"px;left:"+ah+"px;";b('<div class="pieLabelBackground" style="position:absolute;width:'+an.width()+"px;height:"+an.height()+"px;"+al+"background-color:"+ak+';"> </div>').insertBefore(an).css("opacity",a.series.pie.label.background.opacity)}}}}}function J(N){if(a.series.pie.innerRadius>0){N.save();innerRadius=a.series.pie.innerRadius>1?a.series.pie.innerRadius:n*a.series.pie.innerRadius;N.globalCompositeOperation="destination-out";N.beginPath();N.fillStyle=a.series.pie.stroke.color;N.arc(0,0,innerRadius,0,Math.PI*2,false);N.fill();N.closePath();N.restore();N.save();N.beginPath();N.strokeStyle=a.series.pie.stroke.color;N.arc(0,0,innerRadius,0,Math.PI*2,false);N.stroke();N.closePath();N.restore()}}function s(Q,R){for(var S=false,P=-1,N=Q.length,O=N-1;++P<N;O=P){((Q[P][1]<=R[1]&&R[1]<Q[O][1])||(Q[O][1]<=R[1]&&R[1]<Q[P][1]))&&(R[0]<(Q[O][0]-Q[P][0])*(R[1]-Q[P][1])/(Q[O][1]-Q[P][1])+Q[P][0])&&(S=!S)}return S}function u(R,P){var T=D.getData(),O=D.getOptions(),N=O.series.pie.radius>1?O.series.pie.radius:n*O.series.pie.radius;for(var Q=0;Q<T.length;++Q){var S=T[Q];if(S.pie.show){ctx.save();ctx.beginPath();ctx.moveTo(0,0);ctx.arc(0,0,N,S.startAngle,S.startAngle+S.angle,false);ctx.closePath();x=R-B;y=P-p;if(ctx.isPointInPath){if(ctx.isPointInPath(R-B,P-p)){ctx.restore();return{datapoint:[S.percent,S.data],dataIndex:0,series:S,seriesIndex:Q}}}else{p1X=(N*Math.cos(S.startAngle));p1Y=(N*Math.sin(S.startAngle));p2X=(N*Math.cos(S.startAngle+(S.angle/4)));p2Y=(N*Math.sin(S.startAngle+(S.angle/4)));p3X=(N*Math.cos(S.startAngle+(S.angle/2)));p3Y=(N*Math.sin(S.startAngle+(S.angle/2)));p4X=(N*Math.cos(S.startAngle+(S.angle/1.5)));p4Y=(N*Math.sin(S.startAngle+(S.angle/1.5)));p5X=(N*Math.cos(S.startAngle+S.angle));p5Y=(N*Math.sin(S.startAngle+S.angle));arrPoly=[[0,0],[p1X,p1Y],[p2X,p2Y],[p3X,p3Y],[p4X,p4Y],[p5X,p5Y]];arrPoint=[x,y];if(s(arrPoly,arrPoint)){ctx.restore();return{datapoint:[S.percent,S.data],dataIndex:0,series:S,seriesIndex:Q}}}ctx.restore()}}return null}function t(N){m("plothover",N)}function l(N){m("plotclick",N)}function m(N,T){var O=D.offset(),R=parseInt(T.pageX-O.left),P=parseInt(T.pageY-O.top),V=u(R,P);if(a.grid.autoHighlight){for(var Q=0;Q<j.length;++Q){var S=j[Q];if(S.auto==N&&!(V&&S.series==V.series)){f(S.series)}}}if(V){k(V.series,N)}var U={pageX:T.pageX,pageY:T.pageY};L.trigger(N,[U,V])}function k(O,P){if(typeof O=="number"){O=series[O]}var N=C(O);if(N==-1){j.push({series:O,auto:P});D.triggerRedrawOverlay()}else{if(!P){j[N].auto=false}}}function f(O){if(O==null){j=[];D.triggerRedrawOverlay()}if(typeof O=="number"){O=series[O]}var N=C(O);if(N!=-1){j.splice(N,1);D.triggerRedrawOverlay()}}function C(P){for(var N=0;N<j.length;++N){var O=j[N];if(O.series==P){return N}}return -1}function H(Q,R){var P=Q.getOptions();var N=P.series.pie.radius>1?P.series.pie.radius:n*P.series.pie.radius;R.save();R.translate(B,p);R.scale(1,P.series.pie.tilt);for(i=0;i<j.length;++i){O(j[i].series)}J(R);R.restore();function O(S){if(S.angle<0){return}R.fillStyle="rgba(255, 255, 255, "+P.series.pie.highlight.opacity+")";R.beginPath();if(Math.abs(S.angle-Math.PI*2)>1e-9){R.moveTo(0,0)}R.arc(0,0,N,S.startAngle,S.startAngle+S.angle,false);R.closePath();R.fill()}}}var a={series:{pie:{show:false,radius:"auto",innerRadius:0,startAngle:3/2,tilt:1,offset:{top:0,left:"auto"},stroke:{color:"#FFF",width:1},label:{show:"auto",formatter:function(d,e){return'<div style="font-size:x-small;text-align:center;padding:2px;color:'+e.color+';">'+d+"<br/>"+Math.round(e.percent)+"%</div>"},radius:1,background:{color:null,opacity:0},threshold:0},combine:{threshold:-1,color:null,label:"Other"},highlight:{opacity:0.5}}}};b.plot.plugins.push({init:c,options:a,name:"pie",version:"1.0"})})(jQuery);
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.resize.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.resize.js new file mode 100644 index 0000000..69dfb24 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.resize.js @@ -0,0 +1,60 @@ +/* +Flot plugin for automatically redrawing plots when the placeholder +size changes, e.g. on window resizes. + +It works by listening for changes on the placeholder div (through the +jQuery resize event plugin) - if the size changes, it will redraw the +plot. + +There are no options. If you need to disable the plugin for some +plots, you can just fix the size of their placeholders. +*/ + + +/* Inline dependency: + * jQuery resize event - v1.1 - 3/14/2010 + * http://benalman.com/projects/jquery-resize-plugin/ + * + * Copyright (c) 2010 "Cowboy" Ben Alman + * Dual licensed under the MIT and GPL licenses. + * http://benalman.com/about/license/ + */ +(function($,h,c){var a=$([]),e=$.resize=$.extend($.resize,{}),i,k="setTimeout",j="resize",d=j+"-special-event",b="delay",f="throttleWindow";e[b]=250;e[f]=true;$.event.special[j]={setup:function(){if(!e[f]&&this[k]){return false}var l=$(this);a=a.add(l);$.data(this,d,{w:l.width(),h:l.height()});if(a.length===1){g()}},teardown:function(){if(!e[f]&&this[k]){return false}var l=$(this);a=a.not(l);l.removeData(d);if(!a.length){clearTimeout(i)}},add:function(l){if(!e[f]&&this[k]){return false}var n;function m(s,o,p){var q=$(this),r=$.data(this,d);r.w=o!==c?o:q.width();r.h=p!==c?p:q.height();n.apply(this,arguments)}if($.isFunction(l)){n=l;return m}else{n=l.handler;l.handler=m}}};function g(){i=h[k](function(){a.each(function(){var n=$(this),m=n.width(),l=n.height(),o=$.data(this,d);if(m!==o.w||l!==o.h){n.trigger(j,[o.w=m,o.h=l])}});g()},e[b])}})(jQuery,this); + + +(function ($) { + var options = { }; // no options + + function init(plot) { + function onResize() { + var placeholder = plot.getPlaceholder(); + + // somebody might have hidden us and we can't plot + // when we don't have the dimensions + if (placeholder.width() == 0 || placeholder.height() == 0) + return; + + plot.resize(); + plot.setupGrid(); + plot.draw(); + } + + function bindEvents(plot, eventHolder) { + plot.getPlaceholder().resize(onResize); + } + + function shutdown(plot, eventHolder) { + plot.getPlaceholder().unbind("resize", onResize); + } + + plot.hooks.bindEvents.push(bindEvents); + plot.hooks.shutdown.push(shutdown); + } + + $.plot.plugins.push({ + init: init, + options: options, + name: 'resize', + version: '1.0' + }); +})(jQuery); diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.resize.min.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.resize.min.js new file mode 100644 index 0000000..1fa0771 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.resize.min.js @@ -0,0 +1 @@ +(function(n,p,u){var w=n([]),s=n.resize=n.extend(n.resize,{}),o,l="setTimeout",m="resize",t=m+"-special-event",v="delay",r="throttleWindow";s[v]=250;s[r]=true;n.event.special[m]={setup:function(){if(!s[r]&&this[l]){return false}var a=n(this);w=w.add(a);n.data(this,t,{w:a.width(),h:a.height()});if(w.length===1){q()}},teardown:function(){if(!s[r]&&this[l]){return false}var a=n(this);w=w.not(a);a.removeData(t);if(!w.length){clearTimeout(o)}},add:function(b){if(!s[r]&&this[l]){return false}var c;function a(d,h,g){var f=n(this),e=n.data(this,t);e.w=h!==u?h:f.width();e.h=g!==u?g:f.height();c.apply(this,arguments)}if(n.isFunction(b)){c=b;return a}else{c=b.handler;b.handler=a}}};function q(){o=p[l](function(){w.each(function(){var d=n(this),a=d.width(),b=d.height(),c=n.data(this,t);if(a!==c.w||b!==c.h){d.trigger(m,[c.w=a,c.h=b])}});q()},s[v])}})(jQuery,this);(function(b){var a={};function c(f){function e(){var h=f.getPlaceholder();if(h.width()==0||h.height()==0){return}f.resize();f.setupGrid();f.draw()}function g(i,h){i.getPlaceholder().resize(e)}function d(i,h){i.getPlaceholder().unbind("resize",e)}f.hooks.bindEvents.push(g);f.hooks.shutdown.push(d)}b.plot.plugins.push({init:c,options:a,name:"resize",version:"1.0"})})(jQuery);
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.selection.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.selection.js new file mode 100644 index 0000000..7f7b326 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.selection.js @@ -0,0 +1,344 @@ +/* +Flot plugin for selecting regions. + +The plugin defines the following options: + + selection: { + mode: null or "x" or "y" or "xy", + color: color + } + +Selection support is enabled by setting the mode to one of "x", "y" or +"xy". In "x" mode, the user will only be able to specify the x range, +similarly for "y" mode. For "xy", the selection becomes a rectangle +where both ranges can be specified. "color" is color of the selection +(if you need to change the color later on, you can get to it with +plot.getOptions().selection.color). + +When selection support is enabled, a "plotselected" event will be +emitted on the DOM element you passed into the plot function. The +event handler gets a parameter with the ranges selected on the axes, +like this: + + placeholder.bind("plotselected", function(event, ranges) { + alert("You selected " + ranges.xaxis.from + " to " + ranges.xaxis.to) + // similar for yaxis - with multiple axes, the extra ones are in + // x2axis, x3axis, ... + }); + +The "plotselected" event is only fired when the user has finished +making the selection. A "plotselecting" event is fired during the +process with the same parameters as the "plotselected" event, in case +you want to know what's happening while it's happening, + +A "plotunselected" event with no arguments is emitted when the user +clicks the mouse to remove the selection. + +The plugin allso adds the following methods to the plot object: + +- setSelection(ranges, preventEvent) + + Set the selection rectangle. The passed in ranges is on the same + form as returned in the "plotselected" event. If the selection mode + is "x", you should put in either an xaxis range, if the mode is "y" + you need to put in an yaxis range and both xaxis and yaxis if the + selection mode is "xy", like this: + + setSelection({ xaxis: { from: 0, to: 10 }, yaxis: { from: 40, to: 60 } }); + + setSelection will trigger the "plotselected" event when called. If + you don't want that to happen, e.g. if you're inside a + "plotselected" handler, pass true as the second parameter. If you + are using multiple axes, you can specify the ranges on any of those, + e.g. as x2axis/x3axis/... instead of xaxis, the plugin picks the + first one it sees. + +- clearSelection(preventEvent) + + Clear the selection rectangle. Pass in true to avoid getting a + "plotunselected" event. + +- getSelection() + + Returns the current selection in the same format as the + "plotselected" event. If there's currently no selection, the + function returns null. + +*/ + +(function ($) { + function init(plot) { + var selection = { + first: { x: -1, y: -1}, second: { x: -1, y: -1}, + show: false, + active: false + }; + + // FIXME: The drag handling implemented here should be + // abstracted out, there's some similar code from a library in + // the navigation plugin, this should be massaged a bit to fit + // the Flot cases here better and reused. Doing this would + // make this plugin much slimmer. + var savedhandlers = {}; + + var mouseUpHandler = null; + + function onMouseMove(e) { + if (selection.active) { + updateSelection(e); + + plot.getPlaceholder().trigger("plotselecting", [ getSelection() ]); + } + } + + function onMouseDown(e) { + if (e.which != 1) // only accept left-click + return; + + // cancel out any text selections + document.body.focus(); + + // prevent text selection and drag in old-school browsers + if (document.onselectstart !== undefined && savedhandlers.onselectstart == null) { + savedhandlers.onselectstart = document.onselectstart; + document.onselectstart = function () { return false; }; + } + if (document.ondrag !== undefined && savedhandlers.ondrag == null) { + savedhandlers.ondrag = document.ondrag; + document.ondrag = function () { return false; }; + } + + setSelectionPos(selection.first, e); + + selection.active = true; + + // this is a bit silly, but we have to use a closure to be + // able to whack the same handler again + mouseUpHandler = function (e) { onMouseUp(e); }; + + $(document).one("mouseup", mouseUpHandler); + } + + function onMouseUp(e) { + mouseUpHandler = null; + + // revert drag stuff for old-school browsers + if (document.onselectstart !== undefined) + document.onselectstart = savedhandlers.onselectstart; + if (document.ondrag !== undefined) + document.ondrag = savedhandlers.ondrag; + + // no more dragging + selection.active = false; + updateSelection(e); + + if (selectionIsSane()) + triggerSelectedEvent(); + else { + // this counts as a clear + plot.getPlaceholder().trigger("plotunselected", [ ]); + plot.getPlaceholder().trigger("plotselecting", [ null ]); + } + + return false; + } + + function getSelection() { + if (!selectionIsSane()) + return null; + + var r = {}, c1 = selection.first, c2 = selection.second; + $.each(plot.getAxes(), function (name, axis) { + if (axis.used) { + var p1 = axis.c2p(c1[axis.direction]), p2 = axis.c2p(c2[axis.direction]); + r[name] = { from: Math.min(p1, p2), to: Math.max(p1, p2) }; + } + }); + return r; + } + + function triggerSelectedEvent() { + var r = getSelection(); + + plot.getPlaceholder().trigger("plotselected", [ r ]); + + // backwards-compat stuff, to be removed in future + if (r.xaxis && r.yaxis) + plot.getPlaceholder().trigger("selected", [ { x1: r.xaxis.from, y1: r.yaxis.from, x2: r.xaxis.to, y2: r.yaxis.to } ]); + } + + function clamp(min, value, max) { + return value < min ? min: (value > max ? max: value); + } + + function setSelectionPos(pos, e) { + var o = plot.getOptions(); + var offset = plot.getPlaceholder().offset(); + var plotOffset = plot.getPlotOffset(); + pos.x = clamp(0, e.pageX - offset.left - plotOffset.left, plot.width()); + pos.y = clamp(0, e.pageY - offset.top - plotOffset.top, plot.height()); + + if (o.selection.mode == "y") + pos.x = pos == selection.first ? 0 : plot.width(); + + if (o.selection.mode == "x") + pos.y = pos == selection.first ? 0 : plot.height(); + } + + function updateSelection(pos) { + if (pos.pageX == null) + return; + + setSelectionPos(selection.second, pos); + if (selectionIsSane()) { + selection.show = true; + plot.triggerRedrawOverlay(); + } + else + clearSelection(true); + } + + function clearSelection(preventEvent) { + if (selection.show) { + selection.show = false; + plot.triggerRedrawOverlay(); + if (!preventEvent) + plot.getPlaceholder().trigger("plotunselected", [ ]); + } + } + + // function taken from markings support in Flot + function extractRange(ranges, coord) { + var axis, from, to, key, axes = plot.getAxes(); + + for (var k in axes) { + axis = axes[k]; + if (axis.direction == coord) { + key = coord + axis.n + "axis"; + if (!ranges[key] && axis.n == 1) + key = coord + "axis"; // support x1axis as xaxis + if (ranges[key]) { + from = ranges[key].from; + to = ranges[key].to; + break; + } + } + } + + // backwards-compat stuff - to be removed in future + if (!ranges[key]) { + axis = coord == "x" ? plot.getXAxes()[0] : plot.getYAxes()[0]; + from = ranges[coord + "1"]; + to = ranges[coord + "2"]; + } + + // auto-reverse as an added bonus + if (from != null && to != null && from > to) { + var tmp = from; + from = to; + to = tmp; + } + + return { from: from, to: to, axis: axis }; + } + + function setSelection(ranges, preventEvent) { + var axis, range, o = plot.getOptions(); + + if (o.selection.mode == "y") { + selection.first.x = 0; + selection.second.x = plot.width(); + } + else { + range = extractRange(ranges, "x"); + + selection.first.x = range.axis.p2c(range.from); + selection.second.x = range.axis.p2c(range.to); + } + + if (o.selection.mode == "x") { + selection.first.y = 0; + selection.second.y = plot.height(); + } + else { + range = extractRange(ranges, "y"); + + selection.first.y = range.axis.p2c(range.from); + selection.second.y = range.axis.p2c(range.to); + } + + selection.show = true; + plot.triggerRedrawOverlay(); + if (!preventEvent && selectionIsSane()) + triggerSelectedEvent(); + } + + function selectionIsSane() { + var minSize = 5; + return Math.abs(selection.second.x - selection.first.x) >= minSize && + Math.abs(selection.second.y - selection.first.y) >= minSize; + } + + plot.clearSelection = clearSelection; + plot.setSelection = setSelection; + plot.getSelection = getSelection; + + plot.hooks.bindEvents.push(function(plot, eventHolder) { + var o = plot.getOptions(); + if (o.selection.mode != null) { + eventHolder.mousemove(onMouseMove); + eventHolder.mousedown(onMouseDown); + } + }); + + + plot.hooks.drawOverlay.push(function (plot, ctx) { + // draw selection + if (selection.show && selectionIsSane()) { + var plotOffset = plot.getPlotOffset(); + var o = plot.getOptions(); + + ctx.save(); + ctx.translate(plotOffset.left, plotOffset.top); + + var c = $.color.parse(o.selection.color); + + ctx.strokeStyle = c.scale('a', 0.8).toString(); + ctx.lineWidth = 1; + ctx.lineJoin = "round"; + ctx.fillStyle = c.scale('a', 0.4).toString(); + + var x = Math.min(selection.first.x, selection.second.x), + y = Math.min(selection.first.y, selection.second.y), + w = Math.abs(selection.second.x - selection.first.x), + h = Math.abs(selection.second.y - selection.first.y); + + ctx.fillRect(x, y, w, h); + ctx.strokeRect(x, y, w, h); + + ctx.restore(); + } + }); + + plot.hooks.shutdown.push(function (plot, eventHolder) { + eventHolder.unbind("mousemove", onMouseMove); + eventHolder.unbind("mousedown", onMouseDown); + + if (mouseUpHandler) + $(document).unbind("mouseup", mouseUpHandler); + }); + + } + + $.plot.plugins.push({ + init: init, + options: { + selection: { + mode: null, // one of null, "x", "y" or "xy" + color: "#e8cfac" + } + }, + name: 'selection', + version: '1.1' + }); +})(jQuery); diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.selection.min.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.selection.min.js new file mode 100644 index 0000000..badc005 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.selection.min.js @@ -0,0 +1 @@ +(function(a){function b(k){var p={first:{x:-1,y:-1},second:{x:-1,y:-1},show:false,active:false};var m={};var r=null;function e(s){if(p.active){l(s);k.getPlaceholder().trigger("plotselecting",[g()])}}function n(s){if(s.which!=1){return}document.body.focus();if(document.onselectstart!==undefined&&m.onselectstart==null){m.onselectstart=document.onselectstart;document.onselectstart=function(){return false}}if(document.ondrag!==undefined&&m.ondrag==null){m.ondrag=document.ondrag;document.ondrag=function(){return false}}d(p.first,s);p.active=true;r=function(t){j(t)};a(document).one("mouseup",r)}function j(s){r=null;if(document.onselectstart!==undefined){document.onselectstart=m.onselectstart}if(document.ondrag!==undefined){document.ondrag=m.ondrag}p.active=false;l(s);if(f()){i()}else{k.getPlaceholder().trigger("plotunselected",[]);k.getPlaceholder().trigger("plotselecting",[null])}return false}function g(){if(!f()){return null}var u={},t=p.first,s=p.second;a.each(k.getAxes(),function(v,w){if(w.used){var y=w.c2p(t[w.direction]),x=w.c2p(s[w.direction]);u[v]={from:Math.min(y,x),to:Math.max(y,x)}}});return u}function i(){var s=g();k.getPlaceholder().trigger("plotselected",[s]);if(s.xaxis&&s.yaxis){k.getPlaceholder().trigger("selected",[{x1:s.xaxis.from,y1:s.yaxis.from,x2:s.xaxis.to,y2:s.yaxis.to}])}}function h(t,u,s){return u<t?t:(u>s?s:u)}function d(w,t){var v=k.getOptions();var u=k.getPlaceholder().offset();var s=k.getPlotOffset();w.x=h(0,t.pageX-u.left-s.left,k.width());w.y=h(0,t.pageY-u.top-s.top,k.height());if(v.selection.mode=="y"){w.x=w==p.first?0:k.width()}if(v.selection.mode=="x"){w.y=w==p.first?0:k.height()}}function l(s){if(s.pageX==null){return}d(p.second,s);if(f()){p.show=true;k.triggerRedrawOverlay()}else{q(true)}}function q(s){if(p.show){p.show=false;k.triggerRedrawOverlay();if(!s){k.getPlaceholder().trigger("plotunselected",[])}}}function c(s,w){var t,y,z,A,x=k.getAxes();for(var u in x){t=x[u];if(t.direction==w){A=w+t.n+"axis";if(!s[A]&&t.n==1){A=w+"axis"}if(s[A]){y=s[A].from;z=s[A].to;break}}}if(!s[A]){t=w=="x"?k.getXAxes()[0]:k.getYAxes()[0];y=s[w+"1"];z=s[w+"2"]}if(y!=null&&z!=null&&y>z){var v=y;y=z;z=v}return{from:y,to:z,axis:t}}function o(t,s){var v,u,w=k.getOptions();if(w.selection.mode=="y"){p.first.x=0;p.second.x=k.width()}else{u=c(t,"x");p.first.x=u.axis.p2c(u.from);p.second.x=u.axis.p2c(u.to)}if(w.selection.mode=="x"){p.first.y=0;p.second.y=k.height()}else{u=c(t,"y");p.first.y=u.axis.p2c(u.from);p.second.y=u.axis.p2c(u.to)}p.show=true;k.triggerRedrawOverlay();if(!s&&f()){i()}}function f(){var s=5;return Math.abs(p.second.x-p.first.x)>=s&&Math.abs(p.second.y-p.first.y)>=s}k.clearSelection=q;k.setSelection=o;k.getSelection=g;k.hooks.bindEvents.push(function(t,s){var u=t.getOptions();if(u.selection.mode!=null){s.mousemove(e);s.mousedown(n)}});k.hooks.drawOverlay.push(function(v,D){if(p.show&&f()){var t=v.getPlotOffset();var s=v.getOptions();D.save();D.translate(t.left,t.top);var z=a.color.parse(s.selection.color);D.strokeStyle=z.scale("a",0.8).toString();D.lineWidth=1;D.lineJoin="round";D.fillStyle=z.scale("a",0.4).toString();var B=Math.min(p.first.x,p.second.x),A=Math.min(p.first.y,p.second.y),C=Math.abs(p.second.x-p.first.x),u=Math.abs(p.second.y-p.first.y);D.fillRect(B,A,C,u);D.strokeRect(B,A,C,u);D.restore()}});k.hooks.shutdown.push(function(t,s){s.unbind("mousemove",e);s.unbind("mousedown",n);if(r){a(document).unbind("mouseup",r)}})}a.plot.plugins.push({init:b,options:{selection:{mode:null,color:"#e8cfac"}},name:"selection",version:"1.1"})})(jQuery);
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.stack.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.stack.js new file mode 100644 index 0000000..a31d5dc --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.stack.js @@ -0,0 +1,184 @@ +/* +Flot plugin for stacking data sets, i.e. putting them on top of each +other, for accumulative graphs. + +The plugin assumes the data is sorted on x (or y if stacking +horizontally). For line charts, it is assumed that if a line has an +undefined gap (from a null point), then the line above it should have +the same gap - insert zeros instead of "null" if you want another +behaviour. This also holds for the start and end of the chart. Note +that stacking a mix of positive and negative values in most instances +doesn't make sense (so it looks weird). + +Two or more series are stacked when their "stack" attribute is set to +the same key (which can be any number or string or just "true"). To +specify the default stack, you can set + + series: { + stack: null or true or key (number/string) + } + +or specify it for a specific series + + $.plot($("#placeholder"), [{ data: [ ... ], stack: true }]) + +The stacking order is determined by the order of the data series in +the array (later series end up on top of the previous). + +Internally, the plugin modifies the datapoints in each series, adding +an offset to the y value. For line series, extra data points are +inserted through interpolation. If there's a second y value, it's also +adjusted (e.g for bar charts or filled areas). +*/ + +(function ($) { + var options = { + series: { stack: null } // or number/string + }; + + function init(plot) { + function findMatchingSeries(s, allseries) { + var res = null + for (var i = 0; i < allseries.length; ++i) { + if (s == allseries[i]) + break; + + if (allseries[i].stack == s.stack) + res = allseries[i]; + } + + return res; + } + + function stackData(plot, s, datapoints) { + if (s.stack == null) + return; + + var other = findMatchingSeries(s, plot.getData()); + if (!other) + return; + + var ps = datapoints.pointsize, + points = datapoints.points, + otherps = other.datapoints.pointsize, + otherpoints = other.datapoints.points, + newpoints = [], + px, py, intery, qx, qy, bottom, + withlines = s.lines.show, + horizontal = s.bars.horizontal, + withbottom = ps > 2 && (horizontal ? datapoints.format[2].x : datapoints.format[2].y), + withsteps = withlines && s.lines.steps, + fromgap = true, + keyOffset = horizontal ? 1 : 0, + accumulateOffset = horizontal ? 0 : 1, + i = 0, j = 0, l; + + while (true) { + if (i >= points.length) + break; + + l = newpoints.length; + + if (points[i] == null) { + // copy gaps + for (m = 0; m < ps; ++m) + newpoints.push(points[i + m]); + i += ps; + } + else if (j >= otherpoints.length) { + // for lines, we can't use the rest of the points + if (!withlines) { + for (m = 0; m < ps; ++m) + newpoints.push(points[i + m]); + } + i += ps; + } + else if (otherpoints[j] == null) { + // oops, got a gap + for (m = 0; m < ps; ++m) + newpoints.push(null); + fromgap = true; + j += otherps; + } + else { + // cases where we actually got two points + px = points[i + keyOffset]; + py = points[i + accumulateOffset]; + qx = otherpoints[j + keyOffset]; + qy = otherpoints[j + accumulateOffset]; + bottom = 0; + + if (px == qx) { + for (m = 0; m < ps; ++m) + newpoints.push(points[i + m]); + + newpoints[l + accumulateOffset] += qy; + bottom = qy; + + i += ps; + j += otherps; + } + else if (px > qx) { + // we got past point below, might need to + // insert interpolated extra point + if (withlines && i > 0 && points[i - ps] != null) { + intery = py + (points[i - ps + accumulateOffset] - py) * (qx - px) / (points[i - ps + keyOffset] - px); + newpoints.push(qx); + newpoints.push(intery + qy); + for (m = 2; m < ps; ++m) + newpoints.push(points[i + m]); + bottom = qy; + } + + j += otherps; + } + else { // px < qx + if (fromgap && withlines) { + // if we come from a gap, we just skip this point + i += ps; + continue; + } + + for (m = 0; m < ps; ++m) + newpoints.push(points[i + m]); + + // we might be able to interpolate a point below, + // this can give us a better y + if (withlines && j > 0 && otherpoints[j - otherps] != null) + bottom = qy + (otherpoints[j - otherps + accumulateOffset] - qy) * (px - qx) / (otherpoints[j - otherps + keyOffset] - qx); + + newpoints[l + accumulateOffset] += bottom; + + i += ps; + } + + fromgap = false; + + if (l != newpoints.length && withbottom) + newpoints[l + 2] += bottom; + } + + // maintain the line steps invariant + if (withsteps && l != newpoints.length && l > 0 + && newpoints[l] != null + && newpoints[l] != newpoints[l - ps] + && newpoints[l + 1] != newpoints[l - ps + 1]) { + for (m = 0; m < ps; ++m) + newpoints[l + ps + m] = newpoints[l + m]; + newpoints[l + 1] = newpoints[l - ps + 1]; + } + } + + datapoints.points = newpoints; + } + + plot.hooks.processDatapoints.push(stackData); + } + + $.plot.plugins.push({ + init: init, + options: options, + name: 'stack', + version: '1.2' + }); +})(jQuery); diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.stack.min.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.stack.min.js new file mode 100644 index 0000000..bba2a0e --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.stack.min.js @@ -0,0 +1 @@ +(function(b){var a={series:{stack:null}};function c(f){function d(k,j){var h=null;for(var g=0;g<j.length;++g){if(k==j[g]){break}if(j[g].stack==k.stack){h=j[g]}}return h}function e(C,v,g){if(v.stack==null){return}var p=d(v,C.getData());if(!p){return}var z=g.pointsize,F=g.points,h=p.datapoints.pointsize,y=p.datapoints.points,t=[],x,w,k,J,I,r,u=v.lines.show,G=v.bars.horizontal,o=z>2&&(G?g.format[2].x:g.format[2].y),n=u&&v.lines.steps,E=true,q=G?1:0,H=G?0:1,D=0,B=0,A;while(true){if(D>=F.length){break}A=t.length;if(F[D]==null){for(m=0;m<z;++m){t.push(F[D+m])}D+=z}else{if(B>=y.length){if(!u){for(m=0;m<z;++m){t.push(F[D+m])}}D+=z}else{if(y[B]==null){for(m=0;m<z;++m){t.push(null)}E=true;B+=h}else{x=F[D+q];w=F[D+H];J=y[B+q];I=y[B+H];r=0;if(x==J){for(m=0;m<z;++m){t.push(F[D+m])}t[A+H]+=I;r=I;D+=z;B+=h}else{if(x>J){if(u&&D>0&&F[D-z]!=null){k=w+(F[D-z+H]-w)*(J-x)/(F[D-z+q]-x);t.push(J);t.push(k+I);for(m=2;m<z;++m){t.push(F[D+m])}r=I}B+=h}else{if(E&&u){D+=z;continue}for(m=0;m<z;++m){t.push(F[D+m])}if(u&&B>0&&y[B-h]!=null){r=I+(y[B-h+H]-I)*(x-J)/(y[B-h+q]-J)}t[A+H]+=r;D+=z}}E=false;if(A!=t.length&&o){t[A+2]+=r}}}}if(n&&A!=t.length&&A>0&&t[A]!=null&&t[A]!=t[A-z]&&t[A+1]!=t[A-z+1]){for(m=0;m<z;++m){t[A+z+m]=t[A+m]}t[A+1]=t[A-z+1]}}g.points=t}f.hooks.processDatapoints.push(e)}b.plot.plugins.push({init:c,options:a,name:"stack",version:"1.2"})})(jQuery);
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.symbol.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.symbol.js new file mode 100644 index 0000000..a32fe31 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.symbol.js @@ -0,0 +1,70 @@ +/* +Flot plugin that adds some extra symbols for plotting points. + +The symbols are accessed as strings through the standard symbol +choice: + + series: { + points: { + symbol: "square" // or "diamond", "triangle", "cross" + } + } + +*/ + +(function ($) { + function processRawData(plot, series, datapoints) { + // we normalize the area of each symbol so it is approximately the + // same as a circle of the given radius + + var handlers = { + square: function (ctx, x, y, radius, shadow) { + // pi * r^2 = (2s)^2 => s = r * sqrt(pi)/2 + var size = radius * Math.sqrt(Math.PI) / 2; + ctx.rect(x - size, y - size, size + size, size + size); + }, + diamond: function (ctx, x, y, radius, shadow) { + // pi * r^2 = 2s^2 => s = r * sqrt(pi/2) + var size = radius * Math.sqrt(Math.PI / 2); + ctx.moveTo(x - size, y); + ctx.lineTo(x, y - size); + ctx.lineTo(x + size, y); + ctx.lineTo(x, y + size); + ctx.lineTo(x - size, y); + }, + triangle: function (ctx, x, y, radius, shadow) { + // pi * r^2 = 1/2 * s^2 * sin (pi / 3) => s = r * sqrt(2 * pi / sin(pi / 3)) + var size = radius * Math.sqrt(2 * Math.PI / Math.sin(Math.PI / 3)); + var height = size * Math.sin(Math.PI / 3); + ctx.moveTo(x - size/2, y + height/2); + ctx.lineTo(x + size/2, y + height/2); + if (!shadow) { + ctx.lineTo(x, y - height/2); + ctx.lineTo(x - size/2, y + height/2); + } + }, + cross: function (ctx, x, y, radius, shadow) { + // pi * r^2 = (2s)^2 => s = r * sqrt(pi)/2 + var size = radius * Math.sqrt(Math.PI) / 2; + ctx.moveTo(x - size, y - size); + ctx.lineTo(x + size, y + size); + ctx.moveTo(x - size, y + size); + ctx.lineTo(x + size, y - size); + } + } + + var s = series.points.symbol; + if (handlers[s]) + series.points.symbol = handlers[s]; + } + + function init(plot) { + plot.hooks.processDatapoints.push(processRawData); + } + + $.plot.plugins.push({ + init: init, + name: 'symbols', + version: '1.0' + }); +})(jQuery); diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.symbol.min.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.symbol.min.js new file mode 100644 index 0000000..272e003 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.symbol.min.js @@ -0,0 +1 @@ +(function(b){function a(h,e,g){var d={square:function(k,j,n,i,m){var l=i*Math.sqrt(Math.PI)/2;k.rect(j-l,n-l,l+l,l+l)},diamond:function(k,j,n,i,m){var l=i*Math.sqrt(Math.PI/2);k.moveTo(j-l,n);k.lineTo(j,n-l);k.lineTo(j+l,n);k.lineTo(j,n+l);k.lineTo(j-l,n)},triangle:function(l,k,o,j,n){var m=j*Math.sqrt(2*Math.PI/Math.sin(Math.PI/3));var i=m*Math.sin(Math.PI/3);l.moveTo(k-m/2,o+i/2);l.lineTo(k+m/2,o+i/2);if(!n){l.lineTo(k,o-i/2);l.lineTo(k-m/2,o+i/2)}},cross:function(k,j,n,i,m){var l=i*Math.sqrt(Math.PI)/2;k.moveTo(j-l,n-l);k.lineTo(j+l,n+l);k.moveTo(j-l,n+l);k.lineTo(j+l,n-l)}};var f=e.points.symbol;if(d[f]){e.points.symbol=d[f]}}function c(d){d.hooks.processDatapoints.push(a)}b.plot.plugins.push({init:c,name:"symbols",version:"1.0"})})(jQuery);
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.threshold.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.threshold.js new file mode 100644 index 0000000..0b2e7ac --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.threshold.js @@ -0,0 +1,103 @@ +/* +Flot plugin for thresholding data. Controlled through the option +"threshold" in either the global series options + + series: { + threshold: { + below: number + color: colorspec + } + } + +or in a specific series + + $.plot($("#placeholder"), [{ data: [ ... ], threshold: { ... }}]) + +The data points below "below" are drawn with the specified color. This +makes it easy to mark points below 0, e.g. for budget data. + +Internally, the plugin works by splitting the data into two series, +above and below the threshold. The extra series below the threshold +will have its label cleared and the special "originSeries" attribute +set to the original series. You may need to check for this in hover +events. +*/ + +(function ($) { + var options = { + series: { threshold: null } // or { below: number, color: color spec} + }; + + function init(plot) { + function thresholdData(plot, s, datapoints) { + if (!s.threshold) + return; + + var ps = datapoints.pointsize, i, x, y, p, prevp, + thresholded = $.extend({}, s); // note: shallow copy + + thresholded.datapoints = { points: [], pointsize: ps }; + thresholded.label = null; + thresholded.color = s.threshold.color; + thresholded.threshold = null; + thresholded.originSeries = s; + thresholded.data = []; + + var below = s.threshold.below, + origpoints = datapoints.points, + addCrossingPoints = s.lines.show; + + threspoints = []; + newpoints = []; + + for (i = 0; i < origpoints.length; i += ps) { + x = origpoints[i] + y = origpoints[i + 1]; + + prevp = p; + if (y < below) + p = threspoints; + else + p = newpoints; + + if (addCrossingPoints && prevp != p && x != null + && i > 0 && origpoints[i - ps] != null) { + var interx = (x - origpoints[i - ps]) / (y - origpoints[i - ps + 1]) * (below - y) + x; + prevp.push(interx); + prevp.push(below); + for (m = 2; m < ps; ++m) + prevp.push(origpoints[i + m]); + + p.push(null); // start new segment + p.push(null); + for (m = 2; m < ps; ++m) + p.push(origpoints[i + m]); + p.push(interx); + p.push(below); + for (m = 2; m < ps; ++m) + p.push(origpoints[i + m]); + } + + p.push(x); + p.push(y); + } + + datapoints.points = newpoints; + thresholded.datapoints.points = threspoints; + + if (thresholded.datapoints.points.length > 0) + plot.getData().push(thresholded); + + // FIXME: there are probably some edge cases left in bars + } + + plot.hooks.processDatapoints.push(thresholdData); + } + + $.plot.plugins.push({ + init: init, + options: options, + name: 'threshold', + version: '1.0' + }); +})(jQuery); diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.threshold.min.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.threshold.min.js new file mode 100644 index 0000000..d8b79df --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.flot.threshold.min.js @@ -0,0 +1 @@ +(function(B){var A={series:{threshold:null}};function C(D){function E(L,S,M){if(!S.threshold){return }var F=M.pointsize,I,O,N,G,K,H=B.extend({},S);H.datapoints={points:[],pointsize:F};H.label=null;H.color=S.threshold.color;H.threshold=null;H.originSeries=S;H.data=[];var P=S.threshold.below,Q=M.points,R=S.lines.show;threspoints=[];newpoints=[];for(I=0;I<Q.length;I+=F){O=Q[I];N=Q[I+1];K=G;if(N<P){G=threspoints}else{G=newpoints}if(R&&K!=G&&O!=null&&I>0&&Q[I-F]!=null){var J=(O-Q[I-F])/(N-Q[I-F+1])*(P-N)+O;K.push(J);K.push(P);for(m=2;m<F;++m){K.push(Q[I+m])}G.push(null);G.push(null);for(m=2;m<F;++m){G.push(Q[I+m])}G.push(J);G.push(P);for(m=2;m<F;++m){G.push(Q[I+m])}}G.push(O);G.push(N)}M.points=newpoints;H.datapoints.points=threspoints;if(H.datapoints.points.length>0){L.getData().push(H)}}D.hooks.processDatapoints.push(E)}B.plot.plugins.push({init:C,options:A,name:"threshold",version:"1.0"})})(jQuery);
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.js new file mode 100644 index 0000000..78fcfa4 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.js @@ -0,0 +1,8316 @@ +/*! + * jQuery JavaScript Library v1.5.1 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Wed Feb 23 13:55:29 2011 -0500 + */ +(function( window, undefined ) { + +// Use the correct document accordingly with window argument (sandbox) +var document = window.document; +var jQuery = (function() { + +// Define a local copy of jQuery +var jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // A central reference to the root jQuery(document) + rootjQuery, + + // A simple way to check for HTML strings or ID strings + // (both of which we optimize for) + quickExpr = /^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]+)$)/, + + // Check if a string has a non-whitespace character in it + rnotwhite = /\S/, + + // Used for trimming whitespace + trimLeft = /^\s+/, + trimRight = /\s+$/, + + // Check for digits + rdigit = /\d/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, + rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + + // Useragent RegExp + rwebkit = /(webkit)[ \/]([\w.]+)/, + ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, + rmsie = /(msie) ([\w.]+)/, + rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, + + // Keep a UserAgent string for use with jQuery.browser + userAgent = navigator.userAgent, + + // For matching the engine and version of the browser + browserMatch, + + // Has the ready events already been bound? + readyBound = false, + + // The deferred used on DOM ready + readyList, + + // Promise methods + promiseMethods = "then done fail isResolved isRejected promise".split( " " ), + + // The ready event handler + DOMContentLoaded, + + // Save a reference to some core methods + toString = Object.prototype.toString, + hasOwn = Object.prototype.hasOwnProperty, + push = Array.prototype.push, + slice = Array.prototype.slice, + trim = String.prototype.trim, + indexOf = Array.prototype.indexOf, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), or $(undefined) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // The body element only exists once, optimize finding it + if ( selector === "body" && !context && document.body ) { + this.context = document; + this[0] = document.body; + this.selector = "body"; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + match = quickExpr.exec( selector ); + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + doc = (context ? context.ownerDocument || context : document); + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + ret = rsingleTag.exec( selector ); + + if ( ret ) { + if ( jQuery.isPlainObject( context ) ) { + selector = [ document.createElement( ret[1] ) ]; + jQuery.fn.attr.call( selector, context, true ); + + } else { + selector = [ doc.createElement( ret[1] ) ]; + } + + } else { + ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); + selector = (ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment).childNodes; + } + + return jQuery.merge( this, selector ); + + // HANDLE: $("#id") + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return (context || rootjQuery).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if (selector.selector !== undefined) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.5.1", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return slice.call( this, 0 ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = this.constructor(); + + if ( jQuery.isArray( elems ) ) { + push.apply( ret, elems ); + + } else { + jQuery.merge( ret, elems ); + } + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + (this.selector ? " " : "") + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Attach the listeners + jQuery.bindReady(); + + // Add the callback + readyList.done( fn ); + + return this; + }, + + eq: function( i ) { + return i === -1 ? + this.slice( i ) : + this.slice( i, +i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ), + "slice", slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + window.$ = _$; + + if ( deep ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Handle when the DOM is ready + ready: function( wait ) { + // A third-party is pushing the ready event forwards + if ( wait === true ) { + jQuery.readyWait--; + } + + // Make sure that the DOM is not already loaded + if ( !jQuery.readyWait || (wait !== true && !jQuery.isReady) ) { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger( "ready" ).unbind( "ready" ); + } + } + }, + + bindReady: function() { + if ( readyBound ) { + return; + } + + readyBound = true; + + // Catch cases where $(document).ready() is called after the + // browser event has already occurred. + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + return setTimeout( jQuery.ready, 1 ); + } + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent("onreadystatechange", DOMContentLoaded); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var toplevel = false; + + try { + toplevel = window.frameElement == null; + } catch(e) {} + + if ( document.documentElement.doScroll && toplevel ) { + doScrollCheck(); + } + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + // A crude way of determining if an object is a window + isWindow: function( obj ) { + return obj && typeof obj === "object" && "setInterval" in obj; + }, + + isNaN: function( obj ) { + return obj == null || !rdigit.test( obj ) || isNaN( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + // Not own constructor property must be Object + if ( obj.constructor && + !hasOwn.call(obj, "constructor") && + !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + for ( var name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw msg; + }, + + parseJSON: function( data ) { + if ( typeof data !== "string" || !data ) { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test(data.replace(rvalidescape, "@") + .replace(rvalidtokens, "]") + .replace(rvalidbraces, "")) ) { + + // Try to use the native JSON parser first + return window.JSON && window.JSON.parse ? + window.JSON.parse( data ) : + (new Function("return " + data))(); + + } else { + jQuery.error( "Invalid JSON: " + data ); + } + }, + + // Cross-browser xml parsing + // (xml & tmp used internally) + parseXML: function( data , xml , tmp ) { + + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + + tmp = xml.documentElement; + + if ( ! tmp || ! tmp.nodeName || tmp.nodeName === "parsererror" ) { + jQuery.error( "Invalid XML: " + data ); + } + + return xml; + }, + + noop: function() {}, + + // Evalulates a script in a global context + globalEval: function( data ) { + if ( data && rnotwhite.test(data) ) { + // Inspired by code by Andrea Giammarchi + // http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html + var head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement, + script = document.createElement( "script" ); + + if ( jQuery.support.scriptEval() ) { + script.appendChild( document.createTextNode( data ) ); + } else { + script.text = data; + } + + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709). + head.insertBefore( script, head.firstChild ); + head.removeChild( script ); + } + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, + length = object.length, + isObj = length === undefined || jQuery.isFunction(object); + + if ( args ) { + if ( isObj ) { + for ( name in object ) { + if ( callback.apply( object[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( object[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in object ) { + if ( callback.call( object[ name ], name, object[ name ] ) === false ) { + break; + } + } + } else { + for ( var value = object[0]; + i < length && callback.call( value, i, value ) !== false; value = object[++i] ) {} + } + } + + return object; + }, + + // Use native String.trim function wherever possible + trim: trim ? + function( text ) { + return text == null ? + "" : + trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); + }, + + // results is for internal usage only + makeArray: function( array, results ) { + var ret = results || []; + + if ( array != null ) { + // The window, strings (and functions) also have 'length' + // The extra typeof function check is to prevent crashes + // in Safari 2 (See: #3039) + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + var type = jQuery.type(array); + + if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { + push.call( ret, array ); + } else { + jQuery.merge( ret, array ); + } + } + + return ret; + }, + + inArray: function( elem, array ) { + if ( array.indexOf ) { + return array.indexOf( elem ); + } + + for ( var i = 0, length = array.length; i < length; i++ ) { + if ( array[ i ] === elem ) { + return i; + } + } + + return -1; + }, + + merge: function( first, second ) { + var i = first.length, + j = 0; + + if ( typeof second.length === "number" ) { + for ( var l = second.length; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var ret = [], retVal; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var ret = [], value; + + // Go through the array, translating each of the items to their + // new value (or values). + for ( var i = 0, length = elems.length; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Flatten any nested arrays + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + proxy: function( fn, proxy, thisObject ) { + if ( arguments.length === 2 ) { + if ( typeof proxy === "string" ) { + thisObject = fn; + fn = thisObject[ proxy ]; + proxy = undefined; + + } else if ( proxy && !jQuery.isFunction( proxy ) ) { + thisObject = proxy; + proxy = undefined; + } + } + + if ( !proxy && fn ) { + proxy = function() { + return fn.apply( thisObject || this, arguments ); + }; + } + + // Set the guid of unique handler to the same of original handler, so it can be removed + if ( fn ) { + proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + } + + // So proxy can be declared as an argument + return proxy; + }, + + // Mutifunctional method to get and set values to a collection + // The value/s can be optionally by executed if its a function + access: function( elems, key, value, exec, fn, pass ) { + var length = elems.length; + + // Setting many attributes + if ( typeof key === "object" ) { + for ( var k in key ) { + jQuery.access( elems, k, key[k], exec, fn, value ); + } + return elems; + } + + // Setting one attribute + if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = !pass && exec && jQuery.isFunction(value); + + for ( var i = 0; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + + return elems; + } + + // Getting an attribute + return length ? fn( elems[0], key ) : undefined; + }, + + now: function() { + return (new Date()).getTime(); + }, + + // Create a simple deferred (one callbacks list) + _Deferred: function() { + var // callbacks list + callbacks = [], + // stored [ context , args ] + fired, + // to avoid firing when already doing so + firing, + // flag to know if the deferred has been cancelled + cancelled, + // the deferred itself + deferred = { + + // done( f1, f2, ...) + done: function() { + if ( !cancelled ) { + var args = arguments, + i, + length, + elem, + type, + _fired; + if ( fired ) { + _fired = fired; + fired = 0; + } + for ( i = 0, length = args.length; i < length; i++ ) { + elem = args[ i ]; + type = jQuery.type( elem ); + if ( type === "array" ) { + deferred.done.apply( deferred, elem ); + } else if ( type === "function" ) { + callbacks.push( elem ); + } + } + if ( _fired ) { + deferred.resolveWith( _fired[ 0 ], _fired[ 1 ] ); + } + } + return this; + }, + + // resolve with given context and args + resolveWith: function( context, args ) { + if ( !cancelled && !fired && !firing ) { + firing = 1; + try { + while( callbacks[ 0 ] ) { + callbacks.shift().apply( context, args ); + } + } + // We have to add a catch block for + // IE prior to 8 or else the finally + // block will never get executed + catch (e) { + throw e; + } + finally { + fired = [ context, args ]; + firing = 0; + } + } + return this; + }, + + // resolve with this as context and given arguments + resolve: function() { + deferred.resolveWith( jQuery.isFunction( this.promise ) ? this.promise() : this, arguments ); + return this; + }, + + // Has this deferred been resolved? + isResolved: function() { + return !!( firing || fired ); + }, + + // Cancel + cancel: function() { + cancelled = 1; + callbacks = []; + return this; + } + }; + + return deferred; + }, + + // Full fledged deferred (two callbacks list) + Deferred: function( func ) { + var deferred = jQuery._Deferred(), + failDeferred = jQuery._Deferred(), + promise; + // Add errorDeferred methods, then and promise + jQuery.extend( deferred, { + then: function( doneCallbacks, failCallbacks ) { + deferred.done( doneCallbacks ).fail( failCallbacks ); + return this; + }, + fail: failDeferred.done, + rejectWith: failDeferred.resolveWith, + reject: failDeferred.resolve, + isRejected: failDeferred.isResolved, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + if ( obj == null ) { + if ( promise ) { + return promise; + } + promise = obj = {}; + } + var i = promiseMethods.length; + while( i-- ) { + obj[ promiseMethods[i] ] = deferred[ promiseMethods[i] ]; + } + return obj; + } + } ); + // Make sure only one callback list will be used + deferred.done( failDeferred.cancel ).fail( deferred.cancel ); + // Unexpose cancel + delete deferred.cancel; + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + return deferred; + }, + + // Deferred helper + when: function( object ) { + var lastIndex = arguments.length, + deferred = lastIndex <= 1 && object && jQuery.isFunction( object.promise ) ? + object : + jQuery.Deferred(), + promise = deferred.promise(); + + if ( lastIndex > 1 ) { + var array = slice.call( arguments, 0 ), + count = lastIndex, + iCallback = function( index ) { + return function( value ) { + array[ index ] = arguments.length > 1 ? slice.call( arguments, 0 ) : value; + if ( !( --count ) ) { + deferred.resolveWith( promise, array ); + } + }; + }; + while( ( lastIndex-- ) ) { + object = array[ lastIndex ]; + if ( object && jQuery.isFunction( object.promise ) ) { + object.promise().then( iCallback(lastIndex), deferred.reject ); + } else { + --count; + } + } + if ( !count ) { + deferred.resolveWith( promise, array ); + } + } else if ( deferred !== object ) { + deferred.resolve( object ); + } + return promise; + }, + + // Use of jQuery.browser is frowned upon. + // More details: http://docs.jquery.com/Utilities/jQuery.browser + uaMatch: function( ua ) { + ua = ua.toLowerCase(); + + var match = rwebkit.exec( ua ) || + ropera.exec( ua ) || + rmsie.exec( ua ) || + ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || + []; + + return { browser: match[1] || "", version: match[2] || "0" }; + }, + + sub: function() { + function jQuerySubclass( selector, context ) { + return new jQuerySubclass.fn.init( selector, context ); + } + jQuery.extend( true, jQuerySubclass, this ); + jQuerySubclass.superclass = this; + jQuerySubclass.fn = jQuerySubclass.prototype = this(); + jQuerySubclass.fn.constructor = jQuerySubclass; + jQuerySubclass.subclass = this.subclass; + jQuerySubclass.fn.init = function init( selector, context ) { + if ( context && context instanceof jQuery && !(context instanceof jQuerySubclass) ) { + context = jQuerySubclass(context); + } + + return jQuery.fn.init.call( this, selector, context, rootjQuerySubclass ); + }; + jQuerySubclass.fn.init.prototype = jQuerySubclass.fn; + var rootjQuerySubclass = jQuerySubclass(document); + return jQuerySubclass; + }, + + browser: {} +}); + +// Create readyList deferred +readyList = jQuery._Deferred(); + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +browserMatch = jQuery.uaMatch( userAgent ); +if ( browserMatch.browser ) { + jQuery.browser[ browserMatch.browser ] = true; + jQuery.browser.version = browserMatch.version; +} + +// Deprecated, use jQuery.browser.webkit instead +if ( jQuery.browser.webkit ) { + jQuery.browser.safari = true; +} + +if ( indexOf ) { + jQuery.inArray = function( elem, array ) { + return indexOf.call( array, elem ); + }; +} + +// IE doesn't match non-breaking spaces with \s +if ( rnotwhite.test( "\xA0" ) ) { + trimLeft = /^[\s\xA0]+/; + trimRight = /[\s\xA0]+$/; +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); + +// Cleanup functions for the document ready method +if ( document.addEventListener ) { + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +} else if ( document.attachEvent ) { + DOMContentLoaded = function() { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }; +} + +// The DOM ready check for Internet Explorer +function doScrollCheck() { + if ( jQuery.isReady ) { + return; + } + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch(e) { + setTimeout( doScrollCheck, 1 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); +} + +// Expose jQuery to the global object +return jQuery; + +})(); + + +(function() { + + jQuery.support = {}; + + var div = document.createElement("div"); + + div.style.display = "none"; + div.innerHTML = " <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>"; + + var all = div.getElementsByTagName("*"), + a = div.getElementsByTagName("a")[0], + select = document.createElement("select"), + opt = select.appendChild( document.createElement("option") ), + input = div.getElementsByTagName("input")[0]; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return; + } + + jQuery.support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: div.firstChild.nodeType === 3, + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText insted) + style: /red/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: a.getAttribute("href") === "/a", + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.55$/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: input.value === "on", + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Will be defined later + deleteExpando: true, + optDisabled: false, + checkClone: false, + noCloneEvent: true, + noCloneChecked: true, + boxModel: null, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableHiddenOffsets: true + }; + + input.checked = true; + jQuery.support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as diabled) + select.disabled = true; + jQuery.support.optDisabled = !opt.disabled; + + var _scriptEval = null; + jQuery.support.scriptEval = function() { + if ( _scriptEval === null ) { + var root = document.documentElement, + script = document.createElement("script"), + id = "script" + jQuery.now(); + + try { + script.appendChild( document.createTextNode( "window." + id + "=1;" ) ); + } catch(e) {} + + root.insertBefore( script, root.firstChild ); + + // Make sure that the execution of code works by injecting a script + // tag with appendChild/createTextNode + // (IE doesn't support this, fails, and uses .text instead) + if ( window[ id ] ) { + _scriptEval = true; + delete window[ id ]; + } else { + _scriptEval = false; + } + + root.removeChild( script ); + // release memory in IE + root = script = id = null; + } + + return _scriptEval; + }; + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete div.test; + + } catch(e) { + jQuery.support.deleteExpando = false; + } + + if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { + div.attachEvent("onclick", function click() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + jQuery.support.noCloneEvent = false; + div.detachEvent("onclick", click); + }); + div.cloneNode(true).fireEvent("onclick"); + } + + div = document.createElement("div"); + div.innerHTML = "<input type='radio' name='radiotest' checked='checked'/>"; + + var fragment = document.createDocumentFragment(); + fragment.appendChild( div.firstChild ); + + // WebKit doesn't clone checked state correctly in fragments + jQuery.support.checkClone = fragment.cloneNode(true).cloneNode(true).lastChild.checked; + + // Figure out if the W3C box model works as expected + // document.body must exist before we can do this + jQuery(function() { + var div = document.createElement("div"), + body = document.getElementsByTagName("body")[0]; + + // Frameset documents with no body should not run this code + if ( !body ) { + return; + } + + div.style.width = div.style.paddingLeft = "1px"; + body.appendChild( div ); + jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2; + + if ( "zoom" in div.style ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.style.display = "inline"; + div.style.zoom = 1; + jQuery.support.inlineBlockNeedsLayout = div.offsetWidth === 2; + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = ""; + div.innerHTML = "<div style='width:4px;'></div>"; + jQuery.support.shrinkWrapBlocks = div.offsetWidth !== 2; + } + + div.innerHTML = "<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>"; + var tds = div.getElementsByTagName("td"); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + jQuery.support.reliableHiddenOffsets = tds[0].offsetHeight === 0; + + tds[0].style.display = ""; + tds[1].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE < 8 fail this test) + jQuery.support.reliableHiddenOffsets = jQuery.support.reliableHiddenOffsets && tds[0].offsetHeight === 0; + div.innerHTML = ""; + + body.removeChild( div ).style.display = "none"; + div = tds = null; + }); + + // Technique from Juriy Zaytsev + // http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/ + var eventSupported = function( eventName ) { + var el = document.createElement("div"); + eventName = "on" + eventName; + + // We only care about the case where non-standard event systems + // are used, namely in IE. Short-circuiting here helps us to + // avoid an eval call (in setAttribute) which can cause CSP + // to go haywire. See: https://developer.mozilla.org/en/Security/CSP + if ( !el.attachEvent ) { + return true; + } + + var isSupported = (eventName in el); + if ( !isSupported ) { + el.setAttribute(eventName, "return;"); + isSupported = typeof el[eventName] === "function"; + } + el = null; + + return isSupported; + }; + + jQuery.support.submitBubbles = eventSupported("submit"); + jQuery.support.changeBubbles = eventSupported("change"); + + // release memory in IE + div = all = a = null; +})(); + + + +var rbrace = /^(?:\{.*\}|\[.*\])$/; + +jQuery.extend({ + cache: {}, + + // Please use with caution + uuid: 0, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var internalKey = jQuery.expando, getByName = typeof name === "string", thisCache, + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ jQuery.expando ] : elem[ jQuery.expando ] && jQuery.expando; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || (pvt && id && !cache[ id ][ internalKey ])) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ jQuery.expando ] = id = ++jQuery.uuid; + } else { + id = jQuery.expando; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery + // metadata on plain JS objects when the object is serialized using + // JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ][ internalKey ] = jQuery.extend(cache[ id ][ internalKey ], name); + } else { + cache[ id ] = jQuery.extend(cache[ id ], name); + } + } + + thisCache = cache[ id ]; + + // Internal jQuery data is stored in a separate object inside the object's data + // cache in order to avoid key collisions between internal data and user-defined + // data + if ( pvt ) { + if ( !thisCache[ internalKey ] ) { + thisCache[ internalKey ] = {}; + } + + thisCache = thisCache[ internalKey ]; + } + + if ( data !== undefined ) { + thisCache[ name ] = data; + } + + // TODO: This is a hack for 1.5 ONLY. It will be removed in 1.6. Users should + // not attempt to inspect the internal events object using jQuery.data, as this + // internal data object is undocumented and subject to change. + if ( name === "events" && !thisCache[name] ) { + return thisCache[ internalKey ] && thisCache[ internalKey ].events; + } + + return getByName ? thisCache[ name ] : thisCache; + }, + + removeData: function( elem, name, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var internalKey = jQuery.expando, isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + + // See jQuery.data for more information + id = isNode ? elem[ jQuery.expando ] : jQuery.expando; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + var thisCache = pvt ? cache[ id ][ internalKey ] : cache[ id ]; + + if ( thisCache ) { + delete thisCache[ name ]; + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !isEmptyDataObject(thisCache) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( pvt ) { + delete cache[ id ][ internalKey ]; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject(cache[ id ]) ) { + return; + } + } + + var internalCache = cache[ id ][ internalKey ]; + + // Browsers that fail expando deletion also refuse to delete expandos on + // the window, but it will allow it on all other JS objects; other browsers + // don't care + if ( jQuery.support.deleteExpando || cache != window ) { + delete cache[ id ]; + } else { + cache[ id ] = null; + } + + // We destroyed the entire user cache at once because it's faster than + // iterating through each key, but we need to continue to persist internal + // data if it existed + if ( internalCache ) { + cache[ id ] = {}; + // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery + // metadata on plain JS objects when the object is serialized using + // JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + + cache[ id ][ internalKey ] = internalCache; + + // Otherwise, we need to eliminate the expando on the node to avoid + // false lookups in the cache for entries that no longer exist + } else if ( isNode ) { + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( jQuery.support.deleteExpando ) { + delete elem[ jQuery.expando ]; + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } else { + elem[ jQuery.expando ] = null; + } + } + }, + + // For internal use only. + _data: function( elem, name, data ) { + return jQuery.data( elem, name, data, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + if ( elem.nodeName ) { + var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; + + if ( match ) { + return !(match === true || elem.getAttribute("classid") !== match); + } + } + + return true; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var data = null; + + if ( typeof key === "undefined" ) { + if ( this.length ) { + data = jQuery.data( this[0] ); + + if ( this[0].nodeType === 1 ) { + var attr = this[0].attributes, name; + for ( var i = 0, l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = name.substr( 5 ); + dataAttr( this[0], name, data[ name ] ); + } + } + } + } + + return data; + + } else if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + var parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + // Try to fetch any internally stored data first + if ( data === undefined && this.length ) { + data = jQuery.data( this[0], key ); + data = dataAttr( this[0], key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + + } else { + return this.each(function() { + var $this = jQuery( this ), + args = [ parts[0], value ]; + + $this.triggerHandler( "setData" + parts[1] + "!", args ); + jQuery.data( this, key, value ); + $this.triggerHandler( "changeData" + parts[1] + "!", args ); + }); + } + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + data = elem.getAttribute( "data-" + key ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + !jQuery.isNaN( data ) ? parseFloat( data ) : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// TODO: This is a hack for 1.5 ONLY to allow objects with a single toJSON +// property to be considered empty objects; this property always exists in +// order to make sure JSON.stringify does not expose internal metadata +function isEmptyDataObject( obj ) { + for ( var name in obj ) { + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} + + + + +jQuery.extend({ + queue: function( elem, type, data ) { + if ( !elem ) { + return; + } + + type = (type || "fx") + "queue"; + var q = jQuery._data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( !data ) { + return q || []; + } + + if ( !q || jQuery.isArray(data) ) { + q = jQuery._data( elem, type, jQuery.makeArray(data) ); + + } else { + q.push( data ); + } + + return q; + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + fn = queue.shift(); + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift("inprogress"); + } + + fn.call(elem, function() { + jQuery.dequeue(elem, type); + }); + } + + if ( !queue.length ) { + jQuery.removeData( elem, type + "queue", true ); + } + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) { + return jQuery.queue( this[0], type ); + } + return this.each(function( i ) { + var queue = jQuery.queue( this, type, data ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[time] || time : time; + type = type || "fx"; + + return this.queue( type, function() { + var elem = this; + setTimeout(function() { + jQuery.dequeue( elem, type ); + }, time ); + }); + }, + + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + } +}); + + + + +var rclass = /[\n\t\r]/g, + rspaces = /\s+/, + rreturn = /\r/g, + rspecialurl = /^(?:href|src|style)$/, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea)?$/i, + rradiocheck = /^(?:radio|checkbox)$/i; + +jQuery.props = { + "for": "htmlFor", + "class": "className", + readonly: "readOnly", + maxlength: "maxLength", + cellspacing: "cellSpacing", + rowspan: "rowSpan", + colspan: "colSpan", + tabindex: "tabIndex", + usemap: "useMap", + frameborder: "frameBorder" +}; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.attr ); + }, + + removeAttr: function( name, fn ) { + return this.each(function(){ + jQuery.attr( this, name, "" ); + if ( this.nodeType === 1 ) { + this.removeAttribute( name ); + } + }); + }, + + addClass: function( value ) { + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + self.addClass( value.call(this, i, self.attr("class")) ); + }); + } + + if ( value && typeof value === "string" ) { + var classNames = (value || "").split( rspaces ); + + for ( var i = 0, l = this.length; i < l; i++ ) { + var elem = this[i]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className ) { + elem.className = value; + + } else { + var className = " " + elem.className + " ", + setClass = elem.className; + + for ( var c = 0, cl = classNames.length; c < cl; c++ ) { + if ( className.indexOf( " " + classNames[c] + " " ) < 0 ) { + setClass += " " + classNames[c]; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + self.removeClass( value.call(this, i, self.attr("class")) ); + }); + } + + if ( (value && typeof value === "string") || value === undefined ) { + var classNames = (value || "").split( rspaces ); + + for ( var i = 0, l = this.length; i < l; i++ ) { + var elem = this[i]; + + if ( elem.nodeType === 1 && elem.className ) { + if ( value ) { + var className = (" " + elem.className + " ").replace(rclass, " "); + for ( var c = 0, cl = classNames.length; c < cl; c++ ) { + className = className.replace(" " + classNames[c] + " ", " "); + } + elem.className = jQuery.trim( className ); + + } else { + elem.className = ""; + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this); + self.toggleClass( value.call(this, i, self.attr("class"), stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( rspaces ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space seperated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " "; + for ( var i = 0, l = this.length; i < l; i++ ) { + if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + if ( !arguments.length ) { + var elem = this[0]; + + if ( elem ) { + if ( jQuery.nodeName( elem, "option" ) ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + + // We need to handle select boxes special + if ( jQuery.nodeName( elem, "select" ) ) { + var index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { + var option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery(option).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + // Fixes Bug #2551 -- select.val() broken in IE after form.reset() + if ( one && !values.length && options.length ) { + return jQuery( options[ index ] ).val(); + } + + return values; + } + + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + if ( rradiocheck.test( elem.type ) && !jQuery.support.checkOn ) { + return elem.getAttribute("value") === null ? "on" : elem.value; + } + + // Everything else, we just grab the value + return (elem.value || "").replace(rreturn, ""); + + } + + return undefined; + } + + var isFunction = jQuery.isFunction(value); + + return this.each(function(i) { + var self = jQuery(this), val = value; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call(this, i, self.val()); + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray(val) ) { + val = jQuery.map(val, function (value) { + return value == null ? "" : value + ""; + }); + } + + if ( jQuery.isArray(val) && rradiocheck.test( this.type ) ) { + this.checked = jQuery.inArray( self.val(), val ) >= 0; + + } else if ( jQuery.nodeName( this, "select" ) ) { + var values = jQuery.makeArray(val); + + jQuery( "option", this ).each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + this.selectedIndex = -1; + } + + } else { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + attrFn: { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true + }, + + attr: function( elem, name, value, pass ) { + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || elem.nodeType === 2 ) { + return undefined; + } + + if ( pass && name in jQuery.attrFn ) { + return jQuery(elem)[name](value); + } + + var notxml = elem.nodeType !== 1 || !jQuery.isXMLDoc( elem ), + // Whether we are setting (or getting) + set = value !== undefined; + + // Try to normalize/fix the name + name = notxml && jQuery.props[ name ] || name; + + // Only do all the following if this is a node (faster for style) + if ( elem.nodeType === 1 ) { + // These attributes require special treatment + var special = rspecialurl.test( name ); + + // Safari mis-reports the default selected property of an option + // Accessing the parent's selectedIndex property fixes it + if ( name === "selected" && !jQuery.support.optSelected ) { + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + + // If applicable, access the attribute via the DOM 0 way + // 'in' checks fail in Blackberry 4.7 #6931 + if ( (name in elem || elem[ name ] !== undefined) && notxml && !special ) { + if ( set ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( name === "type" && rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } + + if ( value === null ) { + if ( elem.nodeType === 1 ) { + elem.removeAttribute( name ); + } + + } else { + elem[ name ] = value; + } + } + + // browsers index elements by id/name on forms, give priority to attributes. + if ( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) ) { + return elem.getAttributeNode( name ).nodeValue; + } + + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + if ( name === "tabIndex" ) { + var attributeNode = elem.getAttributeNode( "tabIndex" ); + + return attributeNode && attributeNode.specified ? + attributeNode.value : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + + return elem[ name ]; + } + + if ( !jQuery.support.style && notxml && name === "style" ) { + if ( set ) { + elem.style.cssText = "" + value; + } + + return elem.style.cssText; + } + + if ( set ) { + // convert the value to a string (all browsers do this but IE) see #1070 + elem.setAttribute( name, "" + value ); + } + + // Ensure that missing attributes return undefined + // Blackberry 4.7 returns "" from getAttribute #6938 + if ( !elem.attributes[ name ] && (elem.hasAttribute && !elem.hasAttribute( name )) ) { + return undefined; + } + + var attr = !jQuery.support.hrefNormalized && notxml && special ? + // Some attributes require a special call on IE + elem.getAttribute( name, 2 ) : + elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return attr === null ? undefined : attr; + } + // Handle everything which isn't a DOM element node + if ( set ) { + elem[ name ] = value; + } + return elem[ name ]; + } +}); + + + + +var rnamespaces = /\.(.*)$/, + rformElems = /^(?:textarea|input|select)$/i, + rperiod = /\./g, + rspace = / /g, + rescape = /[^\w\s.|`]/g, + fcleanup = function( nm ) { + return nm.replace(rescape, "\\$&"); + }; + +/* + * A number of helper functions used for managing events. + * Many of the ideas behind this code originated from + * Dean Edwards' addEvent library. + */ +jQuery.event = { + + // Bind an event to an element + // Original by Dean Edwards + add: function( elem, types, handler, data ) { + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // TODO :: Use a try/catch until it's safe to pull this out (likely 1.6) + // Minor release fix for bug #8018 + try { + // For whatever reason, IE has trouble passing the window object + // around, causing it to be cloned in the process + if ( jQuery.isWindow( elem ) && ( elem !== window && !elem.frameElement ) ) { + elem = window; + } + } + catch ( e ) {} + + if ( handler === false ) { + handler = returnFalse; + } else if ( !handler ) { + // Fixes bug #7229. Fix recommended by jdalton + return; + } + + var handleObjIn, handleObj; + + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + } + + // Make sure that the function being executed has a unique ID + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure + var elemData = jQuery._data( elem ); + + // If no elemData is found then we must be trying to bind to one of the + // banned noData elements + if ( !elemData ) { + return; + } + + var events = elemData.events, + eventHandle = elemData.handle; + + if ( !events ) { + elemData.events = events = {}; + } + + if ( !eventHandle ) { + elemData.handle = eventHandle = function() { + // Handle the second event of a trigger and when + // an event is called after a page has unloaded + return typeof jQuery !== "undefined" && !jQuery.event.triggered ? + jQuery.event.handle.apply( eventHandle.elem, arguments ) : + undefined; + }; + } + + // Add elem as a property of the handle function + // This is to prevent a memory leak with non-native events in IE. + eventHandle.elem = elem; + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = types.split(" "); + + var type, i = 0, namespaces; + + while ( (type = types[ i++ ]) ) { + handleObj = handleObjIn ? + jQuery.extend({}, handleObjIn) : + { handler: handler, data: data }; + + // Namespaced event handlers + if ( type.indexOf(".") > -1 ) { + namespaces = type.split("."); + type = namespaces.shift(); + handleObj.namespace = namespaces.slice(0).sort().join("."); + + } else { + namespaces = []; + handleObj.namespace = ""; + } + + handleObj.type = type; + if ( !handleObj.guid ) { + handleObj.guid = handler.guid; + } + + // Get the current list of functions bound to this event + var handlers = events[ type ], + special = jQuery.event.special[ type ] || {}; + + // Init the event handler queue + if ( !handlers ) { + handlers = events[ type ] = []; + + // Check for a special event handler + // Only use addEventListener/attachEvent if the special + // events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add the function to the element's handler list + handlers.push( handleObj ); + + // Keep track of which events have been used, for global triggering + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, pos ) { + // don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + if ( handler === false ) { + handler = returnFalse; + } + + var ret, type, fn, j, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType, + elemData = jQuery.hasData( elem ) && jQuery._data( elem ), + events = elemData && elemData.events; + + if ( !elemData || !events ) { + return; + } + + // types is actually an event object here + if ( types && types.type ) { + handler = types.handler; + types = types.type; + } + + // Unbind all events for the element + if ( !types || typeof types === "string" && types.charAt(0) === "." ) { + types = types || ""; + + for ( type in events ) { + jQuery.event.remove( elem, type + types ); + } + + return; + } + + // Handle multiple events separated by a space + // jQuery(...).unbind("mouseover mouseout", fn); + types = types.split(" "); + + while ( (type = types[ i++ ]) ) { + origType = type; + handleObj = null; + all = type.indexOf(".") < 0; + namespaces = []; + + if ( !all ) { + // Namespaced event handlers + namespaces = type.split("."); + type = namespaces.shift(); + + namespace = new RegExp("(^|\\.)" + + jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + eventType = events[ type ]; + + if ( !eventType ) { + continue; + } + + if ( !handler ) { + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( all || namespace.test( handleObj.namespace ) ) { + jQuery.event.remove( elem, origType, handleObj.handler, j ); + eventType.splice( j--, 1 ); + } + } + + continue; + } + + special = jQuery.event.special[ type ] || {}; + + for ( j = pos || 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( handler.guid === handleObj.guid ) { + // remove the given handler for the given type + if ( all || namespace.test( handleObj.namespace ) ) { + if ( pos == null ) { + eventType.splice( j--, 1 ); + } + + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + + if ( pos != null ) { + break; + } + } + } + + // remove generic event handler if no more handlers exist + if ( eventType.length === 0 || pos != null && eventType.length === 1 ) { + if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + ret = null; + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + var handle = elemData.handle; + if ( handle ) { + handle.elem = null; + } + + delete elemData.events; + delete elemData.handle; + + if ( jQuery.isEmptyObject( elemData ) ) { + jQuery.removeData( elem, undefined, true ); + } + } + }, + + // bubbling is internal + trigger: function( event, data, elem /*, bubbling */ ) { + // Event object or event type + var type = event.type || event, + bubbling = arguments[3]; + + if ( !bubbling ) { + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + jQuery.extend( jQuery.Event(type), event ) : + // Just the event type (string) + jQuery.Event(type); + + if ( type.indexOf("!") >= 0 ) { + event.type = type = type.slice(0, -1); + event.exclusive = true; + } + + // Handle a global trigger + if ( !elem ) { + // Don't bubble custom events when global (to avoid too much overhead) + event.stopPropagation(); + + // Only trigger if we've ever bound an event for it + if ( jQuery.event.global[ type ] ) { + // XXX This code smells terrible. event.js should not be directly + // inspecting the data cache + jQuery.each( jQuery.cache, function() { + // internalKey variable is just used to make it easier to find + // and potentially change this stuff later; currently it just + // points to jQuery.expando + var internalKey = jQuery.expando, + internalCache = this[ internalKey ]; + if ( internalCache && internalCache.events && internalCache.events[ type ] ) { + jQuery.event.trigger( event, data, internalCache.handle.elem ); + } + }); + } + } + + // Handle triggering a single element + + // don't do events on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) { + return undefined; + } + + // Clean up in case it is reused + event.result = undefined; + event.target = elem; + + // Clone the incoming data, if any + data = jQuery.makeArray( data ); + data.unshift( event ); + } + + event.currentTarget = elem; + + // Trigger the event, it is assumed that "handle" is a function + var handle = jQuery._data( elem, "handle" ); + + if ( handle ) { + handle.apply( elem, data ); + } + + var parent = elem.parentNode || elem.ownerDocument; + + // Trigger an inline bound script + try { + if ( !(elem && elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()]) ) { + if ( elem[ "on" + type ] && elem[ "on" + type ].apply( elem, data ) === false ) { + event.result = false; + event.preventDefault(); + } + } + + // prevent IE from throwing an error for some elements with some event types, see #3533 + } catch (inlineError) {} + + if ( !event.isPropagationStopped() && parent ) { + jQuery.event.trigger( event, data, parent, true ); + + } else if ( !event.isDefaultPrevented() ) { + var old, + target = event.target, + targetType = type.replace( rnamespaces, "" ), + isClick = jQuery.nodeName( target, "a" ) && targetType === "click", + special = jQuery.event.special[ targetType ] || {}; + + if ( (!special._default || special._default.call( elem, event ) === false) && + !isClick && !(target && target.nodeName && jQuery.noData[target.nodeName.toLowerCase()]) ) { + + try { + if ( target[ targetType ] ) { + // Make sure that we don't accidentally re-trigger the onFOO events + old = target[ "on" + targetType ]; + + if ( old ) { + target[ "on" + targetType ] = null; + } + + jQuery.event.triggered = true; + target[ targetType ](); + } + + // prevent IE from throwing an error for some elements with some event types, see #3533 + } catch (triggerError) {} + + if ( old ) { + target[ "on" + targetType ] = old; + } + + jQuery.event.triggered = false; + } + } + }, + + handle: function( event ) { + var all, handlers, namespaces, namespace_re, events, + namespace_sort = [], + args = jQuery.makeArray( arguments ); + + event = args[0] = jQuery.event.fix( event || window.event ); + event.currentTarget = this; + + // Namespaced event handlers + all = event.type.indexOf(".") < 0 && !event.exclusive; + + if ( !all ) { + namespaces = event.type.split("."); + event.type = namespaces.shift(); + namespace_sort = namespaces.slice(0).sort(); + namespace_re = new RegExp("(^|\\.)" + namespace_sort.join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + event.namespace = event.namespace || namespace_sort.join("."); + + events = jQuery._data(this, "events"); + + handlers = (events || {})[ event.type ]; + + if ( events && handlers ) { + // Clone the handlers to prevent manipulation + handlers = handlers.slice(0); + + for ( var j = 0, l = handlers.length; j < l; j++ ) { + var handleObj = handlers[ j ]; + + // Filter the functions by class + if ( all || namespace_re.test( handleObj.namespace ) ) { + // Pass in a reference to the handler function itself + // So that we can later remove it + event.handler = handleObj.handler; + event.data = handleObj.data; + event.handleObj = handleObj; + + var ret = handleObj.handler.apply( this, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + } + + return event.result; + }, + + props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // store a copy of the original event object + // and "clone" to set read-only properties + var originalEvent = event; + event = jQuery.Event( originalEvent ); + + for ( var i = this.props.length, prop; i; ) { + prop = this.props[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary + if ( !event.target ) { + // Fixes #1925 where srcElement might not be defined either + event.target = event.srcElement || document; + } + + // check if target is a textnode (safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && event.fromElement ) { + event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement; + } + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && event.clientX != null ) { + var doc = document.documentElement, + body = document.body; + + event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0); + event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0); + } + + // Add which for key events + if ( event.which == null && (event.charCode != null || event.keyCode != null) ) { + event.which = event.charCode != null ? event.charCode : event.keyCode; + } + + // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs) + if ( !event.metaKey && event.ctrlKey ) { + event.metaKey = event.ctrlKey; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && event.button !== undefined ) { + event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) )); + } + + return event; + }, + + // Deprecated, use jQuery.guid instead + guid: 1E8, + + // Deprecated, use jQuery.proxy instead + proxy: jQuery.proxy, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady, + teardown: jQuery.noop + }, + + live: { + add: function( handleObj ) { + jQuery.event.add( this, + liveConvert( handleObj.origType, handleObj.selector ), + jQuery.extend({}, handleObj, {handler: liveHandler, guid: handleObj.handler.guid}) ); + }, + + remove: function( handleObj ) { + jQuery.event.remove( this, liveConvert( handleObj.origType, handleObj.selector ), handleObj ); + } + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + } +}; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + if ( elem.detachEvent ) { + elem.detachEvent( "on" + type, handle ); + } + }; + +jQuery.Event = function( src ) { + // Allow instantiation without the 'new' keyword + if ( !this.preventDefault ) { + return new jQuery.Event( src ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = (src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault()) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // timeStamp is buggy for some events on Firefox(#3843) + // So we won't rely on the native value + this.timeStamp = jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Checks if an event happened on an element within another element +// Used in jQuery.event.special.mouseenter and mouseleave handlers +var withinElement = function( event ) { + // Check if mouse(over|out) are still within the same parent element + var parent = event.relatedTarget; + + // Firefox sometimes assigns relatedTarget a XUL element + // which we cannot access the parentNode property of + try { + + // Chrome does something similar, the parentNode property + // can be accessed but is null. + if ( parent !== document && !parent.parentNode ) { + return; + } + // Traverse up the tree + while ( parent && parent !== this ) { + parent = parent.parentNode; + } + + if ( parent !== this ) { + // set the correct event type + event.type = event.data; + + // handle event if we actually just moused on to a non sub-element + jQuery.event.handle.apply( this, arguments ); + } + + // assuming we've left the element since we most likely mousedover a xul element + } catch(e) { } +}, + +// In case of event delegation, we only need to rename the event.type, +// liveHandler will take care of the rest. +delegate = function( event ) { + event.type = event.data; + jQuery.event.handle.apply( this, arguments ); +}; + +// Create mouseenter and mouseleave events +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + setup: function( data ) { + jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig ); + }, + teardown: function( data ) { + jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement ); + } + }; +}); + +// submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function( data, namespaces ) { + if ( this.nodeName && this.nodeName.toLowerCase() !== "form" ) { + jQuery.event.add(this, "click.specialSubmit", function( e ) { + var elem = e.target, + type = elem.type; + + if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) { + trigger( "submit", this, arguments ); + } + }); + + jQuery.event.add(this, "keypress.specialSubmit", function( e ) { + var elem = e.target, + type = elem.type; + + if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) { + trigger( "submit", this, arguments ); + } + }); + + } else { + return false; + } + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialSubmit" ); + } + }; + +} + +// change delegation, happens here so we have bind. +if ( !jQuery.support.changeBubbles ) { + + var changeFilters, + + getVal = function( elem ) { + var type = elem.type, val = elem.value; + + if ( type === "radio" || type === "checkbox" ) { + val = elem.checked; + + } else if ( type === "select-multiple" ) { + val = elem.selectedIndex > -1 ? + jQuery.map( elem.options, function( elem ) { + return elem.selected; + }).join("-") : + ""; + + } else if ( elem.nodeName.toLowerCase() === "select" ) { + val = elem.selectedIndex; + } + + return val; + }, + + testChange = function testChange( e ) { + var elem = e.target, data, val; + + if ( !rformElems.test( elem.nodeName ) || elem.readOnly ) { + return; + } + + data = jQuery._data( elem, "_change_data" ); + val = getVal(elem); + + // the current data will be also retrieved by beforeactivate + if ( e.type !== "focusout" || elem.type !== "radio" ) { + jQuery._data( elem, "_change_data", val ); + } + + if ( data === undefined || val === data ) { + return; + } + + if ( data != null || val ) { + e.type = "change"; + e.liveFired = undefined; + jQuery.event.trigger( e, arguments[1], elem ); + } + }; + + jQuery.event.special.change = { + filters: { + focusout: testChange, + + beforedeactivate: testChange, + + click: function( e ) { + var elem = e.target, type = elem.type; + + if ( type === "radio" || type === "checkbox" || elem.nodeName.toLowerCase() === "select" ) { + testChange.call( this, e ); + } + }, + + // Change has to be called before submit + // Keydown will be called before keypress, which is used in submit-event delegation + keydown: function( e ) { + var elem = e.target, type = elem.type; + + if ( (e.keyCode === 13 && elem.nodeName.toLowerCase() !== "textarea") || + (e.keyCode === 32 && (type === "checkbox" || type === "radio")) || + type === "select-multiple" ) { + testChange.call( this, e ); + } + }, + + // Beforeactivate happens also before the previous element is blurred + // with this event you can't trigger a change event, but you can store + // information + beforeactivate: function( e ) { + var elem = e.target; + jQuery._data( elem, "_change_data", getVal(elem) ); + } + }, + + setup: function( data, namespaces ) { + if ( this.type === "file" ) { + return false; + } + + for ( var type in changeFilters ) { + jQuery.event.add( this, type + ".specialChange", changeFilters[type] ); + } + + return rformElems.test( this.nodeName ); + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialChange" ); + + return rformElems.test( this.nodeName ); + } + }; + + changeFilters = jQuery.event.special.change.filters; + + // Handle when the input is .focus()'d + changeFilters.focus = changeFilters.beforeactivate; +} + +function trigger( type, elem, args ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + // Don't pass args or remember liveFired; they apply to the donor event. + var event = jQuery.extend( {}, args[ 0 ] ); + event.type = type; + event.originalEvent = {}; + event.liveFired = undefined; + jQuery.event.handle.call( elem, event ); + if ( event.isDefaultPrevented() ) { + args[ 0 ].preventDefault(); + } +} + +// Create "bubbling" focus and blur events +if ( document.addEventListener ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + jQuery.event.special[ fix ] = { + setup: function() { + this.addEventListener( orig, handler, true ); + }, + teardown: function() { + this.removeEventListener( orig, handler, true ); + } + }; + + function handler( e ) { + e = jQuery.event.fix( e ); + e.type = fix; + return jQuery.event.handle.call( this, e ); + } + }); +} + +jQuery.each(["bind", "one"], function( i, name ) { + jQuery.fn[ name ] = function( type, data, fn ) { + // Handle object literals + if ( typeof type === "object" ) { + for ( var key in type ) { + this[ name ](key, data, type[key], fn); + } + return this; + } + + if ( jQuery.isFunction( data ) || data === false ) { + fn = data; + data = undefined; + } + + var handler = name === "one" ? jQuery.proxy( fn, function( event ) { + jQuery( this ).unbind( event, handler ); + return fn.apply( this, arguments ); + }) : fn; + + if ( type === "unload" && name !== "one" ) { + this.one( type, data, fn ); + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.add( this[i], type, handler, data ); + } + } + + return this; + }; +}); + +jQuery.fn.extend({ + unbind: function( type, fn ) { + // Handle object literals + if ( typeof type === "object" && !type.preventDefault ) { + for ( var key in type ) { + this.unbind(key, type[key]); + } + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.remove( this[i], type, fn ); + } + } + + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.live( types, data, fn, selector ); + }, + + undelegate: function( selector, types, fn ) { + if ( arguments.length === 0 ) { + return this.unbind( "live" ); + + } else { + return this.die( types, null, fn, selector ); + } + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + + triggerHandler: function( type, data ) { + if ( this[0] ) { + var event = jQuery.Event( type ); + event.preventDefault(); + event.stopPropagation(); + jQuery.event.trigger( event, data, this[0] ); + return event.result; + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + i = 1; + + // link all the functions, so any of them can unbind this click handler + while ( i < args.length ) { + jQuery.proxy( fn, args[ i++ ] ); + } + + return this.click( jQuery.proxy( fn, function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + })); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +var liveMap = { + focus: "focusin", + blur: "focusout", + mouseenter: "mouseover", + mouseleave: "mouseout" +}; + +jQuery.each(["live", "die"], function( i, name ) { + jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) { + var type, i = 0, match, namespaces, preType, + selector = origSelector || this.selector, + context = origSelector ? this : jQuery( this.context ); + + if ( typeof types === "object" && !types.preventDefault ) { + for ( var key in types ) { + context[ name ]( key, data, types[key], selector ); + } + + return this; + } + + if ( jQuery.isFunction( data ) ) { + fn = data; + data = undefined; + } + + types = (types || "").split(" "); + + while ( (type = types[ i++ ]) != null ) { + match = rnamespaces.exec( type ); + namespaces = ""; + + if ( match ) { + namespaces = match[0]; + type = type.replace( rnamespaces, "" ); + } + + if ( type === "hover" ) { + types.push( "mouseenter" + namespaces, "mouseleave" + namespaces ); + continue; + } + + preType = type; + + if ( type === "focus" || type === "blur" ) { + types.push( liveMap[ type ] + namespaces ); + type = type + namespaces; + + } else { + type = (liveMap[ type ] || type) + namespaces; + } + + if ( name === "live" ) { + // bind live handler + for ( var j = 0, l = context.length; j < l; j++ ) { + jQuery.event.add( context[j], "live." + liveConvert( type, selector ), + { data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } ); + } + + } else { + // unbind live handler + context.unbind( "live." + liveConvert( type, selector ), fn ); + } + } + + return this; + }; +}); + +function liveHandler( event ) { + var stop, maxLevel, related, match, handleObj, elem, j, i, l, data, close, namespace, ret, + elems = [], + selectors = [], + events = jQuery._data( this, "events" ); + + // Make sure we avoid non-left-click bubbling in Firefox (#3861) and disabled elements in IE (#6911) + if ( event.liveFired === this || !events || !events.live || event.target.disabled || event.button && event.type === "click" ) { + return; + } + + if ( event.namespace ) { + namespace = new RegExp("(^|\\.)" + event.namespace.split(".").join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + event.liveFired = this; + + var live = events.live.slice(0); + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) { + selectors.push( handleObj.selector ); + + } else { + live.splice( j--, 1 ); + } + } + + match = jQuery( event.target ).closest( selectors, event.currentTarget ); + + for ( i = 0, l = match.length; i < l; i++ ) { + close = match[i]; + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( close.selector === handleObj.selector && (!namespace || namespace.test( handleObj.namespace )) && !close.elem.disabled ) { + elem = close.elem; + related = null; + + // Those two events require additional checking + if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) { + event.type = handleObj.preType; + related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0]; + } + + if ( !related || related !== elem ) { + elems.push({ elem: elem, handleObj: handleObj, level: close.level }); + } + } + } + } + + for ( i = 0, l = elems.length; i < l; i++ ) { + match = elems[i]; + + if ( maxLevel && match.level > maxLevel ) { + break; + } + + event.currentTarget = match.elem; + event.data = match.handleObj.data; + event.handleObj = match.handleObj; + + ret = match.handleObj.origHandler.apply( match.elem, arguments ); + + if ( ret === false || event.isPropagationStopped() ) { + maxLevel = match.level; + + if ( ret === false ) { + stop = false; + } + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + + return stop; +} + +function liveConvert( type, selector ) { + return (type && type !== "*" ? type + "." : "") + selector.replace(rperiod, "`").replace(rspace, "&"); +} + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.bind( name, data, fn ) : + this.trigger( name ); + }; + + if ( jQuery.attrFn ) { + jQuery.attrFn[ name ] = true; + } +}); + + +/*! + * Sizzle CSS Selector Engine + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, + done = 0, + toString = Object.prototype.toString, + hasDuplicate = false, + baseHasDuplicate = true, + rBackslash = /\\/g, + rNonWord = /\W/; + +// Here we check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function() { + baseHasDuplicate = false; + return 0; +}); + +var Sizzle = function( selector, context, results, seed ) { + results = results || []; + context = context || document; + + var origContext = context; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var m, set, checkSet, extra, ret, cur, pop, i, + prune = true, + contextXML = Sizzle.isXML( context ), + parts = [], + soFar = selector; + + // Reset the position of the chunker regexp (start from head) + do { + chunker.exec( "" ); + m = chunker.exec( soFar ); + + if ( m ) { + soFar = m[3]; + + parts.push( m[1] ); + + if ( m[2] ) { + extra = m[3]; + break; + } + } + } while ( m ); + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context ); + + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) { + selector += parts.shift(); + } + + set = posProcess( selector, set ); + } + } + + } else { + // Take a shortcut and set the context if the root selector is an ID + // (but not if it'll be faster if the inner selector is an ID) + if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && + Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + + ret = Sizzle.find( parts.shift(), context, contextXML ); + context = ret.expr ? + Sizzle.filter( ret.expr, ret.set )[0] : + ret.set[0]; + } + + if ( context ) { + ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + + set = ret.expr ? + Sizzle.filter( ret.expr, ret.set ) : + ret.set; + + if ( parts.length > 0 ) { + checkSet = makeArray( set ); + + } else { + prune = false; + } + + while ( parts.length ) { + cur = parts.pop(); + pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, contextXML ); + } + + } else { + checkSet = parts = []; + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + Sizzle.error( cur || selector ); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + + } else if ( context && context.nodeType === 1 ) { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + + } else { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, origContext, results, seed ); + Sizzle.uniqueSort( results ); + } + + return results; +}; + +Sizzle.uniqueSort = function( results ) { + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + } + + return results; +}; + +Sizzle.matches = function( expr, set ) { + return Sizzle( expr, null, null, set ); +}; + +Sizzle.matchesSelector = function( node, expr ) { + return Sizzle( expr, null, null, [node] ).length > 0; +}; + +Sizzle.find = function( expr, context, isXML ) { + var set; + + if ( !expr ) { + return []; + } + + for ( var i = 0, l = Expr.order.length; i < l; i++ ) { + var match, + type = Expr.order[i]; + + if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { + var left = match[1]; + match.splice( 1, 1 ); + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace( rBackslash, "" ); + set = Expr.find[ type ]( match, context, isXML ); + + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = typeof context.getElementsByTagName !== "undefined" ? + context.getElementsByTagName( "*" ) : + []; + } + + return { set: set, expr: expr }; +}; + +Sizzle.filter = function( expr, set, inplace, not ) { + var match, anyFound, + old = expr, + result = [], + curLoop = set, + isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); + + while ( expr && set.length ) { + for ( var type in Expr.filter ) { + if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { + var found, item, + filter = Expr.filter[ type ], + left = match[1]; + + anyFound = false; + + match.splice(1,1); + + if ( left.substr( left.length - 1 ) === "\\" ) { + continue; + } + + if ( curLoop === result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( var i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + var pass = not ^ !!found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + + } else { + curLoop[i] = false; + } + + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr === old ) { + if ( anyFound == null ) { + Sizzle.error( expr ); + + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +Sizzle.error = function( msg ) { + throw "Syntax error, unrecognized expression: " + msg; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + + match: { + ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ + }, + + leftMatch: {}, + + attrMap: { + "class": "className", + "for": "htmlFor" + }, + + attrHandle: { + href: function( elem ) { + return elem.getAttribute( "href" ); + }, + type: function( elem ) { + return elem.getAttribute( "type" ); + } + }, + + relative: { + "+": function(checkSet, part){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !rNonWord.test( part ), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag ) { + part = part.toLowerCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + + ">": function( checkSet, part ) { + var elem, + isPartStr = typeof part === "string", + i = 0, + l = checkSet.length; + + if ( isPartStr && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; + } + } + + } else { + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + + "": function(checkSet, part, isXML){ + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); + }, + + "~": function( checkSet, part, isXML ) { + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); + } + }, + + find: { + ID: function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }, + + NAME: function( match, context ) { + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], + results = context.getElementsByName( match[1] ); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + + TAG: function( match, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( match[1] ); + } + } + }, + preFilter: { + CLASS: function( match, curLoop, inplace, result, not, isXML ) { + match = " " + match[1].replace( rBackslash, "" ) + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) { + if ( !inplace ) { + result.push( elem ); + } + + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + + ID: function( match ) { + return match[1].replace( rBackslash, "" ); + }, + + TAG: function( match, curLoop ) { + return match[1].replace( rBackslash, "" ).toLowerCase(); + }, + + CHILD: function( match ) { + if ( match[1] === "nth" ) { + if ( !match[2] ) { + Sizzle.error( match[0] ); + } + + match[2] = match[2].replace(/^\+|\s*/g, ''); + + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec( + match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + else if ( match[2] ) { + Sizzle.error( match[0] ); + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + + ATTR: function( match, curLoop, inplace, result, not, isXML ) { + var name = match[1] = match[1].replace( rBackslash, "" ); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + // Handle if an un-quoted value was used + match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" ); + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + + PSEUDO: function( match, curLoop, inplace, result, not ) { + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + + if ( !inplace ) { + result.push.apply( result, ret ); + } + + return false; + } + + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + + POS: function( match ) { + match.unshift( true ); + + return match; + } + }, + + filters: { + enabled: function( elem ) { + return elem.disabled === false && elem.type !== "hidden"; + }, + + disabled: function( elem ) { + return elem.disabled === true; + }, + + checked: function( elem ) { + return elem.checked === true; + }, + + selected: function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + parent: function( elem ) { + return !!elem.firstChild; + }, + + empty: function( elem ) { + return !elem.firstChild; + }, + + has: function( elem, i, match ) { + return !!Sizzle( match[3], elem ).length; + }, + + header: function( elem ) { + return (/h\d/i).test( elem.nodeName ); + }, + + text: function( elem ) { + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return "text" === elem.getAttribute( 'type' ); + }, + radio: function( elem ) { + return "radio" === elem.type; + }, + + checkbox: function( elem ) { + return "checkbox" === elem.type; + }, + + file: function( elem ) { + return "file" === elem.type; + }, + password: function( elem ) { + return "password" === elem.type; + }, + + submit: function( elem ) { + return "submit" === elem.type; + }, + + image: function( elem ) { + return "image" === elem.type; + }, + + reset: function( elem ) { + return "reset" === elem.type; + }, + + button: function( elem ) { + return "button" === elem.type || elem.nodeName.toLowerCase() === "button"; + }, + + input: function( elem ) { + return (/input|select|textarea|button/i).test( elem.nodeName ); + } + }, + setFilters: { + first: function( elem, i ) { + return i === 0; + }, + + last: function( elem, i, match, array ) { + return i === array.length - 1; + }, + + even: function( elem, i ) { + return i % 2 === 0; + }, + + odd: function( elem, i ) { + return i % 2 === 1; + }, + + lt: function( elem, i, match ) { + return i < match[3] - 0; + }, + + gt: function( elem, i, match ) { + return i > match[3] - 0; + }, + + nth: function( elem, i, match ) { + return match[3] - 0 === i; + }, + + eq: function( elem, i, match ) { + return match[3] - 0 === i; + } + }, + filter: { + PSEUDO: function( elem, match, i, array ) { + var name = match[1], + filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || Sizzle.getText([ elem ]) || "").indexOf(match[3]) >= 0; + + } else if ( name === "not" ) { + var not = match[3]; + + for ( var j = 0, l = not.length; j < l; j++ ) { + if ( not[j] === elem ) { + return false; + } + } + + return true; + + } else { + Sizzle.error( name ); + } + }, + + CHILD: function( elem, match ) { + var type = match[1], + node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + + case "nth": + var first = match[2], + last = match[3]; + + if ( first === 1 && last === 0 ) { + return true; + } + + var doneName = match[0], + parent = elem.parentNode; + + if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) { + var count = 0; + + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + + parent.sizcache = doneName; + } + + var diff = elem.nodeIndex - last; + + if ( first === 0 ) { + return diff === 0; + + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + } + }, + + ID: function( elem, match ) { + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + + TAG: function( elem, match ) { + return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match; + }, + + CLASS: function( elem, match ) { + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + + ATTR: function( elem, match ) { + var name = match[1], + result = Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value !== check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + + POS: function( elem, match, i, array ) { + var name = match[2], + filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS, + fescape = function(all, num){ + return "\\" + (num - 0 + 1); + }; + +for ( var type in Expr.match ) { + Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); + Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); +} + +var makeArray = function( array, results ) { + array = Array.prototype.slice.call( array, 0 ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +// Also verifies that the returned array holds DOM nodes +// (which is not the case in the Blackberry browser) +try { + Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; + +// Provide a fallback method if it does not work +} catch( e ) { + makeArray = function( array, results ) { + var i = 0, + ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + + } else { + if ( typeof array.length === "number" ) { + for ( var l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + + } else { + for ( ; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder, siblingCheck; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { + return a.compareDocumentPosition ? -1 : 1; + } + + return a.compareDocumentPosition(b) & 4 ? -1 : 1; + }; + +} else { + sortOrder = function( a, b ) { + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // If the nodes are siblings (or identical) we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + + siblingCheck = function( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; + }; +} + +// Utility function for retreiving the text value of an array of DOM nodes +Sizzle.getText = function( elems ) { + var ret = "", elem; + + for ( var i = 0; elems[i]; i++ ) { + elem = elems[i]; + + // Get the text from text nodes and CDATA nodes + if ( elem.nodeType === 3 || elem.nodeType === 4 ) { + ret += elem.nodeValue; + + // Traverse everything else, except comment nodes + } else if ( elem.nodeType !== 8 ) { + ret += Sizzle.getText( elem.childNodes ); + } + } + + return ret; +}; + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("div"), + id = "script" + (new Date()).getTime(), + root = document.documentElement; + + form.innerHTML = "<a name='" + id + "'/>"; + + // Inject it into the root element, check its status, and remove it quickly + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( document.getElementById( id ) ) { + Expr.find.ID = function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + + return m ? + m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? + [m] : + undefined : + []; + } + }; + + Expr.filter.ID = function( elem, match ) { + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); + + // release memory in IE + root = form = null; +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function( match, context ) { + var results = context.getElementsByTagName( match[1] ); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = "<a href='#'></a>"; + + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + + Expr.attrHandle.href = function( elem ) { + return elem.getAttribute( "href", 2 ); + }; + } + + // release memory in IE + div = null; +})(); + +if ( document.querySelectorAll ) { + (function(){ + var oldSizzle = Sizzle, + div = document.createElement("div"), + id = "__sizzle__"; + + div.innerHTML = "<p class='TEST'></p>"; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function( query, context, extra, seed ) { + context = context || document; + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && !Sizzle.isXML(context) ) { + // See if we find a selector to speed up + var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query ); + + if ( match && (context.nodeType === 1 || context.nodeType === 9) ) { + // Speed-up: Sizzle("TAG") + if ( match[1] ) { + return makeArray( context.getElementsByTagName( query ), extra ); + + // Speed-up: Sizzle(".CLASS") + } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) { + return makeArray( context.getElementsByClassName( match[2] ), extra ); + } + } + + if ( context.nodeType === 9 ) { + // Speed-up: Sizzle("body") + // The body element only exists once, optimize finding it + if ( query === "body" && context.body ) { + return makeArray( [ context.body ], extra ); + + // Speed-up: Sizzle("#ID") + } else if ( match && match[3] ) { + var elem = context.getElementById( match[3] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id === match[3] ) { + return makeArray( [ elem ], extra ); + } + + } else { + return makeArray( [], extra ); + } + } + + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(qsaError) {} + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + var oldContext = context, + old = context.getAttribute( "id" ), + nid = old || id, + hasParent = context.parentNode, + relativeHierarchySelector = /^\s*[+~]/.test( query ); + + if ( !old ) { + context.setAttribute( "id", nid ); + } else { + nid = nid.replace( /'/g, "\\$&" ); + } + if ( relativeHierarchySelector && hasParent ) { + context = context.parentNode; + } + + try { + if ( !relativeHierarchySelector || hasParent ) { + return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra ); + } + + } catch(pseudoError) { + } finally { + if ( !old ) { + oldContext.removeAttribute( "id" ); + } + } + } + } + + return oldSizzle(query, context, extra, seed); + }; + + for ( var prop in oldSizzle ) { + Sizzle[ prop ] = oldSizzle[ prop ]; + } + + // release memory in IE + div = null; + })(); +} + +(function(){ + var html = document.documentElement, + matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector, + pseudoWorks = false; + + try { + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( document.documentElement, "[test!='']:sizzle" ); + + } catch( pseudoError ) { + pseudoWorks = true; + } + + if ( matches ) { + Sizzle.matchesSelector = function( node, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + if ( !Sizzle.isXML( node ) ) { + try { + if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { + return matches.call( node, expr ); + } + } catch(e) {} + } + + return Sizzle(expr, null, null, [node]).length > 0; + }; + } +})(); + +(function(){ + var div = document.createElement("div"); + + div.innerHTML = "<div class='test e'></div><div class='test'></div>"; + + // Opera can't find a second classname (in 9.6) + // Also, make sure that getElementsByClassName actually exists + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) { + return; + } + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function( match, context, isXML ) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; + + // release memory in IE + div = null; +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( elem.nodeName.toLowerCase() === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +if ( document.documentElement.contains ) { + Sizzle.contains = function( a, b ) { + return a !== b && (a.contains ? a.contains(b) : true); + }; + +} else if ( document.documentElement.compareDocumentPosition ) { + Sizzle.contains = function( a, b ) { + return !!(a.compareDocumentPosition(b) & 16); + }; + +} else { + Sizzle.contains = function() { + return false; + }; +} + +Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; + + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +var posProcess = function( selector, context ) { + var match, + tmpSet = [], + later = "", + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})(); + + +var runtil = /Until$/, + rparentsprev = /^(?:parents|prevUntil|prevAll)/, + // Note: This RegExp should be improved, or likely pulled from Sizzle + rmultiselector = /,/, + isSimple = /^.[^:#\[\.,]*$/, + slice = Array.prototype.slice, + POS = jQuery.expr.match.POS, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var ret = this.pushStack( "", "find", selector ), + length = 0; + + for ( var i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( var n = length; n < ret.length; n++ ) { + for ( var r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var targets = jQuery( target ); + return this.filter(function() { + for ( var i = 0, l = targets.length; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && jQuery.filter( selector, this ).length > 0; + }, + + closest: function( selectors, context ) { + var ret = [], i, l, cur = this[0]; + + if ( jQuery.isArray( selectors ) ) { + var match, selector, + matches = {}, + level = 1; + + if ( cur && selectors.length ) { + for ( i = 0, l = selectors.length; i < l; i++ ) { + selector = selectors[i]; + + if ( !matches[selector] ) { + matches[selector] = jQuery.expr.match.POS.test( selector ) ? + jQuery( selector, context || this.context ) : + selector; + } + } + + while ( cur && cur.ownerDocument && cur !== context ) { + for ( selector in matches ) { + match = matches[selector]; + + if ( match.jquery ? match.index(cur) > -1 : jQuery(cur).is(match) ) { + ret.push({ selector: selector, elem: cur, level: level }); + } + } + + cur = cur.parentNode; + level++; + } + } + + return ret; + } + + var pos = POS.test( selectors ) ? + jQuery( selectors, context || this.context ) : null; + + for ( i = 0, l = this.length; i < l; i++ ) { + cur = this[i]; + + while ( cur ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + + } else { + cur = cur.parentNode; + if ( !cur || !cur.ownerDocument || cur === context ) { + break; + } + } + } + } + + ret = ret.length > 1 ? jQuery.unique(ret) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + if ( !elem || typeof elem === "string" ) { + return jQuery.inArray( this[0], + // If it receives a string, the selector is used + // If it receives nothing, the siblings are used + elem ? jQuery( elem ) : this.parent().children() ); + } + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + andSelf: function() { + return this.add( this.prevObject ); + } +}); + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return jQuery.nth( elem, 2, "nextSibling" ); + }, + prev: function( elem ) { + return jQuery.nth( elem, 2, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( elem.parentNode.firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.makeArray( elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ), + // The variable 'args' was introduced in + // https://github.com/jquery/jquery/commit/52a0238 + // to work around a bug in Chrome 10 (Dev) and should be removed when the bug is fixed. + // http://code.google.com/p/v8/issues/detail?id=1050 + args = slice.call(arguments); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, args.join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + nth: function( cur, result, dir, elem ) { + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) { + if ( cur.nodeType === 1 && ++num === result ) { + break; + } + } + + return cur; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return (elem === qualifier) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return (jQuery.inArray( elem, qualifier ) >= 0) === keep; + }); +} + + + + +var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, + rtagName = /<([\w:]+)/, + rtbody = /<tbody/i, + rhtml = /<|&#?\w+;/, + rnocache = /<(?:script|object|embed|option|style)/i, + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + wrapMap = { + option: [ 1, "<select multiple='multiple'>", "</select>" ], + legend: [ 1, "<fieldset>", "</fieldset>" ], + thead: [ 1, "<table>", "</table>" ], + tr: [ 2, "<table><tbody>", "</tbody></table>" ], + td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], + col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ], + area: [ 1, "<map>", "</map>" ], + _default: [ 0, "", "" ] + }; + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE can't serialize <link> and <script> tags normally +if ( !jQuery.support.htmlSerialize ) { + wrapMap._default = [ 1, "div<div>", "</div>" ]; +} + +jQuery.fn.extend({ + text: function( text ) { + if ( jQuery.isFunction(text) ) { + return this.each(function(i) { + var self = jQuery( this ); + + self.text( text.call(this, i, self.text()) ); + }); + } + + if ( typeof text !== "object" && text !== undefined ) { + return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) ); + } + + return jQuery.text( this ); + }, + + wrapAll: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapAll( html.call(this, i) ); + }); + } + + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + + if ( this[0].parentNode ) { + wrap.insertBefore( this[0] ); + } + + wrap.map(function() { + var elem = this; + + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } + + return elem; + }).append(this); + } + + return this; + }, + + wrapInner: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapInner( html.call(this, i) ); + }); + } + + return this.each(function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + }); + }, + + wrap: function( html ) { + return this.each(function() { + jQuery( this ).wrapAll( html ); + }); + }, + + unwrap: function() { + return this.parent().each(function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + }).end(); + }, + + append: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.appendChild( elem ); + } + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.insertBefore( elem, this.firstChild ); + } + }); + }, + + before: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this ); + }); + } else if ( arguments.length ) { + var set = jQuery(arguments[0]); + set.push.apply( set, this.toArray() ); + return this.pushStack( set, "before", arguments ); + } + }, + + after: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + } else if ( arguments.length ) { + var set = this.pushStack( this, "after", arguments ); + set.push.apply( set, jQuery(arguments[0]).toArray() ); + return set; + } + }, + + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { + if ( !keepData && elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + jQuery.cleanData( [ elem ] ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + } + } + + return this; + }, + + empty: function() { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function () { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + }); + }, + + html: function( value ) { + if ( value === undefined ) { + return this[0] && this[0].nodeType === 1 ? + this[0].innerHTML.replace(rinlinejQuery, "") : + null; + + // See if we can take a shortcut and just use innerHTML + } else if ( typeof value === "string" && !rnocache.test( value ) && + (jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) && + !wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) { + + value = value.replace(rxhtmlTag, "<$1></$2>"); + + try { + for ( var i = 0, l = this.length; i < l; i++ ) { + // Remove element nodes and prevent memory leaks + if ( this[i].nodeType === 1 ) { + jQuery.cleanData( this[i].getElementsByTagName("*") ); + this[i].innerHTML = value; + } + } + + // If using innerHTML throws an exception, use the fallback method + } catch(e) { + this.empty().append( value ); + } + + } else if ( jQuery.isFunction( value ) ) { + this.each(function(i){ + var self = jQuery( this ); + + self.html( value.call(this, i, self.html()) ); + }); + + } else { + this.empty().append( value ); + } + + return this; + }, + + replaceWith: function( value ) { + if ( this[0] && this[0].parentNode ) { + // Make sure that the elements are removed from the DOM before they are inserted + // this can help fix replacing a parent with child elements + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this), old = self.html(); + self.replaceWith( value.call( this, i, old ) ); + }); + } + + if ( typeof value !== "string" ) { + value = jQuery( value ).detach(); + } + + return this.each(function() { + var next = this.nextSibling, + parent = this.parentNode; + + jQuery( this ).remove(); + + if ( next ) { + jQuery(next).before( value ); + } else { + jQuery(parent).append( value ); + } + }); + } else { + return this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ); + } + }, + + detach: function( selector ) { + return this.remove( selector, true ); + }, + + domManip: function( args, table, callback ) { + var results, first, fragment, parent, + value = args[0], + scripts = []; + + // We can't cloneNode fragments that contain checked, in WebKit + if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) { + return this.each(function() { + jQuery(this).domManip( args, table, callback, true ); + }); + } + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + args[0] = value.call(this, i, table ? self.html() : undefined); + self.domManip( args, table, callback ); + }); + } + + if ( this[0] ) { + parent = value && value.parentNode; + + // If we're in a fragment, just use that instead of building a new one + if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) { + results = { fragment: parent }; + + } else { + results = jQuery.buildFragment( args, this, scripts ); + } + + fragment = results.fragment; + + if ( fragment.childNodes.length === 1 ) { + first = fragment = fragment.firstChild; + } else { + first = fragment.firstChild; + } + + if ( first ) { + table = table && jQuery.nodeName( first, "tr" ); + + for ( var i = 0, l = this.length, lastIndex = l - 1; i < l; i++ ) { + callback.call( + table ? + root(this[i], first) : + this[i], + // Make sure that we do not leak memory by inadvertently discarding + // the original fragment (which might have attached data) instead of + // using it; in addition, use the original fragment object for the last + // item instead of first because it can end up being emptied incorrectly + // in certain situations (Bug #8070). + // Fragments from the fragment cache must always be cloned and never used + // in place. + results.cacheable || (l > 1 && i < lastIndex) ? + jQuery.clone( fragment, true, true ) : + fragment + ); + } + } + + if ( scripts.length ) { + jQuery.each( scripts, evalScript ); + } + } + + return this; + } +}); + +function root( elem, cur ) { + return jQuery.nodeName(elem, "table") ? + (elem.getElementsByTagName("tbody")[0] || + elem.appendChild(elem.ownerDocument.createElement("tbody"))) : + elem; +} + +function cloneCopyEvent( src, dest ) { + + if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { + return; + } + + var internalKey = jQuery.expando, + oldData = jQuery.data( src ), + curData = jQuery.data( dest, oldData ); + + // Switch to use the internal data object, if it exists, for the next + // stage of data copying + if ( (oldData = oldData[ internalKey ]) ) { + var events = oldData.events; + curData = curData[ internalKey ] = jQuery.extend({}, oldData); + + if ( events ) { + delete curData.handle; + curData.events = {}; + + for ( var type in events ) { + for ( var i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type + ( events[ type ][ i ].namespace ? "." : "" ) + events[ type ][ i ].namespace, events[ type ][ i ], events[ type ][ i ].data ); + } + } + } + } +} + +function cloneFixAttributes(src, dest) { + // We do not need to do anything for non-Elements + if ( dest.nodeType !== 1 ) { + return; + } + + var nodeName = dest.nodeName.toLowerCase(); + + // clearAttributes removes the attributes, which we don't want, + // but also removes the attachEvent events, which we *do* want + dest.clearAttributes(); + + // mergeAttributes, in contrast, only merges back on the + // original attributes, not the events + dest.mergeAttributes(src); + + // IE6-8 fail to clone children inside object elements that use + // the proprietary classid attribute value (rather than the type + // attribute) to identify the type of content to display + if ( nodeName === "object" ) { + dest.outerHTML = src.outerHTML; + + } else if ( nodeName === "input" && (src.type === "checkbox" || src.type === "radio") ) { + // IE6-8 fails to persist the checked state of a cloned checkbox + // or radio button. Worse, IE6-7 fail to give the cloned element + // a checked appearance if the defaultChecked value isn't also set + if ( src.checked ) { + dest.defaultChecked = dest.checked = src.checked; + } + + // IE6-7 get confused and end up setting the value of a cloned + // checkbox/radio button to an empty string instead of "on" + if ( dest.value !== src.value ) { + dest.value = src.value; + } + + // IE6-8 fails to return the selected option to the default selected + // state when cloning options + } else if ( nodeName === "option" ) { + dest.selected = src.defaultSelected; + + // IE6-8 fails to set the defaultValue to the correct value when + // cloning other types of input fields + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } + + // Event data gets referenced instead of copied if the expando + // gets copied too + dest.removeAttribute( jQuery.expando ); +} + +jQuery.buildFragment = function( args, nodes, scripts ) { + var fragment, cacheable, cacheresults, + doc = (nodes && nodes[0] ? nodes[0].ownerDocument || nodes[0] : document); + + // Only cache "small" (1/2 KB) HTML strings that are associated with the main document + // Cloning options loses the selected state, so don't cache them + // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment + // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache + if ( args.length === 1 && typeof args[0] === "string" && args[0].length < 512 && doc === document && + args[0].charAt(0) === "<" && !rnocache.test( args[0] ) && (jQuery.support.checkClone || !rchecked.test( args[0] )) ) { + + cacheable = true; + cacheresults = jQuery.fragments[ args[0] ]; + if ( cacheresults ) { + if ( cacheresults !== 1 ) { + fragment = cacheresults; + } + } + } + + if ( !fragment ) { + fragment = doc.createDocumentFragment(); + jQuery.clean( args, doc, fragment, scripts ); + } + + if ( cacheable ) { + jQuery.fragments[ args[0] ] = cacheresults ? fragment : 1; + } + + return { fragment: fragment, cacheable: cacheable }; +}; + +jQuery.fragments = {}; + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var ret = [], + insert = jQuery( selector ), + parent = this.length === 1 && this[0].parentNode; + + if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) { + insert[ original ]( this[0] ); + return this; + + } else { + for ( var i = 0, l = insert.length; i < l; i++ ) { + var elems = (i > 0 ? this.clone(true) : this).get(); + jQuery( insert[i] )[ original ]( elems ); + ret = ret.concat( elems ); + } + + return this.pushStack( ret, name, insert.selector ); + } + }; +}); + +function getAll( elem ) { + if ( "getElementsByTagName" in elem ) { + return elem.getElementsByTagName( "*" ); + + } else if ( "querySelectorAll" in elem ) { + return elem.querySelectorAll( "*" ); + + } else { + return []; + } +} + +jQuery.extend({ + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var clone = elem.cloneNode(true), + srcElements, + destElements, + i; + + if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) && + (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) { + // IE copies events bound via attachEvent when using cloneNode. + // Calling detachEvent on the clone will also remove the events + // from the original. In order to get around this, we use some + // proprietary methods to clear the events. Thanks to MooTools + // guys for this hotness. + + cloneFixAttributes( elem, clone ); + + // Using Sizzle here is crazy slow, so we use getElementsByTagName + // instead + srcElements = getAll( elem ); + destElements = getAll( clone ); + + // Weird iteration because IE will replace the length property + // with an element if you are cloning the body and one of the + // elements on the page has a name or id of "length" + for ( i = 0; srcElements[i]; ++i ) { + cloneFixAttributes( srcElements[i], destElements[i] ); + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + cloneCopyEvent( elem, clone ); + + if ( deepDataAndEvents ) { + srcElements = getAll( elem ); + destElements = getAll( clone ); + + for ( i = 0; srcElements[i]; ++i ) { + cloneCopyEvent( srcElements[i], destElements[i] ); + } + } + } + + // Return the cloned set + return clone; +}, + clean: function( elems, context, fragment, scripts ) { + context = context || document; + + // !context.createElement fails in IE with an error but returns typeof 'object' + if ( typeof context.createElement === "undefined" ) { + context = context.ownerDocument || context[0] && context[0].ownerDocument || document; + } + + var ret = []; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( typeof elem === "number" ) { + elem += ""; + } + + if ( !elem ) { + continue; + } + + // Convert html string into DOM nodes + if ( typeof elem === "string" && !rhtml.test( elem ) ) { + elem = context.createTextNode( elem ); + + } else if ( typeof elem === "string" ) { + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(rxhtmlTag, "<$1></$2>"); + + // Trim whitespace, otherwise indexOf won't work as expected + var tag = (rtagName.exec( elem ) || ["", ""])[1].toLowerCase(), + wrap = wrapMap[ tag ] || wrapMap._default, + depth = wrap[0], + div = context.createElement("div"); + + // Go to html and back, then peel off extra wrappers + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( depth-- ) { + div = div.lastChild; + } + + // Remove IE's autoinserted <tbody> from table fragments + if ( !jQuery.support.tbody ) { + + // String was a <table>, *may* have spurious <tbody> + var hasBody = rtbody.test(elem), + tbody = tag === "table" && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare <thead> or <tfoot> + wrap[1] === "<table>" && !hasBody ? + div.childNodes : + []; + + for ( var j = tbody.length - 1; j >= 0 ; --j ) { + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + } + } + + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); + } + + elem = div.childNodes; + } + + if ( elem.nodeType ) { + ret.push( elem ); + } else { + ret = jQuery.merge( ret, elem ); + } + } + + if ( fragment ) { + for ( i = 0; ret[i]; i++ ) { + if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) { + scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] ); + + } else { + if ( ret[i].nodeType === 1 ) { + ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) ); + } + fragment.appendChild( ret[i] ); + } + } + } + + return ret; + }, + + cleanData: function( elems ) { + var data, id, cache = jQuery.cache, internalKey = jQuery.expando, special = jQuery.event.special, + deleteExpando = jQuery.support.deleteExpando; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) { + continue; + } + + id = elem[ jQuery.expando ]; + + if ( id ) { + data = cache[ id ] && cache[ id ][ internalKey ]; + + if ( data && data.events ) { + for ( var type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + + // Null the DOM reference to avoid IE6/7/8 leak (#7054) + if ( data.handle ) { + data.handle.elem = null; + } + } + + if ( deleteExpando ) { + delete elem[ jQuery.expando ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } + + delete cache[ id ]; + } + } + } +}); + +function evalScript( i, elem ) { + if ( elem.src ) { + jQuery.ajax({ + url: elem.src, + async: false, + dataType: "script" + }); + } else { + jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } +} + + + + +var ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity=([^)]*)/, + rdashAlpha = /-([a-z])/ig, + rupper = /([A-Z])/g, + rnumpx = /^-?\d+(?:px)?$/i, + rnum = /^-?\d/, + + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssWidth = [ "Left", "Right" ], + cssHeight = [ "Top", "Bottom" ], + curCSS, + + getComputedStyle, + currentStyle, + + fcamelCase = function( all, letter ) { + return letter.toUpperCase(); + }; + +jQuery.fn.css = function( name, value ) { + // Setting 'undefined' is a no-op + if ( arguments.length === 2 && value === undefined ) { + return this; + } + + return jQuery.access( this, name, value, true, function( elem, name, value ) { + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }); +}; + +jQuery.extend({ + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity", "opacity" ); + return ret === "" ? "1" : ret; + + } else { + return elem.style.opacity; + } + } + } + }, + + // Exclude the following css properties to add px + cssNumber: { + "zIndex": true, + "fontWeight": true, + "opacity": true, + "zoom": true, + "lineHeight": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { + // normalize float css property + "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" + }, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, origName = jQuery.camelCase( name ), + style = elem.style, hooks = jQuery.cssHooks[ origName ]; + + name = jQuery.cssProps[ origName ] || origName; + + // Check if we're setting a value + if ( value !== undefined ) { + // Make sure that NaN and null values aren't set. See: #7116 + if ( typeof value === "number" && isNaN( value ) || value == null ) { + return; + } + + // If a number was passed in, add 'px' to the (except for certain CSS properties) + if ( typeof value === "number" && !jQuery.cssNumber[ origName ] ) { + value += "px"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) { + // Wrapped to prevent IE from throwing errors when 'invalid' values are provided + // Fixes bug #5509 + try { + style[ name ] = value; + } catch(e) {} + } + + } else { + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra ) { + // Make sure that we're working with the right name + var ret, origName = jQuery.camelCase( name ), + hooks = jQuery.cssHooks[ origName ]; + + name = jQuery.cssProps[ origName ] || origName; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) { + return ret; + + // Otherwise, if a way to get the computed value exists, use that + } else if ( curCSS ) { + return curCSS( elem, name, origName ); + } + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var old = {}; + + // Remember the old values, and insert the new ones + for ( var name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + }, + + camelCase: function( string ) { + return string.replace( rdashAlpha, fcamelCase ); + } +}); + +// DEPRECATED, Use jQuery.css() instead +jQuery.curCSS = jQuery.css; + +jQuery.each(["height", "width"], function( i, name ) { + jQuery.cssHooks[ name ] = { + get: function( elem, computed, extra ) { + var val; + + if ( computed ) { + if ( elem.offsetWidth !== 0 ) { + val = getWH( elem, name, extra ); + + } else { + jQuery.swap( elem, cssShow, function() { + val = getWH( elem, name, extra ); + }); + } + + if ( val <= 0 ) { + val = curCSS( elem, name, name ); + + if ( val === "0px" && currentStyle ) { + val = currentStyle( elem, name, name ); + } + + if ( val != null ) { + // Should return "auto" instead of 0, use 0 for + // temporary backwards-compat + return val === "" || val === "auto" ? "0px" : val; + } + } + + if ( val < 0 || val == null ) { + val = elem.style[ name ]; + + // Should return "auto" instead of 0, use 0 for + // temporary backwards-compat + return val === "" || val === "auto" ? "0px" : val; + } + + return typeof val === "string" ? val : val + "px"; + } + }, + + set: function( elem, value ) { + if ( rnumpx.test( value ) ) { + // ignore negative width and height values #1599 + value = parseFloat(value); + + if ( value >= 0 ) { + return value + "px"; + } + + } else { + return value; + } + } + }; +}); + +if ( !jQuery.support.opacity ) { + jQuery.cssHooks.opacity = { + get: function( elem, computed ) { + // IE uses filters for opacity + return ropacity.test((computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "") ? + (parseFloat(RegExp.$1) / 100) + "" : + computed ? "1" : ""; + }, + + set: function( elem, value ) { + var style = elem.style; + + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + style.zoom = 1; + + // Set the alpha filter to set the opacity + var opacity = jQuery.isNaN(value) ? + "" : + "alpha(opacity=" + value * 100 + ")", + filter = style.filter || ""; + + style.filter = ralpha.test(filter) ? + filter.replace(ralpha, opacity) : + style.filter + ' ' + opacity; + } + }; +} + +if ( document.defaultView && document.defaultView.getComputedStyle ) { + getComputedStyle = function( elem, newName, name ) { + var ret, defaultView, computedStyle; + + name = name.replace( rupper, "-$1" ).toLowerCase(); + + if ( !(defaultView = elem.ownerDocument.defaultView) ) { + return undefined; + } + + if ( (computedStyle = defaultView.getComputedStyle( elem, null )) ) { + ret = computedStyle.getPropertyValue( name ); + if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { + ret = jQuery.style( elem, name ); + } + } + + return ret; + }; +} + +if ( document.documentElement.currentStyle ) { + currentStyle = function( elem, name ) { + var left, + ret = elem.currentStyle && elem.currentStyle[ name ], + rsLeft = elem.runtimeStyle && elem.runtimeStyle[ name ], + style = elem.style; + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + if ( !rnumpx.test( ret ) && rnum.test( ret ) ) { + // Remember the original values + left = style.left; + + // Put in the new values to get a computed value out + if ( rsLeft ) { + elem.runtimeStyle.left = elem.currentStyle.left; + } + style.left = name === "fontSize" ? "1em" : (ret || 0); + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + if ( rsLeft ) { + elem.runtimeStyle.left = rsLeft; + } + } + + return ret === "" ? "auto" : ret; + }; +} + +curCSS = getComputedStyle || currentStyle; + +function getWH( elem, name, extra ) { + var which = name === "width" ? cssWidth : cssHeight, + val = name === "width" ? elem.offsetWidth : elem.offsetHeight; + + if ( extra === "border" ) { + return val; + } + + jQuery.each( which, function() { + if ( !extra ) { + val -= parseFloat(jQuery.css( elem, "padding" + this )) || 0; + } + + if ( extra === "margin" ) { + val += parseFloat(jQuery.css( elem, "margin" + this )) || 0; + + } else { + val -= parseFloat(jQuery.css( elem, "border" + this + "Width" )) || 0; + } + }); + + return val; +} + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.hidden = function( elem ) { + var width = elem.offsetWidth, + height = elem.offsetHeight; + + return (width === 0 && height === 0) || (!jQuery.support.reliableHiddenOffsets && (elem.style.display || jQuery.css( elem, "display" )) === "none"); + }; + + jQuery.expr.filters.visible = function( elem ) { + return !jQuery.expr.filters.hidden( elem ); + }; +} + + + + +var r20 = /%20/g, + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rhash = /#.*$/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL + rinput = /^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /(?:^file|^widget|\-extension):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + rquery = /\?/, + rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, + rselectTextarea = /^(?:select|textarea)/i, + rspacesAjax = /\s+/, + rts = /([?&])_=[^&]*/, + rucHeaders = /(^|\-)([a-z])/g, + rucHeadersFunc = function( _, $1, $2 ) { + return $1 + $2.toUpperCase(); + }, + rurl = /^([\w\+\.\-]+:)\/\/([^\/?#:]*)(?::(\d+))?/, + + // Keep a copy of the old load method + _load = jQuery.fn.load, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Document location + ajaxLocation, + + // Document location segments + ajaxLocParts; + +// #8138, IE may throw an exception when accessing +// a field from document.location if document.domain has been set +try { + ajaxLocation = document.location.href; +} catch( e ) { + // Use the href attribute of an A element + // since IE will modify it given document.location + ajaxLocation = document.createElement( "a" ); + ajaxLocation.href = ""; + ajaxLocation = ajaxLocation.href; +} + +// Segment location into parts +ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ); + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + if ( jQuery.isFunction( func ) ) { + var dataTypes = dataTypeExpression.toLowerCase().split( rspacesAjax ), + i = 0, + length = dataTypes.length, + dataType, + list, + placeBefore; + + // For each dataType in the dataTypeExpression + for(; i < length; i++ ) { + dataType = dataTypes[ i ]; + // We control if we're asked to add before + // any existing element + placeBefore = /^\+/.test( dataType ); + if ( placeBefore ) { + dataType = dataType.substr( 1 ) || "*"; + } + list = structure[ dataType ] = structure[ dataType ] || []; + // then we add to the structure accordingly + list[ placeBefore ? "unshift" : "push" ]( func ); + } + } + }; +} + +//Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR, + dataType /* internal */, inspected /* internal */ ) { + + dataType = dataType || options.dataTypes[ 0 ]; + inspected = inspected || {}; + + inspected[ dataType ] = true; + + var list = structure[ dataType ], + i = 0, + length = list ? list.length : 0, + executeOnly = ( structure === prefilters ), + selection; + + for(; i < length && ( executeOnly || !selection ); i++ ) { + selection = list[ i ]( options, originalOptions, jqXHR ); + // If we got redirected to another dataType + // we try there if executing only and not done already + if ( typeof selection === "string" ) { + if ( !executeOnly || inspected[ selection ] ) { + selection = undefined; + } else { + options.dataTypes.unshift( selection ); + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, selection, inspected ); + } + } + } + // If we're only executing or nothing was selected + // we try the catchall dataType if not done already + if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) { + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, "*", inspected ); + } + // unnecessary when only executing (prefilters) + // but it'll be ignored by the caller in that case + return selection; +} + +jQuery.fn.extend({ + load: function( url, params, callback ) { + if ( typeof url !== "string" && _load ) { + return _load.apply( this, arguments ); + + // Don't do a request if no elements are being requested + } else if ( !this.length ) { + return this; + } + + var off = url.indexOf( " " ); + if ( off >= 0 ) { + var selector = url.slice( off, url.length ); + url = url.slice( 0, off ); + } + + // Default to a GET request + var type = "GET"; + + // If the second parameter was provided + if ( params ) { + // If it's a function + if ( jQuery.isFunction( params ) ) { + // We assume that it's the callback + callback = params; + params = undefined; + + // Otherwise, build a param string + } else if ( typeof params === "object" ) { + params = jQuery.param( params, jQuery.ajaxSettings.traditional ); + type = "POST"; + } + } + + var self = this; + + // Request the remote document + jQuery.ajax({ + url: url, + type: type, + dataType: "html", + data: params, + // Complete callback (responseText is used internally) + complete: function( jqXHR, status, responseText ) { + // Store the response as specified by the jqXHR object + responseText = jqXHR.responseText; + // If successful, inject the HTML into all the matched elements + if ( jqXHR.isResolved() ) { + // #4825: Get the actual response in case + // a dataFilter is present in ajaxSettings + jqXHR.done(function( r ) { + responseText = r; + }); + // See if a selector was specified + self.html( selector ? + // Create a dummy div to hold the results + jQuery("<div>") + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append(responseText.replace(rscript, "")) + + // Locate the specified elements + .find(selector) : + + // If not, just inject the full result + responseText ); + } + + if ( callback ) { + self.each( callback, [ responseText, status, jqXHR ] ); + } + } + }); + + return this; + }, + + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + + serializeArray: function() { + return this.map(function(){ + return this.elements ? jQuery.makeArray( this.elements ) : this; + }) + .filter(function(){ + return this.name && !this.disabled && + ( this.checked || rselectTextarea.test( this.nodeName ) || + rinput.test( this.type ) ); + }) + .map(function( i, elem ){ + var val = jQuery( this ).val(); + + return val == null ? + null : + jQuery.isArray( val ) ? + jQuery.map( val, function( val, i ){ + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }) : + { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }).get(); + } +}); + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){ + jQuery.fn[ o ] = function( f ){ + return this.bind( o, f ); + }; +} ); + +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + // shift arguments if data argument was omitted + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + return jQuery.ajax({ + type: method, + url: url, + data: data, + success: callback, + dataType: type + }); + }; +} ); + +jQuery.extend({ + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function ( target, settings ) { + if ( !settings ) { + // Only one parameter, we extend ajaxSettings + settings = target; + target = jQuery.extend( true, jQuery.ajaxSettings, settings ); + } else { + // target was provided, we extend into it + jQuery.extend( true, target, jQuery.ajaxSettings, settings ); + } + // Flatten fields we don't want deep extended + for( var field in { context: 1, url: 1 } ) { + if ( field in settings ) { + target[ field ] = settings[ field ]; + } else if( field in jQuery.ajaxSettings ) { + target[ field ] = jQuery.ajaxSettings[ field ]; + } + } + return target; + }, + + ajaxSettings: { + url: ajaxLocation, + isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ), + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded", + processData: true, + async: true, + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + traditional: false, + headers: {}, + crossDomain: null, + */ + + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + text: "text/plain", + json: "application/json, text/javascript", + "*": "*/*" + }, + + contents: { + xml: /xml/, + html: /html/, + json: /json/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText" + }, + + // List of data converters + // 1) key format is "source_type destination_type" (a single space in-between) + // 2) the catchall symbol "*" can be used for source_type + converters: { + + // Convert anything to text + "* text": window.String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": jQuery.parseJSON, + + // Parse text as xml + "text xml": jQuery.parseXML + } + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + // Callbacks context + callbackContext = s.context || s, + // Context for global events + // It's the callbackContext if one was provided in the options + // and if it's a DOM node or a jQuery collection + globalEventContext = callbackContext !== s && + ( callbackContext.nodeType || callbackContext instanceof jQuery ) ? + jQuery( callbackContext ) : jQuery.event, + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery._Deferred(), + // Status-dependent callbacks + statusCode = s.statusCode || {}, + // ifModified key + ifModifiedKey, + // Headers (they are sent all at once) + requestHeaders = {}, + // Response headers + responseHeadersString, + responseHeaders, + // transport + transport, + // timeout handle + timeoutTimer, + // Cross-domain detection vars + parts, + // The jqXHR state + state = 0, + // To know if global events are to be dispatched + fireGlobals, + // Loop variable + i, + // Fake xhr + jqXHR = { + + readyState: 0, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( !state ) { + requestHeaders[ name.toLowerCase().replace( rucHeaders, rucHeadersFunc ) ] = value; + } + return this; + }, + + // Raw string + getAllResponseHeaders: function() { + return state === 2 ? responseHeadersString : null; + }, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( state === 2 ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[1].toLowerCase() ] = match[ 2 ]; + } + } + match = responseHeaders[ key.toLowerCase() ]; + } + return match === undefined ? null : match; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( !state ) { + s.mimeType = type; + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + statusText = statusText || "abort"; + if ( transport ) { + transport.abort( statusText ); + } + done( 0, statusText ); + return this; + } + }; + + // Callback for when everything is done + // It is defined here because jslint complains if it is declared + // at the end of the function (which would be more logical and readable) + function done( status, statusText, responses, headers ) { + + // Called once + if ( state === 2 ) { + return; + } + + // State is "done" now + state = 2; + + // Clear timeout if it exists + if ( timeoutTimer ) { + clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status ? 4 : 0; + + var isSuccess, + success, + error, + response = responses ? ajaxHandleResponses( s, jqXHR, responses ) : undefined, + lastModified, + etag; + + // If successful, handle type chaining + if ( status >= 200 && status < 300 || status === 304 ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + + if ( ( lastModified = jqXHR.getResponseHeader( "Last-Modified" ) ) ) { + jQuery.lastModified[ ifModifiedKey ] = lastModified; + } + if ( ( etag = jqXHR.getResponseHeader( "Etag" ) ) ) { + jQuery.etag[ ifModifiedKey ] = etag; + } + } + + // If not modified + if ( status === 304 ) { + + statusText = "notmodified"; + isSuccess = true; + + // If we have data + } else { + + try { + success = ajaxConvert( s, response ); + statusText = "success"; + isSuccess = true; + } catch(e) { + // We have a parsererror + statusText = "parsererror"; + error = e; + } + } + } else { + // We extract error from statusText + // then normalize statusText and status for non-aborts + error = statusText; + if( !statusText || status ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = statusText; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ), + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.resolveWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s] ); + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + // Attach deferreds + deferred.promise( jqXHR ); + jqXHR.success = jqXHR.done; + jqXHR.error = jqXHR.fail; + jqXHR.complete = completeDeferred.done; + + // Status-dependent callbacks + jqXHR.statusCode = function( map ) { + if ( map ) { + var tmp; + if ( state < 2 ) { + for( tmp in map ) { + statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ]; + } + } else { + tmp = map[ jqXHR.status ]; + jqXHR.then( tmp, tmp ); + } + } + return this; + }; + + // Remove hash character (#7531: and string promotion) + // Add protocol if not provided (#5866: IE7 issue with protocol-less urls) + // We also use the url parameter if available + s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" ); + + // Extract dataTypes list + s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( rspacesAjax ); + + // Determine if a cross-domain request is in order + if ( !s.crossDomain ) { + parts = rurl.exec( s.url.toLowerCase() ); + s.crossDomain = !!( parts && + ( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] || + ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) != + ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) ) + ); + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefiler, stop there + if ( state === 2 ) { + return false; + } + + // We can fire global events as of now if asked to + fireGlobals = s.global; + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // If data is available, append data to url + if ( s.data ) { + s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data; + } + + // Get ifModifiedKey before adding the anti-cache parameter + ifModifiedKey = s.url; + + // Add anti-cache in url if needed + if ( s.cache === false ) { + + var ts = jQuery.now(), + // try replacing _= if it is there + ret = s.url.replace( rts, "$1_=" + ts ); + + // if nothing was replaced, add timestamp to the end + s.url = ret + ( (ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + requestHeaders[ "Content-Type" ] = s.contentType; + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + ifModifiedKey = ifModifiedKey || s.url; + if ( jQuery.lastModified[ ifModifiedKey ] ) { + requestHeaders[ "If-Modified-Since" ] = jQuery.lastModified[ ifModifiedKey ]; + } + if ( jQuery.etag[ ifModifiedKey ] ) { + requestHeaders[ "If-None-Match" ] = jQuery.etag[ ifModifiedKey ]; + } + } + + // Set the Accepts header for the server, depending on the dataType + requestHeaders.Accept = s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ? + s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", */*; q=0.01" : "" ) : + s.accepts[ "*" ]; + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) { + // Abort if not done already + jqXHR.abort(); + return false; + + } + + // Install callbacks on deferreds + for ( i in { success: 1, error: 1, complete: 1 } ) { + jqXHR[ i ]( s[ i ] ); + } + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = setTimeout( function(){ + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + state = 1; + transport.send( requestHeaders, done ); + } catch (e) { + // Propagate exception as error if not done + if ( status < 2 ) { + done( -1, e ); + // Simply rethrow otherwise + } else { + jQuery.error( e ); + } + } + } + + return jqXHR; + }, + + // Serialize an array of form elements or a set of + // key/values into a query string + param: function( a, traditional ) { + var s = [], + add = function( key, value ) { + // If value is a function, invoke it and return its value + value = jQuery.isFunction( value ) ? value() : value; + s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value ); + }; + + // Set traditional to true for jQuery <= 1.3.2 behavior. + if ( traditional === undefined ) { + traditional = jQuery.ajaxSettings.traditional; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + } ); + + } else { + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( var prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ).replace( r20, "+" ); + } +}); + +function buildParams( prefix, obj, traditional, add ) { + if ( jQuery.isArray( obj ) && obj.length ) { + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + // If array item is non-scalar (array or object), encode its + // numeric index to resolve deserialization ambiguity issues. + // Note that rack (as of 1.0.0) can't currently deserialize + // nested arrays properly, and attempting to do so may cause + // a server error. Possible fixes are to modify rack's + // deserialization algorithm or to provide an option or flag + // to force array serialization to be shallow. + buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add ); + } + }); + + } else if ( !traditional && obj != null && typeof obj === "object" ) { + // If we see an array here, it is empty and should be treated as an empty + // object + if ( jQuery.isArray( obj ) || jQuery.isEmptyObject( obj ) ) { + add( prefix, "" ); + + // Serialize object item. + } else { + for ( var name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + } + + } else { + // Serialize scalar item. + add( prefix, obj ); + } +} + +// This is still on the jQuery object... for now +// Want to move this to jQuery.ajax some day +jQuery.extend({ + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {} + +}); + +/* Handles responses to an ajax request: + * - sets all responseXXX fields accordingly + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var contents = s.contents, + dataTypes = s.dataTypes, + responseFields = s.responseFields, + ct, + type, + finalDataType, + firstDataType; + + // Fill responseXXX fields + for( type in responseFields ) { + if ( type in responses ) { + jqXHR[ responseFields[type] ] = responses[ type ]; + } + } + + // Remove auto dataType and get content-type in the process + while( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "content-type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +// Chain conversions given the request and the original response +function ajaxConvert( s, response ) { + + // Apply the dataFilter if provided + if ( s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + var dataTypes = s.dataTypes, + converters = {}, + i, + key, + length = dataTypes.length, + tmp, + // Current and previous dataTypes + current = dataTypes[ 0 ], + prev, + // Conversion expression + conversion, + // Conversion function + conv, + // Conversion functions (transitive conversion) + conv1, + conv2; + + // For each dataType in the chain + for( i = 1; i < length; i++ ) { + + // Create converters map + // with lowercased keys + if ( i === 1 ) { + for( key in s.converters ) { + if( typeof key === "string" ) { + converters[ key.toLowerCase() ] = s.converters[ key ]; + } + } + } + + // Get the dataTypes + prev = current; + current = dataTypes[ i ]; + + // If current is auto dataType, update it to prev + if( current === "*" ) { + current = prev; + // If no auto and dataTypes are actually different + } else if ( prev !== "*" && prev !== current ) { + + // Get the converter + conversion = prev + " " + current; + conv = converters[ conversion ] || converters[ "* " + current ]; + + // If there is no direct converter, search transitively + if ( !conv ) { + conv2 = undefined; + for( conv1 in converters ) { + tmp = conv1.split( " " ); + if ( tmp[ 0 ] === prev || tmp[ 0 ] === "*" ) { + conv2 = converters[ tmp[1] + " " + current ]; + if ( conv2 ) { + conv1 = converters[ conv1 ]; + if ( conv1 === true ) { + conv = conv2; + } else if ( conv2 === true ) { + conv = conv1; + } + break; + } + } + } + } + // If we found no converter, dispatch an error + if ( !( conv || conv2 ) ) { + jQuery.error( "No conversion from " + conversion.replace(" "," to ") ); + } + // If found converter is not an equivalence + if ( conv !== true ) { + // Convert with 1 or 2 converters accordingly + response = conv ? conv( response ) : conv2( conv1(response) ); + } + } + } + return response; +} + + + + +var jsc = jQuery.now(), + jsre = /(\=)\?(&|$)|()\?\?()/i; + +// Default jsonp settings +jQuery.ajaxSetup({ + jsonp: "callback", + jsonpCallback: function() { + return jQuery.expando + "_" + ( jsc++ ); + } +}); + +// Detect, normalize options and install callbacks for jsonp requests +jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { + + var dataIsString = ( typeof s.data === "string" ); + + if ( s.dataTypes[ 0 ] === "jsonp" || + originalSettings.jsonpCallback || + originalSettings.jsonp != null || + s.jsonp !== false && ( jsre.test( s.url ) || + dataIsString && jsre.test( s.data ) ) ) { + + var responseContainer, + jsonpCallback = s.jsonpCallback = + jQuery.isFunction( s.jsonpCallback ) ? s.jsonpCallback() : s.jsonpCallback, + previous = window[ jsonpCallback ], + url = s.url, + data = s.data, + replace = "$1" + jsonpCallback + "$2", + cleanUp = function() { + // Set callback back to previous value + window[ jsonpCallback ] = previous; + // Call if it was a function and we have a response + if ( responseContainer && jQuery.isFunction( previous ) ) { + window[ jsonpCallback ]( responseContainer[ 0 ] ); + } + }; + + if ( s.jsonp !== false ) { + url = url.replace( jsre, replace ); + if ( s.url === url ) { + if ( dataIsString ) { + data = data.replace( jsre, replace ); + } + if ( s.data === data ) { + // Add callback manually + url += (/\?/.test( url ) ? "&" : "?") + s.jsonp + "=" + jsonpCallback; + } + } + } + + s.url = url; + s.data = data; + + // Install callback + window[ jsonpCallback ] = function( response ) { + responseContainer = [ response ]; + }; + + // Install cleanUp function + jqXHR.then( cleanUp, cleanUp ); + + // Use data converter to retrieve json after script execution + s.converters["script json"] = function() { + if ( !responseContainer ) { + jQuery.error( jsonpCallback + " was not called" ); + } + return responseContainer[ 0 ]; + }; + + // force json dataType + s.dataTypes[ 0 ] = "json"; + + // Delegate to script + return "script"; + } +} ); + + + + +// Install script dataType +jQuery.ajaxSetup({ + accepts: { + script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /javascript|ecmascript/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +}); + +// Handle cache's special case and global +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + s.global = false; + } +} ); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function(s) { + + // This transport only deals with cross domain requests + if ( s.crossDomain ) { + + var script, + head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement; + + return { + + send: function( _, callback ) { + + script = document.createElement( "script" ); + + script.async = "async"; + + if ( s.scriptCharset ) { + script.charset = s.scriptCharset; + } + + script.src = s.url; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function( _, isAbort ) { + + if ( !script.readyState || /loaded|complete/.test( script.readyState ) ) { + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + + // Remove the script + if ( head && script.parentNode ) { + head.removeChild( script ); + } + + // Dereference the script + script = undefined; + + // Callback if not abort + if ( !isAbort ) { + callback( 200, "success" ); + } + } + }; + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709 and #4378). + head.insertBefore( script, head.firstChild ); + }, + + abort: function() { + if ( script ) { + script.onload( 0, 1 ); + } + } + }; + } +} ); + + + + +var // #5280: next active xhr id and list of active xhrs' callbacks + xhrId = jQuery.now(), + xhrCallbacks, + + // XHR used to determine supports properties + testXHR; + +// #5280: Internet Explorer will keep connections alive if we don't abort on unload +function xhrOnUnloadAbort() { + jQuery( window ).unload(function() { + // Abort all pending requests + for ( var key in xhrCallbacks ) { + xhrCallbacks[ key ]( 0, 1 ); + } + }); +} + +// Functions to create xhrs +function createStandardXHR() { + try { + return new window.XMLHttpRequest(); + } catch( e ) {} +} + +function createActiveXHR() { + try { + return new window.ActiveXObject( "Microsoft.XMLHTTP" ); + } catch( e ) {} +} + +// Create the request object +// (This is still attached to ajaxSettings for backward compatibility) +jQuery.ajaxSettings.xhr = window.ActiveXObject ? + /* Microsoft failed to properly + * implement the XMLHttpRequest in IE7 (can't request local files), + * so we use the ActiveXObject when it is available + * Additionally XMLHttpRequest can be disabled in IE7/IE8 so + * we need a fallback. + */ + function() { + return !this.isLocal && createStandardXHR() || createActiveXHR(); + } : + // For all other browsers, use the standard XMLHttpRequest object + createStandardXHR; + +// Test if we can create an xhr object +testXHR = jQuery.ajaxSettings.xhr(); +jQuery.support.ajax = !!testXHR; + +// Does this browser support crossDomain XHR requests +jQuery.support.cors = testXHR && ( "withCredentials" in testXHR ); + +// No need for the temporary xhr anymore +testXHR = undefined; + +// Create transport if the browser can provide an xhr +if ( jQuery.support.ajax ) { + + jQuery.ajaxTransport(function( s ) { + // Cross domain only allowed if supported through XMLHttpRequest + if ( !s.crossDomain || jQuery.support.cors ) { + + var callback; + + return { + send: function( headers, complete ) { + + // Get a new xhr + var xhr = s.xhr(), + handle, + i; + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if ( s.username ) { + xhr.open( s.type, s.url, s.async, s.username, s.password ); + } else { + xhr.open( s.type, s.url, s.async ); + } + + // Apply custom fields if provided + if ( s.xhrFields ) { + for ( i in s.xhrFields ) { + xhr[ i ] = s.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( s.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( s.mimeType ); + } + + // Requested-With header + // Not set for crossDomain requests with no content + // (see why at http://trac.dojotoolkit.org/ticket/9486) + // Won't change header if already provided + if ( !( s.crossDomain && !s.hasContent ) && !headers["X-Requested-With"] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + } catch( _ ) {} + + // Do send the request + // This may raise an exception which is actually + // handled in jQuery.ajax (so no try/catch here) + xhr.send( ( s.hasContent && s.data ) || null ); + + // Listener + callback = function( _, isAbort ) { + + var status, + statusText, + responseHeaders, + responses, + xml; + + // Firefox throws exceptions when accessing properties + // of an xhr when a network error occured + // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE) + try { + + // Was never called and is aborted or complete + if ( callback && ( isAbort || xhr.readyState === 4 ) ) { + + // Only called once + callback = undefined; + + // Do not keep as active anymore + if ( handle ) { + xhr.onreadystatechange = jQuery.noop; + delete xhrCallbacks[ handle ]; + } + + // If it's an abort + if ( isAbort ) { + // Abort it manually if needed + if ( xhr.readyState !== 4 ) { + xhr.abort(); + } + } else { + status = xhr.status; + responseHeaders = xhr.getAllResponseHeaders(); + responses = {}; + xml = xhr.responseXML; + + // Construct response list + if ( xml && xml.documentElement /* #4958 */ ) { + responses.xml = xml; + } + responses.text = xhr.responseText; + + // Firefox throws an exception when accessing + // statusText for faulty cross-domain requests + try { + statusText = xhr.statusText; + } catch( e ) { + // We normalize with Webkit giving an empty statusText + statusText = ""; + } + + // Filter status for non standard behaviors + + // If the request is local and we have data: assume a success + // (success with no data won't get notified, that's the best we + // can do given current implementations) + if ( !status && s.isLocal && !s.crossDomain ) { + status = responses.text ? 200 : 404; + // IE - #1450: sometimes returns 1223 when it should be 204 + } else if ( status === 1223 ) { + status = 204; + } + } + } + } catch( firefoxAccessException ) { + if ( !isAbort ) { + complete( -1, firefoxAccessException ); + } + } + + // Call complete if needed + if ( responses ) { + complete( status, statusText, responses, responseHeaders ); + } + }; + + // if we're in sync mode or it's in cache + // and has been retrieved directly (IE6 & IE7) + // we need to manually fire the callback + if ( !s.async || xhr.readyState === 4 ) { + callback(); + } else { + // Create the active xhrs callbacks list if needed + // and attach the unload handler + if ( !xhrCallbacks ) { + xhrCallbacks = {}; + xhrOnUnloadAbort(); + } + // Add to list of active xhrs callbacks + handle = xhrId++; + xhr.onreadystatechange = xhrCallbacks[ handle ] = callback; + } + }, + + abort: function() { + if ( callback ) { + callback(0,1); + } + } + }; + } + }); +} + + + + +var elemdisplay = {}, + rfxtypes = /^(?:toggle|show|hide)$/, + rfxnum = /^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i, + timerId, + fxAttrs = [ + // height animations + [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ], + // width animations + [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ], + // opacity animations + [ "opacity" ] + ]; + +jQuery.fn.extend({ + show: function( speed, easing, callback ) { + var elem, display; + + if ( speed || speed === 0 ) { + return this.animate( genFx("show", 3), speed, easing, callback); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + elem = this[i]; + display = elem.style.display; + + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !jQuery._data(elem, "olddisplay") && display === "none" ) { + display = elem.style.display = ""; + } + + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( display === "" && jQuery.css( elem, "display" ) === "none" ) { + jQuery._data(elem, "olddisplay", defaultDisplay(elem.nodeName)); + } + } + + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + elem = this[i]; + display = elem.style.display; + + if ( display === "" || display === "none" ) { + elem.style.display = jQuery._data(elem, "olddisplay") || ""; + } + } + + return this; + } + }, + + hide: function( speed, easing, callback ) { + if ( speed || speed === 0 ) { + return this.animate( genFx("hide", 3), speed, easing, callback); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + var display = jQuery.css( this[i], "display" ); + + if ( display !== "none" && !jQuery._data( this[i], "olddisplay" ) ) { + jQuery._data( this[i], "olddisplay", display ); + } + } + + // Set the display of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + this[i].style.display = "none"; + } + + return this; + } + }, + + // Save the old toggle function + _toggle: jQuery.fn.toggle, + + toggle: function( fn, fn2, callback ) { + var bool = typeof fn === "boolean"; + + if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) { + this._toggle.apply( this, arguments ); + + } else if ( fn == null || bool ) { + this.each(function() { + var state = bool ? fn : jQuery(this).is(":hidden"); + jQuery(this)[ state ? "show" : "hide" ](); + }); + + } else { + this.animate(genFx("toggle", 3), fn, fn2, callback); + } + + return this; + }, + + fadeTo: function( speed, to, easing, callback ) { + return this.filter(":hidden").css("opacity", 0).show().end() + .animate({opacity: to}, speed, easing, callback); + }, + + animate: function( prop, speed, easing, callback ) { + var optall = jQuery.speed(speed, easing, callback); + + if ( jQuery.isEmptyObject( prop ) ) { + return this.each( optall.complete ); + } + + return this[ optall.queue === false ? "each" : "queue" ](function() { + // XXX 'this' does not always have a nodeName when running the + // test suite + + var opt = jQuery.extend({}, optall), p, + isElement = this.nodeType === 1, + hidden = isElement && jQuery(this).is(":hidden"), + self = this; + + for ( p in prop ) { + var name = jQuery.camelCase( p ); + + if ( p !== name ) { + prop[ name ] = prop[ p ]; + delete prop[ p ]; + p = name; + } + + if ( prop[p] === "hide" && hidden || prop[p] === "show" && !hidden ) { + return opt.complete.call(this); + } + + if ( isElement && ( p === "height" || p === "width" ) ) { + // Make sure that nothing sneaks out + // Record all 3 overflow attributes because IE does not + // change the overflow attribute when overflowX and + // overflowY are set to the same value + opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ]; + + // Set display property to inline-block for height/width + // animations on inline elements that are having width/height + // animated + if ( jQuery.css( this, "display" ) === "inline" && + jQuery.css( this, "float" ) === "none" ) { + if ( !jQuery.support.inlineBlockNeedsLayout ) { + this.style.display = "inline-block"; + + } else { + var display = defaultDisplay(this.nodeName); + + // inline-level elements accept inline-block; + // block-level elements need to be inline with layout + if ( display === "inline" ) { + this.style.display = "inline-block"; + + } else { + this.style.display = "inline"; + this.style.zoom = 1; + } + } + } + } + + if ( jQuery.isArray( prop[p] ) ) { + // Create (if needed) and add to specialEasing + (opt.specialEasing = opt.specialEasing || {})[p] = prop[p][1]; + prop[p] = prop[p][0]; + } + } + + if ( opt.overflow != null ) { + this.style.overflow = "hidden"; + } + + opt.curAnim = jQuery.extend({}, prop); + + jQuery.each( prop, function( name, val ) { + var e = new jQuery.fx( self, opt, name ); + + if ( rfxtypes.test(val) ) { + e[ val === "toggle" ? hidden ? "show" : "hide" : val ]( prop ); + + } else { + var parts = rfxnum.exec(val), + start = e.cur(); + + if ( parts ) { + var end = parseFloat( parts[2] ), + unit = parts[3] || ( jQuery.cssNumber[ name ] ? "" : "px" ); + + // We need to compute starting value + if ( unit !== "px" ) { + jQuery.style( self, name, (end || 1) + unit); + start = ((end || 1) / e.cur()) * start; + jQuery.style( self, name, start + unit); + } + + // If a +=/-= token was provided, we're doing a relative animation + if ( parts[1] ) { + end = ((parts[1] === "-=" ? -1 : 1) * end) + start; + } + + e.custom( start, end, unit ); + + } else { + e.custom( start, val, "" ); + } + } + }); + + // For JS strict compliance + return true; + }); + }, + + stop: function( clearQueue, gotoEnd ) { + var timers = jQuery.timers; + + if ( clearQueue ) { + this.queue([]); + } + + this.each(function() { + // go in reverse order so anything added to the queue during the loop is ignored + for ( var i = timers.length - 1; i >= 0; i-- ) { + if ( timers[i].elem === this ) { + if (gotoEnd) { + // force the next step to be the last + timers[i](true); + } + + timers.splice(i, 1); + } + } + }); + + // start the next in the queue if the last step wasn't forced + if ( !gotoEnd ) { + this.dequeue(); + } + + return this; + } + +}); + +function genFx( type, num ) { + var obj = {}; + + jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function() { + obj[ this ] = type; + }); + + return obj; +} + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx("show", 1), + slideUp: genFx("hide", 1), + slideToggle: genFx("toggle", 1), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +}); + +jQuery.extend({ + speed: function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction(easing) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[opt.duration] : jQuery.fx.speeds._default; + + // Queueing + opt.old = opt.complete; + opt.complete = function() { + if ( opt.queue !== false ) { + jQuery(this).dequeue(); + } + if ( jQuery.isFunction( opt.old ) ) { + opt.old.call( this ); + } + }; + + return opt; + }, + + easing: { + linear: function( p, n, firstNum, diff ) { + return firstNum + diff * p; + }, + swing: function( p, n, firstNum, diff ) { + return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum; + } + }, + + timers: [], + + fx: function( elem, options, prop ) { + this.options = options; + this.elem = elem; + this.prop = prop; + + if ( !options.orig ) { + options.orig = {}; + } + } + +}); + +jQuery.fx.prototype = { + // Simple function for setting a style value + update: function() { + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + (jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this ); + }, + + // Get the current size + cur: function() { + if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) { + return this.elem[ this.prop ]; + } + + var parsed, + r = jQuery.css( this.elem, this.prop ); + // Empty strings, null, undefined and "auto" are converted to 0, + // complex values such as "rotate(1rad)" are returned as is, + // simple values such as "10px" are parsed to Float. + return isNaN( parsed = parseFloat( r ) ) ? !r || r === "auto" ? 0 : r : parsed; + }, + + // Start an animation from one number to another + custom: function( from, to, unit ) { + var self = this, + fx = jQuery.fx; + + this.startTime = jQuery.now(); + this.start = from; + this.end = to; + this.unit = unit || this.unit || ( jQuery.cssNumber[ this.prop ] ? "" : "px" ); + this.now = this.start; + this.pos = this.state = 0; + + function t( gotoEnd ) { + return self.step(gotoEnd); + } + + t.elem = this.elem; + + if ( t() && jQuery.timers.push(t) && !timerId ) { + timerId = setInterval(fx.tick, fx.interval); + } + }, + + // Simple 'show' function + show: function() { + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.style( this.elem, this.prop ); + this.options.show = true; + + // Begin the animation + // Make sure that we start at a small width/height to avoid any + // flash of content + this.custom(this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur()); + + // Start by showing the element + jQuery( this.elem ).show(); + }, + + // Simple 'hide' function + hide: function() { + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.style( this.elem, this.prop ); + this.options.hide = true; + + // Begin the animation + this.custom(this.cur(), 0); + }, + + // Each step of an animation + step: function( gotoEnd ) { + var t = jQuery.now(), done = true; + + if ( gotoEnd || t >= this.options.duration + this.startTime ) { + this.now = this.end; + this.pos = this.state = 1; + this.update(); + + this.options.curAnim[ this.prop ] = true; + + for ( var i in this.options.curAnim ) { + if ( this.options.curAnim[i] !== true ) { + done = false; + } + } + + if ( done ) { + // Reset the overflow + if ( this.options.overflow != null && !jQuery.support.shrinkWrapBlocks ) { + var elem = this.elem, + options = this.options; + + jQuery.each( [ "", "X", "Y" ], function (index, value) { + elem.style[ "overflow" + value ] = options.overflow[index]; + } ); + } + + // Hide the element if the "hide" operation was done + if ( this.options.hide ) { + jQuery(this.elem).hide(); + } + + // Reset the properties, if the item has been hidden or shown + if ( this.options.hide || this.options.show ) { + for ( var p in this.options.curAnim ) { + jQuery.style( this.elem, p, this.options.orig[p] ); + } + } + + // Execute the complete function + this.options.complete.call( this.elem ); + } + + return false; + + } else { + var n = t - this.startTime; + this.state = n / this.options.duration; + + // Perform the easing function, defaults to swing + var specialEasing = this.options.specialEasing && this.options.specialEasing[this.prop]; + var defaultEasing = this.options.easing || (jQuery.easing.swing ? "swing" : "linear"); + this.pos = jQuery.easing[specialEasing || defaultEasing](this.state, n, 0, 1, this.options.duration); + this.now = this.start + ((this.end - this.start) * this.pos); + + // Perform the next step of the animation + this.update(); + } + + return true; + } +}; + +jQuery.extend( jQuery.fx, { + tick: function() { + var timers = jQuery.timers; + + for ( var i = 0; i < timers.length; i++ ) { + if ( !timers[i]() ) { + timers.splice(i--, 1); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + }, + + interval: 13, + + stop: function() { + clearInterval( timerId ); + timerId = null; + }, + + speeds: { + slow: 600, + fast: 200, + // Default speed + _default: 400 + }, + + step: { + opacity: function( fx ) { + jQuery.style( fx.elem, "opacity", fx.now ); + }, + + _default: function( fx ) { + if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) { + fx.elem.style[ fx.prop ] = (fx.prop === "width" || fx.prop === "height" ? Math.max(0, fx.now) : fx.now) + fx.unit; + } else { + fx.elem[ fx.prop ] = fx.now; + } + } + } +}); + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.animated = function( elem ) { + return jQuery.grep(jQuery.timers, function( fn ) { + return elem === fn.elem; + }).length; + }; +} + +function defaultDisplay( nodeName ) { + if ( !elemdisplay[ nodeName ] ) { + var elem = jQuery("<" + nodeName + ">").appendTo("body"), + display = elem.css("display"); + + elem.remove(); + + if ( display === "none" || display === "" ) { + display = "block"; + } + + elemdisplay[ nodeName ] = display; + } + + return elemdisplay[ nodeName ]; +} + + + + +var rtable = /^t(?:able|d|h)$/i, + rroot = /^(?:body|html)$/i; + +if ( "getBoundingClientRect" in document.documentElement ) { + jQuery.fn.offset = function( options ) { + var elem = this[0], box; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + try { + box = elem.getBoundingClientRect(); + } catch(e) {} + + var doc = elem.ownerDocument, + docElem = doc.documentElement; + + // Make sure we're not dealing with a disconnected DOM node + if ( !box || !jQuery.contains( docElem, elem ) ) { + return box ? { top: box.top, left: box.left } : { top: 0, left: 0 }; + } + + var body = doc.body, + win = getWindow(doc), + clientTop = docElem.clientTop || body.clientTop || 0, + clientLeft = docElem.clientLeft || body.clientLeft || 0, + scrollTop = (win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop ), + scrollLeft = (win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft), + top = box.top + scrollTop - clientTop, + left = box.left + scrollLeft - clientLeft; + + return { top: top, left: left }; + }; + +} else { + jQuery.fn.offset = function( options ) { + var elem = this[0]; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + jQuery.offset.initialize(); + + var computedStyle, + offsetParent = elem.offsetParent, + prevOffsetParent = elem, + doc = elem.ownerDocument, + docElem = doc.documentElement, + body = doc.body, + defaultView = doc.defaultView, + prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle, + top = elem.offsetTop, + left = elem.offsetLeft; + + while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) { + if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) { + break; + } + + computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle; + top -= elem.scrollTop; + left -= elem.scrollLeft; + + if ( elem === offsetParent ) { + top += elem.offsetTop; + left += elem.offsetLeft; + + if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevOffsetParent = offsetParent; + offsetParent = elem.offsetParent; + } + + if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevComputedStyle = computedStyle; + } + + if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) { + top += body.offsetTop; + left += body.offsetLeft; + } + + if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) { + top += Math.max( docElem.scrollTop, body.scrollTop ); + left += Math.max( docElem.scrollLeft, body.scrollLeft ); + } + + return { top: top, left: left }; + }; +} + +jQuery.offset = { + initialize: function() { + var body = document.body, container = document.createElement("div"), innerDiv, checkDiv, table, td, bodyMarginTop = parseFloat( jQuery.css(body, "marginTop") ) || 0, + html = "<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>"; + + jQuery.extend( container.style, { position: "absolute", top: 0, left: 0, margin: 0, border: 0, width: "1px", height: "1px", visibility: "hidden" } ); + + container.innerHTML = html; + body.insertBefore( container, body.firstChild ); + innerDiv = container.firstChild; + checkDiv = innerDiv.firstChild; + td = innerDiv.nextSibling.firstChild.firstChild; + + this.doesNotAddBorder = (checkDiv.offsetTop !== 5); + this.doesAddBorderForTableAndCells = (td.offsetTop === 5); + + checkDiv.style.position = "fixed"; + checkDiv.style.top = "20px"; + + // safari subtracts parent border width here which is 5px + this.supportsFixedPosition = (checkDiv.offsetTop === 20 || checkDiv.offsetTop === 15); + checkDiv.style.position = checkDiv.style.top = ""; + + innerDiv.style.overflow = "hidden"; + innerDiv.style.position = "relative"; + + this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5); + + this.doesNotIncludeMarginInBodyOffset = (body.offsetTop !== bodyMarginTop); + + body.removeChild( container ); + body = container = innerDiv = checkDiv = table = td = null; + jQuery.offset.initialize = jQuery.noop; + }, + + bodyOffset: function( body ) { + var top = body.offsetTop, + left = body.offsetLeft; + + jQuery.offset.initialize(); + + if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) { + top += parseFloat( jQuery.css(body, "marginTop") ) || 0; + left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; + } + + return { top: top, left: left }; + }, + + setOffset: function( elem, options, i ) { + var position = jQuery.css( elem, "position" ); + + // set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + var curElem = jQuery( elem ), + curOffset = curElem.offset(), + curCSSTop = jQuery.css( elem, "top" ), + curCSSLeft = jQuery.css( elem, "left" ), + calculatePosition = (position === "absolute" && jQuery.inArray('auto', [curCSSTop, curCSSLeft]) > -1), + props = {}, curPosition = {}, curTop, curLeft; + + // need to be able to calculate position if either top or left is auto and position is absolute + if ( calculatePosition ) { + curPosition = curElem.position(); + } + + curTop = calculatePosition ? curPosition.top : parseInt( curCSSTop, 10 ) || 0; + curLeft = calculatePosition ? curPosition.left : parseInt( curCSSLeft, 10 ) || 0; + + if ( jQuery.isFunction( options ) ) { + options = options.call( elem, i, curOffset ); + } + + if (options.top != null) { + props.top = (options.top - curOffset.top) + curTop; + } + if (options.left != null) { + props.left = (options.left - curOffset.left) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + } +}; + + +jQuery.fn.extend({ + position: function() { + if ( !this[0] ) { + return null; + } + + var elem = this[0], + + // Get *real* offsetParent + offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; + offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; + + // Add offsetParent borders + parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; + parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; + + // Subtract the two offsets + return { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + }, + + offsetParent: function() { + return this.map(function() { + var offsetParent = this.offsetParent || document.body; + while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { + offsetParent = offsetParent.offsetParent; + } + return offsetParent; + }); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( ["Left", "Top"], function( i, name ) { + var method = "scroll" + name; + + jQuery.fn[ method ] = function(val) { + var elem = this[0], win; + + if ( !elem ) { + return null; + } + + if ( val !== undefined ) { + // Set the scroll offset + return this.each(function() { + win = getWindow( this ); + + if ( win ) { + win.scrollTo( + !i ? val : jQuery(win).scrollLeft(), + i ? val : jQuery(win).scrollTop() + ); + + } else { + this[ method ] = val; + } + }); + } else { + win = getWindow( elem ); + + // Return the scroll offset + return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] : + jQuery.support.boxModel && win.document.documentElement[ method ] || + win.document.body[ method ] : + elem[ method ]; + } + }; +}); + +function getWindow( elem ) { + return jQuery.isWindow( elem ) ? + elem : + elem.nodeType === 9 ? + elem.defaultView || elem.parentWindow : + false; +} + + + + +// Create innerHeight, innerWidth, outerHeight and outerWidth methods +jQuery.each([ "Height", "Width" ], function( i, name ) { + + var type = name.toLowerCase(); + + // innerHeight and innerWidth + jQuery.fn["inner" + name] = function() { + return this[0] ? + parseFloat( jQuery.css( this[0], type, "padding" ) ) : + null; + }; + + // outerHeight and outerWidth + jQuery.fn["outer" + name] = function( margin ) { + return this[0] ? + parseFloat( jQuery.css( this[0], type, margin ? "margin" : "border" ) ) : + null; + }; + + jQuery.fn[ type ] = function( size ) { + // Get window width or height + var elem = this[0]; + if ( !elem ) { + return size == null ? null : this; + } + + if ( jQuery.isFunction( size ) ) { + return this.each(function( i ) { + var self = jQuery( this ); + self[ type ]( size.call( this, i, self[ type ]() ) ); + }); + } + + if ( jQuery.isWindow( elem ) ) { + // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode + // 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat + var docElemProp = elem.document.documentElement[ "client" + name ]; + return elem.document.compatMode === "CSS1Compat" && docElemProp || + elem.document.body[ "client" + name ] || docElemProp; + + // Get document width or height + } else if ( elem.nodeType === 9 ) { + // Either scroll[Width/Height] or offset[Width/Height], whichever is greater + return Math.max( + elem.documentElement["client" + name], + elem.body["scroll" + name], elem.documentElement["scroll" + name], + elem.body["offset" + name], elem.documentElement["offset" + name] + ); + + // Get or set width or height on the element + } else if ( size === undefined ) { + var orig = jQuery.css( elem, type ), + ret = parseFloat( orig ); + + return jQuery.isNaN( ret ) ? orig : ret; + + // Set the width or height on the element (default to pixels if value is unitless) + } else { + return this.css( type, typeof size === "string" ? size : size + "px" ); + } + }; + +}); + + +window.jQuery = window.$ = jQuery; +})(window); diff --git a/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.min.js b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.min.js new file mode 100644 index 0000000..6422523 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/flot-0.7/jquery.min.js @@ -0,0 +1,23 @@ +/* + * jQuery JavaScript Library v1.5.1 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Wed Feb 23 13:55:29 2011 -0500 + */ +(function(aY,H){var al=aY.document;var a=(function(){var bn=function(bI,bJ){return new bn.fn.init(bI,bJ,bl)},bD=aY.jQuery,bp=aY.$,bl,bH=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]+)$)/,bv=/\S/,br=/^\s+/,bm=/\s+$/,bq=/\d/,bj=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,bw=/^[\],:{}\s]*$/,bF=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,by=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,bs=/(?:^|:|,)(?:\s*\[)+/g,bh=/(webkit)[ \/]([\w.]+)/,bA=/(opera)(?:.*version)?[ \/]([\w.]+)/,bz=/(msie) ([\w.]+)/,bB=/(mozilla)(?:.*? rv:([\w.]+))?/,bG=navigator.userAgent,bE,bC=false,bk,e="then done fail isResolved isRejected promise".split(" "),bd,bu=Object.prototype.toString,bo=Object.prototype.hasOwnProperty,bi=Array.prototype.push,bt=Array.prototype.slice,bx=String.prototype.trim,be=Array.prototype.indexOf,bg={};bn.fn=bn.prototype={constructor:bn,init:function(bI,bM,bL){var bK,bN,bJ,bO;if(!bI){return this}if(bI.nodeType){this.context=this[0]=bI;this.length=1;return this}if(bI==="body"&&!bM&&al.body){this.context=al;this[0]=al.body;this.selector="body";this.length=1;return this}if(typeof bI==="string"){bK=bH.exec(bI);if(bK&&(bK[1]||!bM)){if(bK[1]){bM=bM instanceof bn?bM[0]:bM;bO=(bM?bM.ownerDocument||bM:al);bJ=bj.exec(bI);if(bJ){if(bn.isPlainObject(bM)){bI=[al.createElement(bJ[1])];bn.fn.attr.call(bI,bM,true)}else{bI=[bO.createElement(bJ[1])]}}else{bJ=bn.buildFragment([bK[1]],[bO]);bI=(bJ.cacheable?bn.clone(bJ.fragment):bJ.fragment).childNodes}return bn.merge(this,bI)}else{bN=al.getElementById(bK[2]);if(bN&&bN.parentNode){if(bN.id!==bK[2]){return bL.find(bI)}this.length=1;this[0]=bN}this.context=al;this.selector=bI;return this}}else{if(!bM||bM.jquery){return(bM||bL).find(bI)}else{return this.constructor(bM).find(bI)}}}else{if(bn.isFunction(bI)){return bL.ready(bI)}}if(bI.selector!==H){this.selector=bI.selector;this.context=bI.context}return bn.makeArray(bI,this)},selector:"",jquery:"1.5.1",length:0,size:function(){return this.length},toArray:function(){return bt.call(this,0)},get:function(bI){return bI==null?this.toArray():(bI<0?this[this.length+bI]:this[bI])},pushStack:function(bJ,bL,bI){var bK=this.constructor();if(bn.isArray(bJ)){bi.apply(bK,bJ)}else{bn.merge(bK,bJ)}bK.prevObject=this;bK.context=this.context;if(bL==="find"){bK.selector=this.selector+(this.selector?" ":"")+bI}else{if(bL){bK.selector=this.selector+"."+bL+"("+bI+")"}}return bK},each:function(bJ,bI){return bn.each(this,bJ,bI)},ready:function(bI){bn.bindReady();bk.done(bI);return this},eq:function(bI){return bI===-1?this.slice(bI):this.slice(bI,+bI+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(bt.apply(this,arguments),"slice",bt.call(arguments).join(","))},map:function(bI){return this.pushStack(bn.map(this,function(bK,bJ){return bI.call(bK,bJ,bK)}))},end:function(){return this.prevObject||this.constructor(null)},push:bi,sort:[].sort,splice:[].splice};bn.fn.init.prototype=bn.fn;bn.extend=bn.fn.extend=function(){var bR,bK,bI,bJ,bO,bP,bN=arguments[0]||{},bM=1,bL=arguments.length,bQ=false;if(typeof bN==="boolean"){bQ=bN;bN=arguments[1]||{};bM=2}if(typeof bN!=="object"&&!bn.isFunction(bN)){bN={}}if(bL===bM){bN=this;--bM}for(;bM<bL;bM++){if((bR=arguments[bM])!=null){for(bK in bR){bI=bN[bK];bJ=bR[bK];if(bN===bJ){continue}if(bQ&&bJ&&(bn.isPlainObject(bJ)||(bO=bn.isArray(bJ)))){if(bO){bO=false;bP=bI&&bn.isArray(bI)?bI:[]}else{bP=bI&&bn.isPlainObject(bI)?bI:{}}bN[bK]=bn.extend(bQ,bP,bJ)}else{if(bJ!==H){bN[bK]=bJ}}}}}return bN};bn.extend({noConflict:function(bI){aY.$=bp;if(bI){aY.jQuery=bD}return bn},isReady:false,readyWait:1,ready:function(bI){if(bI===true){bn.readyWait--}if(!bn.readyWait||(bI!==true&&!bn.isReady)){if(!al.body){return setTimeout(bn.ready,1)}bn.isReady=true;if(bI!==true&&--bn.readyWait>0){return}bk.resolveWith(al,[bn]);if(bn.fn.trigger){bn(al).trigger("ready").unbind("ready")}}},bindReady:function(){if(bC){return}bC=true;if(al.readyState==="complete"){return setTimeout(bn.ready,1)}if(al.addEventListener){al.addEventListener("DOMContentLoaded",bd,false);aY.addEventListener("load",bn.ready,false)}else{if(al.attachEvent){al.attachEvent("onreadystatechange",bd);aY.attachEvent("onload",bn.ready);var bI=false;try{bI=aY.frameElement==null}catch(bJ){}if(al.documentElement.doScroll&&bI){bf()}}}},isFunction:function(bI){return bn.type(bI)==="function"},isArray:Array.isArray||function(bI){return bn.type(bI)==="array"},isWindow:function(bI){return bI&&typeof bI==="object"&&"setInterval" in bI},isNaN:function(bI){return bI==null||!bq.test(bI)||isNaN(bI)},type:function(bI){return bI==null?String(bI):bg[bu.call(bI)]||"object"},isPlainObject:function(bJ){if(!bJ||bn.type(bJ)!=="object"||bJ.nodeType||bn.isWindow(bJ)){return false}if(bJ.constructor&&!bo.call(bJ,"constructor")&&!bo.call(bJ.constructor.prototype,"isPrototypeOf")){return false}var bI;for(bI in bJ){}return bI===H||bo.call(bJ,bI)},isEmptyObject:function(bJ){for(var bI in bJ){return false}return true},error:function(bI){throw bI},parseJSON:function(bI){if(typeof bI!=="string"||!bI){return null}bI=bn.trim(bI);if(bw.test(bI.replace(bF,"@").replace(by,"]").replace(bs,""))){return aY.JSON&&aY.JSON.parse?aY.JSON.parse(bI):(new Function("return "+bI))()}else{bn.error("Invalid JSON: "+bI)}},parseXML:function(bK,bI,bJ){if(aY.DOMParser){bJ=new DOMParser();bI=bJ.parseFromString(bK,"text/xml")}else{bI=new ActiveXObject("Microsoft.XMLDOM");bI.async="false";bI.loadXML(bK)}bJ=bI.documentElement;if(!bJ||!bJ.nodeName||bJ.nodeName==="parsererror"){bn.error("Invalid XML: "+bK)}return bI},noop:function(){},globalEval:function(bK){if(bK&&bv.test(bK)){var bJ=al.head||al.getElementsByTagName("head")[0]||al.documentElement,bI=al.createElement("script");if(bn.support.scriptEval()){bI.appendChild(al.createTextNode(bK))}else{bI.text=bK}bJ.insertBefore(bI,bJ.firstChild);bJ.removeChild(bI)}},nodeName:function(bJ,bI){return bJ.nodeName&&bJ.nodeName.toUpperCase()===bI.toUpperCase()},each:function(bL,bP,bK){var bJ,bM=0,bN=bL.length,bI=bN===H||bn.isFunction(bL);if(bK){if(bI){for(bJ in bL){if(bP.apply(bL[bJ],bK)===false){break}}}else{for(;bM<bN;){if(bP.apply(bL[bM++],bK)===false){break}}}}else{if(bI){for(bJ in bL){if(bP.call(bL[bJ],bJ,bL[bJ])===false){break}}}else{for(var bO=bL[0];bM<bN&&bP.call(bO,bM,bO)!==false;bO=bL[++bM]){}}}return bL},trim:bx?function(bI){return bI==null?"":bx.call(bI)}:function(bI){return bI==null?"":bI.toString().replace(br,"").replace(bm,"")},makeArray:function(bL,bJ){var bI=bJ||[];if(bL!=null){var bK=bn.type(bL);if(bL.length==null||bK==="string"||bK==="function"||bK==="regexp"||bn.isWindow(bL)){bi.call(bI,bL)}else{bn.merge(bI,bL)}}return bI},inArray:function(bK,bL){if(bL.indexOf){return bL.indexOf(bK)}for(var bI=0,bJ=bL.length;bI<bJ;bI++){if(bL[bI]===bK){return bI}}return -1},merge:function(bM,bK){var bL=bM.length,bJ=0;if(typeof bK.length==="number"){for(var bI=bK.length;bJ<bI;bJ++){bM[bL++]=bK[bJ]}}else{while(bK[bJ]!==H){bM[bL++]=bK[bJ++]}}bM.length=bL;return bM},grep:function(bJ,bO,bI){var bK=[],bN;bI=!!bI;for(var bL=0,bM=bJ.length;bL<bM;bL++){bN=!!bO(bJ[bL],bL);if(bI!==bN){bK.push(bJ[bL])}}return bK},map:function(bJ,bO,bI){var bK=[],bN;for(var bL=0,bM=bJ.length;bL<bM;bL++){bN=bO(bJ[bL],bL,bI);if(bN!=null){bK[bK.length]=bN}}return bK.concat.apply([],bK)},guid:1,proxy:function(bK,bJ,bI){if(arguments.length===2){if(typeof bJ==="string"){bI=bK;bK=bI[bJ];bJ=H}else{if(bJ&&!bn.isFunction(bJ)){bI=bJ;bJ=H}}}if(!bJ&&bK){bJ=function(){return bK.apply(bI||this,arguments)}}if(bK){bJ.guid=bK.guid=bK.guid||bJ.guid||bn.guid++}return bJ},access:function(bI,bQ,bO,bK,bN,bP){var bJ=bI.length;if(typeof bQ==="object"){for(var bL in bQ){bn.access(bI,bL,bQ[bL],bK,bN,bO)}return bI}if(bO!==H){bK=!bP&&bK&&bn.isFunction(bO);for(var bM=0;bM<bJ;bM++){bN(bI[bM],bQ,bK?bO.call(bI[bM],bM,bN(bI[bM],bQ)):bO,bP)}return bI}return bJ?bN(bI[0],bQ):H},now:function(){return(new Date()).getTime()},_Deferred:function(){var bL=[],bM,bJ,bK,bI={done:function(){if(!bK){var bO=arguments,bP,bS,bR,bQ,bN;if(bM){bN=bM;bM=0}for(bP=0,bS=bO.length;bP<bS;bP++){bR=bO[bP];bQ=bn.type(bR);if(bQ==="array"){bI.done.apply(bI,bR)}else{if(bQ==="function"){bL.push(bR)}}}if(bN){bI.resolveWith(bN[0],bN[1])}}return this},resolveWith:function(bO,bN){if(!bK&&!bM&&!bJ){bJ=1;try{while(bL[0]){bL.shift().apply(bO,bN)}}catch(bP){throw bP}finally{bM=[bO,bN];bJ=0}}return this},resolve:function(){bI.resolveWith(bn.isFunction(this.promise)?this.promise():this,arguments);return this},isResolved:function(){return !!(bJ||bM)},cancel:function(){bK=1;bL=[];return this}};return bI},Deferred:function(bJ){var bI=bn._Deferred(),bL=bn._Deferred(),bK;bn.extend(bI,{then:function(bN,bM){bI.done(bN).fail(bM);return this},fail:bL.done,rejectWith:bL.resolveWith,reject:bL.resolve,isRejected:bL.isResolved,promise:function(bN){if(bN==null){if(bK){return bK}bK=bN={}}var bM=e.length;while(bM--){bN[e[bM]]=bI[e[bM]]}return bN}});bI.done(bL.cancel).fail(bI.cancel);delete bI.cancel;if(bJ){bJ.call(bI,bI)}return bI},when:function(bJ){var bO=arguments.length,bI=bO<=1&&bJ&&bn.isFunction(bJ.promise)?bJ:bn.Deferred(),bM=bI.promise();if(bO>1){var bN=bt.call(arguments,0),bL=bO,bK=function(bP){return function(bQ){bN[bP]=arguments.length>1?bt.call(arguments,0):bQ;if(!(--bL)){bI.resolveWith(bM,bN)}}};while((bO--)){bJ=bN[bO];if(bJ&&bn.isFunction(bJ.promise)){bJ.promise().then(bK(bO),bI.reject)}else{--bL}}if(!bL){bI.resolveWith(bM,bN)}}else{if(bI!==bJ){bI.resolve(bJ)}}return bM},uaMatch:function(bJ){bJ=bJ.toLowerCase();var bI=bh.exec(bJ)||bA.exec(bJ)||bz.exec(bJ)||bJ.indexOf("compatible")<0&&bB.exec(bJ)||[];return{browser:bI[1]||"",version:bI[2]||"0"}},sub:function(){function bJ(bL,bM){return new bJ.fn.init(bL,bM)}bn.extend(true,bJ,this);bJ.superclass=this;bJ.fn=bJ.prototype=this();bJ.fn.constructor=bJ;bJ.subclass=this.subclass;bJ.fn.init=function bK(bL,bM){if(bM&&bM instanceof bn&&!(bM instanceof bJ)){bM=bJ(bM)}return bn.fn.init.call(this,bL,bM,bI)};bJ.fn.init.prototype=bJ.fn;var bI=bJ(al);return bJ},browser:{}});bk=bn._Deferred();bn.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(bJ,bI){bg["[object "+bI+"]"]=bI.toLowerCase()});bE=bn.uaMatch(bG);if(bE.browser){bn.browser[bE.browser]=true;bn.browser.version=bE.version}if(bn.browser.webkit){bn.browser.safari=true}if(be){bn.inArray=function(bI,bJ){return be.call(bJ,bI)}}if(bv.test("\xA0")){br=/^[\s\xA0]+/;bm=/[\s\xA0]+$/}bl=bn(al);if(al.addEventListener){bd=function(){al.removeEventListener("DOMContentLoaded",bd,false);bn.ready()}}else{if(al.attachEvent){bd=function(){if(al.readyState==="complete"){al.detachEvent("onreadystatechange",bd);bn.ready()}}}}function bf(){if(bn.isReady){return}try{al.documentElement.doScroll("left")}catch(bI){setTimeout(bf,1);return}bn.ready()}return bn})();(function(){a.support={};var bd=al.createElement("div");bd.style.display="none";bd.innerHTML=" <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";var bm=bd.getElementsByTagName("*"),bk=bd.getElementsByTagName("a")[0],bl=al.createElement("select"),be=bl.appendChild(al.createElement("option")),bj=bd.getElementsByTagName("input")[0];if(!bm||!bm.length||!bk){return}a.support={leadingWhitespace:bd.firstChild.nodeType===3,tbody:!bd.getElementsByTagName("tbody").length,htmlSerialize:!!bd.getElementsByTagName("link").length,style:/red/.test(bk.getAttribute("style")),hrefNormalized:bk.getAttribute("href")==="/a",opacity:/^0.55$/.test(bk.style.opacity),cssFloat:!!bk.style.cssFloat,checkOn:bj.value==="on",optSelected:be.selected,deleteExpando:true,optDisabled:false,checkClone:false,noCloneEvent:true,noCloneChecked:true,boxModel:null,inlineBlockNeedsLayout:false,shrinkWrapBlocks:false,reliableHiddenOffsets:true};bj.checked=true;a.support.noCloneChecked=bj.cloneNode(true).checked;bl.disabled=true;a.support.optDisabled=!be.disabled;var bf=null;a.support.scriptEval=function(){if(bf===null){var bo=al.documentElement,bp=al.createElement("script"),br="script"+a.now();try{bp.appendChild(al.createTextNode("window."+br+"=1;"))}catch(bq){}bo.insertBefore(bp,bo.firstChild);if(aY[br]){bf=true;delete aY[br]}else{bf=false}bo.removeChild(bp);bo=bp=br=null}return bf};try{delete bd.test}catch(bh){a.support.deleteExpando=false}if(!bd.addEventListener&&bd.attachEvent&&bd.fireEvent){bd.attachEvent("onclick",function bn(){a.support.noCloneEvent=false;bd.detachEvent("onclick",bn)});bd.cloneNode(true).fireEvent("onclick")}bd=al.createElement("div");bd.innerHTML="<input type='radio' name='radiotest' checked='checked'/>";var bg=al.createDocumentFragment();bg.appendChild(bd.firstChild);a.support.checkClone=bg.cloneNode(true).cloneNode(true).lastChild.checked;a(function(){var bp=al.createElement("div"),e=al.getElementsByTagName("body")[0];if(!e){return}bp.style.width=bp.style.paddingLeft="1px";e.appendChild(bp);a.boxModel=a.support.boxModel=bp.offsetWidth===2;if("zoom" in bp.style){bp.style.display="inline";bp.style.zoom=1;a.support.inlineBlockNeedsLayout=bp.offsetWidth===2;bp.style.display="";bp.innerHTML="<div style='width:4px;'></div>";a.support.shrinkWrapBlocks=bp.offsetWidth!==2}bp.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>";var bo=bp.getElementsByTagName("td");a.support.reliableHiddenOffsets=bo[0].offsetHeight===0;bo[0].style.display="";bo[1].style.display="none";a.support.reliableHiddenOffsets=a.support.reliableHiddenOffsets&&bo[0].offsetHeight===0;bp.innerHTML="";e.removeChild(bp).style.display="none";bp=bo=null});var bi=function(e){var bp=al.createElement("div");e="on"+e;if(!bp.attachEvent){return true}var bo=(e in bp);if(!bo){bp.setAttribute(e,"return;");bo=typeof bp[e]==="function"}bp=null;return bo};a.support.submitBubbles=bi("submit");a.support.changeBubbles=bi("change");bd=bm=bk=null})();var aE=/^(?:\{.*\}|\[.*\])$/;a.extend({cache:{},uuid:0,expando:"jQuery"+(a.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:true,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:true},hasData:function(e){e=e.nodeType?a.cache[e[a.expando]]:e[a.expando];return !!e&&!P(e)},data:function(bf,bd,bh,bg){if(!a.acceptData(bf)){return}var bk=a.expando,bj=typeof bd==="string",bi,bl=bf.nodeType,e=bl?a.cache:bf,be=bl?bf[a.expando]:bf[a.expando]&&a.expando;if((!be||(bg&&be&&!e[be][bk]))&&bj&&bh===H){return}if(!be){if(bl){bf[a.expando]=be=++a.uuid}else{be=a.expando}}if(!e[be]){e[be]={};if(!bl){e[be].toJSON=a.noop}}if(typeof bd==="object"||typeof bd==="function"){if(bg){e[be][bk]=a.extend(e[be][bk],bd)}else{e[be]=a.extend(e[be],bd)}}bi=e[be];if(bg){if(!bi[bk]){bi[bk]={}}bi=bi[bk]}if(bh!==H){bi[bd]=bh}if(bd==="events"&&!bi[bd]){return bi[bk]&&bi[bk].events}return bj?bi[bd]:bi},removeData:function(bg,be,bh){if(!a.acceptData(bg)){return}var bj=a.expando,bk=bg.nodeType,bd=bk?a.cache:bg,bf=bk?bg[a.expando]:a.expando;if(!bd[bf]){return}if(be){var bi=bh?bd[bf][bj]:bd[bf];if(bi){delete bi[be];if(!P(bi)){return}}}if(bh){delete bd[bf][bj];if(!P(bd[bf])){return}}var e=bd[bf][bj];if(a.support.deleteExpando||bd!=aY){delete bd[bf]}else{bd[bf]=null}if(e){bd[bf]={};if(!bk){bd[bf].toJSON=a.noop}bd[bf][bj]=e}else{if(bk){if(a.support.deleteExpando){delete bg[a.expando]}else{if(bg.removeAttribute){bg.removeAttribute(a.expando)}else{bg[a.expando]=null}}}}},_data:function(bd,e,be){return a.data(bd,e,be,true)},acceptData:function(bd){if(bd.nodeName){var e=a.noData[bd.nodeName.toLowerCase()];if(e){return !(e===true||bd.getAttribute("classid")!==e)}}return true}});a.fn.extend({data:function(bg,bi){var bh=null;if(typeof bg==="undefined"){if(this.length){bh=a.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,be;for(var bf=0,bd=e.length;bf<bd;bf++){be=e[bf].name;if(be.indexOf("data-")===0){be=be.substr(5);aT(this[0],be,bh[be])}}}}return bh}else{if(typeof bg==="object"){return this.each(function(){a.data(this,bg)})}}var bj=bg.split(".");bj[1]=bj[1]?"."+bj[1]:"";if(bi===H){bh=this.triggerHandler("getData"+bj[1]+"!",[bj[0]]);if(bh===H&&this.length){bh=a.data(this[0],bg);bh=aT(this[0],bg,bh)}return bh===H&&bj[1]?this.data(bj[0]):bh}else{return this.each(function(){var bl=a(this),bk=[bj[0],bi];bl.triggerHandler("setData"+bj[1]+"!",bk);a.data(this,bg,bi);bl.triggerHandler("changeData"+bj[1]+"!",bk)})}},removeData:function(e){return this.each(function(){a.removeData(this,e)})}});function aT(be,bd,bf){if(bf===H&&be.nodeType===1){bf=be.getAttribute("data-"+bd);if(typeof bf==="string"){try{bf=bf==="true"?true:bf==="false"?false:bf==="null"?null:!a.isNaN(bf)?parseFloat(bf):aE.test(bf)?a.parseJSON(bf):bf}catch(bg){}a.data(be,bd,bf)}else{bf=H}}return bf}function P(bd){for(var e in bd){if(e!=="toJSON"){return false}}return true}a.extend({queue:function(bd,e,bf){if(!bd){return}e=(e||"fx")+"queue";var be=a._data(bd,e);if(!bf){return be||[]}if(!be||a.isArray(bf)){be=a._data(bd,e,a.makeArray(bf))}else{be.push(bf)}return be},dequeue:function(bf,be){be=be||"fx";var e=a.queue(bf,be),bd=e.shift();if(bd==="inprogress"){bd=e.shift()}if(bd){if(be==="fx"){e.unshift("inprogress")}bd.call(bf,function(){a.dequeue(bf,be)})}if(!e.length){a.removeData(bf,be+"queue",true)}}});a.fn.extend({queue:function(e,bd){if(typeof e!=="string"){bd=e;e="fx"}if(bd===H){return a.queue(this[0],e)}return this.each(function(bf){var be=a.queue(this,e,bd);if(e==="fx"&&be[0]!=="inprogress"){a.dequeue(this,e)}})},dequeue:function(e){return this.each(function(){a.dequeue(this,e)})},delay:function(bd,e){bd=a.fx?a.fx.speeds[bd]||bd:bd;e=e||"fx";return this.queue(e,function(){var be=this;setTimeout(function(){a.dequeue(be,e)},bd)})},clearQueue:function(e){return this.queue(e||"fx",[])}});var aC=/[\n\t\r]/g,a3=/\s+/,aG=/\r/g,a2=/^(?:href|src|style)$/,f=/^(?:button|input)$/i,C=/^(?:button|input|object|select|textarea)$/i,k=/^a(?:rea)?$/i,Q=/^(?:radio|checkbox)$/i;a.props={"for":"htmlFor","class":"className",readonly:"readOnly",maxlength:"maxLength",cellspacing:"cellSpacing",rowspan:"rowSpan",colspan:"colSpan",tabindex:"tabIndex",usemap:"useMap",frameborder:"frameBorder"};a.fn.extend({attr:function(e,bd){return a.access(this,e,bd,true,a.attr)},removeAttr:function(e,bd){return this.each(function(){a.attr(this,e,"");if(this.nodeType===1){this.removeAttribute(e)}})},addClass:function(bj){if(a.isFunction(bj)){return this.each(function(bm){var bl=a(this);bl.addClass(bj.call(this,bm,bl.attr("class")))})}if(bj&&typeof bj==="string"){var e=(bj||"").split(a3);for(var bf=0,be=this.length;bf<be;bf++){var bd=this[bf];if(bd.nodeType===1){if(!bd.className){bd.className=bj}else{var bg=" "+bd.className+" ",bi=bd.className;for(var bh=0,bk=e.length;bh<bk;bh++){if(bg.indexOf(" "+e[bh]+" ")<0){bi+=" "+e[bh]}}bd.className=a.trim(bi)}}}}return this},removeClass:function(bh){if(a.isFunction(bh)){return this.each(function(bl){var bk=a(this);bk.removeClass(bh.call(this,bl,bk.attr("class")))})}if((bh&&typeof bh==="string")||bh===H){var bi=(bh||"").split(a3);for(var be=0,bd=this.length;be<bd;be++){var bg=this[be];if(bg.nodeType===1&&bg.className){if(bh){var bf=(" "+bg.className+" ").replace(aC," ");for(var bj=0,e=bi.length;bj<e;bj++){bf=bf.replace(" "+bi[bj]+" "," ")}bg.className=a.trim(bf)}else{bg.className=""}}}}return this},toggleClass:function(bf,bd){var be=typeof bf,e=typeof bd==="boolean";if(a.isFunction(bf)){return this.each(function(bh){var bg=a(this);bg.toggleClass(bf.call(this,bh,bg.attr("class"),bd),bd)})}return this.each(function(){if(be==="string"){var bi,bh=0,bg=a(this),bj=bd,bk=bf.split(a3);while((bi=bk[bh++])){bj=e?bj:!bg.hasClass(bi);bg[bj?"addClass":"removeClass"](bi)}}else{if(be==="undefined"||be==="boolean"){if(this.className){a._data(this,"__className__",this.className)}this.className=this.className||bf===false?"":a._data(this,"__className__")||""}}})},hasClass:function(e){var bf=" "+e+" ";for(var be=0,bd=this.length;be<bd;be++){if((" "+this[be].className+" ").replace(aC," ").indexOf(bf)>-1){return true}}return false},val:function(bk){if(!arguments.length){var be=this[0];if(be){if(a.nodeName(be,"option")){var bd=be.attributes.value;return !bd||bd.specified?be.value:be.text}if(a.nodeName(be,"select")){var bi=be.selectedIndex,bl=[],bm=be.options,bh=be.type==="select-one";if(bi<0){return null}for(var bf=bh?bi:0,bj=bh?bi+1:bm.length;bf<bj;bf++){var bg=bm[bf];if(bg.selected&&(a.support.optDisabled?!bg.disabled:bg.getAttribute("disabled")===null)&&(!bg.parentNode.disabled||!a.nodeName(bg.parentNode,"optgroup"))){bk=a(bg).val();if(bh){return bk}bl.push(bk)}}if(bh&&!bl.length&&bm.length){return a(bm[bi]).val()}return bl}if(Q.test(be.type)&&!a.support.checkOn){return be.getAttribute("value")===null?"on":be.value}return(be.value||"").replace(aG,"")}return H}var e=a.isFunction(bk);return this.each(function(bp){var bo=a(this),bq=bk;if(this.nodeType!==1){return}if(e){bq=bk.call(this,bp,bo.val())}if(bq==null){bq=""}else{if(typeof bq==="number"){bq+=""}else{if(a.isArray(bq)){bq=a.map(bq,function(br){return br==null?"":br+""})}}}if(a.isArray(bq)&&Q.test(this.type)){this.checked=a.inArray(bo.val(),bq)>=0}else{if(a.nodeName(this,"select")){var bn=a.makeArray(bq);a("option",this).each(function(){this.selected=a.inArray(a(this).val(),bn)>=0});if(!bn.length){this.selectedIndex=-1}}else{this.value=bq}}})}});a.extend({attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attr:function(bd,e,bi,bl){if(!bd||bd.nodeType===3||bd.nodeType===8||bd.nodeType===2){return H}if(bl&&e in a.attrFn){return a(bd)[e](bi)}var be=bd.nodeType!==1||!a.isXMLDoc(bd),bh=bi!==H;e=be&&a.props[e]||e;if(bd.nodeType===1){var bg=a2.test(e);if(e==="selected"&&!a.support.optSelected){var bj=bd.parentNode;if(bj){bj.selectedIndex;if(bj.parentNode){bj.parentNode.selectedIndex}}}if((e in bd||bd[e]!==H)&&be&&!bg){if(bh){if(e==="type"&&f.test(bd.nodeName)&&bd.parentNode){a.error("type property can't be changed")}if(bi===null){if(bd.nodeType===1){bd.removeAttribute(e)}}else{bd[e]=bi}}if(a.nodeName(bd,"form")&&bd.getAttributeNode(e)){return bd.getAttributeNode(e).nodeValue}if(e==="tabIndex"){var bk=bd.getAttributeNode("tabIndex");return bk&&bk.specified?bk.value:C.test(bd.nodeName)||k.test(bd.nodeName)&&bd.href?0:H}return bd[e]}if(!a.support.style&&be&&e==="style"){if(bh){bd.style.cssText=""+bi}return bd.style.cssText}if(bh){bd.setAttribute(e,""+bi)}if(!bd.attributes[e]&&(bd.hasAttribute&&!bd.hasAttribute(e))){return H}var bf=!a.support.hrefNormalized&&be&&bg?bd.getAttribute(e,2):bd.getAttribute(e);return bf===null?H:bf}if(bh){bd[e]=bi}return bd[e]}});var aP=/\.(.*)$/,a0=/^(?:textarea|input|select)$/i,K=/\./g,aa=/ /g,aw=/[^\w\s.|`]/g,E=function(e){return e.replace(aw,"\\$&")};a.event={add:function(bg,bk,br,bi){if(bg.nodeType===3||bg.nodeType===8){return}try{if(a.isWindow(bg)&&(bg!==aY&&!bg.frameElement)){bg=aY}}catch(bl){}if(br===false){br=a5}else{if(!br){return}}var be,bp;if(br.handler){be=br;br=be.handler}if(!br.guid){br.guid=a.guid++}var bm=a._data(bg);if(!bm){return}var bq=bm.events,bj=bm.handle;if(!bq){bm.events=bq={}}if(!bj){bm.handle=bj=function(){return typeof a!=="undefined"&&!a.event.triggered?a.event.handle.apply(bj.elem,arguments):H}}bj.elem=bg;bk=bk.split(" ");var bo,bh=0,bd;while((bo=bk[bh++])){bp=be?a.extend({},be):{handler:br,data:bi};if(bo.indexOf(".")>-1){bd=bo.split(".");bo=bd.shift();bp.namespace=bd.slice(0).sort().join(".")}else{bd=[];bp.namespace=""}bp.type=bo;if(!bp.guid){bp.guid=br.guid}var bf=bq[bo],bn=a.event.special[bo]||{};if(!bf){bf=bq[bo]=[];if(!bn.setup||bn.setup.call(bg,bi,bd,bj)===false){if(bg.addEventListener){bg.addEventListener(bo,bj,false)}else{if(bg.attachEvent){bg.attachEvent("on"+bo,bj)}}}}if(bn.add){bn.add.call(bg,bp);if(!bp.handler.guid){bp.handler.guid=br.guid}}bf.push(bp);a.event.global[bo]=true}bg=null},global:{},remove:function(br,bm,be,bi){if(br.nodeType===3||br.nodeType===8){return}if(be===false){be=a5}var bu,bh,bj,bo,bp=0,bf,bk,bn,bg,bl,e,bt,bq=a.hasData(br)&&a._data(br),bd=bq&&bq.events;if(!bq||!bd){return}if(bm&&bm.type){be=bm.handler;bm=bm.type}if(!bm||typeof bm==="string"&&bm.charAt(0)==="."){bm=bm||"";for(bh in bd){a.event.remove(br,bh+bm)}return}bm=bm.split(" ");while((bh=bm[bp++])){bt=bh;e=null;bf=bh.indexOf(".")<0;bk=[];if(!bf){bk=bh.split(".");bh=bk.shift();bn=new RegExp("(^|\\.)"+a.map(bk.slice(0).sort(),E).join("\\.(?:.*\\.)?")+"(\\.|$)")}bl=bd[bh];if(!bl){continue}if(!be){for(bo=0;bo<bl.length;bo++){e=bl[bo];if(bf||bn.test(e.namespace)){a.event.remove(br,bt,e.handler,bo);bl.splice(bo--,1)}}continue}bg=a.event.special[bh]||{};for(bo=bi||0;bo<bl.length;bo++){e=bl[bo];if(be.guid===e.guid){if(bf||bn.test(e.namespace)){if(bi==null){bl.splice(bo--,1)}if(bg.remove){bg.remove.call(br,e)}}if(bi!=null){break}}}if(bl.length===0||bi!=null&&bl.length===1){if(!bg.teardown||bg.teardown.call(br,bk)===false){a.removeEvent(br,bh,bq.handle)}bu=null;delete bd[bh]}}if(a.isEmptyObject(bd)){var bs=bq.handle;if(bs){bs.elem=null}delete bq.events;delete bq.handle;if(a.isEmptyObject(bq)){a.removeData(br,H,true)}}},trigger:function(bd,bi,bf){var bm=bd.type||bd,bh=arguments[3];if(!bh){bd=typeof bd==="object"?bd[a.expando]?bd:a.extend(a.Event(bm),bd):a.Event(bm);if(bm.indexOf("!")>=0){bd.type=bm=bm.slice(0,-1);bd.exclusive=true}if(!bf){bd.stopPropagation();if(a.event.global[bm]){a.each(a.cache,function(){var br=a.expando,bq=this[br];if(bq&&bq.events&&bq.events[bm]){a.event.trigger(bd,bi,bq.handle.elem)}})}}if(!bf||bf.nodeType===3||bf.nodeType===8){return H}bd.result=H;bd.target=bf;bi=a.makeArray(bi);bi.unshift(bd)}bd.currentTarget=bf;var bj=a._data(bf,"handle");if(bj){bj.apply(bf,bi)}var bo=bf.parentNode||bf.ownerDocument;try{if(!(bf&&bf.nodeName&&a.noData[bf.nodeName.toLowerCase()])){if(bf["on"+bm]&&bf["on"+bm].apply(bf,bi)===false){bd.result=false;bd.preventDefault()}}}catch(bn){}if(!bd.isPropagationStopped()&&bo){a.event.trigger(bd,bi,bo,true)}else{if(!bd.isDefaultPrevented()){var be,bk=bd.target,e=bm.replace(aP,""),bp=a.nodeName(bk,"a")&&e==="click",bl=a.event.special[e]||{};if((!bl._default||bl._default.call(bf,bd)===false)&&!bp&&!(bk&&bk.nodeName&&a.noData[bk.nodeName.toLowerCase()])){try{if(bk[e]){be=bk["on"+e];if(be){bk["on"+e]=null}a.event.triggered=true;bk[e]()}}catch(bg){}if(be){bk["on"+e]=be}a.event.triggered=false}}}},handle:function(e){var bl,be,bd,bn,bm,bh=[],bj=a.makeArray(arguments);e=bj[0]=a.event.fix(e||aY.event);e.currentTarget=this;bl=e.type.indexOf(".")<0&&!e.exclusive;if(!bl){bd=e.type.split(".");e.type=bd.shift();bh=bd.slice(0).sort();bn=new RegExp("(^|\\.)"+bh.join("\\.(?:.*\\.)?")+"(\\.|$)")}e.namespace=e.namespace||bh.join(".");bm=a._data(this,"events");be=(bm||{})[e.type];if(bm&&be){be=be.slice(0);for(var bg=0,bf=be.length;bg<bf;bg++){var bk=be[bg];if(bl||bn.test(bk.namespace)){e.handler=bk.handler;e.data=bk.data;e.handleObj=bk;var bi=bk.handler.apply(this,bj);if(bi!==H){e.result=bi;if(bi===false){e.preventDefault();e.stopPropagation()}}if(e.isImmediatePropagationStopped()){break}}}}return e.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(bf){if(bf[a.expando]){return bf}var bd=bf;bf=a.Event(bd);for(var be=this.props.length,bh;be;){bh=this.props[--be];bf[bh]=bd[bh]}if(!bf.target){bf.target=bf.srcElement||al}if(bf.target.nodeType===3){bf.target=bf.target.parentNode}if(!bf.relatedTarget&&bf.fromElement){bf.relatedTarget=bf.fromElement===bf.target?bf.toElement:bf.fromElement}if(bf.pageX==null&&bf.clientX!=null){var bg=al.documentElement,e=al.body;bf.pageX=bf.clientX+(bg&&bg.scrollLeft||e&&e.scrollLeft||0)-(bg&&bg.clientLeft||e&&e.clientLeft||0);bf.pageY=bf.clientY+(bg&&bg.scrollTop||e&&e.scrollTop||0)-(bg&&bg.clientTop||e&&e.clientTop||0)}if(bf.which==null&&(bf.charCode!=null||bf.keyCode!=null)){bf.which=bf.charCode!=null?bf.charCode:bf.keyCode}if(!bf.metaKey&&bf.ctrlKey){bf.metaKey=bf.ctrlKey}if(!bf.which&&bf.button!==H){bf.which=(bf.button&1?1:(bf.button&2?3:(bf.button&4?2:0)))}return bf},guid:100000000,proxy:a.proxy,special:{ready:{setup:a.bindReady,teardown:a.noop},live:{add:function(e){a.event.add(this,n(e.origType,e.selector),a.extend({},e,{handler:af,guid:e.handler.guid}))},remove:function(e){a.event.remove(this,n(e.origType,e.selector),e)}},beforeunload:{setup:function(be,bd,e){if(a.isWindow(this)){this.onbeforeunload=e}},teardown:function(bd,e){if(this.onbeforeunload===e){this.onbeforeunload=null}}}}};a.removeEvent=al.removeEventListener?function(bd,e,be){if(bd.removeEventListener){bd.removeEventListener(e,be,false)}}:function(bd,e,be){if(bd.detachEvent){bd.detachEvent("on"+e,be)}};a.Event=function(e){if(!this.preventDefault){return new a.Event(e)}if(e&&e.type){this.originalEvent=e;this.type=e.type;this.isDefaultPrevented=(e.defaultPrevented||e.returnValue===false||e.getPreventDefault&&e.getPreventDefault())?h:a5}else{this.type=e}this.timeStamp=a.now();this[a.expando]=true};function a5(){return false}function h(){return true}a.Event.prototype={preventDefault:function(){this.isDefaultPrevented=h;var bd=this.originalEvent;if(!bd){return}if(bd.preventDefault){bd.preventDefault()}else{bd.returnValue=false}},stopPropagation:function(){this.isPropagationStopped=h;var bd=this.originalEvent;if(!bd){return}if(bd.stopPropagation){bd.stopPropagation()}bd.cancelBubble=true},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=h;this.stopPropagation()},isDefaultPrevented:a5,isPropagationStopped:a5,isImmediatePropagationStopped:a5};var Z=function(be){var bd=be.relatedTarget;try{if(bd!==al&&!bd.parentNode){return}while(bd&&bd!==this){bd=bd.parentNode}if(bd!==this){be.type=be.data;a.event.handle.apply(this,arguments)}}catch(bf){}},aK=function(e){e.type=e.data;a.event.handle.apply(this,arguments)};a.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(bd,e){a.event.special[bd]={setup:function(be){a.event.add(this,e,be&&be.selector?aK:Z,bd)},teardown:function(be){a.event.remove(this,e,be&&be.selector?aK:Z)}}});if(!a.support.submitBubbles){a.event.special.submit={setup:function(bd,e){if(this.nodeName&&this.nodeName.toLowerCase()!=="form"){a.event.add(this,"click.specialSubmit",function(bg){var bf=bg.target,be=bf.type;if((be==="submit"||be==="image")&&a(bf).closest("form").length){aN("submit",this,arguments)}});a.event.add(this,"keypress.specialSubmit",function(bg){var bf=bg.target,be=bf.type;if((be==="text"||be==="password")&&a(bf).closest("form").length&&bg.keyCode===13){aN("submit",this,arguments)}})}else{return false}},teardown:function(e){a.event.remove(this,".specialSubmit")}}}if(!a.support.changeBubbles){var a6,j=function(bd){var e=bd.type,be=bd.value;if(e==="radio"||e==="checkbox"){be=bd.checked}else{if(e==="select-multiple"){be=bd.selectedIndex>-1?a.map(bd.options,function(bf){return bf.selected}).join("-"):""}else{if(bd.nodeName.toLowerCase()==="select"){be=bd.selectedIndex}}}return be},X=function X(bf){var bd=bf.target,be,bg;if(!a0.test(bd.nodeName)||bd.readOnly){return}be=a._data(bd,"_change_data");bg=j(bd);if(bf.type!=="focusout"||bd.type!=="radio"){a._data(bd,"_change_data",bg)}if(be===H||bg===be){return}if(be!=null||bg){bf.type="change";bf.liveFired=H;a.event.trigger(bf,arguments[1],bd)}};a.event.special.change={filters:{focusout:X,beforedeactivate:X,click:function(bf){var be=bf.target,bd=be.type;if(bd==="radio"||bd==="checkbox"||be.nodeName.toLowerCase()==="select"){X.call(this,bf)}},keydown:function(bf){var be=bf.target,bd=be.type;if((bf.keyCode===13&&be.nodeName.toLowerCase()!=="textarea")||(bf.keyCode===32&&(bd==="checkbox"||bd==="radio"))||bd==="select-multiple"){X.call(this,bf)}},beforeactivate:function(be){var bd=be.target;a._data(bd,"_change_data",j(bd))}},setup:function(be,bd){if(this.type==="file"){return false}for(var e in a6){a.event.add(this,e+".specialChange",a6[e])}return a0.test(this.nodeName)},teardown:function(e){a.event.remove(this,".specialChange");return a0.test(this.nodeName)}};a6=a.event.special.change.filters;a6.focus=a6.beforeactivate}function aN(bd,bf,e){var be=a.extend({},e[0]);be.type=bd;be.originalEvent={};be.liveFired=H;a.event.handle.call(bf,be);if(be.isDefaultPrevented()){e[0].preventDefault()}}if(al.addEventListener){a.each({focus:"focusin",blur:"focusout"},function(be,e){a.event.special[e]={setup:function(){this.addEventListener(be,bd,true)},teardown:function(){this.removeEventListener(be,bd,true)}};function bd(bf){bf=a.event.fix(bf);bf.type=e;return a.event.handle.call(this,bf)}})}a.each(["bind","one"],function(bd,e){a.fn[e]=function(bj,bk,bi){if(typeof bj==="object"){for(var bg in bj){this[e](bg,bk,bj[bg],bi)}return this}if(a.isFunction(bk)||bk===false){bi=bk;bk=H}var bh=e==="one"?a.proxy(bi,function(bl){a(this).unbind(bl,bh);return bi.apply(this,arguments)}):bi;if(bj==="unload"&&e!=="one"){this.one(bj,bk,bi)}else{for(var bf=0,be=this.length;bf<be;bf++){a.event.add(this[bf],bj,bh,bk)}}return this}});a.fn.extend({unbind:function(bg,bf){if(typeof bg==="object"&&!bg.preventDefault){for(var be in bg){this.unbind(be,bg[be])}}else{for(var bd=0,e=this.length;bd<e;bd++){a.event.remove(this[bd],bg,bf)}}return this},delegate:function(e,bd,bf,be){return this.live(bd,bf,be,e)},undelegate:function(e,bd,be){if(arguments.length===0){return this.unbind("live")}else{return this.die(bd,null,be,e)}},trigger:function(e,bd){return this.each(function(){a.event.trigger(e,bd,this)})},triggerHandler:function(e,be){if(this[0]){var bd=a.Event(e);bd.preventDefault();bd.stopPropagation();a.event.trigger(bd,be,this[0]);return bd.result}},toggle:function(be){var e=arguments,bd=1;while(bd<e.length){a.proxy(be,e[bd++])}return this.click(a.proxy(be,function(bf){var bg=(a._data(this,"lastToggle"+be.guid)||0)%bd;a._data(this,"lastToggle"+be.guid,bg+1);bf.preventDefault();return e[bg].apply(this,arguments)||false}))},hover:function(e,bd){return this.mouseenter(e).mouseleave(bd||e)}});var aH={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};a.each(["live","die"],function(bd,e){a.fn[e]=function(bn,bk,bp,bg){var bo,bl=0,bm,bf,br,bi=bg||this.selector,be=bg?this:a(this.context);if(typeof bn==="object"&&!bn.preventDefault){for(var bq in bn){be[e](bq,bk,bn[bq],bi)}return this}if(a.isFunction(bk)){bp=bk;bk=H}bn=(bn||"").split(" ");while((bo=bn[bl++])!=null){bm=aP.exec(bo);bf="";if(bm){bf=bm[0];bo=bo.replace(aP,"")}if(bo==="hover"){bn.push("mouseenter"+bf,"mouseleave"+bf);continue}br=bo;if(bo==="focus"||bo==="blur"){bn.push(aH[bo]+bf);bo=bo+bf}else{bo=(aH[bo]||bo)+bf}if(e==="live"){for(var bj=0,bh=be.length;bj<bh;bj++){a.event.add(be[bj],"live."+n(bo,bi),{data:bk,selector:bi,handler:bp,origType:bo,origHandler:bp,preType:br})}}else{be.unbind("live."+n(bo,bi),bp)}}return this}});function af(bn){var bk,bf,bt,bh,e,bp,bm,bo,bl,bs,bj,bi,br,bq=[],bg=[],bd=a._data(this,"events");if(bn.liveFired===this||!bd||!bd.live||bn.target.disabled||bn.button&&bn.type==="click"){return}if(bn.namespace){bi=new RegExp("(^|\\.)"+bn.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")}bn.liveFired=this;var be=bd.live.slice(0);for(bm=0;bm<be.length;bm++){e=be[bm];if(e.origType.replace(aP,"")===bn.type){bg.push(e.selector)}else{be.splice(bm--,1)}}bh=a(bn.target).closest(bg,bn.currentTarget);for(bo=0,bl=bh.length;bo<bl;bo++){bj=bh[bo];for(bm=0;bm<be.length;bm++){e=be[bm];if(bj.selector===e.selector&&(!bi||bi.test(e.namespace))&&!bj.elem.disabled){bp=bj.elem;bt=null;if(e.preType==="mouseenter"||e.preType==="mouseleave"){bn.type=e.preType;bt=a(bn.relatedTarget).closest(e.selector)[0]}if(!bt||bt!==bp){bq.push({elem:bp,handleObj:e,level:bj.level})}}}}for(bo=0,bl=bq.length;bo<bl;bo++){bh=bq[bo];if(bf&&bh.level>bf){break}bn.currentTarget=bh.elem;bn.data=bh.handleObj.data;bn.handleObj=bh.handleObj;br=bh.handleObj.origHandler.apply(bh.elem,arguments);if(br===false||bn.isPropagationStopped()){bf=bh.level;if(br===false){bk=false}if(bn.isImmediatePropagationStopped()){break}}}return bk}function n(bd,e){return(bd&&bd!=="*"?bd+".":"")+e.replace(K,"`").replace(aa,"&")}a.each(("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error").split(" "),function(bd,e){a.fn[e]=function(bf,be){if(be==null){be=bf;bf=null}return arguments.length>0?this.bind(e,bf,be):this.trigger(e)};if(a.attrFn){a.attrFn[e]=true}}); +/* + * Sizzle CSS Selector Engine + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){var bn=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,bo=0,br=Object.prototype.toString,bi=false,bh=true,bp=/\\/g,bv=/\W/;[0,0].sort(function(){bh=false;return 0});var bf=function(bA,e,bD,bE){bD=bD||[];e=e||al;var bG=e;if(e.nodeType!==1&&e.nodeType!==9){return[]}if(!bA||typeof bA!=="string"){return bD}var bx,bI,bL,bw,bH,bK,bJ,bC,bz=true,by=bf.isXML(e),bB=[],bF=bA;do{bn.exec("");bx=bn.exec(bF);if(bx){bF=bx[3];bB.push(bx[1]);if(bx[2]){bw=bx[3];break}}}while(bx);if(bB.length>1&&bj.exec(bA)){if(bB.length===2&&bk.relative[bB[0]]){bI=bs(bB[0]+bB[1],e)}else{bI=bk.relative[bB[0]]?[e]:bf(bB.shift(),e);while(bB.length){bA=bB.shift();if(bk.relative[bA]){bA+=bB.shift()}bI=bs(bA,bI)}}}else{if(!bE&&bB.length>1&&e.nodeType===9&&!by&&bk.match.ID.test(bB[0])&&!bk.match.ID.test(bB[bB.length-1])){bH=bf.find(bB.shift(),e,by);e=bH.expr?bf.filter(bH.expr,bH.set)[0]:bH.set[0]}if(e){bH=bE?{expr:bB.pop(),set:bl(bE)}:bf.find(bB.pop(),bB.length===1&&(bB[0]==="~"||bB[0]==="+")&&e.parentNode?e.parentNode:e,by);bI=bH.expr?bf.filter(bH.expr,bH.set):bH.set;if(bB.length>0){bL=bl(bI)}else{bz=false}while(bB.length){bK=bB.pop();bJ=bK;if(!bk.relative[bK]){bK=""}else{bJ=bB.pop()}if(bJ==null){bJ=e}bk.relative[bK](bL,bJ,by)}}else{bL=bB=[]}}if(!bL){bL=bI}if(!bL){bf.error(bK||bA)}if(br.call(bL)==="[object Array]"){if(!bz){bD.push.apply(bD,bL)}else{if(e&&e.nodeType===1){for(bC=0;bL[bC]!=null;bC++){if(bL[bC]&&(bL[bC]===true||bL[bC].nodeType===1&&bf.contains(e,bL[bC]))){bD.push(bI[bC])}}}else{for(bC=0;bL[bC]!=null;bC++){if(bL[bC]&&bL[bC].nodeType===1){bD.push(bI[bC])}}}}}else{bl(bL,bD)}if(bw){bf(bw,bG,bD,bE);bf.uniqueSort(bD)}return bD};bf.uniqueSort=function(bw){if(bq){bi=bh;bw.sort(bq);if(bi){for(var e=1;e<bw.length;e++){if(bw[e]===bw[e-1]){bw.splice(e--,1)}}}}return bw};bf.matches=function(e,bw){return bf(e,null,null,bw)};bf.matchesSelector=function(e,bw){return bf(bw,null,null,[e]).length>0};bf.find=function(bC,e,bD){var bB;if(!bC){return[]}for(var by=0,bx=bk.order.length;by<bx;by++){var bz,bA=bk.order[by];if((bz=bk.leftMatch[bA].exec(bC))){var bw=bz[1];bz.splice(1,1);if(bw.substr(bw.length-1)!=="\\"){bz[1]=(bz[1]||"").replace(bp,"");bB=bk.find[bA](bz,e,bD);if(bB!=null){bC=bC.replace(bk.match[bA],"");break}}}}if(!bB){bB=typeof e.getElementsByTagName!=="undefined"?e.getElementsByTagName("*"):[]}return{set:bB,expr:bC}};bf.filter=function(bG,bF,bJ,bz){var bB,e,bx=bG,bL=[],bD=bF,bC=bF&&bF[0]&&bf.isXML(bF[0]);while(bG&&bF.length){for(var bE in bk.filter){if((bB=bk.leftMatch[bE].exec(bG))!=null&&bB[2]){var bK,bI,bw=bk.filter[bE],by=bB[1];e=false;bB.splice(1,1);if(by.substr(by.length-1)==="\\"){continue}if(bD===bL){bL=[]}if(bk.preFilter[bE]){bB=bk.preFilter[bE](bB,bD,bJ,bL,bz,bC);if(!bB){e=bK=true}else{if(bB===true){continue}}}if(bB){for(var bA=0;(bI=bD[bA])!=null;bA++){if(bI){bK=bw(bI,bB,bA,bD);var bH=bz^!!bK;if(bJ&&bK!=null){if(bH){e=true}else{bD[bA]=false}}else{if(bH){bL.push(bI);e=true}}}}}if(bK!==H){if(!bJ){bD=bL}bG=bG.replace(bk.match[bE],"");if(!e){return[]}break}}}if(bG===bx){if(e==null){bf.error(bG)}else{break}}bx=bG}return bD};bf.error=function(e){throw"Syntax error, unrecognized expression: "+e};var bk=bf.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(e){return e.getAttribute("href")},type:function(e){return e.getAttribute("type")}},relative:{"+":function(bB,bw){var by=typeof bw==="string",bA=by&&!bv.test(bw),bC=by&&!bA;if(bA){bw=bw.toLowerCase()}for(var bx=0,e=bB.length,bz;bx<e;bx++){if((bz=bB[bx])){while((bz=bz.previousSibling)&&bz.nodeType!==1){}bB[bx]=bC||bz&&bz.nodeName.toLowerCase()===bw?bz||false:bz===bw}}if(bC){bf.filter(bw,bB,true)}},">":function(bB,bw){var bA,bz=typeof bw==="string",bx=0,e=bB.length;if(bz&&!bv.test(bw)){bw=bw.toLowerCase();for(;bx<e;bx++){bA=bB[bx];if(bA){var by=bA.parentNode;bB[bx]=by.nodeName.toLowerCase()===bw?by:false}}}else{for(;bx<e;bx++){bA=bB[bx];if(bA){bB[bx]=bz?bA.parentNode:bA.parentNode===bw}}if(bz){bf.filter(bw,bB,true)}}},"":function(by,bw,bA){var bz,bx=bo++,e=bt;if(typeof bw==="string"&&!bv.test(bw)){bw=bw.toLowerCase();bz=bw;e=bd}e("parentNode",bw,bx,by,bz,bA)},"~":function(by,bw,bA){var bz,bx=bo++,e=bt;if(typeof bw==="string"&&!bv.test(bw)){bw=bw.toLowerCase();bz=bw;e=bd}e("previousSibling",bw,bx,by,bz,bA)}},find:{ID:function(bw,bx,by){if(typeof bx.getElementById!=="undefined"&&!by){var e=bx.getElementById(bw[1]);return e&&e.parentNode?[e]:[]}},NAME:function(bx,bA){if(typeof bA.getElementsByName!=="undefined"){var bw=[],bz=bA.getElementsByName(bx[1]);for(var by=0,e=bz.length;by<e;by++){if(bz[by].getAttribute("name")===bx[1]){bw.push(bz[by])}}return bw.length===0?null:bw}},TAG:function(e,bw){if(typeof bw.getElementsByTagName!=="undefined"){return bw.getElementsByTagName(e[1])}}},preFilter:{CLASS:function(by,bw,bx,e,bB,bC){by=" "+by[1].replace(bp,"")+" ";if(bC){return by}for(var bz=0,bA;(bA=bw[bz])!=null;bz++){if(bA){if(bB^(bA.className&&(" "+bA.className+" ").replace(/[\t\n\r]/g," ").indexOf(by)>=0)){if(!bx){e.push(bA)}}else{if(bx){bw[bz]=false}}}}return false},ID:function(e){return e[1].replace(bp,"")},TAG:function(bw,e){return bw[1].replace(bp,"").toLowerCase()},CHILD:function(e){if(e[1]==="nth"){if(!e[2]){bf.error(e[0])}e[2]=e[2].replace(/^\+|\s*/g,"");var bw=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(e[2]==="even"&&"2n"||e[2]==="odd"&&"2n+1"||!/\D/.test(e[2])&&"0n+"+e[2]||e[2]);e[2]=(bw[1]+(bw[2]||1))-0;e[3]=bw[3]-0}else{if(e[2]){bf.error(e[0])}}e[0]=bo++;return e},ATTR:function(bz,bw,bx,e,bA,bB){var by=bz[1]=bz[1].replace(bp,"");if(!bB&&bk.attrMap[by]){bz[1]=bk.attrMap[by]}bz[4]=(bz[4]||bz[5]||"").replace(bp,"");if(bz[2]==="~="){bz[4]=" "+bz[4]+" "}return bz},PSEUDO:function(bz,bw,bx,e,bA){if(bz[1]==="not"){if((bn.exec(bz[3])||"").length>1||/^\w/.test(bz[3])){bz[3]=bf(bz[3],null,null,bw)}else{var by=bf.filter(bz[3],bw,bx,true^bA);if(!bx){e.push.apply(e,by)}return false}}else{if(bk.match.POS.test(bz[0])||bk.match.CHILD.test(bz[0])){return true}}return bz},POS:function(e){e.unshift(true);return e}},filters:{enabled:function(e){return e.disabled===false&&e.type!=="hidden"},disabled:function(e){return e.disabled===true},checked:function(e){return e.checked===true},selected:function(e){if(e.parentNode){e.parentNode.selectedIndex}return e.selected===true},parent:function(e){return !!e.firstChild},empty:function(e){return !e.firstChild},has:function(bx,bw,e){return !!bf(e[3],bx).length},header:function(e){return(/h\d/i).test(e.nodeName)},text:function(e){return"text"===e.getAttribute("type")},radio:function(e){return"radio"===e.type},checkbox:function(e){return"checkbox"===e.type},file:function(e){return"file"===e.type},password:function(e){return"password"===e.type},submit:function(e){return"submit"===e.type},image:function(e){return"image"===e.type},reset:function(e){return"reset"===e.type},button:function(e){return"button"===e.type||e.nodeName.toLowerCase()==="button"},input:function(e){return(/input|select|textarea|button/i).test(e.nodeName)}},setFilters:{first:function(bw,e){return e===0},last:function(bx,bw,e,by){return bw===by.length-1},even:function(bw,e){return e%2===0},odd:function(bw,e){return e%2===1},lt:function(bx,bw,e){return bw<e[3]-0},gt:function(bx,bw,e){return bw>e[3]-0},nth:function(bx,bw,e){return e[3]-0===bw},eq:function(bx,bw,e){return e[3]-0===bw}},filter:{PSEUDO:function(bx,bC,bB,bD){var e=bC[1],bw=bk.filters[e];if(bw){return bw(bx,bB,bC,bD)}else{if(e==="contains"){return(bx.textContent||bx.innerText||bf.getText([bx])||"").indexOf(bC[3])>=0}else{if(e==="not"){var by=bC[3];for(var bA=0,bz=by.length;bA<bz;bA++){if(by[bA]===bx){return false}}return true}else{bf.error(e)}}}},CHILD:function(e,by){var bB=by[1],bw=e;switch(bB){case"only":case"first":while((bw=bw.previousSibling)){if(bw.nodeType===1){return false}}if(bB==="first"){return true}bw=e;case"last":while((bw=bw.nextSibling)){if(bw.nodeType===1){return false}}return true;case"nth":var bx=by[2],bE=by[3];if(bx===1&&bE===0){return true}var bA=by[0],bD=e.parentNode;if(bD&&(bD.sizcache!==bA||!e.nodeIndex)){var bz=0;for(bw=bD.firstChild;bw;bw=bw.nextSibling){if(bw.nodeType===1){bw.nodeIndex=++bz}}bD.sizcache=bA}var bC=e.nodeIndex-bE;if(bx===0){return bC===0}else{return(bC%bx===0&&bC/bx>=0)}}},ID:function(bw,e){return bw.nodeType===1&&bw.getAttribute("id")===e},TAG:function(bw,e){return(e==="*"&&bw.nodeType===1)||bw.nodeName.toLowerCase()===e},CLASS:function(bw,e){return(" "+(bw.className||bw.getAttribute("class"))+" ").indexOf(e)>-1},ATTR:function(bA,by){var bx=by[1],e=bk.attrHandle[bx]?bk.attrHandle[bx](bA):bA[bx]!=null?bA[bx]:bA.getAttribute(bx),bB=e+"",bz=by[2],bw=by[4];return e==null?bz==="!=":bz==="="?bB===bw:bz==="*="?bB.indexOf(bw)>=0:bz==="~="?(" "+bB+" ").indexOf(bw)>=0:!bw?bB&&e!==false:bz==="!="?bB!==bw:bz==="^="?bB.indexOf(bw)===0:bz==="$="?bB.substr(bB.length-bw.length)===bw:bz==="|="?bB===bw||bB.substr(0,bw.length+1)===bw+"-":false},POS:function(bz,bw,bx,bA){var e=bw[2],by=bk.setFilters[e];if(by){return by(bz,bx,bw,bA)}}}};var bj=bk.match.POS,be=function(bw,e){return"\\"+(e-0+1)};for(var bg in bk.match){bk.match[bg]=new RegExp(bk.match[bg].source+(/(?![^\[]*\])(?![^\(]*\))/.source));bk.leftMatch[bg]=new RegExp(/(^(?:.|\r|\n)*?)/.source+bk.match[bg].source.replace(/\\(\d+)/g,be))}var bl=function(bw,e){bw=Array.prototype.slice.call(bw,0);if(e){e.push.apply(e,bw);return e}return bw};try{Array.prototype.slice.call(al.documentElement.childNodes,0)[0].nodeType}catch(bu){bl=function(bz,by){var bx=0,bw=by||[];if(br.call(bz)==="[object Array]"){Array.prototype.push.apply(bw,bz)}else{if(typeof bz.length==="number"){for(var e=bz.length;bx<e;bx++){bw.push(bz[bx])}}else{for(;bz[bx];bx++){bw.push(bz[bx])}}}return bw}}var bq,bm;if(al.documentElement.compareDocumentPosition){bq=function(bw,e){if(bw===e){bi=true;return 0}if(!bw.compareDocumentPosition||!e.compareDocumentPosition){return bw.compareDocumentPosition?-1:1}return bw.compareDocumentPosition(e)&4?-1:1}}else{bq=function(bD,bC){var bA,bw,bx=[],e=[],bz=bD.parentNode,bB=bC.parentNode,bE=bz;if(bD===bC){bi=true;return 0}else{if(bz===bB){return bm(bD,bC)}else{if(!bz){return -1}else{if(!bB){return 1}}}}while(bE){bx.unshift(bE);bE=bE.parentNode}bE=bB;while(bE){e.unshift(bE);bE=bE.parentNode}bA=bx.length;bw=e.length;for(var by=0;by<bA&&by<bw;by++){if(bx[by]!==e[by]){return bm(bx[by],e[by])}}return by===bA?bm(bD,e[by],-1):bm(bx[by],bC,1)};bm=function(bw,e,bx){if(bw===e){return bx}var by=bw.nextSibling;while(by){if(by===e){return -1}by=by.nextSibling}return 1}}bf.getText=function(e){var bw="",by;for(var bx=0;e[bx];bx++){by=e[bx];if(by.nodeType===3||by.nodeType===4){bw+=by.nodeValue}else{if(by.nodeType!==8){bw+=bf.getText(by.childNodes)}}}return bw};(function(){var bw=al.createElement("div"),bx="script"+(new Date()).getTime(),e=al.documentElement;bw.innerHTML="<a name='"+bx+"'/>";e.insertBefore(bw,e.firstChild);if(al.getElementById(bx)){bk.find.ID=function(bz,bA,bB){if(typeof bA.getElementById!=="undefined"&&!bB){var by=bA.getElementById(bz[1]);return by?by.id===bz[1]||typeof by.getAttributeNode!=="undefined"&&by.getAttributeNode("id").nodeValue===bz[1]?[by]:H:[]}};bk.filter.ID=function(bA,by){var bz=typeof bA.getAttributeNode!=="undefined"&&bA.getAttributeNode("id");return bA.nodeType===1&&bz&&bz.nodeValue===by}}e.removeChild(bw);e=bw=null})();(function(){var e=al.createElement("div");e.appendChild(al.createComment(""));if(e.getElementsByTagName("*").length>0){bk.find.TAG=function(bw,bA){var bz=bA.getElementsByTagName(bw[1]);if(bw[1]==="*"){var by=[];for(var bx=0;bz[bx];bx++){if(bz[bx].nodeType===1){by.push(bz[bx])}}bz=by}return bz}}e.innerHTML="<a href='#'></a>";if(e.firstChild&&typeof e.firstChild.getAttribute!=="undefined"&&e.firstChild.getAttribute("href")!=="#"){bk.attrHandle.href=function(bw){return bw.getAttribute("href",2)}}e=null})();if(al.querySelectorAll){(function(){var e=bf,by=al.createElement("div"),bx="__sizzle__";by.innerHTML="<p class='TEST'></p>";if(by.querySelectorAll&&by.querySelectorAll(".TEST").length===0){return}bf=function(bJ,bA,bE,bI){bA=bA||al;if(!bI&&!bf.isXML(bA)){var bH=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(bJ);if(bH&&(bA.nodeType===1||bA.nodeType===9)){if(bH[1]){return bl(bA.getElementsByTagName(bJ),bE)}else{if(bH[2]&&bk.find.CLASS&&bA.getElementsByClassName){return bl(bA.getElementsByClassName(bH[2]),bE)}}}if(bA.nodeType===9){if(bJ==="body"&&bA.body){return bl([bA.body],bE)}else{if(bH&&bH[3]){var bD=bA.getElementById(bH[3]);if(bD&&bD.parentNode){if(bD.id===bH[3]){return bl([bD],bE)}}else{return bl([],bE)}}}try{return bl(bA.querySelectorAll(bJ),bE)}catch(bF){}}else{if(bA.nodeType===1&&bA.nodeName.toLowerCase()!=="object"){var bB=bA,bC=bA.getAttribute("id"),bz=bC||bx,bL=bA.parentNode,bK=/^\s*[+~]/.test(bJ);if(!bC){bA.setAttribute("id",bz)}else{bz=bz.replace(/'/g,"\\$&")}if(bK&&bL){bA=bA.parentNode}try{if(!bK||bL){return bl(bA.querySelectorAll("[id='"+bz+"'] "+bJ),bE)}}catch(bG){}finally{if(!bC){bB.removeAttribute("id")}}}}}return e(bJ,bA,bE,bI)};for(var bw in e){bf[bw]=e[bw]}by=null})()}(function(){var e=al.documentElement,bx=e.matchesSelector||e.mozMatchesSelector||e.webkitMatchesSelector||e.msMatchesSelector,bw=false;try{bx.call(al.documentElement,"[test!='']:sizzle")}catch(by){bw=true}if(bx){bf.matchesSelector=function(bz,bB){bB=bB.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!bf.isXML(bz)){try{if(bw||!bk.match.PSEUDO.test(bB)&&!/!=/.test(bB)){return bx.call(bz,bB)}}catch(bA){}}return bf(bB,null,null,[bz]).length>0}}})();(function(){var e=al.createElement("div");e.innerHTML="<div class='test e'></div><div class='test'></div>";if(!e.getElementsByClassName||e.getElementsByClassName("e").length===0){return}e.lastChild.className="e";if(e.getElementsByClassName("e").length===1){return}bk.order.splice(1,0,"CLASS");bk.find.CLASS=function(bw,bx,by){if(typeof bx.getElementsByClassName!=="undefined"&&!by){return bx.getElementsByClassName(bw[1])}};e=null})();function bd(bw,bB,bA,bE,bC,bD){for(var by=0,bx=bE.length;by<bx;by++){var e=bE[by];if(e){var bz=false;e=e[bw];while(e){if(e.sizcache===bA){bz=bE[e.sizset];break}if(e.nodeType===1&&!bD){e.sizcache=bA;e.sizset=by}if(e.nodeName.toLowerCase()===bB){bz=e;break}e=e[bw]}bE[by]=bz}}}function bt(bw,bB,bA,bE,bC,bD){for(var by=0,bx=bE.length;by<bx;by++){var e=bE[by];if(e){var bz=false;e=e[bw];while(e){if(e.sizcache===bA){bz=bE[e.sizset];break}if(e.nodeType===1){if(!bD){e.sizcache=bA;e.sizset=by}if(typeof bB!=="string"){if(e===bB){bz=true;break}}else{if(bf.filter(bB,[e]).length>0){bz=e;break}}}e=e[bw]}bE[by]=bz}}}if(al.documentElement.contains){bf.contains=function(bw,e){return bw!==e&&(bw.contains?bw.contains(e):true)}}else{if(al.documentElement.compareDocumentPosition){bf.contains=function(bw,e){return !!(bw.compareDocumentPosition(e)&16)}}else{bf.contains=function(){return false}}}bf.isXML=function(e){var bw=(e?e.ownerDocument||e:0).documentElement;return bw?bw.nodeName!=="HTML":false};var bs=function(e,bC){var bA,by=[],bz="",bx=bC.nodeType?[bC]:bC;while((bA=bk.match.PSEUDO.exec(e))){bz+=bA[0];e=e.replace(bk.match.PSEUDO,"")}e=bk.relative[e]?e+"*":e;for(var bB=0,bw=bx.length;bB<bw;bB++){bf(e,bx[bB],by)}return bf.filter(bz,by)};a.find=bf;a.expr=bf.selectors;a.expr[":"]=a.expr.filters;a.unique=bf.uniqueSort;a.text=bf.getText;a.isXMLDoc=bf.isXML;a.contains=bf.contains})();var W=/Until$/,ai=/^(?:parents|prevUntil|prevAll)/,aW=/,/,a9=/^.[^:#\[\.,]*$/,M=Array.prototype.slice,F=a.expr.match.POS,ao={children:true,contents:true,next:true,prev:true};a.fn.extend({find:function(e){var be=this.pushStack("","find",e),bh=0;for(var bf=0,bd=this.length;bf<bd;bf++){bh=be.length;a.find(e,this[bf],be);if(bf>0){for(var bi=bh;bi<be.length;bi++){for(var bg=0;bg<bh;bg++){if(be[bg]===be[bi]){be.splice(bi--,1);break}}}}}return be},has:function(bd){var e=a(bd);return this.filter(function(){for(var bf=0,be=e.length;bf<be;bf++){if(a.contains(this,e[bf])){return true}}})},not:function(e){return this.pushStack(av(this,e,false),"not",e)},filter:function(e){return this.pushStack(av(this,e,true),"filter",e)},is:function(e){return !!e&&a.filter(e,this).length>0},closest:function(bm,bd){var bj=[],bg,be,bl=this[0];if(a.isArray(bm)){var bi,bf,bh={},e=1;if(bl&&bm.length){for(bg=0,be=bm.length;bg<be;bg++){bf=bm[bg];if(!bh[bf]){bh[bf]=a.expr.match.POS.test(bf)?a(bf,bd||this.context):bf}}while(bl&&bl.ownerDocument&&bl!==bd){for(bf in bh){bi=bh[bf];if(bi.jquery?bi.index(bl)>-1:a(bl).is(bi)){bj.push({selector:bf,elem:bl,level:e})}}bl=bl.parentNode;e++}}return bj}var bk=F.test(bm)?a(bm,bd||this.context):null;for(bg=0,be=this.length;bg<be;bg++){bl=this[bg];while(bl){if(bk?bk.index(bl)>-1:a.find.matchesSelector(bl,bm)){bj.push(bl);break}else{bl=bl.parentNode;if(!bl||!bl.ownerDocument||bl===bd){break}}}}bj=bj.length>1?a.unique(bj):bj;return this.pushStack(bj,"closest",bm)},index:function(e){if(!e||typeof e==="string"){return a.inArray(this[0],e?a(e):this.parent().children())}return a.inArray(e.jquery?e[0]:e,this)},add:function(e,bd){var bf=typeof e==="string"?a(e,bd):a.makeArray(e),be=a.merge(this.get(),bf);return this.pushStack(B(bf[0])||B(be[0])?be:a.unique(be))},andSelf:function(){return this.add(this.prevObject)}});function B(e){return !e||!e.parentNode||e.parentNode.nodeType===11}a.each({parent:function(bd){var e=bd.parentNode;return e&&e.nodeType!==11?e:null},parents:function(e){return a.dir(e,"parentNode")},parentsUntil:function(bd,e,be){return a.dir(bd,"parentNode",be)},next:function(e){return a.nth(e,2,"nextSibling")},prev:function(e){return a.nth(e,2,"previousSibling")},nextAll:function(e){return a.dir(e,"nextSibling")},prevAll:function(e){return a.dir(e,"previousSibling")},nextUntil:function(bd,e,be){return a.dir(bd,"nextSibling",be)},prevUntil:function(bd,e,be){return a.dir(bd,"previousSibling",be)},siblings:function(e){return a.sibling(e.parentNode.firstChild,e)},children:function(e){return a.sibling(e.firstChild)},contents:function(e){return a.nodeName(e,"iframe")?e.contentDocument||e.contentWindow.document:a.makeArray(e.childNodes)}},function(e,bd){a.fn[e]=function(bh,be){var bg=a.map(this,bd,bh),bf=M.call(arguments);if(!W.test(e)){be=bh}if(be&&typeof be==="string"){bg=a.filter(be,bg)}bg=this.length>1&&!ao[e]?a.unique(bg):bg;if((this.length>1||aW.test(be))&&ai.test(e)){bg=bg.reverse()}return this.pushStack(bg,e,bf.join(","))}});a.extend({filter:function(be,e,bd){if(bd){be=":not("+be+")"}return e.length===1?a.find.matchesSelector(e[0],be)?[e[0]]:[]:a.find.matches(be,e)},dir:function(be,bd,bg){var e=[],bf=be[bd];while(bf&&bf.nodeType!==9&&(bg===H||bf.nodeType!==1||!a(bf).is(bg))){if(bf.nodeType===1){e.push(bf)}bf=bf[bd]}return e},nth:function(bg,e,be,bf){e=e||1;var bd=0;for(;bg;bg=bg[be]){if(bg.nodeType===1&&++bd===e){break}}return bg},sibling:function(be,bd){var e=[];for(;be;be=be.nextSibling){if(be.nodeType===1&&be!==bd){e.push(be)}}return e}});function av(bf,be,e){if(a.isFunction(be)){return a.grep(bf,function(bh,bg){var bi=!!be.call(bh,bg,bh);return bi===e})}else{if(be.nodeType){return a.grep(bf,function(bh,bg){return(bh===be)===e})}else{if(typeof be==="string"){var bd=a.grep(bf,function(bg){return bg.nodeType===1});if(a9.test(be)){return a.filter(be,bd,!e)}else{be=a.filter(be,bd)}}}}return a.grep(bf,function(bh,bg){return(a.inArray(bh,be)>=0)===e})}var ab=/ jQuery\d+="(?:\d+|null)"/g,aj=/^\s+/,O=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,c=/<([\w:]+)/,v=/<tbody/i,T=/<|&#?\w+;/,L=/<(?:script|object|embed|option|style)/i,m=/checked\s*(?:[^=]|=\s*.checked.)/i,an={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};an.optgroup=an.option;an.tbody=an.tfoot=an.colgroup=an.caption=an.thead;an.th=an.td;if(!a.support.htmlSerialize){an._default=[1,"div<div>","</div>"]}a.fn.extend({text:function(e){if(a.isFunction(e)){return this.each(function(be){var bd=a(this);bd.text(e.call(this,be,bd.text()))})}if(typeof e!=="object"&&e!==H){return this.empty().append((this[0]&&this[0].ownerDocument||al).createTextNode(e))}return a.text(this)},wrapAll:function(e){if(a.isFunction(e)){return this.each(function(be){a(this).wrapAll(e.call(this,be))})}if(this[0]){var bd=a(e,this[0].ownerDocument).eq(0).clone(true);if(this[0].parentNode){bd.insertBefore(this[0])}bd.map(function(){var be=this;while(be.firstChild&&be.firstChild.nodeType===1){be=be.firstChild}return be}).append(this)}return this},wrapInner:function(e){if(a.isFunction(e)){return this.each(function(bd){a(this).wrapInner(e.call(this,bd))})}return this.each(function(){var bd=a(this),be=bd.contents();if(be.length){be.wrapAll(e)}else{bd.append(e)}})},wrap:function(e){return this.each(function(){a(this).wrapAll(e)})},unwrap:function(){return this.parent().each(function(){if(!a.nodeName(this,"body")){a(this).replaceWith(this.childNodes)}}).end()},append:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.appendChild(e)}})},prepend:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.insertBefore(e,this.firstChild)}})},before:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bd){this.parentNode.insertBefore(bd,this)})}else{if(arguments.length){var e=a(arguments[0]);e.push.apply(e,this.toArray());return this.pushStack(e,"before",arguments)}}},after:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bd){this.parentNode.insertBefore(bd,this.nextSibling)})}else{if(arguments.length){var e=this.pushStack(this,"after",arguments);e.push.apply(e,a(arguments[0]).toArray());return e}}},remove:function(e,bf){for(var bd=0,be;(be=this[bd])!=null;bd++){if(!e||a.filter(e,[be]).length){if(!bf&&be.nodeType===1){a.cleanData(be.getElementsByTagName("*"));a.cleanData([be])}if(be.parentNode){be.parentNode.removeChild(be)}}}return this},empty:function(){for(var e=0,bd;(bd=this[e])!=null;e++){if(bd.nodeType===1){a.cleanData(bd.getElementsByTagName("*"))}while(bd.firstChild){bd.removeChild(bd.firstChild)}}return this},clone:function(bd,e){bd=bd==null?false:bd;e=e==null?bd:e;return this.map(function(){return a.clone(this,bd,e)})},html:function(bf){if(bf===H){return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(ab,""):null}else{if(typeof bf==="string"&&!L.test(bf)&&(a.support.leadingWhitespace||!aj.test(bf))&&!an[(c.exec(bf)||["",""])[1].toLowerCase()]){bf=bf.replace(O,"<$1></$2>");try{for(var be=0,bd=this.length;be<bd;be++){if(this[be].nodeType===1){a.cleanData(this[be].getElementsByTagName("*"));this[be].innerHTML=bf}}}catch(bg){this.empty().append(bf)}}else{if(a.isFunction(bf)){this.each(function(bh){var e=a(this);e.html(bf.call(this,bh,e.html()))})}else{this.empty().append(bf)}}}return this},replaceWith:function(e){if(this[0]&&this[0].parentNode){if(a.isFunction(e)){return this.each(function(bf){var be=a(this),bd=be.html();be.replaceWith(e.call(this,bf,bd))})}if(typeof e!=="string"){e=a(e).detach()}return this.each(function(){var be=this.nextSibling,bd=this.parentNode;a(this).remove();if(be){a(be).before(e)}else{a(bd).append(e)}})}else{return this.pushStack(a(a.isFunction(e)?e():e),"replaceWith",e)}},detach:function(e){return this.remove(e,true)},domManip:function(bj,bn,bm){var bf,bg,bi,bl,bk=bj[0],bd=[];if(!a.support.checkClone&&arguments.length===3&&typeof bk==="string"&&m.test(bk)){return this.each(function(){a(this).domManip(bj,bn,bm,true)})}if(a.isFunction(bk)){return this.each(function(bp){var bo=a(this);bj[0]=bk.call(this,bp,bn?bo.html():H);bo.domManip(bj,bn,bm)})}if(this[0]){bl=bk&&bk.parentNode;if(a.support.parentNode&&bl&&bl.nodeType===11&&bl.childNodes.length===this.length){bf={fragment:bl}}else{bf=a.buildFragment(bj,this,bd)}bi=bf.fragment;if(bi.childNodes.length===1){bg=bi=bi.firstChild}else{bg=bi.firstChild}if(bg){bn=bn&&a.nodeName(bg,"tr");for(var be=0,e=this.length,bh=e-1;be<e;be++){bm.call(bn?aX(this[be],bg):this[be],bf.cacheable||(e>1&&be<bh)?a.clone(bi,true,true):bi)}}if(bd.length){a.each(bd,a8)}}return this}});function aX(e,bd){return a.nodeName(e,"table")?(e.getElementsByTagName("tbody")[0]||e.appendChild(e.ownerDocument.createElement("tbody"))):e}function s(e,bj){if(bj.nodeType!==1||!a.hasData(e)){return}var bi=a.expando,bf=a.data(e),bg=a.data(bj,bf);if((bf=bf[bi])){var bk=bf.events;bg=bg[bi]=a.extend({},bf);if(bk){delete bg.handle;bg.events={};for(var bh in bk){for(var be=0,bd=bk[bh].length;be<bd;be++){a.event.add(bj,bh+(bk[bh][be].namespace?".":"")+bk[bh][be].namespace,bk[bh][be],bk[bh][be].data)}}}}}function ac(bd,e){if(e.nodeType!==1){return}var be=e.nodeName.toLowerCase();e.clearAttributes();e.mergeAttributes(bd);if(be==="object"){e.outerHTML=bd.outerHTML}else{if(be==="input"&&(bd.type==="checkbox"||bd.type==="radio")){if(bd.checked){e.defaultChecked=e.checked=bd.checked}if(e.value!==bd.value){e.value=bd.value}}else{if(be==="option"){e.selected=bd.defaultSelected}else{if(be==="input"||be==="textarea"){e.defaultValue=bd.defaultValue}}}}e.removeAttribute(a.expando)}a.buildFragment=function(bh,bf,bd){var bg,e,be,bi=(bf&&bf[0]?bf[0].ownerDocument||bf[0]:al);if(bh.length===1&&typeof bh[0]==="string"&&bh[0].length<512&&bi===al&&bh[0].charAt(0)==="<"&&!L.test(bh[0])&&(a.support.checkClone||!m.test(bh[0]))){e=true;be=a.fragments[bh[0]];if(be){if(be!==1){bg=be}}}if(!bg){bg=bi.createDocumentFragment();a.clean(bh,bi,bg,bd)}if(e){a.fragments[bh[0]]=be?bg:1}return{fragment:bg,cacheable:e}};a.fragments={};a.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,bd){a.fn[e]=function(be){var bh=[],bk=a(be),bj=this.length===1&&this[0].parentNode;if(bj&&bj.nodeType===11&&bj.childNodes.length===1&&bk.length===1){bk[bd](this[0]);return this}else{for(var bi=0,bf=bk.length;bi<bf;bi++){var bg=(bi>0?this.clone(true):this).get();a(bk[bi])[bd](bg);bh=bh.concat(bg)}return this.pushStack(bh,e,bk.selector)}}});function a1(e){if("getElementsByTagName" in e){return e.getElementsByTagName("*")}else{if("querySelectorAll" in e){return e.querySelectorAll("*")}else{return[]}}}a.extend({clone:function(bg,bi,be){var bh=bg.cloneNode(true),e,bd,bf;if((!a.support.noCloneEvent||!a.support.noCloneChecked)&&(bg.nodeType===1||bg.nodeType===11)&&!a.isXMLDoc(bg)){ac(bg,bh);e=a1(bg);bd=a1(bh);for(bf=0;e[bf];++bf){ac(e[bf],bd[bf])}}if(bi){s(bg,bh);if(be){e=a1(bg);bd=a1(bh);for(bf=0;e[bf];++bf){s(e[bf],bd[bf])}}}return bh},clean:function(be,bg,bn,bi){bg=bg||al;if(typeof bg.createElement==="undefined"){bg=bg.ownerDocument||bg[0]&&bg[0].ownerDocument||al}var bo=[];for(var bm=0,bh;(bh=be[bm])!=null;bm++){if(typeof bh==="number"){bh+=""}if(!bh){continue}if(typeof bh==="string"&&!T.test(bh)){bh=bg.createTextNode(bh)}else{if(typeof bh==="string"){bh=bh.replace(O,"<$1></$2>");var bp=(c.exec(bh)||["",""])[1].toLowerCase(),bf=an[bp]||an._default,bl=bf[0],bd=bg.createElement("div");bd.innerHTML=bf[1]+bh+bf[2];while(bl--){bd=bd.lastChild}if(!a.support.tbody){var e=v.test(bh),bk=bp==="table"&&!e?bd.firstChild&&bd.firstChild.childNodes:bf[1]==="<table>"&&!e?bd.childNodes:[];for(var bj=bk.length-1;bj>=0;--bj){if(a.nodeName(bk[bj],"tbody")&&!bk[bj].childNodes.length){bk[bj].parentNode.removeChild(bk[bj])}}}if(!a.support.leadingWhitespace&&aj.test(bh)){bd.insertBefore(bg.createTextNode(aj.exec(bh)[0]),bd.firstChild)}bh=bd.childNodes}}if(bh.nodeType){bo.push(bh)}else{bo=a.merge(bo,bh)}}if(bn){for(bm=0;bo[bm];bm++){if(bi&&a.nodeName(bo[bm],"script")&&(!bo[bm].type||bo[bm].type.toLowerCase()==="text/javascript")){bi.push(bo[bm].parentNode?bo[bm].parentNode.removeChild(bo[bm]):bo[bm])}else{if(bo[bm].nodeType===1){bo.splice.apply(bo,[bm+1,0].concat(a.makeArray(bo[bm].getElementsByTagName("script"))))}bn.appendChild(bo[bm])}}}return bo},cleanData:function(bd){var bg,be,e=a.cache,bl=a.expando,bj=a.event.special,bi=a.support.deleteExpando;for(var bh=0,bf;(bf=bd[bh])!=null;bh++){if(bf.nodeName&&a.noData[bf.nodeName.toLowerCase()]){continue}be=bf[a.expando];if(be){bg=e[be]&&e[be][bl];if(bg&&bg.events){for(var bk in bg.events){if(bj[bk]){a.event.remove(bf,bk)}else{a.removeEvent(bf,bk,bg.handle)}}if(bg.handle){bg.handle.elem=null}}if(bi){delete bf[a.expando]}else{if(bf.removeAttribute){bf.removeAttribute(a.expando)}}delete e[be]}}}});function a8(e,bd){if(bd.src){a.ajax({url:bd.src,async:false,dataType:"script"})}else{a.globalEval(bd.text||bd.textContent||bd.innerHTML||"")}if(bd.parentNode){bd.parentNode.removeChild(bd)}}var ae=/alpha\([^)]*\)/i,ak=/opacity=([^)]*)/,aM=/-([a-z])/ig,y=/([A-Z])/g,aZ=/^-?\d+(?:px)?$/i,a7=/^-?\d/,aV={position:"absolute",visibility:"hidden",display:"block"},ag=["Left","Right"],aR=["Top","Bottom"],U,ay,aL,l=function(e,bd){return bd.toUpperCase()};a.fn.css=function(e,bd){if(arguments.length===2&&bd===H){return this}return a.access(this,e,bd,true,function(bf,be,bg){return bg!==H?a.style(bf,be,bg):a.css(bf,be)})};a.extend({cssHooks:{opacity:{get:function(be,bd){if(bd){var e=U(be,"opacity","opacity");return e===""?"1":e}else{return be.style.opacity}}}},cssNumber:{zIndex:true,fontWeight:true,opacity:true,zoom:true,lineHeight:true},cssProps:{"float":a.support.cssFloat?"cssFloat":"styleFloat"},style:function(bf,be,bk,bg){if(!bf||bf.nodeType===3||bf.nodeType===8||!bf.style){return}var bj,bh=a.camelCase(be),bd=bf.style,bl=a.cssHooks[bh];be=a.cssProps[bh]||bh;if(bk!==H){if(typeof bk==="number"&&isNaN(bk)||bk==null){return}if(typeof bk==="number"&&!a.cssNumber[bh]){bk+="px"}if(!bl||!("set" in bl)||(bk=bl.set(bf,bk))!==H){try{bd[be]=bk}catch(bi){}}}else{if(bl&&"get" in bl&&(bj=bl.get(bf,false,bg))!==H){return bj}return bd[be]}},css:function(bh,bg,bd){var bf,be=a.camelCase(bg),e=a.cssHooks[be];bg=a.cssProps[be]||be;if(e&&"get" in e&&(bf=e.get(bh,true,bd))!==H){return bf}else{if(U){return U(bh,bg,be)}}},swap:function(bf,be,bg){var e={};for(var bd in be){e[bd]=bf.style[bd];bf.style[bd]=be[bd]}bg.call(bf);for(bd in be){bf.style[bd]=e[bd]}},camelCase:function(e){return e.replace(aM,l)}});a.curCSS=a.css;a.each(["height","width"],function(bd,e){a.cssHooks[e]={get:function(bg,bf,be){var bh;if(bf){if(bg.offsetWidth!==0){bh=o(bg,e,be)}else{a.swap(bg,aV,function(){bh=o(bg,e,be)})}if(bh<=0){bh=U(bg,e,e);if(bh==="0px"&&aL){bh=aL(bg,e,e)}if(bh!=null){return bh===""||bh==="auto"?"0px":bh}}if(bh<0||bh==null){bh=bg.style[e];return bh===""||bh==="auto"?"0px":bh}return typeof bh==="string"?bh:bh+"px"}},set:function(be,bf){if(aZ.test(bf)){bf=parseFloat(bf);if(bf>=0){return bf+"px"}}else{return bf}}}});if(!a.support.opacity){a.cssHooks.opacity={get:function(bd,e){return ak.test((e&&bd.currentStyle?bd.currentStyle.filter:bd.style.filter)||"")?(parseFloat(RegExp.$1)/100)+"":e?"1":""},set:function(bf,bg){var be=bf.style;be.zoom=1;var e=a.isNaN(bg)?"":"alpha(opacity="+bg*100+")",bd=be.filter||"";be.filter=ae.test(bd)?bd.replace(ae,e):be.filter+" "+e}}}if(al.defaultView&&al.defaultView.getComputedStyle){ay=function(bh,e,bf){var be,bg,bd;bf=bf.replace(y,"-$1").toLowerCase();if(!(bg=bh.ownerDocument.defaultView)){return H}if((bd=bg.getComputedStyle(bh,null))){be=bd.getPropertyValue(bf);if(be===""&&!a.contains(bh.ownerDocument.documentElement,bh)){be=a.style(bh,bf)}}return be}}if(al.documentElement.currentStyle){aL=function(bg,be){var bh,bd=bg.currentStyle&&bg.currentStyle[be],e=bg.runtimeStyle&&bg.runtimeStyle[be],bf=bg.style;if(!aZ.test(bd)&&a7.test(bd)){bh=bf.left;if(e){bg.runtimeStyle.left=bg.currentStyle.left}bf.left=be==="fontSize"?"1em":(bd||0);bd=bf.pixelLeft+"px";bf.left=bh;if(e){bg.runtimeStyle.left=e}}return bd===""?"auto":bd}}U=ay||aL;function o(be,bd,e){var bg=bd==="width"?ag:aR,bf=bd==="width"?be.offsetWidth:be.offsetHeight;if(e==="border"){return bf}a.each(bg,function(){if(!e){bf-=parseFloat(a.css(be,"padding"+this))||0}if(e==="margin"){bf+=parseFloat(a.css(be,"margin"+this))||0}else{bf-=parseFloat(a.css(be,"border"+this+"Width"))||0}});return bf}if(a.expr&&a.expr.filters){a.expr.filters.hidden=function(be){var bd=be.offsetWidth,e=be.offsetHeight;return(bd===0&&e===0)||(!a.support.reliableHiddenOffsets&&(be.style.display||a.css(be,"display"))==="none")};a.expr.filters.visible=function(e){return !a.expr.filters.hidden(e)}}var i=/%20/g,ah=/\[\]$/,bc=/\r?\n/g,ba=/#.*$/,ar=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,aO=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,aB=/(?:^file|^widget|\-extension):$/,aD=/^(?:GET|HEAD)$/,b=/^\/\//,I=/\?/,aU=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,p=/^(?:select|textarea)/i,g=/\s+/,bb=/([?&])_=[^&]*/,R=/(^|\-)([a-z])/g,aJ=function(bd,e,be){return e+be.toUpperCase()},G=/^([\w\+\.\-]+:)\/\/([^\/?#:]*)(?::(\d+))?/,z=a.fn.load,V={},q={},au,r;try{au=al.location.href}catch(am){au=al.createElement("a");au.href="";au=au.href}r=G.exec(au.toLowerCase());function d(e){return function(bg,bi){if(typeof bg!=="string"){bi=bg;bg="*"}if(a.isFunction(bi)){var bf=bg.toLowerCase().split(g),be=0,bh=bf.length,bd,bj,bk;for(;be<bh;be++){bd=bf[be];bk=/^\+/.test(bd);if(bk){bd=bd.substr(1)||"*"}bj=e[bd]=e[bd]||[];bj[bk?"unshift":"push"](bi)}}}}function aI(bd,bm,bh,bl,bj,bf){bj=bj||bm.dataTypes[0];bf=bf||{};bf[bj]=true;var bi=bd[bj],be=0,e=bi?bi.length:0,bg=(bd===V),bk;for(;be<e&&(bg||!bk);be++){bk=bi[be](bm,bh,bl);if(typeof bk==="string"){if(!bg||bf[bk]){bk=H}else{bm.dataTypes.unshift(bk);bk=aI(bd,bm,bh,bl,bk,bf)}}}if((bg||!bk)&&!bf["*"]){bk=aI(bd,bm,bh,bl,"*",bf)}return bk}a.fn.extend({load:function(be,bh,bi){if(typeof be!=="string"&&z){return z.apply(this,arguments)}else{if(!this.length){return this}}var bg=be.indexOf(" ");if(bg>=0){var e=be.slice(bg,be.length);be=be.slice(0,bg)}var bf="GET";if(bh){if(a.isFunction(bh)){bi=bh;bh=H}else{if(typeof bh==="object"){bh=a.param(bh,a.ajaxSettings.traditional);bf="POST"}}}var bd=this;a.ajax({url:be,type:bf,dataType:"html",data:bh,complete:function(bk,bj,bl){bl=bk.responseText;if(bk.isResolved()){bk.done(function(bm){bl=bm});bd.html(e?a("<div>").append(bl.replace(aU,"")).find(e):bl)}if(bi){bd.each(bi,[bl,bj,bk])}}});return this},serialize:function(){return a.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?a.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||p.test(this.nodeName)||aO.test(this.type))}).map(function(e,bd){var be=a(this).val();return be==null?null:a.isArray(be)?a.map(be,function(bg,bf){return{name:bd.name,value:bg.replace(bc,"\r\n")}}):{name:bd.name,value:be.replace(bc,"\r\n")}}).get()}});a.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(e,bd){a.fn[bd]=function(be){return this.bind(bd,be)}});a.each(["get","post"],function(e,bd){a[bd]=function(be,bg,bh,bf){if(a.isFunction(bg)){bf=bf||bh;bh=bg;bg=H}return a.ajax({type:bd,url:be,data:bg,success:bh,dataType:bf})}});a.extend({getScript:function(e,bd){return a.get(e,H,bd,"script")},getJSON:function(e,bd,be){return a.get(e,bd,be,"json")},ajaxSetup:function(be,e){if(!e){e=be;be=a.extend(true,a.ajaxSettings,e)}else{a.extend(true,be,a.ajaxSettings,e)}for(var bd in {context:1,url:1}){if(bd in e){be[bd]=e[bd]}else{if(bd in a.ajaxSettings){be[bd]=a.ajaxSettings[bd]}}}return be},ajaxSettings:{url:au,isLocal:aB.test(r[1]),global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":aY.String,"text html":true,"text json":a.parseJSON,"text xml":a.parseXML}},ajaxPrefilter:d(V),ajaxTransport:d(q),ajax:function(bh,bf){if(typeof bh==="object"){bf=bh;bh=H}bf=bf||{};var bl=a.ajaxSetup({},bf),bz=bl.context||bl,bo=bz!==bl&&(bz.nodeType||bz instanceof a)?a(bz):a.event,by=a.Deferred(),bv=a._Deferred(),bj=bl.statusCode||{},bk,bp={},bx,bg,bt,bm,bq,bi=0,be,bs,br={readyState:0,setRequestHeader:function(e,bA){if(!bi){bp[e.toLowerCase().replace(R,aJ)]=bA}return this},getAllResponseHeaders:function(){return bi===2?bx:null},getResponseHeader:function(bA){var e;if(bi===2){if(!bg){bg={};while((e=ar.exec(bx))){bg[e[1].toLowerCase()]=e[2]}}e=bg[bA.toLowerCase()]}return e===H?null:e},overrideMimeType:function(e){if(!bi){bl.mimeType=e}return this},abort:function(e){e=e||"abort";if(bt){bt.abort(e)}bn(0,e);return this}};function bn(bF,bD,bG,bC){if(bi===2){return}bi=2;if(bm){clearTimeout(bm)}bt=H;bx=bC||"";br.readyState=bF?4:0;var bA,bK,bJ,bE=bG?a4(bl,br,bG):H,bB,bI;if(bF>=200&&bF<300||bF===304){if(bl.ifModified){if((bB=br.getResponseHeader("Last-Modified"))){a.lastModified[bk]=bB}if((bI=br.getResponseHeader("Etag"))){a.etag[bk]=bI}}if(bF===304){bD="notmodified";bA=true}else{try{bK=D(bl,bE);bD="success";bA=true}catch(bH){bD="parsererror";bJ=bH}}}else{bJ=bD;if(!bD||bF){bD="error";if(bF<0){bF=0}}}br.status=bF;br.statusText=bD;if(bA){by.resolveWith(bz,[bK,bD,br])}else{by.rejectWith(bz,[br,bD,bJ])}br.statusCode(bj);bj=H;if(be){bo.trigger("ajax"+(bA?"Success":"Error"),[br,bl,bA?bK:bJ])}bv.resolveWith(bz,[br,bD]);if(be){bo.trigger("ajaxComplete",[br,bl]);if(!(--a.active)){a.event.trigger("ajaxStop")}}}by.promise(br);br.success=br.done;br.error=br.fail;br.complete=bv.done;br.statusCode=function(bA){if(bA){var e;if(bi<2){for(e in bA){bj[e]=[bj[e],bA[e]]}}else{e=bA[br.status];br.then(e,e)}}return this};bl.url=((bh||bl.url)+"").replace(ba,"").replace(b,r[1]+"//");bl.dataTypes=a.trim(bl.dataType||"*").toLowerCase().split(g);if(!bl.crossDomain){bq=G.exec(bl.url.toLowerCase());bl.crossDomain=!!(bq&&(bq[1]!=r[1]||bq[2]!=r[2]||(bq[3]||(bq[1]==="http:"?80:443))!=(r[3]||(r[1]==="http:"?80:443))))}if(bl.data&&bl.processData&&typeof bl.data!=="string"){bl.data=a.param(bl.data,bl.traditional)}aI(V,bl,bf,br);if(bi===2){return false}be=bl.global;bl.type=bl.type.toUpperCase();bl.hasContent=!aD.test(bl.type);if(be&&a.active++===0){a.event.trigger("ajaxStart")}if(!bl.hasContent){if(bl.data){bl.url+=(I.test(bl.url)?"&":"?")+bl.data}bk=bl.url;if(bl.cache===false){var bd=a.now(),bw=bl.url.replace(bb,"$1_="+bd);bl.url=bw+((bw===bl.url)?(I.test(bl.url)?"&":"?")+"_="+bd:"")}}if(bl.data&&bl.hasContent&&bl.contentType!==false||bf.contentType){bp["Content-Type"]=bl.contentType}if(bl.ifModified){bk=bk||bl.url;if(a.lastModified[bk]){bp["If-Modified-Since"]=a.lastModified[bk]}if(a.etag[bk]){bp["If-None-Match"]=a.etag[bk]}}bp.Accept=bl.dataTypes[0]&&bl.accepts[bl.dataTypes[0]]?bl.accepts[bl.dataTypes[0]]+(bl.dataTypes[0]!=="*"?", */*; q=0.01":""):bl.accepts["*"];for(bs in bl.headers){br.setRequestHeader(bs,bl.headers[bs])}if(bl.beforeSend&&(bl.beforeSend.call(bz,br,bl)===false||bi===2)){br.abort();return false}for(bs in {success:1,error:1,complete:1}){br[bs](bl[bs])}bt=aI(q,bl,bf,br);if(!bt){bn(-1,"No Transport")}else{br.readyState=1;if(be){bo.trigger("ajaxSend",[br,bl])}if(bl.async&&bl.timeout>0){bm=setTimeout(function(){br.abort("timeout")},bl.timeout)}try{bi=1;bt.send(bp,bn)}catch(bu){if(status<2){bn(-1,bu)}else{a.error(bu)}}}return br},param:function(e,be){var bd=[],bg=function(bh,bi){bi=a.isFunction(bi)?bi():bi;bd[bd.length]=encodeURIComponent(bh)+"="+encodeURIComponent(bi)};if(be===H){be=a.ajaxSettings.traditional}if(a.isArray(e)||(e.jquery&&!a.isPlainObject(e))){a.each(e,function(){bg(this.name,this.value)})}else{for(var bf in e){u(bf,e[bf],be,bg)}}return bd.join("&").replace(i,"+")}});function u(be,bg,bd,bf){if(a.isArray(bg)&&bg.length){a.each(bg,function(bi,bh){if(bd||ah.test(be)){bf(be,bh)}else{u(be+"["+(typeof bh==="object"||a.isArray(bh)?bi:"")+"]",bh,bd,bf)}})}else{if(!bd&&bg!=null&&typeof bg==="object"){if(a.isArray(bg)||a.isEmptyObject(bg)){bf(be,"")}else{for(var e in bg){u(be+"["+e+"]",bg[e],bd,bf)}}}else{bf(be,bg)}}}a.extend({active:0,lastModified:{},etag:{}});function a4(bl,bk,bh){var bd=bl.contents,bj=bl.dataTypes,be=bl.responseFields,bg,bi,bf,e;for(bi in be){if(bi in bh){bk[be[bi]]=bh[bi]}}while(bj[0]==="*"){bj.shift();if(bg===H){bg=bl.mimeType||bk.getResponseHeader("content-type")}}if(bg){for(bi in bd){if(bd[bi]&&bd[bi].test(bg)){bj.unshift(bi);break}}}if(bj[0] in bh){bf=bj[0]}else{for(bi in bh){if(!bj[0]||bl.converters[bi+" "+bj[0]]){bf=bi;break}if(!e){e=bi}}bf=bf||e}if(bf){if(bf!==bj[0]){bj.unshift(bf)}return bh[bf]}}function D(bp,bh){if(bp.dataFilter){bh=bp.dataFilter(bh,bp.dataType)}var bl=bp.dataTypes,bo={},bi,bm,be=bl.length,bj,bk=bl[0],bf,bg,bn,bd,e;for(bi=1;bi<be;bi++){if(bi===1){for(bm in bp.converters){if(typeof bm==="string"){bo[bm.toLowerCase()]=bp.converters[bm]}}}bf=bk;bk=bl[bi];if(bk==="*"){bk=bf}else{if(bf!=="*"&&bf!==bk){bg=bf+" "+bk;bn=bo[bg]||bo["* "+bk];if(!bn){e=H;for(bd in bo){bj=bd.split(" ");if(bj[0]===bf||bj[0]==="*"){e=bo[bj[1]+" "+bk];if(e){bd=bo[bd];if(bd===true){bn=e}else{if(e===true){bn=bd}}break}}}}if(!(bn||e)){a.error("No conversion from "+bg.replace(" "," to "))}if(bn!==true){bh=bn?bn(bh):e(bd(bh))}}}}return bh}var aq=a.now(),t=/(\=)\?(&|$)|()\?\?()/i;a.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return a.expando+"_"+(aq++)}});a.ajaxPrefilter("json jsonp",function(bm,bi,bl){var bk=(typeof bm.data==="string");if(bm.dataTypes[0]==="jsonp"||bi.jsonpCallback||bi.jsonp!=null||bm.jsonp!==false&&(t.test(bm.url)||bk&&t.test(bm.data))){var bj,be=bm.jsonpCallback=a.isFunction(bm.jsonpCallback)?bm.jsonpCallback():bm.jsonpCallback,bh=aY[be],e=bm.url,bg=bm.data,bd="$1"+be+"$2",bf=function(){aY[be]=bh;if(bj&&a.isFunction(bh)){aY[be](bj[0])}};if(bm.jsonp!==false){e=e.replace(t,bd);if(bm.url===e){if(bk){bg=bg.replace(t,bd)}if(bm.data===bg){e+=(/\?/.test(e)?"&":"?")+bm.jsonp+"="+be}}}bm.url=e;bm.data=bg;aY[be]=function(bn){bj=[bn]};bl.then(bf,bf);bm.converters["script json"]=function(){if(!bj){a.error(be+" was not called")}return bj[0]};bm.dataTypes[0]="json";return"script"}});a.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(e){a.globalEval(e);return e}}});a.ajaxPrefilter("script",function(e){if(e.cache===H){e.cache=false}if(e.crossDomain){e.type="GET";e.global=false}});a.ajaxTransport("script",function(be){if(be.crossDomain){var e,bd=al.head||al.getElementsByTagName("head")[0]||al.documentElement;return{send:function(bf,bg){e=al.createElement("script");e.async="async";if(be.scriptCharset){e.charset=be.scriptCharset}e.src=be.url;e.onload=e.onreadystatechange=function(bi,bh){if(!e.readyState||/loaded|complete/.test(e.readyState)){e.onload=e.onreadystatechange=null;if(bd&&e.parentNode){bd.removeChild(e)}e=H;if(!bh){bg(200,"success")}}};bd.insertBefore(e,bd.firstChild)},abort:function(){if(e){e.onload(0,1)}}}}});var x=a.now(),J,at;function A(){a(aY).unload(function(){for(var e in J){J[e](0,1)}})}function aA(){try{return new aY.XMLHttpRequest()}catch(bd){}}function ad(){try{return new aY.ActiveXObject("Microsoft.XMLHTTP")}catch(bd){}}a.ajaxSettings.xhr=aY.ActiveXObject?function(){return !this.isLocal&&aA()||ad()}:aA;at=a.ajaxSettings.xhr();a.support.ajax=!!at;a.support.cors=at&&("withCredentials" in at);at=H;if(a.support.ajax){a.ajaxTransport(function(e){if(!e.crossDomain||a.support.cors){var bd;return{send:function(bj,be){var bi=e.xhr(),bh,bg;if(e.username){bi.open(e.type,e.url,e.async,e.username,e.password)}else{bi.open(e.type,e.url,e.async)}if(e.xhrFields){for(bg in e.xhrFields){bi[bg]=e.xhrFields[bg]}}if(e.mimeType&&bi.overrideMimeType){bi.overrideMimeType(e.mimeType)}if(!(e.crossDomain&&!e.hasContent)&&!bj["X-Requested-With"]){bj["X-Requested-With"]="XMLHttpRequest"}try{for(bg in bj){bi.setRequestHeader(bg,bj[bg])}}catch(bf){}bi.send((e.hasContent&&e.data)||null);bd=function(bs,bm){var bn,bl,bk,bq,bp;try{if(bd&&(bm||bi.readyState===4)){bd=H;if(bh){bi.onreadystatechange=a.noop;delete J[bh]}if(bm){if(bi.readyState!==4){bi.abort()}}else{bn=bi.status;bk=bi.getAllResponseHeaders();bq={};bp=bi.responseXML;if(bp&&bp.documentElement){bq.xml=bp}bq.text=bi.responseText;try{bl=bi.statusText}catch(br){bl=""}if(!bn&&e.isLocal&&!e.crossDomain){bn=bq.text?200:404}else{if(bn===1223){bn=204}}}}}catch(bo){if(!bm){be(-1,bo)}}if(bq){be(bn,bl,bq,bk)}};if(!e.async||bi.readyState===4){bd()}else{if(!J){J={};A()}bh=x++;bi.onreadystatechange=J[bh]=bd}},abort:function(){if(bd){bd(0,1)}}}}})}var N={},ap=/^(?:toggle|show|hide)$/,aF=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,aS,ax=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];a.fn.extend({show:function(bf,bi,bh){var be,bg;if(bf||bf===0){return this.animate(aQ("show",3),bf,bi,bh)}else{for(var bd=0,e=this.length;bd<e;bd++){be=this[bd];bg=be.style.display;if(!a._data(be,"olddisplay")&&bg==="none"){bg=be.style.display=""}if(bg===""&&a.css(be,"display")==="none"){a._data(be,"olddisplay",w(be.nodeName))}}for(bd=0;bd<e;bd++){be=this[bd];bg=be.style.display;if(bg===""||bg==="none"){be.style.display=a._data(be,"olddisplay")||""}}return this}},hide:function(be,bh,bg){if(be||be===0){return this.animate(aQ("hide",3),be,bh,bg)}else{for(var bd=0,e=this.length;bd<e;bd++){var bf=a.css(this[bd],"display");if(bf!=="none"&&!a._data(this[bd],"olddisplay")){a._data(this[bd],"olddisplay",bf)}}for(bd=0;bd<e;bd++){this[bd].style.display="none"}return this}},_toggle:a.fn.toggle,toggle:function(be,bd,bf){var e=typeof be==="boolean";if(a.isFunction(be)&&a.isFunction(bd)){this._toggle.apply(this,arguments)}else{if(be==null||e){this.each(function(){var bg=e?be:a(this).is(":hidden");a(this)[bg?"show":"hide"]()})}else{this.animate(aQ("toggle",3),be,bd,bf)}}return this},fadeTo:function(e,bf,be,bd){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:bf},e,be,bd)},animate:function(bg,bd,bf,be){var e=a.speed(bd,bf,be);if(a.isEmptyObject(bg)){return this.each(e.complete)}return this[e.queue===false?"each":"queue"](function(){var bj=a.extend({},e),bn,bk=this.nodeType===1,bl=bk&&a(this).is(":hidden"),bh=this;for(bn in bg){var bi=a.camelCase(bn);if(bn!==bi){bg[bi]=bg[bn];delete bg[bn];bn=bi}if(bg[bn]==="hide"&&bl||bg[bn]==="show"&&!bl){return bj.complete.call(this)}if(bk&&(bn==="height"||bn==="width")){bj.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY];if(a.css(this,"display")==="inline"&&a.css(this,"float")==="none"){if(!a.support.inlineBlockNeedsLayout){this.style.display="inline-block"}else{var bm=w(this.nodeName);if(bm==="inline"){this.style.display="inline-block"}else{this.style.display="inline";this.style.zoom=1}}}}if(a.isArray(bg[bn])){(bj.specialEasing=bj.specialEasing||{})[bn]=bg[bn][1];bg[bn]=bg[bn][0]}}if(bj.overflow!=null){this.style.overflow="hidden"}bj.curAnim=a.extend({},bg);a.each(bg,function(bp,bt){var bs=new a.fx(bh,bj,bp);if(ap.test(bt)){bs[bt==="toggle"?bl?"show":"hide":bt](bg)}else{var br=aF.exec(bt),bu=bs.cur();if(br){var bo=parseFloat(br[2]),bq=br[3]||(a.cssNumber[bp]?"":"px");if(bq!=="px"){a.style(bh,bp,(bo||1)+bq);bu=((bo||1)/bs.cur())*bu;a.style(bh,bp,bu+bq)}if(br[1]){bo=((br[1]==="-="?-1:1)*bo)+bu}bs.custom(bu,bo,bq)}else{bs.custom(bu,bt,"")}}});return true})},stop:function(bd,e){var be=a.timers;if(bd){this.queue([])}this.each(function(){for(var bf=be.length-1;bf>=0;bf--){if(be[bf].elem===this){if(e){be[bf](true)}be.splice(bf,1)}}});if(!e){this.dequeue()}return this}});function aQ(bd,e){var be={};a.each(ax.concat.apply([],ax.slice(0,e)),function(){be[this]=bd});return be}a.each({slideDown:aQ("show",1),slideUp:aQ("hide",1),slideToggle:aQ("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,bd){a.fn[e]=function(be,bg,bf){return this.animate(bd,be,bg,bf)}});a.extend({speed:function(be,bf,bd){var e=be&&typeof be==="object"?a.extend({},be):{complete:bd||!bd&&bf||a.isFunction(be)&&be,duration:be,easing:bd&&bf||bf&&!a.isFunction(bf)&&bf};e.duration=a.fx.off?0:typeof e.duration==="number"?e.duration:e.duration in a.fx.speeds?a.fx.speeds[e.duration]:a.fx.speeds._default;e.old=e.complete;e.complete=function(){if(e.queue!==false){a(this).dequeue()}if(a.isFunction(e.old)){e.old.call(this)}};return e},easing:{linear:function(be,bf,e,bd){return e+bd*be},swing:function(be,bf,e,bd){return((-Math.cos(be*Math.PI)/2)+0.5)*bd+e}},timers:[],fx:function(bd,e,be){this.options=e;this.elem=bd;this.prop=be;if(!e.orig){e.orig={}}}});a.fx.prototype={update:function(){if(this.options.step){this.options.step.call(this.elem,this.now,this)}(a.fx.step[this.prop]||a.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null)){return this.elem[this.prop]}var e,bd=a.css(this.elem,this.prop);return isNaN(e=parseFloat(bd))?!bd||bd==="auto"?0:bd:e},custom:function(bh,bg,bf){var e=this,be=a.fx;this.startTime=a.now();this.start=bh;this.end=bg;this.unit=bf||this.unit||(a.cssNumber[this.prop]?"":"px");this.now=this.start;this.pos=this.state=0;function bd(bi){return e.step(bi)}bd.elem=this.elem;if(bd()&&a.timers.push(bd)&&!aS){aS=setInterval(be.tick,be.interval)}},show:function(){this.options.orig[this.prop]=a.style(this.elem,this.prop);this.options.show=true;this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur());a(this.elem).show()},hide:function(){this.options.orig[this.prop]=a.style(this.elem,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(bf){var bk=a.now(),bg=true;if(bf||bk>=this.options.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;for(var bh in this.options.curAnim){if(this.options.curAnim[bh]!==true){bg=false}}if(bg){if(this.options.overflow!=null&&!a.support.shrinkWrapBlocks){var be=this.elem,bl=this.options;a.each(["","X","Y"],function(bm,bn){be.style["overflow"+bn]=bl.overflow[bm]})}if(this.options.hide){a(this.elem).hide()}if(this.options.hide||this.options.show){for(var e in this.options.curAnim){a.style(this.elem,e,this.options.orig[e])}}this.options.complete.call(this.elem)}return false}else{var bd=bk-this.startTime;this.state=bd/this.options.duration;var bi=this.options.specialEasing&&this.options.specialEasing[this.prop];var bj=this.options.easing||(a.easing.swing?"swing":"linear");this.pos=a.easing[bi||bj](this.state,bd,0,1,this.options.duration);this.now=this.start+((this.end-this.start)*this.pos);this.update()}return true}};a.extend(a.fx,{tick:function(){var bd=a.timers;for(var e=0;e<bd.length;e++){if(!bd[e]()){bd.splice(e--,1)}}if(!bd.length){a.fx.stop()}},interval:13,stop:function(){clearInterval(aS);aS=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(e){a.style(e.elem,"opacity",e.now)},_default:function(e){if(e.elem.style&&e.elem.style[e.prop]!=null){e.elem.style[e.prop]=(e.prop==="width"||e.prop==="height"?Math.max(0,e.now):e.now)+e.unit}else{e.elem[e.prop]=e.now}}}});if(a.expr&&a.expr.filters){a.expr.filters.animated=function(e){return a.grep(a.timers,function(bd){return e===bd.elem}).length}}function w(be){if(!N[be]){var e=a("<"+be+">").appendTo("body"),bd=e.css("display");e.remove();if(bd==="none"||bd===""){bd="block"}N[be]=bd}return N[be]}var S=/^t(?:able|d|h)$/i,Y=/^(?:body|html)$/i;if("getBoundingClientRect" in al.documentElement){a.fn.offset=function(bq){var bg=this[0],bj;if(bq){return this.each(function(e){a.offset.setOffset(this,bq,e)})}if(!bg||!bg.ownerDocument){return null}if(bg===bg.ownerDocument.body){return a.offset.bodyOffset(bg)}try{bj=bg.getBoundingClientRect()}catch(bn){}var bp=bg.ownerDocument,be=bp.documentElement;if(!bj||!a.contains(be,bg)){return bj?{top:bj.top,left:bj.left}:{top:0,left:0}}var bk=bp.body,bl=az(bp),bi=be.clientTop||bk.clientTop||0,bm=be.clientLeft||bk.clientLeft||0,bd=(bl.pageYOffset||a.support.boxModel&&be.scrollTop||bk.scrollTop),bh=(bl.pageXOffset||a.support.boxModel&&be.scrollLeft||bk.scrollLeft),bo=bj.top+bd-bi,bf=bj.left+bh-bm;return{top:bo,left:bf}}}else{a.fn.offset=function(bn){var bh=this[0];if(bn){return this.each(function(bo){a.offset.setOffset(this,bn,bo)})}if(!bh||!bh.ownerDocument){return null}if(bh===bh.ownerDocument.body){return a.offset.bodyOffset(bh)}a.offset.initialize();var bk,be=bh.offsetParent,bd=bh,bm=bh.ownerDocument,bf=bm.documentElement,bi=bm.body,bj=bm.defaultView,e=bj?bj.getComputedStyle(bh,null):bh.currentStyle,bl=bh.offsetTop,bg=bh.offsetLeft;while((bh=bh.parentNode)&&bh!==bi&&bh!==bf){if(a.offset.supportsFixedPosition&&e.position==="fixed"){break}bk=bj?bj.getComputedStyle(bh,null):bh.currentStyle;bl-=bh.scrollTop;bg-=bh.scrollLeft;if(bh===be){bl+=bh.offsetTop;bg+=bh.offsetLeft;if(a.offset.doesNotAddBorder&&!(a.offset.doesAddBorderForTableAndCells&&S.test(bh.nodeName))){bl+=parseFloat(bk.borderTopWidth)||0;bg+=parseFloat(bk.borderLeftWidth)||0}bd=be;be=bh.offsetParent}if(a.offset.subtractsBorderForOverflowNotVisible&&bk.overflow!=="visible"){bl+=parseFloat(bk.borderTopWidth)||0;bg+=parseFloat(bk.borderLeftWidth)||0}e=bk}if(e.position==="relative"||e.position==="static"){bl+=bi.offsetTop;bg+=bi.offsetLeft}if(a.offset.supportsFixedPosition&&e.position==="fixed"){bl+=Math.max(bf.scrollTop,bi.scrollTop);bg+=Math.max(bf.scrollLeft,bi.scrollLeft)}return{top:bl,left:bg}}}a.offset={initialize:function(){var e=al.body,bd=al.createElement("div"),bg,bi,bh,bj,be=parseFloat(a.css(e,"marginTop"))||0,bf="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";a.extend(bd.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"});bd.innerHTML=bf;e.insertBefore(bd,e.firstChild);bg=bd.firstChild;bi=bg.firstChild;bj=bg.nextSibling.firstChild.firstChild;this.doesNotAddBorder=(bi.offsetTop!==5);this.doesAddBorderForTableAndCells=(bj.offsetTop===5);bi.style.position="fixed";bi.style.top="20px";this.supportsFixedPosition=(bi.offsetTop===20||bi.offsetTop===15);bi.style.position=bi.style.top="";bg.style.overflow="hidden";bg.style.position="relative";this.subtractsBorderForOverflowNotVisible=(bi.offsetTop===-5);this.doesNotIncludeMarginInBodyOffset=(e.offsetTop!==be);e.removeChild(bd);e=bd=bg=bi=bh=bj=null;a.offset.initialize=a.noop},bodyOffset:function(e){var be=e.offsetTop,bd=e.offsetLeft;a.offset.initialize();if(a.offset.doesNotIncludeMarginInBodyOffset){be+=parseFloat(a.css(e,"marginTop"))||0;bd+=parseFloat(a.css(e,"marginLeft"))||0}return{top:be,left:bd}},setOffset:function(bf,bo,bi){var bj=a.css(bf,"position");if(bj==="static"){bf.style.position="relative"}var bh=a(bf),bd=bh.offset(),e=a.css(bf,"top"),bm=a.css(bf,"left"),bn=(bj==="absolute"&&a.inArray("auto",[e,bm])>-1),bl={},bk={},be,bg;if(bn){bk=bh.position()}be=bn?bk.top:parseInt(e,10)||0;bg=bn?bk.left:parseInt(bm,10)||0;if(a.isFunction(bo)){bo=bo.call(bf,bi,bd)}if(bo.top!=null){bl.top=(bo.top-bd.top)+be}if(bo.left!=null){bl.left=(bo.left-bd.left)+bg}if("using" in bo){bo.using.call(bf,bl)}else{bh.css(bl)}}};a.fn.extend({position:function(){if(!this[0]){return null}var be=this[0],bd=this.offsetParent(),bf=this.offset(),e=Y.test(bd[0].nodeName)?{top:0,left:0}:bd.offset();bf.top-=parseFloat(a.css(be,"marginTop"))||0;bf.left-=parseFloat(a.css(be,"marginLeft"))||0;e.top+=parseFloat(a.css(bd[0],"borderTopWidth"))||0;e.left+=parseFloat(a.css(bd[0],"borderLeftWidth"))||0;return{top:bf.top-e.top,left:bf.left-e.left}},offsetParent:function(){return this.map(function(){var e=this.offsetParent||al.body;while(e&&(!Y.test(e.nodeName)&&a.css(e,"position")==="static")){e=e.offsetParent}return e})}});a.each(["Left","Top"],function(bd,e){var be="scroll"+e;a.fn[be]=function(bh){var bf=this[0],bg;if(!bf){return null}if(bh!==H){return this.each(function(){bg=az(this);if(bg){bg.scrollTo(!bd?bh:a(bg).scrollLeft(),bd?bh:a(bg).scrollTop())}else{this[be]=bh}})}else{bg=az(bf);return bg?("pageXOffset" in bg)?bg[bd?"pageYOffset":"pageXOffset"]:a.support.boxModel&&bg.document.documentElement[be]||bg.document.body[be]:bf[be]}}});function az(e){return a.isWindow(e)?e:e.nodeType===9?e.defaultView||e.parentWindow:false}a.each(["Height","Width"],function(bd,e){var be=e.toLowerCase();a.fn["inner"+e]=function(){return this[0]?parseFloat(a.css(this[0],be,"padding")):null};a.fn["outer"+e]=function(bf){return this[0]?parseFloat(a.css(this[0],be,bf?"margin":"border")):null};a.fn[be]=function(bg){var bh=this[0];if(!bh){return bg==null?null:this}if(a.isFunction(bg)){return this.each(function(bl){var bk=a(this);bk[be](bg.call(this,bl,bk[be]()))})}if(a.isWindow(bh)){var bi=bh.document.documentElement["client"+e];return bh.document.compatMode==="CSS1Compat"&&bi||bh.document.body["client"+e]||bi}else{if(bh.nodeType===9){return Math.max(bh.documentElement["client"+e],bh.body["scroll"+e],bh.documentElement["scroll"+e],bh.body["offset"+e],bh.documentElement["offset"+e])}else{if(bg===H){var bj=a.css(bh,be),bf=parseFloat(bj);return a.isNaN(bf)?bj:bf}else{return this.css(be,typeof bg==="string"?bg:bg+"px")}}}}});aY.jQuery=aY.$=a})(window);
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/lib/jquery-1.6.2/jquery-1.6.2.js b/ebus-datastore/ebus/web_static/lib/jquery-1.6.2/jquery-1.6.2.js new file mode 100644 index 0000000..f3201aa --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-1.6.2/jquery-1.6.2.js @@ -0,0 +1,8981 @@ +/*! + * jQuery JavaScript Library v1.6.2 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Thu Jun 30 14:16:56 2011 -0400 + */ +(function( window, undefined ) { + +// Use the correct document accordingly with window argument (sandbox) +var document = window.document, + navigator = window.navigator, + location = window.location; +var jQuery = (function() { + +// Define a local copy of jQuery +var jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // A central reference to the root jQuery(document) + rootjQuery, + + // A simple way to check for HTML strings or ID strings + // (both of which we optimize for) + quickExpr = /^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, + + // Check if a string has a non-whitespace character in it + rnotwhite = /\S/, + + // Used for trimming whitespace + trimLeft = /^\s+/, + trimRight = /\s+$/, + + // Check for digits + rdigit = /\d/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, + rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + + // Useragent RegExp + rwebkit = /(webkit)[ \/]([\w.]+)/, + ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, + rmsie = /(msie) ([\w.]+)/, + rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, + + // Matches dashed string for camelizing + rdashAlpha = /-([a-z])/ig, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return letter.toUpperCase(); + }, + + // Keep a UserAgent string for use with jQuery.browser + userAgent = navigator.userAgent, + + // For matching the engine and version of the browser + browserMatch, + + // The deferred used on DOM ready + readyList, + + // The ready event handler + DOMContentLoaded, + + // Save a reference to some core methods + toString = Object.prototype.toString, + hasOwn = Object.prototype.hasOwnProperty, + push = Array.prototype.push, + slice = Array.prototype.slice, + trim = String.prototype.trim, + indexOf = Array.prototype.indexOf, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), or $(undefined) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // The body element only exists once, optimize finding it + if ( selector === "body" && !context && document.body ) { + this.context = document; + this[0] = document.body; + this.selector = selector; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = quickExpr.exec( selector ); + } + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + doc = (context ? context.ownerDocument || context : document); + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + ret = rsingleTag.exec( selector ); + + if ( ret ) { + if ( jQuery.isPlainObject( context ) ) { + selector = [ document.createElement( ret[1] ) ]; + jQuery.fn.attr.call( selector, context, true ); + + } else { + selector = [ doc.createElement( ret[1] ) ]; + } + + } else { + ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); + selector = (ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment).childNodes; + } + + return jQuery.merge( this, selector ); + + // HANDLE: $("#id") + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return (context || rootjQuery).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if (selector.selector !== undefined) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.6.2", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return slice.call( this, 0 ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = this.constructor(); + + if ( jQuery.isArray( elems ) ) { + push.apply( ret, elems ); + + } else { + jQuery.merge( ret, elems ); + } + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + (this.selector ? " " : "") + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Attach the listeners + jQuery.bindReady(); + + // Add the callback + readyList.done( fn ); + + return this; + }, + + eq: function( i ) { + return i === -1 ? + this.slice( i ) : + this.slice( i, +i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ), + "slice", slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + // Either a released hold or an DOMready/load event and not yet ready + if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger( "ready" ).unbind( "ready" ); + } + } + }, + + bindReady: function() { + if ( readyList ) { + return; + } + + readyList = jQuery._Deferred(); + + // Catch cases where $(document).ready() is called after the + // browser event has already occurred. + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + return setTimeout( jQuery.ready, 1 ); + } + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", DOMContentLoaded ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var toplevel = false; + + try { + toplevel = window.frameElement == null; + } catch(e) {} + + if ( document.documentElement.doScroll && toplevel ) { + doScrollCheck(); + } + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + // A crude way of determining if an object is a window + isWindow: function( obj ) { + return obj && typeof obj === "object" && "setInterval" in obj; + }, + + isNaN: function( obj ) { + return obj == null || !rdigit.test( obj ) || isNaN( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + // Not own constructor property must be Object + if ( obj.constructor && + !hasOwn.call(obj, "constructor") && + !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + for ( var name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw msg; + }, + + parseJSON: function( data ) { + if ( typeof data !== "string" || !data ) { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Attempt to parse using the native JSON parser first + if ( window.JSON && window.JSON.parse ) { + return window.JSON.parse( data ); + } + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test( data.replace( rvalidescape, "@" ) + .replace( rvalidtokens, "]" ) + .replace( rvalidbraces, "")) ) { + + return (new Function( "return " + data ))(); + + } + jQuery.error( "Invalid JSON: " + data ); + }, + + // Cross-browser xml parsing + // (xml & tmp used internally) + parseXML: function( data , xml , tmp ) { + + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + + tmp = xml.documentElement; + + if ( ! tmp || ! tmp.nodeName || tmp.nodeName === "parsererror" ) { + jQuery.error( "Invalid XML: " + data ); + } + + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + // Workarounds based on findings by Jim Driscoll + // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context + globalEval: function( data ) { + if ( data && rnotwhite.test( data ) ) { + // We use execScript on Internet Explorer + // We use an anonymous function so that context is window + // rather than jQuery in Firefox + ( window.execScript || function( data ) { + window[ "eval" ].call( window, data ); + } )( data ); + } + }, + + // Converts a dashed string to camelCased string; + // Used by both the css and data modules + camelCase: function( string ) { + return string.replace( rdashAlpha, fcamelCase ); + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, + length = object.length, + isObj = length === undefined || jQuery.isFunction( object ); + + if ( args ) { + if ( isObj ) { + for ( name in object ) { + if ( callback.apply( object[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( object[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in object ) { + if ( callback.call( object[ name ], name, object[ name ] ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) { + break; + } + } + } + } + + return object; + }, + + // Use native String.trim function wherever possible + trim: trim ? + function( text ) { + return text == null ? + "" : + trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); + }, + + // results is for internal usage only + makeArray: function( array, results ) { + var ret = results || []; + + if ( array != null ) { + // The window, strings (and functions) also have 'length' + // The extra typeof function check is to prevent crashes + // in Safari 2 (See: #3039) + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + var type = jQuery.type( array ); + + if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { + push.call( ret, array ); + } else { + jQuery.merge( ret, array ); + } + } + + return ret; + }, + + inArray: function( elem, array ) { + + if ( indexOf ) { + return indexOf.call( array, elem ); + } + + for ( var i = 0, length = array.length; i < length; i++ ) { + if ( array[ i ] === elem ) { + return i; + } + } + + return -1; + }, + + merge: function( first, second ) { + var i = first.length, + j = 0; + + if ( typeof second.length === "number" ) { + for ( var l = second.length; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var ret = [], retVal; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, key, ret = [], + i = 0, + length = elems.length, + // jquery objects are treated as arrays + isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( key in elems ) { + value = callback( elems[ key ], key, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + if ( typeof context === "string" ) { + var tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + var args = slice.call( arguments, 2 ), + proxy = function() { + return fn.apply( context, args.concat( slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + + return proxy; + }, + + // Mutifunctional method to get and set values to a collection + // The value/s can optionally be executed if it's a function + access: function( elems, key, value, exec, fn, pass ) { + var length = elems.length; + + // Setting many attributes + if ( typeof key === "object" ) { + for ( var k in key ) { + jQuery.access( elems, k, key[k], exec, fn, value ); + } + return elems; + } + + // Setting one attribute + if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = !pass && exec && jQuery.isFunction(value); + + for ( var i = 0; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + + return elems; + } + + // Getting an attribute + return length ? fn( elems[0], key ) : undefined; + }, + + now: function() { + return (new Date()).getTime(); + }, + + // Use of jQuery.browser is frowned upon. + // More details: http://docs.jquery.com/Utilities/jQuery.browser + uaMatch: function( ua ) { + ua = ua.toLowerCase(); + + var match = rwebkit.exec( ua ) || + ropera.exec( ua ) || + rmsie.exec( ua ) || + ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || + []; + + return { browser: match[1] || "", version: match[2] || "0" }; + }, + + sub: function() { + function jQuerySub( selector, context ) { + return new jQuerySub.fn.init( selector, context ); + } + jQuery.extend( true, jQuerySub, this ); + jQuerySub.superclass = this; + jQuerySub.fn = jQuerySub.prototype = this(); + jQuerySub.fn.constructor = jQuerySub; + jQuerySub.sub = this.sub; + jQuerySub.fn.init = function init( selector, context ) { + if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { + context = jQuerySub( context ); + } + + return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); + }; + jQuerySub.fn.init.prototype = jQuerySub.fn; + var rootjQuerySub = jQuerySub(document); + return jQuerySub; + }, + + browser: {} +}); + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +browserMatch = jQuery.uaMatch( userAgent ); +if ( browserMatch.browser ) { + jQuery.browser[ browserMatch.browser ] = true; + jQuery.browser.version = browserMatch.version; +} + +// Deprecated, use jQuery.browser.webkit instead +if ( jQuery.browser.webkit ) { + jQuery.browser.safari = true; +} + +// IE doesn't match non-breaking spaces with \s +if ( rnotwhite.test( "\xA0" ) ) { + trimLeft = /^[\s\xA0]+/; + trimRight = /[\s\xA0]+$/; +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); + +// Cleanup functions for the document ready method +if ( document.addEventListener ) { + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +} else if ( document.attachEvent ) { + DOMContentLoaded = function() { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }; +} + +// The DOM ready check for Internet Explorer +function doScrollCheck() { + if ( jQuery.isReady ) { + return; + } + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch(e) { + setTimeout( doScrollCheck, 1 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); +} + +return jQuery; + +})(); + + +var // Promise methods + promiseMethods = "done fail isResolved isRejected promise then always pipe".split( " " ), + // Static reference to slice + sliceDeferred = [].slice; + +jQuery.extend({ + // Create a simple deferred (one callbacks list) + _Deferred: function() { + var // callbacks list + callbacks = [], + // stored [ context , args ] + fired, + // to avoid firing when already doing so + firing, + // flag to know if the deferred has been cancelled + cancelled, + // the deferred itself + deferred = { + + // done( f1, f2, ...) + done: function() { + if ( !cancelled ) { + var args = arguments, + i, + length, + elem, + type, + _fired; + if ( fired ) { + _fired = fired; + fired = 0; + } + for ( i = 0, length = args.length; i < length; i++ ) { + elem = args[ i ]; + type = jQuery.type( elem ); + if ( type === "array" ) { + deferred.done.apply( deferred, elem ); + } else if ( type === "function" ) { + callbacks.push( elem ); + } + } + if ( _fired ) { + deferred.resolveWith( _fired[ 0 ], _fired[ 1 ] ); + } + } + return this; + }, + + // resolve with given context and args + resolveWith: function( context, args ) { + if ( !cancelled && !fired && !firing ) { + // make sure args are available (#8421) + args = args || []; + firing = 1; + try { + while( callbacks[ 0 ] ) { + callbacks.shift().apply( context, args ); + } + } + finally { + fired = [ context, args ]; + firing = 0; + } + } + return this; + }, + + // resolve with this as context and given arguments + resolve: function() { + deferred.resolveWith( this, arguments ); + return this; + }, + + // Has this deferred been resolved? + isResolved: function() { + return !!( firing || fired ); + }, + + // Cancel + cancel: function() { + cancelled = 1; + callbacks = []; + return this; + } + }; + + return deferred; + }, + + // Full fledged deferred (two callbacks list) + Deferred: function( func ) { + var deferred = jQuery._Deferred(), + failDeferred = jQuery._Deferred(), + promise; + // Add errorDeferred methods, then and promise + jQuery.extend( deferred, { + then: function( doneCallbacks, failCallbacks ) { + deferred.done( doneCallbacks ).fail( failCallbacks ); + return this; + }, + always: function() { + return deferred.done.apply( deferred, arguments ).fail.apply( this, arguments ); + }, + fail: failDeferred.done, + rejectWith: failDeferred.resolveWith, + reject: failDeferred.resolve, + isRejected: failDeferred.isResolved, + pipe: function( fnDone, fnFail ) { + return jQuery.Deferred(function( newDefer ) { + jQuery.each( { + done: [ fnDone, "resolve" ], + fail: [ fnFail, "reject" ] + }, function( handler, data ) { + var fn = data[ 0 ], + action = data[ 1 ], + returned; + if ( jQuery.isFunction( fn ) ) { + deferred[ handler ](function() { + returned = fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise().then( newDefer.resolve, newDefer.reject ); + } else { + newDefer[ action ]( returned ); + } + }); + } else { + deferred[ handler ]( newDefer[ action ] ); + } + }); + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + if ( obj == null ) { + if ( promise ) { + return promise; + } + promise = obj = {}; + } + var i = promiseMethods.length; + while( i-- ) { + obj[ promiseMethods[i] ] = deferred[ promiseMethods[i] ]; + } + return obj; + } + }); + // Make sure only one callback list will be used + deferred.done( failDeferred.cancel ).fail( deferred.cancel ); + // Unexpose cancel + delete deferred.cancel; + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + return deferred; + }, + + // Deferred helper + when: function( firstParam ) { + var args = arguments, + i = 0, + length = args.length, + count = length, + deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ? + firstParam : + jQuery.Deferred(); + function resolveFunc( i ) { + return function( value ) { + args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; + if ( !( --count ) ) { + // Strange bug in FF4: + // Values changed onto the arguments object sometimes end up as undefined values + // outside the $.when method. Cloning the object into a fresh array solves the issue + deferred.resolveWith( deferred, sliceDeferred.call( args, 0 ) ); + } + }; + } + if ( length > 1 ) { + for( ; i < length; i++ ) { + if ( args[ i ] && jQuery.isFunction( args[ i ].promise ) ) { + args[ i ].promise().then( resolveFunc(i), deferred.reject ); + } else { + --count; + } + } + if ( !count ) { + deferred.resolveWith( deferred, args ); + } + } else if ( deferred !== firstParam ) { + deferred.resolveWith( deferred, length ? [ firstParam ] : [] ); + } + return deferred.promise(); + } +}); + + + +jQuery.support = (function() { + + var div = document.createElement( "div" ), + documentElement = document.documentElement, + all, + a, + select, + opt, + input, + marginDiv, + support, + fragment, + body, + testElementParent, + testElement, + testElementStyle, + tds, + events, + eventName, + i, + isSupported; + + // Preliminary tests + div.setAttribute("className", "t"); + div.innerHTML = " <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>"; + + all = div.getElementsByTagName( "*" ); + a = div.getElementsByTagName( "a" )[ 0 ]; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return {}; + } + + // First batch of supports tests + select = document.createElement( "select" ); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName( "input" )[ 0 ]; + + support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: ( div.firstChild.nodeType === 3 ), + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName( "tbody" ).length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName( "link" ).length, + + // Get the style information from getAttribute + // (IE uses .cssText instead) + style: /top/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: ( a.getAttribute( "href" ) === "/a" ), + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.55$/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: ( input.value === "on" ), + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // Will be defined later + submitBubbles: true, + changeBubbles: true, + focusinBubbles: false, + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { + div.attachEvent( "onclick", function() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + support.noCloneEvent = false; + }); + div.cloneNode( true ).fireEvent( "onclick" ); + } + + // Check if a radio maintains it's value + // after being appended to the DOM + input = document.createElement("input"); + input.value = "t"; + input.setAttribute("type", "radio"); + support.radioValue = input.value === "t"; + + input.setAttribute("checked", "checked"); + div.appendChild( input ); + fragment = document.createDocumentFragment(); + fragment.appendChild( div.firstChild ); + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + div.innerHTML = ""; + + // Figure out if the W3C box model works as expected + div.style.width = div.style.paddingLeft = "1px"; + + body = document.getElementsByTagName( "body" )[ 0 ]; + // We use our own, invisible, body unless the body is already present + // in which case we use a div (#9239) + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0 + }; + if ( body ) { + jQuery.extend( testElementStyle, { + position: "absolute", + left: -1000, + top: -1000 + }); + } + for ( i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + support.boxModel = div.offsetWidth === 2; + + if ( "zoom" in div.style ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.style.display = "inline"; + div.style.zoom = 1; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 2 ); + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = ""; + div.innerHTML = "<div style='width:4px;'></div>"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 2 ); + } + + div.innerHTML = "<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>"; + tds = div.getElementsByTagName( "td" ); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE < 8 fail this test) + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + div.innerHTML = ""; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. For more + // info see bug #3333 + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + if ( document.defaultView && document.defaultView.getComputedStyle ) { + marginDiv = document.createElement( "div" ); + marginDiv.style.width = "0"; + marginDiv.style.marginRight = "0"; + div.appendChild( marginDiv ); + support.reliableMarginRight = + ( parseInt( ( document.defaultView.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0; + } + + // Remove the body element we added + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + // Technique from Juriy Zaytsev + // http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/ + // We only care about the case where non-standard event systems + // are used, namely in IE. Short-circuiting here helps us to + // avoid an eval call (in setAttribute) which can cause CSP + // to go haywire. See: https://developer.mozilla.org/en/Security/CSP + if ( div.attachEvent ) { + for( i in { + submit: 1, + change: 1, + focusin: 1 + } ) { + eventName = "on" + i; + isSupported = ( eventName in div ); + if ( !isSupported ) { + div.setAttribute( eventName, "return;" ); + isSupported = ( typeof div[ eventName ] === "function" ); + } + support[ i + "Bubbles" ] = isSupported; + } + } + + // Null connected elements to avoid leaks in IE + testElement = fragment = select = opt = body = marginDiv = div = input = null; + + return support; +})(); + +// Keep track of boxModel +jQuery.boxModel = jQuery.support.boxModel; + + + + +var rbrace = /^(?:\{.*\}|\[.*\])$/, + rmultiDash = /([a-z])([A-Z])/g; + +jQuery.extend({ + cache: {}, + + // Please use with caution + uuid: 0, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var internalKey = jQuery.expando, getByName = typeof name === "string", thisCache, + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ jQuery.expando ] : elem[ jQuery.expando ] && jQuery.expando; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || (pvt && id && !cache[ id ][ internalKey ])) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ jQuery.expando ] = id = ++jQuery.uuid; + } else { + id = jQuery.expando; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery + // metadata on plain JS objects when the object is serialized using + // JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ][ internalKey ] = jQuery.extend(cache[ id ][ internalKey ], name); + } else { + cache[ id ] = jQuery.extend(cache[ id ], name); + } + } + + thisCache = cache[ id ]; + + // Internal jQuery data is stored in a separate object inside the object's data + // cache in order to avoid key collisions between internal data and user-defined + // data + if ( pvt ) { + if ( !thisCache[ internalKey ] ) { + thisCache[ internalKey ] = {}; + } + + thisCache = thisCache[ internalKey ]; + } + + if ( data !== undefined ) { + thisCache[ jQuery.camelCase( name ) ] = data; + } + + // TODO: This is a hack for 1.5 ONLY. It will be removed in 1.6. Users should + // not attempt to inspect the internal events object using jQuery.data, as this + // internal data object is undocumented and subject to change. + if ( name === "events" && !thisCache[name] ) { + return thisCache[ internalKey ] && thisCache[ internalKey ].events; + } + + return getByName ? + // Check for both converted-to-camel and non-converted data property names + thisCache[ jQuery.camelCase( name ) ] || thisCache[ name ] : + thisCache; + }, + + removeData: function( elem, name, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var internalKey = jQuery.expando, isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + + // See jQuery.data for more information + id = isNode ? elem[ jQuery.expando ] : jQuery.expando; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + var thisCache = pvt ? cache[ id ][ internalKey ] : cache[ id ]; + + if ( thisCache ) { + delete thisCache[ name ]; + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !isEmptyDataObject(thisCache) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( pvt ) { + delete cache[ id ][ internalKey ]; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject(cache[ id ]) ) { + return; + } + } + + var internalCache = cache[ id ][ internalKey ]; + + // Browsers that fail expando deletion also refuse to delete expandos on + // the window, but it will allow it on all other JS objects; other browsers + // don't care + if ( jQuery.support.deleteExpando || cache != window ) { + delete cache[ id ]; + } else { + cache[ id ] = null; + } + + // We destroyed the entire user cache at once because it's faster than + // iterating through each key, but we need to continue to persist internal + // data if it existed + if ( internalCache ) { + cache[ id ] = {}; + // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery + // metadata on plain JS objects when the object is serialized using + // JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + + cache[ id ][ internalKey ] = internalCache; + + // Otherwise, we need to eliminate the expando on the node to avoid + // false lookups in the cache for entries that no longer exist + } else if ( isNode ) { + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( jQuery.support.deleteExpando ) { + delete elem[ jQuery.expando ]; + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } else { + elem[ jQuery.expando ] = null; + } + } + }, + + // For internal use only. + _data: function( elem, name, data ) { + return jQuery.data( elem, name, data, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + if ( elem.nodeName ) { + var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; + + if ( match ) { + return !(match === true || elem.getAttribute("classid") !== match); + } + } + + return true; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var data = null; + + if ( typeof key === "undefined" ) { + if ( this.length ) { + data = jQuery.data( this[0] ); + + if ( this[0].nodeType === 1 ) { + var attr = this[0].attributes, name; + for ( var i = 0, l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = jQuery.camelCase( name.substring(5) ); + + dataAttr( this[0], name, data[ name ] ); + } + } + } + } + + return data; + + } else if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + var parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + // Try to fetch any internally stored data first + if ( data === undefined && this.length ) { + data = jQuery.data( this[0], key ); + data = dataAttr( this[0], key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + + } else { + return this.each(function() { + var $this = jQuery( this ), + args = [ parts[0], value ]; + + $this.triggerHandler( "setData" + parts[1] + "!", args ); + jQuery.data( this, key, value ); + $this.triggerHandler( "changeData" + parts[1] + "!", args ); + }); + } + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + var name = "data-" + key.replace( rmultiDash, "$1-$2" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + !jQuery.isNaN( data ) ? parseFloat( data ) : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// TODO: This is a hack for 1.5 ONLY to allow objects with a single toJSON +// property to be considered empty objects; this property always exists in +// order to make sure JSON.stringify does not expose internal metadata +function isEmptyDataObject( obj ) { + for ( var name in obj ) { + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} + + + + +function handleQueueMarkDefer( elem, type, src ) { + var deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + defer = jQuery.data( elem, deferDataKey, undefined, true ); + if ( defer && + ( src === "queue" || !jQuery.data( elem, queueDataKey, undefined, true ) ) && + ( src === "mark" || !jQuery.data( elem, markDataKey, undefined, true ) ) ) { + // Give room for hard-coded callbacks to fire first + // and eventually mark/queue something else on the element + setTimeout( function() { + if ( !jQuery.data( elem, queueDataKey, undefined, true ) && + !jQuery.data( elem, markDataKey, undefined, true ) ) { + jQuery.removeData( elem, deferDataKey, true ); + defer.resolve(); + } + }, 0 ); + } +} + +jQuery.extend({ + + _mark: function( elem, type ) { + if ( elem ) { + type = (type || "fx") + "mark"; + jQuery.data( elem, type, (jQuery.data(elem,type,undefined,true) || 0) + 1, true ); + } + }, + + _unmark: function( force, elem, type ) { + if ( force !== true ) { + type = elem; + elem = force; + force = false; + } + if ( elem ) { + type = type || "fx"; + var key = type + "mark", + count = force ? 0 : ( (jQuery.data( elem, key, undefined, true) || 1 ) - 1 ); + if ( count ) { + jQuery.data( elem, key, count, true ); + } else { + jQuery.removeData( elem, key, true ); + handleQueueMarkDefer( elem, type, "mark" ); + } + } + }, + + queue: function( elem, type, data ) { + if ( elem ) { + type = (type || "fx") + "queue"; + var q = jQuery.data( elem, type, undefined, true ); + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !q || jQuery.isArray(data) ) { + q = jQuery.data( elem, type, jQuery.makeArray(data), true ); + } else { + q.push( data ); + } + } + return q || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + fn = queue.shift(), + defer; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift("inprogress"); + } + + fn.call(elem, function() { + jQuery.dequeue(elem, type); + }); + } + + if ( !queue.length ) { + jQuery.removeData( elem, type + "queue", true ); + handleQueueMarkDefer( elem, type, "queue" ); + } + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) { + return jQuery.queue( this[0], type ); + } + return this.each(function() { + var queue = jQuery.queue( this, type, data ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[time] || time : time; + type = type || "fx"; + + return this.queue( type, function() { + var elem = this; + setTimeout(function() { + jQuery.dequeue( elem, type ); + }, time ); + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, object ) { + if ( typeof type !== "string" ) { + object = type; + type = undefined; + } + type = type || "fx"; + var defer = jQuery.Deferred(), + elements = this, + i = elements.length, + count = 1, + deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + tmp; + function resolve() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + } + while( i-- ) { + if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || + ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || + jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && + jQuery.data( elements[ i ], deferDataKey, jQuery._Deferred(), true ) )) { + count++; + tmp.done( resolve ); + } + } + resolve(); + return defer.promise(); + } +}); + + + + +var rclass = /[\n\t\r]/g, + rspace = /\s+/, + rreturn = /\r/g, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea)?$/i, + rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, + rinvalidChar = /\:|^on/, + formHook, boolHook; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.attr ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.prop ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classNames, i, l, elem, + setClass, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call(this, j, this.className) ); + }); + } + + if ( value && typeof value === "string" ) { + classNames = value.split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className && classNames.length === 1 ) { + elem.className = value; + + } else { + setClass = " " + elem.className + " "; + + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) { + setClass += classNames[ c ] + " "; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classNames, i, l, elem, className, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call(this, j, this.className) ); + }); + } + + if ( (value && typeof value === "string") || value === undefined ) { + classNames = (value || "").split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 && elem.className ) { + if ( value ) { + className = (" " + elem.className + " ").replace( rclass, " " ); + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + className = className.replace(" " + classNames[ c ] + " ", " "); + } + elem.className = jQuery.trim( className ); + + } else { + elem.className = ""; + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( rspace ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space seperated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " "; + for ( var i = 0, l = this.length; i < l; i++ ) { + if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.nodeName.toLowerCase() ] || jQuery.valHooks[ elem.type ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return undefined; + } + + var isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var self = jQuery(this), val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.nodeName.toLowerCase() ] || jQuery.valHooks[ this.type ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, + index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { + var option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + // Fixes Bug #2551 -- select.val() broken in IE after form.reset() + if ( one && !values.length && options.length ) { + return jQuery( options[ index ] ).val(); + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + attrFn: { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true + }, + + attrFix: { + // Always normalize to ensure hook usage + tabindex: "tabIndex" + }, + + attr: function( elem, name, value, pass ) { + var nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return undefined; + } + + if ( pass && name in jQuery.attrFn ) { + return jQuery( elem )[ name ]( value ); + } + + // Fallback to prop when attributes are not supported + if ( !("getAttribute" in elem) ) { + return jQuery.prop( elem, name, value ); + } + + var ret, hooks, + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // Normalize the name if needed + if ( notxml ) { + name = jQuery.attrFix[ name ] || name; + + hooks = jQuery.attrHooks[ name ]; + + if ( !hooks ) { + // Use boolHook for boolean attributes + if ( rboolean.test( name ) ) { + + hooks = boolHook; + + // Use formHook for forms and if the name contains certain characters + } else if ( formHook && name !== "className" && + (jQuery.nodeName( elem, "form" ) || rinvalidChar.test( name )) ) { + + hooks = formHook; + } + } + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return undefined; + + } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, "" + value ); + return value; + } + + } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret === null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, name ) { + var propName; + if ( elem.nodeType === 1 ) { + name = jQuery.attrFix[ name ] || name; + + if ( jQuery.support.getSetAttribute ) { + // Use removeAttribute in browsers that support it + elem.removeAttribute( name ); + } else { + jQuery.attr( elem, name, "" ); + elem.removeAttributeNode( elem.getAttributeNode( name ) ); + } + + // Set corresponding property to false for boolean attributes + if ( rboolean.test( name ) && (propName = jQuery.propFix[ name ] || name) in elem ) { + elem[ propName ] = false; + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to it's default in case type is set after value + // This is for element creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + }, + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabIndex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + }, + // Use the value property for back compat + // Use the formHook for button elements in IE6/7 (#1954) + value: { + get: function( elem, name ) { + if ( formHook && jQuery.nodeName( elem, "button" ) ) { + return formHook.get( elem, name ); + } + return name in elem ? + elem.value : + null; + }, + set: function( elem, value, name ) { + if ( formHook && jQuery.nodeName( elem, "button" ) ) { + return formHook.set( elem, value, name ); + } + // Does not return so that setAttribute is also used + elem.value = value; + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return undefined; + } + + var ret, hooks, + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return (elem[ name ] = value); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== undefined ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: {} +}); + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + // Align boolean attributes with corresponding properties + return jQuery.prop( elem, name ) ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + var propName; + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + // value is true since we know at this point it's type boolean and not false + // Set boolean attributes to the same name and set the DOM property + propName = jQuery.propFix[ name ] || name; + if ( propName in elem ) { + // Only set the IDL specifically if it already exists on the element + elem[ propName ] = true; + } + + elem.setAttribute( name, name.toLowerCase() ); + } + return name; + } +}; + +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !jQuery.support.getSetAttribute ) { + + // propFix is more comprehensive and contains all fixes + jQuery.attrFix = jQuery.propFix; + + // Use this for any attribute on a form in IE6/7 + formHook = jQuery.attrHooks.name = jQuery.attrHooks.title = jQuery.valHooks.button = { + get: function( elem, name ) { + var ret; + ret = elem.getAttributeNode( name ); + // Return undefined if nodeValue is empty string + return ret && ret.nodeValue !== "" ? + ret.nodeValue : + undefined; + }, + set: function( elem, value, name ) { + // Check form objects in IE (multiple bugs related) + // Only use nodeValue if the attribute node exists on the form + var ret = elem.getAttributeNode( name ); + if ( ret ) { + ret.nodeValue = value; + return value; + } + } + }; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each([ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } + } + }); + }); +} + + +// Some attributes require a special call on IE +if ( !jQuery.support.hrefNormalized ) { + jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + get: function( elem ) { + var ret = elem.getAttribute( name, 2 ); + return ret === null ? undefined : ret; + } + }); + }); +} + +if ( !jQuery.support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { + // Return undefined in the case of empty string + // Normalize to lowercase since IE uppercases css property names + return elem.style.cssText.toLowerCase() || undefined; + }, + set: function( elem, value ) { + return (elem.style.cssText = "" + value); + } + }; +} + +// Safari mis-reports the default selected property of an option +// Accessing the parent's selectedIndex property fixes it +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + }); +} + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return (elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0); + } + } + }); +}); + + + + +var rnamespaces = /\.(.*)$/, + rformElems = /^(?:textarea|input|select)$/i, + rperiod = /\./g, + rspaces = / /g, + rescape = /[^\w\s.|`]/g, + fcleanup = function( nm ) { + return nm.replace(rescape, "\\$&"); + }; + +/* + * A number of helper functions used for managing events. + * Many of the ideas behind this code originated from + * Dean Edwards' addEvent library. + */ +jQuery.event = { + + // Bind an event to an element + // Original by Dean Edwards + add: function( elem, types, handler, data ) { + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + if ( handler === false ) { + handler = returnFalse; + } else if ( !handler ) { + // Fixes bug #7229. Fix recommended by jdalton + return; + } + + var handleObjIn, handleObj; + + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + } + + // Make sure that the function being executed has a unique ID + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure + var elemData = jQuery._data( elem ); + + // If no elemData is found then we must be trying to bind to one of the + // banned noData elements + if ( !elemData ) { + return; + } + + var events = elemData.events, + eventHandle = elemData.handle; + + if ( !events ) { + elemData.events = events = {}; + } + + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.handle.apply( eventHandle.elem, arguments ) : + undefined; + }; + } + + // Add elem as a property of the handle function + // This is to prevent a memory leak with non-native events in IE. + eventHandle.elem = elem; + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = types.split(" "); + + var type, i = 0, namespaces; + + while ( (type = types[ i++ ]) ) { + handleObj = handleObjIn ? + jQuery.extend({}, handleObjIn) : + { handler: handler, data: data }; + + // Namespaced event handlers + if ( type.indexOf(".") > -1 ) { + namespaces = type.split("."); + type = namespaces.shift(); + handleObj.namespace = namespaces.slice(0).sort().join("."); + + } else { + namespaces = []; + handleObj.namespace = ""; + } + + handleObj.type = type; + if ( !handleObj.guid ) { + handleObj.guid = handler.guid; + } + + // Get the current list of functions bound to this event + var handlers = events[ type ], + special = jQuery.event.special[ type ] || {}; + + // Init the event handler queue + if ( !handlers ) { + handlers = events[ type ] = []; + + // Check for a special event handler + // Only use addEventListener/attachEvent if the special + // events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add the function to the element's handler list + handlers.push( handleObj ); + + // Keep track of which events have been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, pos ) { + // don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + if ( handler === false ) { + handler = returnFalse; + } + + var ret, type, fn, j, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType, + elemData = jQuery.hasData( elem ) && jQuery._data( elem ), + events = elemData && elemData.events; + + if ( !elemData || !events ) { + return; + } + + // types is actually an event object here + if ( types && types.type ) { + handler = types.handler; + types = types.type; + } + + // Unbind all events for the element + if ( !types || typeof types === "string" && types.charAt(0) === "." ) { + types = types || ""; + + for ( type in events ) { + jQuery.event.remove( elem, type + types ); + } + + return; + } + + // Handle multiple events separated by a space + // jQuery(...).unbind("mouseover mouseout", fn); + types = types.split(" "); + + while ( (type = types[ i++ ]) ) { + origType = type; + handleObj = null; + all = type.indexOf(".") < 0; + namespaces = []; + + if ( !all ) { + // Namespaced event handlers + namespaces = type.split("."); + type = namespaces.shift(); + + namespace = new RegExp("(^|\\.)" + + jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + eventType = events[ type ]; + + if ( !eventType ) { + continue; + } + + if ( !handler ) { + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( all || namespace.test( handleObj.namespace ) ) { + jQuery.event.remove( elem, origType, handleObj.handler, j ); + eventType.splice( j--, 1 ); + } + } + + continue; + } + + special = jQuery.event.special[ type ] || {}; + + for ( j = pos || 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( handler.guid === handleObj.guid ) { + // remove the given handler for the given type + if ( all || namespace.test( handleObj.namespace ) ) { + if ( pos == null ) { + eventType.splice( j--, 1 ); + } + + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + + if ( pos != null ) { + break; + } + } + } + + // remove generic event handler if no more handlers exist + if ( eventType.length === 0 || pos != null && eventType.length === 1 ) { + if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + ret = null; + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + var handle = elemData.handle; + if ( handle ) { + handle.elem = null; + } + + delete elemData.events; + delete elemData.handle; + + if ( jQuery.isEmptyObject( elemData ) ) { + jQuery.removeData( elem, undefined, true ); + } + } + }, + + // Events that are safe to short-circuit if no handlers are attached. + // Native DOM events should not be added, they may have inline handlers. + customEvent: { + "getData": true, + "setData": true, + "changeData": true + }, + + trigger: function( event, data, elem, onlyHandlers ) { + // Event object or event type + var type = event.type || event, + namespaces = [], + exclusive; + + if ( type.indexOf("!") >= 0 ) { + // Exclusive events trigger only for the exact event (no namespaces) + type = type.slice(0, -1); + exclusive = true; + } + + if ( type.indexOf(".") >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { + // No jQuery handlers for this event type, and it can't have inline handlers + return; + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.exclusive = exclusive; + event.namespace = namespaces.join("."); + event.namespace_re = new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)"); + + // triggerHandler() and global events don't bubble or run the default action + if ( onlyHandlers || !elem ) { + event.preventDefault(); + event.stopPropagation(); + } + + // Handle a global trigger + if ( !elem ) { + // TODO: Stop taunting the data cache; remove global events and always attach to document + jQuery.each( jQuery.cache, function() { + // internalKey variable is just used to make it easier to find + // and potentially change this stuff later; currently it just + // points to jQuery.expando + var internalKey = jQuery.expando, + internalCache = this[ internalKey ]; + if ( internalCache && internalCache.events && internalCache.events[ type ] ) { + jQuery.event.trigger( event, data, internalCache.handle.elem ); + } + }); + return; + } + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // Clean up the event in case it is being reused + event.result = undefined; + event.target = elem; + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data != null ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + var cur = elem, + // IE doesn't like method names with a colon (#3533, #8272) + ontype = type.indexOf(":") < 0 ? "on" + type : ""; + + // Fire event on the current element, then bubble up the DOM tree + do { + var handle = jQuery._data( cur, "handle" ); + + event.currentTarget = cur; + if ( handle ) { + handle.apply( cur, data ); + } + + // Trigger an inline bound script + if ( ontype && jQuery.acceptData( cur ) && cur[ ontype ] && cur[ ontype ].apply( cur, data ) === false ) { + event.result = false; + event.preventDefault(); + } + + // Bubble up to document, then to window + cur = cur.parentNode || cur.ownerDocument || cur === event.target.ownerDocument && window; + } while ( cur && !event.isPropagationStopped() ); + + // If nobody prevented the default action, do it now + if ( !event.isDefaultPrevented() ) { + var old, + special = jQuery.event.special[ type ] || {}; + + if ( (!special._default || special._default.call( elem.ownerDocument, event ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Can't use an .isFunction)() check here because IE6/7 fails that test. + // IE<9 dies on focus to hidden element (#1486), may want to revisit a try/catch. + try { + if ( ontype && elem[ type ] ) { + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + jQuery.event.triggered = type; + elem[ type ](); + } + } catch ( ieError ) {} + + if ( old ) { + elem[ ontype ] = old; + } + + jQuery.event.triggered = undefined; + } + } + + return event.result; + }, + + handle: function( event ) { + event = jQuery.event.fix( event || window.event ); + // Snapshot the handlers list since a called handler may add/remove events. + var handlers = ((jQuery._data( this, "events" ) || {})[ event.type ] || []).slice(0), + run_all = !event.exclusive && !event.namespace, + args = Array.prototype.slice.call( arguments, 0 ); + + // Use the fix-ed Event rather than the (read-only) native event + args[0] = event; + event.currentTarget = this; + + for ( var j = 0, l = handlers.length; j < l; j++ ) { + var handleObj = handlers[ j ]; + + // Triggered event must 1) be non-exclusive and have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event. + if ( run_all || event.namespace_re.test( handleObj.namespace ) ) { + // Pass in a reference to the handler function itself + // So that we can later remove it + event.handler = handleObj.handler; + event.data = handleObj.data; + event.handleObj = handleObj; + + var ret = handleObj.handler.apply( this, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + return event.result; + }, + + props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // store a copy of the original event object + // and "clone" to set read-only properties + var originalEvent = event; + event = jQuery.Event( originalEvent ); + + for ( var i = this.props.length, prop; i; ) { + prop = this.props[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary + if ( !event.target ) { + // Fixes #1925 where srcElement might not be defined either + event.target = event.srcElement || document; + } + + // check if target is a textnode (safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && event.fromElement ) { + event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement; + } + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && event.clientX != null ) { + var eventDocument = event.target.ownerDocument || document, + doc = eventDocument.documentElement, + body = eventDocument.body; + + event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0); + event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0); + } + + // Add which for key events + if ( event.which == null && (event.charCode != null || event.keyCode != null) ) { + event.which = event.charCode != null ? event.charCode : event.keyCode; + } + + // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs) + if ( !event.metaKey && event.ctrlKey ) { + event.metaKey = event.ctrlKey; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && event.button !== undefined ) { + event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) )); + } + + return event; + }, + + // Deprecated, use jQuery.guid instead + guid: 1E8, + + // Deprecated, use jQuery.proxy instead + proxy: jQuery.proxy, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady, + teardown: jQuery.noop + }, + + live: { + add: function( handleObj ) { + jQuery.event.add( this, + liveConvert( handleObj.origType, handleObj.selector ), + jQuery.extend({}, handleObj, {handler: liveHandler, guid: handleObj.handler.guid}) ); + }, + + remove: function( handleObj ) { + jQuery.event.remove( this, liveConvert( handleObj.origType, handleObj.selector ), handleObj ); + } + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + } +}; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + if ( elem.detachEvent ) { + elem.detachEvent( "on" + type, handle ); + } + }; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !this.preventDefault ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = (src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault()) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // timeStamp is buggy for some events on Firefox(#3843) + // So we won't rely on the native value + this.timeStamp = jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Checks if an event happened on an element within another element +// Used in jQuery.event.special.mouseenter and mouseleave handlers +var withinElement = function( event ) { + + // Check if mouse(over|out) are still within the same parent element + var related = event.relatedTarget, + inside = false, + eventType = event.type; + + event.type = event.data; + + if ( related !== this ) { + + if ( related ) { + inside = jQuery.contains( this, related ); + } + + if ( !inside ) { + + jQuery.event.handle.apply( this, arguments ); + + event.type = eventType; + } + } +}, + +// In case of event delegation, we only need to rename the event.type, +// liveHandler will take care of the rest. +delegate = function( event ) { + event.type = event.data; + jQuery.event.handle.apply( this, arguments ); +}; + +// Create mouseenter and mouseleave events +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + setup: function( data ) { + jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig ); + }, + teardown: function( data ) { + jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement ); + } + }; +}); + +// submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function( data, namespaces ) { + if ( !jQuery.nodeName( this, "form" ) ) { + jQuery.event.add(this, "click.specialSubmit", function( e ) { + var elem = e.target, + type = elem.type; + + if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) { + trigger( "submit", this, arguments ); + } + }); + + jQuery.event.add(this, "keypress.specialSubmit", function( e ) { + var elem = e.target, + type = elem.type; + + if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) { + trigger( "submit", this, arguments ); + } + }); + + } else { + return false; + } + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialSubmit" ); + } + }; + +} + +// change delegation, happens here so we have bind. +if ( !jQuery.support.changeBubbles ) { + + var changeFilters, + + getVal = function( elem ) { + var type = elem.type, val = elem.value; + + if ( type === "radio" || type === "checkbox" ) { + val = elem.checked; + + } else if ( type === "select-multiple" ) { + val = elem.selectedIndex > -1 ? + jQuery.map( elem.options, function( elem ) { + return elem.selected; + }).join("-") : + ""; + + } else if ( jQuery.nodeName( elem, "select" ) ) { + val = elem.selectedIndex; + } + + return val; + }, + + testChange = function testChange( e ) { + var elem = e.target, data, val; + + if ( !rformElems.test( elem.nodeName ) || elem.readOnly ) { + return; + } + + data = jQuery._data( elem, "_change_data" ); + val = getVal(elem); + + // the current data will be also retrieved by beforeactivate + if ( e.type !== "focusout" || elem.type !== "radio" ) { + jQuery._data( elem, "_change_data", val ); + } + + if ( data === undefined || val === data ) { + return; + } + + if ( data != null || val ) { + e.type = "change"; + e.liveFired = undefined; + jQuery.event.trigger( e, arguments[1], elem ); + } + }; + + jQuery.event.special.change = { + filters: { + focusout: testChange, + + beforedeactivate: testChange, + + click: function( e ) { + var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : ""; + + if ( type === "radio" || type === "checkbox" || jQuery.nodeName( elem, "select" ) ) { + testChange.call( this, e ); + } + }, + + // Change has to be called before submit + // Keydown will be called before keypress, which is used in submit-event delegation + keydown: function( e ) { + var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : ""; + + if ( (e.keyCode === 13 && !jQuery.nodeName( elem, "textarea" ) ) || + (e.keyCode === 32 && (type === "checkbox" || type === "radio")) || + type === "select-multiple" ) { + testChange.call( this, e ); + } + }, + + // Beforeactivate happens also before the previous element is blurred + // with this event you can't trigger a change event, but you can store + // information + beforeactivate: function( e ) { + var elem = e.target; + jQuery._data( elem, "_change_data", getVal(elem) ); + } + }, + + setup: function( data, namespaces ) { + if ( this.type === "file" ) { + return false; + } + + for ( var type in changeFilters ) { + jQuery.event.add( this, type + ".specialChange", changeFilters[type] ); + } + + return rformElems.test( this.nodeName ); + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialChange" ); + + return rformElems.test( this.nodeName ); + } + }; + + changeFilters = jQuery.event.special.change.filters; + + // Handle when the input is .focus()'d + changeFilters.focus = changeFilters.beforeactivate; +} + +function trigger( type, elem, args ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + // Don't pass args or remember liveFired; they apply to the donor event. + var event = jQuery.extend( {}, args[ 0 ] ); + event.type = type; + event.originalEvent = {}; + event.liveFired = undefined; + jQuery.event.handle.call( elem, event ); + if ( event.isDefaultPrevented() ) { + args[ 0 ].preventDefault(); + } +} + +// Create "bubbling" focus and blur events +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + + function handler( donor ) { + // Donor event is always a native one; fix it and switch its type. + // Let focusin/out handler cancel the donor focus/blur event. + var e = jQuery.event.fix( donor ); + e.type = fix; + e.originalEvent = {}; + jQuery.event.trigger( e, null, e.target ); + if ( e.isDefaultPrevented() ) { + donor.preventDefault(); + } + } + }); +} + +jQuery.each(["bind", "one"], function( i, name ) { + jQuery.fn[ name ] = function( type, data, fn ) { + var handler; + + // Handle object literals + if ( typeof type === "object" ) { + for ( var key in type ) { + this[ name ](key, data, type[key], fn); + } + return this; + } + + if ( arguments.length === 2 || data === false ) { + fn = data; + data = undefined; + } + + if ( name === "one" ) { + handler = function( event ) { + jQuery( this ).unbind( event, handler ); + return fn.apply( this, arguments ); + }; + handler.guid = fn.guid || jQuery.guid++; + } else { + handler = fn; + } + + if ( type === "unload" && name !== "one" ) { + this.one( type, data, fn ); + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.add( this[i], type, handler, data ); + } + } + + return this; + }; +}); + +jQuery.fn.extend({ + unbind: function( type, fn ) { + // Handle object literals + if ( typeof type === "object" && !type.preventDefault ) { + for ( var key in type ) { + this.unbind(key, type[key]); + } + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.remove( this[i], type, fn ); + } + } + + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.live( types, data, fn, selector ); + }, + + undelegate: function( selector, types, fn ) { + if ( arguments.length === 0 ) { + return this.unbind( "live" ); + + } else { + return this.die( types, null, fn, selector ); + } + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + guid = fn.guid || jQuery.guid++, + i = 0, + toggler = function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + }; + + // link all the functions, so any of them can unbind this click handler + toggler.guid = guid; + while ( i < args.length ) { + args[ i++ ].guid = guid; + } + + return this.click( toggler ); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +var liveMap = { + focus: "focusin", + blur: "focusout", + mouseenter: "mouseover", + mouseleave: "mouseout" +}; + +jQuery.each(["live", "die"], function( i, name ) { + jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) { + var type, i = 0, match, namespaces, preType, + selector = origSelector || this.selector, + context = origSelector ? this : jQuery( this.context ); + + if ( typeof types === "object" && !types.preventDefault ) { + for ( var key in types ) { + context[ name ]( key, data, types[key], selector ); + } + + return this; + } + + if ( name === "die" && !types && + origSelector && origSelector.charAt(0) === "." ) { + + context.unbind( origSelector ); + + return this; + } + + if ( data === false || jQuery.isFunction( data ) ) { + fn = data || returnFalse; + data = undefined; + } + + types = (types || "").split(" "); + + while ( (type = types[ i++ ]) != null ) { + match = rnamespaces.exec( type ); + namespaces = ""; + + if ( match ) { + namespaces = match[0]; + type = type.replace( rnamespaces, "" ); + } + + if ( type === "hover" ) { + types.push( "mouseenter" + namespaces, "mouseleave" + namespaces ); + continue; + } + + preType = type; + + if ( liveMap[ type ] ) { + types.push( liveMap[ type ] + namespaces ); + type = type + namespaces; + + } else { + type = (liveMap[ type ] || type) + namespaces; + } + + if ( name === "live" ) { + // bind live handler + for ( var j = 0, l = context.length; j < l; j++ ) { + jQuery.event.add( context[j], "live." + liveConvert( type, selector ), + { data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } ); + } + + } else { + // unbind live handler + context.unbind( "live." + liveConvert( type, selector ), fn ); + } + } + + return this; + }; +}); + +function liveHandler( event ) { + var stop, maxLevel, related, match, handleObj, elem, j, i, l, data, close, namespace, ret, + elems = [], + selectors = [], + events = jQuery._data( this, "events" ); + + // Make sure we avoid non-left-click bubbling in Firefox (#3861) and disabled elements in IE (#6911) + if ( event.liveFired === this || !events || !events.live || event.target.disabled || event.button && event.type === "click" ) { + return; + } + + if ( event.namespace ) { + namespace = new RegExp("(^|\\.)" + event.namespace.split(".").join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + event.liveFired = this; + + var live = events.live.slice(0); + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) { + selectors.push( handleObj.selector ); + + } else { + live.splice( j--, 1 ); + } + } + + match = jQuery( event.target ).closest( selectors, event.currentTarget ); + + for ( i = 0, l = match.length; i < l; i++ ) { + close = match[i]; + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( close.selector === handleObj.selector && (!namespace || namespace.test( handleObj.namespace )) && !close.elem.disabled ) { + elem = close.elem; + related = null; + + // Those two events require additional checking + if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) { + event.type = handleObj.preType; + related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0]; + + // Make sure not to accidentally match a child element with the same selector + if ( related && jQuery.contains( elem, related ) ) { + related = elem; + } + } + + if ( !related || related !== elem ) { + elems.push({ elem: elem, handleObj: handleObj, level: close.level }); + } + } + } + } + + for ( i = 0, l = elems.length; i < l; i++ ) { + match = elems[i]; + + if ( maxLevel && match.level > maxLevel ) { + break; + } + + event.currentTarget = match.elem; + event.data = match.handleObj.data; + event.handleObj = match.handleObj; + + ret = match.handleObj.origHandler.apply( match.elem, arguments ); + + if ( ret === false || event.isPropagationStopped() ) { + maxLevel = match.level; + + if ( ret === false ) { + stop = false; + } + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + + return stop; +} + +function liveConvert( type, selector ) { + return (type && type !== "*" ? type + "." : "") + selector.replace(rperiod, "`").replace(rspaces, "&"); +} + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.bind( name, data, fn ) : + this.trigger( name ); + }; + + if ( jQuery.attrFn ) { + jQuery.attrFn[ name ] = true; + } +}); + + + +/*! + * Sizzle CSS Selector Engine + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, + done = 0, + toString = Object.prototype.toString, + hasDuplicate = false, + baseHasDuplicate = true, + rBackslash = /\\/g, + rNonWord = /\W/; + +// Here we check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function() { + baseHasDuplicate = false; + return 0; +}); + +var Sizzle = function( selector, context, results, seed ) { + results = results || []; + context = context || document; + + var origContext = context; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var m, set, checkSet, extra, ret, cur, pop, i, + prune = true, + contextXML = Sizzle.isXML( context ), + parts = [], + soFar = selector; + + // Reset the position of the chunker regexp (start from head) + do { + chunker.exec( "" ); + m = chunker.exec( soFar ); + + if ( m ) { + soFar = m[3]; + + parts.push( m[1] ); + + if ( m[2] ) { + extra = m[3]; + break; + } + } + } while ( m ); + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context ); + + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) { + selector += parts.shift(); + } + + set = posProcess( selector, set ); + } + } + + } else { + // Take a shortcut and set the context if the root selector is an ID + // (but not if it'll be faster if the inner selector is an ID) + if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && + Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + + ret = Sizzle.find( parts.shift(), context, contextXML ); + context = ret.expr ? + Sizzle.filter( ret.expr, ret.set )[0] : + ret.set[0]; + } + + if ( context ) { + ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + + set = ret.expr ? + Sizzle.filter( ret.expr, ret.set ) : + ret.set; + + if ( parts.length > 0 ) { + checkSet = makeArray( set ); + + } else { + prune = false; + } + + while ( parts.length ) { + cur = parts.pop(); + pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, contextXML ); + } + + } else { + checkSet = parts = []; + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + Sizzle.error( cur || selector ); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + + } else if ( context && context.nodeType === 1 ) { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + + } else { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, origContext, results, seed ); + Sizzle.uniqueSort( results ); + } + + return results; +}; + +Sizzle.uniqueSort = function( results ) { + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + } + + return results; +}; + +Sizzle.matches = function( expr, set ) { + return Sizzle( expr, null, null, set ); +}; + +Sizzle.matchesSelector = function( node, expr ) { + return Sizzle( expr, null, null, [node] ).length > 0; +}; + +Sizzle.find = function( expr, context, isXML ) { + var set; + + if ( !expr ) { + return []; + } + + for ( var i = 0, l = Expr.order.length; i < l; i++ ) { + var match, + type = Expr.order[i]; + + if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { + var left = match[1]; + match.splice( 1, 1 ); + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace( rBackslash, "" ); + set = Expr.find[ type ]( match, context, isXML ); + + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = typeof context.getElementsByTagName !== "undefined" ? + context.getElementsByTagName( "*" ) : + []; + } + + return { set: set, expr: expr }; +}; + +Sizzle.filter = function( expr, set, inplace, not ) { + var match, anyFound, + old = expr, + result = [], + curLoop = set, + isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); + + while ( expr && set.length ) { + for ( var type in Expr.filter ) { + if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { + var found, item, + filter = Expr.filter[ type ], + left = match[1]; + + anyFound = false; + + match.splice(1,1); + + if ( left.substr( left.length - 1 ) === "\\" ) { + continue; + } + + if ( curLoop === result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( var i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + var pass = not ^ !!found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + + } else { + curLoop[i] = false; + } + + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr === old ) { + if ( anyFound == null ) { + Sizzle.error( expr ); + + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +Sizzle.error = function( msg ) { + throw "Syntax error, unrecognized expression: " + msg; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + + match: { + ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ + }, + + leftMatch: {}, + + attrMap: { + "class": "className", + "for": "htmlFor" + }, + + attrHandle: { + href: function( elem ) { + return elem.getAttribute( "href" ); + }, + type: function( elem ) { + return elem.getAttribute( "type" ); + } + }, + + relative: { + "+": function(checkSet, part){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !rNonWord.test( part ), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag ) { + part = part.toLowerCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + + ">": function( checkSet, part ) { + var elem, + isPartStr = typeof part === "string", + i = 0, + l = checkSet.length; + + if ( isPartStr && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; + } + } + + } else { + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + + "": function(checkSet, part, isXML){ + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); + }, + + "~": function( checkSet, part, isXML ) { + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); + } + }, + + find: { + ID: function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }, + + NAME: function( match, context ) { + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], + results = context.getElementsByName( match[1] ); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + + TAG: function( match, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( match[1] ); + } + } + }, + preFilter: { + CLASS: function( match, curLoop, inplace, result, not, isXML ) { + match = " " + match[1].replace( rBackslash, "" ) + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) { + if ( !inplace ) { + result.push( elem ); + } + + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + + ID: function( match ) { + return match[1].replace( rBackslash, "" ); + }, + + TAG: function( match, curLoop ) { + return match[1].replace( rBackslash, "" ).toLowerCase(); + }, + + CHILD: function( match ) { + if ( match[1] === "nth" ) { + if ( !match[2] ) { + Sizzle.error( match[0] ); + } + + match[2] = match[2].replace(/^\+|\s*/g, ''); + + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec( + match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + else if ( match[2] ) { + Sizzle.error( match[0] ); + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + + ATTR: function( match, curLoop, inplace, result, not, isXML ) { + var name = match[1] = match[1].replace( rBackslash, "" ); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + // Handle if an un-quoted value was used + match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" ); + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + + PSEUDO: function( match, curLoop, inplace, result, not ) { + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + + if ( !inplace ) { + result.push.apply( result, ret ); + } + + return false; + } + + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + + POS: function( match ) { + match.unshift( true ); + + return match; + } + }, + + filters: { + enabled: function( elem ) { + return elem.disabled === false && elem.type !== "hidden"; + }, + + disabled: function( elem ) { + return elem.disabled === true; + }, + + checked: function( elem ) { + return elem.checked === true; + }, + + selected: function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + parent: function( elem ) { + return !!elem.firstChild; + }, + + empty: function( elem ) { + return !elem.firstChild; + }, + + has: function( elem, i, match ) { + return !!Sizzle( match[3], elem ).length; + }, + + header: function( elem ) { + return (/h\d/i).test( elem.nodeName ); + }, + + text: function( elem ) { + var attr = elem.getAttribute( "type" ), type = elem.type; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null ); + }, + + radio: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type; + }, + + checkbox: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type; + }, + + file: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "file" === elem.type; + }, + + password: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "password" === elem.type; + }, + + submit: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "submit" === elem.type; + }, + + image: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "image" === elem.type; + }, + + reset: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "reset" === elem.type; + }, + + button: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && "button" === elem.type || name === "button"; + }, + + input: function( elem ) { + return (/input|select|textarea|button/i).test( elem.nodeName ); + }, + + focus: function( elem ) { + return elem === elem.ownerDocument.activeElement; + } + }, + setFilters: { + first: function( elem, i ) { + return i === 0; + }, + + last: function( elem, i, match, array ) { + return i === array.length - 1; + }, + + even: function( elem, i ) { + return i % 2 === 0; + }, + + odd: function( elem, i ) { + return i % 2 === 1; + }, + + lt: function( elem, i, match ) { + return i < match[3] - 0; + }, + + gt: function( elem, i, match ) { + return i > match[3] - 0; + }, + + nth: function( elem, i, match ) { + return match[3] - 0 === i; + }, + + eq: function( elem, i, match ) { + return match[3] - 0 === i; + } + }, + filter: { + PSEUDO: function( elem, match, i, array ) { + var name = match[1], + filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || Sizzle.getText([ elem ]) || "").indexOf(match[3]) >= 0; + + } else if ( name === "not" ) { + var not = match[3]; + + for ( var j = 0, l = not.length; j < l; j++ ) { + if ( not[j] === elem ) { + return false; + } + } + + return true; + + } else { + Sizzle.error( name ); + } + }, + + CHILD: function( elem, match ) { + var type = match[1], + node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + + case "nth": + var first = match[2], + last = match[3]; + + if ( first === 1 && last === 0 ) { + return true; + } + + var doneName = match[0], + parent = elem.parentNode; + + if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) { + var count = 0; + + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + + parent.sizcache = doneName; + } + + var diff = elem.nodeIndex - last; + + if ( first === 0 ) { + return diff === 0; + + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + } + }, + + ID: function( elem, match ) { + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + + TAG: function( elem, match ) { + return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match; + }, + + CLASS: function( elem, match ) { + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + + ATTR: function( elem, match ) { + var name = match[1], + result = Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value !== check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + + POS: function( elem, match, i, array ) { + var name = match[2], + filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS, + fescape = function(all, num){ + return "\\" + (num - 0 + 1); + }; + +for ( var type in Expr.match ) { + Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); + Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); +} + +var makeArray = function( array, results ) { + array = Array.prototype.slice.call( array, 0 ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +// Also verifies that the returned array holds DOM nodes +// (which is not the case in the Blackberry browser) +try { + Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; + +// Provide a fallback method if it does not work +} catch( e ) { + makeArray = function( array, results ) { + var i = 0, + ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + + } else { + if ( typeof array.length === "number" ) { + for ( var l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + + } else { + for ( ; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder, siblingCheck; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { + return a.compareDocumentPosition ? -1 : 1; + } + + return a.compareDocumentPosition(b) & 4 ? -1 : 1; + }; + +} else { + sortOrder = function( a, b ) { + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Fallback to using sourceIndex (in IE) if it's available on both nodes + } else if ( a.sourceIndex && b.sourceIndex ) { + return a.sourceIndex - b.sourceIndex; + } + + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // If the nodes are siblings (or identical) we can do a quick check + if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + + siblingCheck = function( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; + }; +} + +// Utility function for retreiving the text value of an array of DOM nodes +Sizzle.getText = function( elems ) { + var ret = "", elem; + + for ( var i = 0; elems[i]; i++ ) { + elem = elems[i]; + + // Get the text from text nodes and CDATA nodes + if ( elem.nodeType === 3 || elem.nodeType === 4 ) { + ret += elem.nodeValue; + + // Traverse everything else, except comment nodes + } else if ( elem.nodeType !== 8 ) { + ret += Sizzle.getText( elem.childNodes ); + } + } + + return ret; +}; + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("div"), + id = "script" + (new Date()).getTime(), + root = document.documentElement; + + form.innerHTML = "<a name='" + id + "'/>"; + + // Inject it into the root element, check its status, and remove it quickly + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( document.getElementById( id ) ) { + Expr.find.ID = function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + + return m ? + m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? + [m] : + undefined : + []; + } + }; + + Expr.filter.ID = function( elem, match ) { + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); + + // release memory in IE + root = form = null; +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function( match, context ) { + var results = context.getElementsByTagName( match[1] ); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = "<a href='#'></a>"; + + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + + Expr.attrHandle.href = function( elem ) { + return elem.getAttribute( "href", 2 ); + }; + } + + // release memory in IE + div = null; +})(); + +if ( document.querySelectorAll ) { + (function(){ + var oldSizzle = Sizzle, + div = document.createElement("div"), + id = "__sizzle__"; + + div.innerHTML = "<p class='TEST'></p>"; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function( query, context, extra, seed ) { + context = context || document; + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && !Sizzle.isXML(context) ) { + // See if we find a selector to speed up + var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query ); + + if ( match && (context.nodeType === 1 || context.nodeType === 9) ) { + // Speed-up: Sizzle("TAG") + if ( match[1] ) { + return makeArray( context.getElementsByTagName( query ), extra ); + + // Speed-up: Sizzle(".CLASS") + } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) { + return makeArray( context.getElementsByClassName( match[2] ), extra ); + } + } + + if ( context.nodeType === 9 ) { + // Speed-up: Sizzle("body") + // The body element only exists once, optimize finding it + if ( query === "body" && context.body ) { + return makeArray( [ context.body ], extra ); + + // Speed-up: Sizzle("#ID") + } else if ( match && match[3] ) { + var elem = context.getElementById( match[3] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id === match[3] ) { + return makeArray( [ elem ], extra ); + } + + } else { + return makeArray( [], extra ); + } + } + + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(qsaError) {} + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + var oldContext = context, + old = context.getAttribute( "id" ), + nid = old || id, + hasParent = context.parentNode, + relativeHierarchySelector = /^\s*[+~]/.test( query ); + + if ( !old ) { + context.setAttribute( "id", nid ); + } else { + nid = nid.replace( /'/g, "\\$&" ); + } + if ( relativeHierarchySelector && hasParent ) { + context = context.parentNode; + } + + try { + if ( !relativeHierarchySelector || hasParent ) { + return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra ); + } + + } catch(pseudoError) { + } finally { + if ( !old ) { + oldContext.removeAttribute( "id" ); + } + } + } + } + + return oldSizzle(query, context, extra, seed); + }; + + for ( var prop in oldSizzle ) { + Sizzle[ prop ] = oldSizzle[ prop ]; + } + + // release memory in IE + div = null; + })(); +} + +(function(){ + var html = document.documentElement, + matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector; + + if ( matches ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9 fails this) + var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ), + pseudoWorks = false; + + try { + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( document.documentElement, "[test!='']:sizzle" ); + + } catch( pseudoError ) { + pseudoWorks = true; + } + + Sizzle.matchesSelector = function( node, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + if ( !Sizzle.isXML( node ) ) { + try { + if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { + var ret = matches.call( node, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || !disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9, so check for that + node.document && node.document.nodeType !== 11 ) { + return ret; + } + } + } catch(e) {} + } + + return Sizzle(expr, null, null, [node]).length > 0; + }; + } +})(); + +(function(){ + var div = document.createElement("div"); + + div.innerHTML = "<div class='test e'></div><div class='test'></div>"; + + // Opera can't find a second classname (in 9.6) + // Also, make sure that getElementsByClassName actually exists + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) { + return; + } + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function( match, context, isXML ) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; + + // release memory in IE + div = null; +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( elem.nodeName.toLowerCase() === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +if ( document.documentElement.contains ) { + Sizzle.contains = function( a, b ) { + return a !== b && (a.contains ? a.contains(b) : true); + }; + +} else if ( document.documentElement.compareDocumentPosition ) { + Sizzle.contains = function( a, b ) { + return !!(a.compareDocumentPosition(b) & 16); + }; + +} else { + Sizzle.contains = function() { + return false; + }; +} + +Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; + + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +var posProcess = function( selector, context ) { + var match, + tmpSet = [], + later = "", + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})(); + + +var runtil = /Until$/, + rparentsprev = /^(?:parents|prevUntil|prevAll)/, + // Note: This RegExp should be improved, or likely pulled from Sizzle + rmultiselector = /,/, + isSimple = /^.[^:#\[\.,]*$/, + slice = Array.prototype.slice, + POS = jQuery.expr.match.POS, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var self = this, + i, l; + + if ( typeof selector !== "string" ) { + return jQuery( selector ).filter(function() { + for ( i = 0, l = self.length; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }); + } + + var ret = this.pushStack( "", "find", selector ), + length, n, r; + + for ( i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( n = length; n < ret.length; n++ ) { + for ( r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var targets = jQuery( target ); + return this.filter(function() { + for ( var i = 0, l = targets.length; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && ( typeof selector === "string" ? + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var ret = [], i, l, cur = this[0]; + + // Array + if ( jQuery.isArray( selectors ) ) { + var match, selector, + matches = {}, + level = 1; + + if ( cur && selectors.length ) { + for ( i = 0, l = selectors.length; i < l; i++ ) { + selector = selectors[i]; + + if ( !matches[ selector ] ) { + matches[ selector ] = POS.test( selector ) ? + jQuery( selector, context || this.context ) : + selector; + } + } + + while ( cur && cur.ownerDocument && cur !== context ) { + for ( selector in matches ) { + match = matches[ selector ]; + + if ( match.jquery ? match.index( cur ) > -1 : jQuery( cur ).is( match ) ) { + ret.push({ selector: selector, elem: cur, level: level }); + } + } + + cur = cur.parentNode; + level++; + } + } + + return ret; + } + + // String + var pos = POS.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( i = 0, l = this.length; i < l; i++ ) { + cur = this[i]; + + while ( cur ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + + } else { + cur = cur.parentNode; + if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) { + break; + } + } + } + } + + ret = ret.length > 1 ? jQuery.unique( ret ) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + if ( !elem || typeof elem === "string" ) { + return jQuery.inArray( this[0], + // If it receives a string, the selector is used + // If it receives nothing, the siblings are used + elem ? jQuery( elem ) : this.parent().children() ); + } + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + andSelf: function() { + return this.add( this.prevObject ); + } +}); + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return jQuery.nth( elem, 2, "nextSibling" ); + }, + prev: function( elem ) { + return jQuery.nth( elem, 2, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( elem.parentNode.firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.makeArray( elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ), + // The variable 'args' was introduced in + // https://github.com/jquery/jquery/commit/52a0238 + // to work around a bug in Chrome 10 (Dev) and should be removed when the bug is fixed. + // http://code.google.com/p/v8/issues/detail?id=1050 + args = slice.call(arguments); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, args.join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + nth: function( cur, result, dir, elem ) { + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) { + if ( cur.nodeType === 1 && ++num === result ) { + break; + } + } + + return cur; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return (elem === qualifier) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return (jQuery.inArray( elem, qualifier ) >= 0) === keep; + }); +} + + + + +var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, + rtagName = /<([\w:]+)/, + rtbody = /<tbody/i, + rhtml = /<|&#?\w+;/, + rnocache = /<(?:script|object|embed|option|style)/i, + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + rscriptType = /\/(java|ecma)script/i, + rcleanScript = /^\s*<!(?:\[CDATA\[|\-\-)/, + wrapMap = { + option: [ 1, "<select multiple='multiple'>", "</select>" ], + legend: [ 1, "<fieldset>", "</fieldset>" ], + thead: [ 1, "<table>", "</table>" ], + tr: [ 2, "<table><tbody>", "</tbody></table>" ], + td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], + col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ], + area: [ 1, "<map>", "</map>" ], + _default: [ 0, "", "" ] + }; + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE can't serialize <link> and <script> tags normally +if ( !jQuery.support.htmlSerialize ) { + wrapMap._default = [ 1, "div<div>", "</div>" ]; +} + +jQuery.fn.extend({ + text: function( text ) { + if ( jQuery.isFunction(text) ) { + return this.each(function(i) { + var self = jQuery( this ); + + self.text( text.call(this, i, self.text()) ); + }); + } + + if ( typeof text !== "object" && text !== undefined ) { + return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) ); + } + + return jQuery.text( this ); + }, + + wrapAll: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapAll( html.call(this, i) ); + }); + } + + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + + if ( this[0].parentNode ) { + wrap.insertBefore( this[0] ); + } + + wrap.map(function() { + var elem = this; + + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } + + return elem; + }).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapInner( html.call(this, i) ); + }); + } + + return this.each(function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + }); + }, + + wrap: function( html ) { + return this.each(function() { + jQuery( this ).wrapAll( html ); + }); + }, + + unwrap: function() { + return this.parent().each(function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + }).end(); + }, + + append: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.appendChild( elem ); + } + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.insertBefore( elem, this.firstChild ); + } + }); + }, + + before: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this ); + }); + } else if ( arguments.length ) { + var set = jQuery(arguments[0]); + set.push.apply( set, this.toArray() ); + return this.pushStack( set, "before", arguments ); + } + }, + + after: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + } else if ( arguments.length ) { + var set = this.pushStack( this, "after", arguments ); + set.push.apply( set, jQuery(arguments[0]).toArray() ); + return set; + } + }, + + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { + if ( !keepData && elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + jQuery.cleanData( [ elem ] ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + } + } + + return this; + }, + + empty: function() { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function () { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + }); + }, + + html: function( value ) { + if ( value === undefined ) { + return this[0] && this[0].nodeType === 1 ? + this[0].innerHTML.replace(rinlinejQuery, "") : + null; + + // See if we can take a shortcut and just use innerHTML + } else if ( typeof value === "string" && !rnocache.test( value ) && + (jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) && + !wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) { + + value = value.replace(rxhtmlTag, "<$1></$2>"); + + try { + for ( var i = 0, l = this.length; i < l; i++ ) { + // Remove element nodes and prevent memory leaks + if ( this[i].nodeType === 1 ) { + jQuery.cleanData( this[i].getElementsByTagName("*") ); + this[i].innerHTML = value; + } + } + + // If using innerHTML throws an exception, use the fallback method + } catch(e) { + this.empty().append( value ); + } + + } else if ( jQuery.isFunction( value ) ) { + this.each(function(i){ + var self = jQuery( this ); + + self.html( value.call(this, i, self.html()) ); + }); + + } else { + this.empty().append( value ); + } + + return this; + }, + + replaceWith: function( value ) { + if ( this[0] && this[0].parentNode ) { + // Make sure that the elements are removed from the DOM before they are inserted + // this can help fix replacing a parent with child elements + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this), old = self.html(); + self.replaceWith( value.call( this, i, old ) ); + }); + } + + if ( typeof value !== "string" ) { + value = jQuery( value ).detach(); + } + + return this.each(function() { + var next = this.nextSibling, + parent = this.parentNode; + + jQuery( this ).remove(); + + if ( next ) { + jQuery(next).before( value ); + } else { + jQuery(parent).append( value ); + } + }); + } else { + return this.length ? + this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) : + this; + } + }, + + detach: function( selector ) { + return this.remove( selector, true ); + }, + + domManip: function( args, table, callback ) { + var results, first, fragment, parent, + value = args[0], + scripts = []; + + // We can't cloneNode fragments that contain checked, in WebKit + if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) { + return this.each(function() { + jQuery(this).domManip( args, table, callback, true ); + }); + } + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + args[0] = value.call(this, i, table ? self.html() : undefined); + self.domManip( args, table, callback ); + }); + } + + if ( this[0] ) { + parent = value && value.parentNode; + + // If we're in a fragment, just use that instead of building a new one + if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) { + results = { fragment: parent }; + + } else { + results = jQuery.buildFragment( args, this, scripts ); + } + + fragment = results.fragment; + + if ( fragment.childNodes.length === 1 ) { + first = fragment = fragment.firstChild; + } else { + first = fragment.firstChild; + } + + if ( first ) { + table = table && jQuery.nodeName( first, "tr" ); + + for ( var i = 0, l = this.length, lastIndex = l - 1; i < l; i++ ) { + callback.call( + table ? + root(this[i], first) : + this[i], + // Make sure that we do not leak memory by inadvertently discarding + // the original fragment (which might have attached data) instead of + // using it; in addition, use the original fragment object for the last + // item instead of first because it can end up being emptied incorrectly + // in certain situations (Bug #8070). + // Fragments from the fragment cache must always be cloned and never used + // in place. + results.cacheable || (l > 1 && i < lastIndex) ? + jQuery.clone( fragment, true, true ) : + fragment + ); + } + } + + if ( scripts.length ) { + jQuery.each( scripts, evalScript ); + } + } + + return this; + } +}); + +function root( elem, cur ) { + return jQuery.nodeName(elem, "table") ? + (elem.getElementsByTagName("tbody")[0] || + elem.appendChild(elem.ownerDocument.createElement("tbody"))) : + elem; +} + +function cloneCopyEvent( src, dest ) { + + if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { + return; + } + + var internalKey = jQuery.expando, + oldData = jQuery.data( src ), + curData = jQuery.data( dest, oldData ); + + // Switch to use the internal data object, if it exists, for the next + // stage of data copying + if ( (oldData = oldData[ internalKey ]) ) { + var events = oldData.events; + curData = curData[ internalKey ] = jQuery.extend({}, oldData); + + if ( events ) { + delete curData.handle; + curData.events = {}; + + for ( var type in events ) { + for ( var i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type + ( events[ type ][ i ].namespace ? "." : "" ) + events[ type ][ i ].namespace, events[ type ][ i ], events[ type ][ i ].data ); + } + } + } + } +} + +function cloneFixAttributes( src, dest ) { + var nodeName; + + // We do not need to do anything for non-Elements + if ( dest.nodeType !== 1 ) { + return; + } + + // clearAttributes removes the attributes, which we don't want, + // but also removes the attachEvent events, which we *do* want + if ( dest.clearAttributes ) { + dest.clearAttributes(); + } + + // mergeAttributes, in contrast, only merges back on the + // original attributes, not the events + if ( dest.mergeAttributes ) { + dest.mergeAttributes( src ); + } + + nodeName = dest.nodeName.toLowerCase(); + + // IE6-8 fail to clone children inside object elements that use + // the proprietary classid attribute value (rather than the type + // attribute) to identify the type of content to display + if ( nodeName === "object" ) { + dest.outerHTML = src.outerHTML; + + } else if ( nodeName === "input" && (src.type === "checkbox" || src.type === "radio") ) { + // IE6-8 fails to persist the checked state of a cloned checkbox + // or radio button. Worse, IE6-7 fail to give the cloned element + // a checked appearance if the defaultChecked value isn't also set + if ( src.checked ) { + dest.defaultChecked = dest.checked = src.checked; + } + + // IE6-7 get confused and end up setting the value of a cloned + // checkbox/radio button to an empty string instead of "on" + if ( dest.value !== src.value ) { + dest.value = src.value; + } + + // IE6-8 fails to return the selected option to the default selected + // state when cloning options + } else if ( nodeName === "option" ) { + dest.selected = src.defaultSelected; + + // IE6-8 fails to set the defaultValue to the correct value when + // cloning other types of input fields + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } + + // Event data gets referenced instead of copied if the expando + // gets copied too + dest.removeAttribute( jQuery.expando ); +} + +jQuery.buildFragment = function( args, nodes, scripts ) { + var fragment, cacheable, cacheresults, doc; + + // nodes may contain either an explicit document object, + // a jQuery collection or context object. + // If nodes[0] contains a valid object to assign to doc + if ( nodes && nodes[0] ) { + doc = nodes[0].ownerDocument || nodes[0]; + } + + // Ensure that an attr object doesn't incorrectly stand in as a document object + // Chrome and Firefox seem to allow this to occur and will throw exception + // Fixes #8950 + if ( !doc.createDocumentFragment ) { + doc = document; + } + + // Only cache "small" (1/2 KB) HTML strings that are associated with the main document + // Cloning options loses the selected state, so don't cache them + // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment + // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache + if ( args.length === 1 && typeof args[0] === "string" && args[0].length < 512 && doc === document && + args[0].charAt(0) === "<" && !rnocache.test( args[0] ) && (jQuery.support.checkClone || !rchecked.test( args[0] )) ) { + + cacheable = true; + + cacheresults = jQuery.fragments[ args[0] ]; + if ( cacheresults && cacheresults !== 1 ) { + fragment = cacheresults; + } + } + + if ( !fragment ) { + fragment = doc.createDocumentFragment(); + jQuery.clean( args, doc, fragment, scripts ); + } + + if ( cacheable ) { + jQuery.fragments[ args[0] ] = cacheresults ? fragment : 1; + } + + return { fragment: fragment, cacheable: cacheable }; +}; + +jQuery.fragments = {}; + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var ret = [], + insert = jQuery( selector ), + parent = this.length === 1 && this[0].parentNode; + + if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) { + insert[ original ]( this[0] ); + return this; + + } else { + for ( var i = 0, l = insert.length; i < l; i++ ) { + var elems = (i > 0 ? this.clone(true) : this).get(); + jQuery( insert[i] )[ original ]( elems ); + ret = ret.concat( elems ); + } + + return this.pushStack( ret, name, insert.selector ); + } + }; +}); + +function getAll( elem ) { + if ( "getElementsByTagName" in elem ) { + return elem.getElementsByTagName( "*" ); + + } else if ( "querySelectorAll" in elem ) { + return elem.querySelectorAll( "*" ); + + } else { + return []; + } +} + +// Used in clean, fixes the defaultChecked property +function fixDefaultChecked( elem ) { + if ( elem.type === "checkbox" || elem.type === "radio" ) { + elem.defaultChecked = elem.checked; + } +} +// Finds all inputs and passes them to fixDefaultChecked +function findInputs( elem ) { + if ( jQuery.nodeName( elem, "input" ) ) { + fixDefaultChecked( elem ); + } else if ( "getElementsByTagName" in elem ) { + jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked ); + } +} + +jQuery.extend({ + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var clone = elem.cloneNode(true), + srcElements, + destElements, + i; + + if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) && + (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) { + // IE copies events bound via attachEvent when using cloneNode. + // Calling detachEvent on the clone will also remove the events + // from the original. In order to get around this, we use some + // proprietary methods to clear the events. Thanks to MooTools + // guys for this hotness. + + cloneFixAttributes( elem, clone ); + + // Using Sizzle here is crazy slow, so we use getElementsByTagName + // instead + srcElements = getAll( elem ); + destElements = getAll( clone ); + + // Weird iteration because IE will replace the length property + // with an element if you are cloning the body and one of the + // elements on the page has a name or id of "length" + for ( i = 0; srcElements[i]; ++i ) { + cloneFixAttributes( srcElements[i], destElements[i] ); + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + cloneCopyEvent( elem, clone ); + + if ( deepDataAndEvents ) { + srcElements = getAll( elem ); + destElements = getAll( clone ); + + for ( i = 0; srcElements[i]; ++i ) { + cloneCopyEvent( srcElements[i], destElements[i] ); + } + } + } + + srcElements = destElements = null; + + // Return the cloned set + return clone; + }, + + clean: function( elems, context, fragment, scripts ) { + var checkScriptType; + + context = context || document; + + // !context.createElement fails in IE with an error but returns typeof 'object' + if ( typeof context.createElement === "undefined" ) { + context = context.ownerDocument || context[0] && context[0].ownerDocument || document; + } + + var ret = [], j; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( typeof elem === "number" ) { + elem += ""; + } + + if ( !elem ) { + continue; + } + + // Convert html string into DOM nodes + if ( typeof elem === "string" ) { + if ( !rhtml.test( elem ) ) { + elem = context.createTextNode( elem ); + } else { + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(rxhtmlTag, "<$1></$2>"); + + // Trim whitespace, otherwise indexOf won't work as expected + var tag = (rtagName.exec( elem ) || ["", ""])[1].toLowerCase(), + wrap = wrapMap[ tag ] || wrapMap._default, + depth = wrap[0], + div = context.createElement("div"); + + // Go to html and back, then peel off extra wrappers + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( depth-- ) { + div = div.lastChild; + } + + // Remove IE's autoinserted <tbody> from table fragments + if ( !jQuery.support.tbody ) { + + // String was a <table>, *may* have spurious <tbody> + var hasBody = rtbody.test(elem), + tbody = tag === "table" && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare <thead> or <tfoot> + wrap[1] === "<table>" && !hasBody ? + div.childNodes : + []; + + for ( j = tbody.length - 1; j >= 0 ; --j ) { + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + } + } + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); + } + + elem = div.childNodes; + } + } + + // Resets defaultChecked for any radios and checkboxes + // about to be appended to the DOM in IE 6/7 (#8060) + var len; + if ( !jQuery.support.appendChecked ) { + if ( elem[0] && typeof (len = elem.length) === "number" ) { + for ( j = 0; j < len; j++ ) { + findInputs( elem[j] ); + } + } else { + findInputs( elem ); + } + } + + if ( elem.nodeType ) { + ret.push( elem ); + } else { + ret = jQuery.merge( ret, elem ); + } + } + + if ( fragment ) { + checkScriptType = function( elem ) { + return !elem.type || rscriptType.test( elem.type ); + }; + for ( i = 0; ret[i]; i++ ) { + if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) { + scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] ); + + } else { + if ( ret[i].nodeType === 1 ) { + var jsTags = jQuery.grep( ret[i].getElementsByTagName( "script" ), checkScriptType ); + + ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) ); + } + fragment.appendChild( ret[i] ); + } + } + } + + return ret; + }, + + cleanData: function( elems ) { + var data, id, cache = jQuery.cache, internalKey = jQuery.expando, special = jQuery.event.special, + deleteExpando = jQuery.support.deleteExpando; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) { + continue; + } + + id = elem[ jQuery.expando ]; + + if ( id ) { + data = cache[ id ] && cache[ id ][ internalKey ]; + + if ( data && data.events ) { + for ( var type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + + // Null the DOM reference to avoid IE6/7/8 leak (#7054) + if ( data.handle ) { + data.handle.elem = null; + } + } + + if ( deleteExpando ) { + delete elem[ jQuery.expando ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } + + delete cache[ id ]; + } + } + } +}); + +function evalScript( i, elem ) { + if ( elem.src ) { + jQuery.ajax({ + url: elem.src, + async: false, + dataType: "script" + }); + } else { + jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "/*$0*/" ) ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } +} + + + +var ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity=([^)]*)/, + // fixed for IE9, see #8346 + rupper = /([A-Z]|^ms)/g, + rnumpx = /^-?\d+(?:px)?$/i, + rnum = /^-?\d/, + rrelNum = /^[+\-]=/, + rrelNumFilter = /[^+\-\.\de]+/g, + + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssWidth = [ "Left", "Right" ], + cssHeight = [ "Top", "Bottom" ], + curCSS, + + getComputedStyle, + currentStyle; + +jQuery.fn.css = function( name, value ) { + // Setting 'undefined' is a no-op + if ( arguments.length === 2 && value === undefined ) { + return this; + } + + return jQuery.access( this, name, value, true, function( elem, name, value ) { + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }); +}; + +jQuery.extend({ + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity", "opacity" ); + return ret === "" ? "1" : ret; + + } else { + return elem.style.opacity; + } + } + } + }, + + // Exclude the following css properties to add px + cssNumber: { + "fillOpacity": true, + "fontWeight": true, + "lineHeight": true, + "opacity": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { + // normalize float css property + "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" + }, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, origName = jQuery.camelCase( name ), + style = elem.style, hooks = jQuery.cssHooks[ origName ]; + + name = jQuery.cssProps[ origName ] || origName; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // Make sure that NaN and null values aren't set. See: #7116 + if ( type === "number" && isNaN( value ) || value == null ) { + return; + } + + // convert relative number strings (+= or -=) to relative numbers. #7345 + if ( type === "string" && rrelNum.test( value ) ) { + value = +value.replace( rrelNumFilter, "" ) + parseFloat( jQuery.css( elem, name ) ); + // Fixes bug #9237 + type = "number"; + } + + // If a number was passed in, add 'px' to the (except for certain CSS properties) + if ( type === "number" && !jQuery.cssNumber[ origName ] ) { + value += "px"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) { + // Wrapped to prevent IE from throwing errors when 'invalid' values are provided + // Fixes bug #5509 + try { + style[ name ] = value; + } catch(e) {} + } + + } else { + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra ) { + var ret, hooks; + + // Make sure that we're working with the right name + name = jQuery.camelCase( name ); + hooks = jQuery.cssHooks[ name ]; + name = jQuery.cssProps[ name ] || name; + + // cssFloat needs a special treatment + if ( name === "cssFloat" ) { + name = "float"; + } + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) { + return ret; + + // Otherwise, if a way to get the computed value exists, use that + } else if ( curCSS ) { + return curCSS( elem, name ); + } + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var old = {}; + + // Remember the old values, and insert the new ones + for ( var name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + } +}); + +// DEPRECATED, Use jQuery.css() instead +jQuery.curCSS = jQuery.css; + +jQuery.each(["height", "width"], function( i, name ) { + jQuery.cssHooks[ name ] = { + get: function( elem, computed, extra ) { + var val; + + if ( computed ) { + if ( elem.offsetWidth !== 0 ) { + return getWH( elem, name, extra ); + } else { + jQuery.swap( elem, cssShow, function() { + val = getWH( elem, name, extra ); + }); + } + + return val; + } + }, + + set: function( elem, value ) { + if ( rnumpx.test( value ) ) { + // ignore negative width and height values #1599 + value = parseFloat( value ); + + if ( value >= 0 ) { + return value + "px"; + } + + } else { + return value; + } + } + }; +}); + +if ( !jQuery.support.opacity ) { + jQuery.cssHooks.opacity = { + get: function( elem, computed ) { + // IE uses filters for opacity + return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ? + ( parseFloat( RegExp.$1 ) / 100 ) + "" : + computed ? "1" : ""; + }, + + set: function( elem, value ) { + var style = elem.style, + currentStyle = elem.currentStyle; + + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + style.zoom = 1; + + // Set the alpha filter to set the opacity + var opacity = jQuery.isNaN( value ) ? + "" : + "alpha(opacity=" + value * 100 + ")", + filter = currentStyle && currentStyle.filter || style.filter || ""; + + style.filter = ralpha.test( filter ) ? + filter.replace( ralpha, opacity ) : + filter + " " + opacity; + } + }; +} + +jQuery(function() { + // This hook cannot be added until DOM ready because the support test + // for it is not run until after DOM ready + if ( !jQuery.support.reliableMarginRight ) { + jQuery.cssHooks.marginRight = { + get: function( elem, computed ) { + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + // Work around by temporarily setting element display to inline-block + var ret; + jQuery.swap( elem, { "display": "inline-block" }, function() { + if ( computed ) { + ret = curCSS( elem, "margin-right", "marginRight" ); + } else { + ret = elem.style.marginRight; + } + }); + return ret; + } + }; + } +}); + +if ( document.defaultView && document.defaultView.getComputedStyle ) { + getComputedStyle = function( elem, name ) { + var ret, defaultView, computedStyle; + + name = name.replace( rupper, "-$1" ).toLowerCase(); + + if ( !(defaultView = elem.ownerDocument.defaultView) ) { + return undefined; + } + + if ( (computedStyle = defaultView.getComputedStyle( elem, null )) ) { + ret = computedStyle.getPropertyValue( name ); + if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { + ret = jQuery.style( elem, name ); + } + } + + return ret; + }; +} + +if ( document.documentElement.currentStyle ) { + currentStyle = function( elem, name ) { + var left, + ret = elem.currentStyle && elem.currentStyle[ name ], + rsLeft = elem.runtimeStyle && elem.runtimeStyle[ name ], + style = elem.style; + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + if ( !rnumpx.test( ret ) && rnum.test( ret ) ) { + // Remember the original values + left = style.left; + + // Put in the new values to get a computed value out + if ( rsLeft ) { + elem.runtimeStyle.left = elem.currentStyle.left; + } + style.left = name === "fontSize" ? "1em" : (ret || 0); + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + if ( rsLeft ) { + elem.runtimeStyle.left = rsLeft; + } + } + + return ret === "" ? "auto" : ret; + }; +} + +curCSS = getComputedStyle || currentStyle; + +function getWH( elem, name, extra ) { + + // Start with offset property + var val = name === "width" ? elem.offsetWidth : elem.offsetHeight, + which = name === "width" ? cssWidth : cssHeight; + + if ( val > 0 ) { + if ( extra !== "border" ) { + jQuery.each( which, function() { + if ( !extra ) { + val -= parseFloat( jQuery.css( elem, "padding" + this ) ) || 0; + } + if ( extra === "margin" ) { + val += parseFloat( jQuery.css( elem, extra + this ) ) || 0; + } else { + val -= parseFloat( jQuery.css( elem, "border" + this + "Width" ) ) || 0; + } + }); + } + + return val + "px"; + } + + // Fall back to computed then uncomputed css if necessary + val = curCSS( elem, name, name ); + if ( val < 0 || val == null ) { + val = elem.style[ name ] || 0; + } + // Normalize "", auto, and prepare for extra + val = parseFloat( val ) || 0; + + // Add padding, border, margin + if ( extra ) { + jQuery.each( which, function() { + val += parseFloat( jQuery.css( elem, "padding" + this ) ) || 0; + if ( extra !== "padding" ) { + val += parseFloat( jQuery.css( elem, "border" + this + "Width" ) ) || 0; + } + if ( extra === "margin" ) { + val += parseFloat( jQuery.css( elem, extra + this ) ) || 0; + } + }); + } + + return val + "px"; +} + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.hidden = function( elem ) { + var width = elem.offsetWidth, + height = elem.offsetHeight; + + return (width === 0 && height === 0) || (!jQuery.support.reliableHiddenOffsets && (elem.style.display || jQuery.css( elem, "display" )) === "none"); + }; + + jQuery.expr.filters.visible = function( elem ) { + return !jQuery.expr.filters.hidden( elem ); + }; +} + + + + +var r20 = /%20/g, + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rhash = /#.*$/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL + rinput = /^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + rquery = /\?/, + rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, + rselectTextarea = /^(?:select|textarea)/i, + rspacesAjax = /\s+/, + rts = /([?&])_=[^&]*/, + rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/, + + // Keep a copy of the old load method + _load = jQuery.fn.load, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Document location + ajaxLocation, + + // Document location segments + ajaxLocParts; + +// #8138, IE may throw an exception when accessing +// a field from window.location if document.domain has been set +try { + ajaxLocation = location.href; +} catch( e ) { + // Use the href attribute of an A element + // since IE will modify it given document.location + ajaxLocation = document.createElement( "a" ); + ajaxLocation.href = ""; + ajaxLocation = ajaxLocation.href; +} + +// Segment location into parts +ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || []; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + if ( jQuery.isFunction( func ) ) { + var dataTypes = dataTypeExpression.toLowerCase().split( rspacesAjax ), + i = 0, + length = dataTypes.length, + dataType, + list, + placeBefore; + + // For each dataType in the dataTypeExpression + for(; i < length; i++ ) { + dataType = dataTypes[ i ]; + // We control if we're asked to add before + // any existing element + placeBefore = /^\+/.test( dataType ); + if ( placeBefore ) { + dataType = dataType.substr( 1 ) || "*"; + } + list = structure[ dataType ] = structure[ dataType ] || []; + // then we add to the structure accordingly + list[ placeBefore ? "unshift" : "push" ]( func ); + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR, + dataType /* internal */, inspected /* internal */ ) { + + dataType = dataType || options.dataTypes[ 0 ]; + inspected = inspected || {}; + + inspected[ dataType ] = true; + + var list = structure[ dataType ], + i = 0, + length = list ? list.length : 0, + executeOnly = ( structure === prefilters ), + selection; + + for(; i < length && ( executeOnly || !selection ); i++ ) { + selection = list[ i ]( options, originalOptions, jqXHR ); + // If we got redirected to another dataType + // we try there if executing only and not done already + if ( typeof selection === "string" ) { + if ( !executeOnly || inspected[ selection ] ) { + selection = undefined; + } else { + options.dataTypes.unshift( selection ); + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, selection, inspected ); + } + } + } + // If we're only executing or nothing was selected + // we try the catchall dataType if not done already + if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) { + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, "*", inspected ); + } + // unnecessary when only executing (prefilters) + // but it'll be ignored by the caller in that case + return selection; +} + +jQuery.fn.extend({ + load: function( url, params, callback ) { + if ( typeof url !== "string" && _load ) { + return _load.apply( this, arguments ); + + // Don't do a request if no elements are being requested + } else if ( !this.length ) { + return this; + } + + var off = url.indexOf( " " ); + if ( off >= 0 ) { + var selector = url.slice( off, url.length ); + url = url.slice( 0, off ); + } + + // Default to a GET request + var type = "GET"; + + // If the second parameter was provided + if ( params ) { + // If it's a function + if ( jQuery.isFunction( params ) ) { + // We assume that it's the callback + callback = params; + params = undefined; + + // Otherwise, build a param string + } else if ( typeof params === "object" ) { + params = jQuery.param( params, jQuery.ajaxSettings.traditional ); + type = "POST"; + } + } + + var self = this; + + // Request the remote document + jQuery.ajax({ + url: url, + type: type, + dataType: "html", + data: params, + // Complete callback (responseText is used internally) + complete: function( jqXHR, status, responseText ) { + // Store the response as specified by the jqXHR object + responseText = jqXHR.responseText; + // If successful, inject the HTML into all the matched elements + if ( jqXHR.isResolved() ) { + // #4825: Get the actual response in case + // a dataFilter is present in ajaxSettings + jqXHR.done(function( r ) { + responseText = r; + }); + // See if a selector was specified + self.html( selector ? + // Create a dummy div to hold the results + jQuery("<div>") + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append(responseText.replace(rscript, "")) + + // Locate the specified elements + .find(selector) : + + // If not, just inject the full result + responseText ); + } + + if ( callback ) { + self.each( callback, [ responseText, status, jqXHR ] ); + } + } + }); + + return this; + }, + + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + + serializeArray: function() { + return this.map(function(){ + return this.elements ? jQuery.makeArray( this.elements ) : this; + }) + .filter(function(){ + return this.name && !this.disabled && + ( this.checked || rselectTextarea.test( this.nodeName ) || + rinput.test( this.type ) ); + }) + .map(function( i, elem ){ + var val = jQuery( this ).val(); + + return val == null ? + null : + jQuery.isArray( val ) ? + jQuery.map( val, function( val, i ){ + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }) : + { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }).get(); + } +}); + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){ + jQuery.fn[ o ] = function( f ){ + return this.bind( o, f ); + }; +}); + +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + // shift arguments if data argument was omitted + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + return jQuery.ajax({ + type: method, + url: url, + data: data, + success: callback, + dataType: type + }); + }; +}); + +jQuery.extend({ + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function ( target, settings ) { + if ( !settings ) { + // Only one parameter, we extend ajaxSettings + settings = target; + target = jQuery.extend( true, jQuery.ajaxSettings, settings ); + } else { + // target was provided, we extend into it + jQuery.extend( true, target, jQuery.ajaxSettings, settings ); + } + // Flatten fields we don't want deep extended + for( var field in { context: 1, url: 1 } ) { + if ( field in settings ) { + target[ field ] = settings[ field ]; + } else if( field in jQuery.ajaxSettings ) { + target[ field ] = jQuery.ajaxSettings[ field ]; + } + } + return target; + }, + + ajaxSettings: { + url: ajaxLocation, + isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ), + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded", + processData: true, + async: true, + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + traditional: false, + headers: {}, + */ + + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + text: "text/plain", + json: "application/json, text/javascript", + "*": "*/*" + }, + + contents: { + xml: /xml/, + html: /html/, + json: /json/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText" + }, + + // List of data converters + // 1) key format is "source_type destination_type" (a single space in-between) + // 2) the catchall symbol "*" can be used for source_type + converters: { + + // Convert anything to text + "* text": window.String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": jQuery.parseJSON, + + // Parse text as xml + "text xml": jQuery.parseXML + } + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + // Callbacks context + callbackContext = s.context || s, + // Context for global events + // It's the callbackContext if one was provided in the options + // and if it's a DOM node or a jQuery collection + globalEventContext = callbackContext !== s && + ( callbackContext.nodeType || callbackContext instanceof jQuery ) ? + jQuery( callbackContext ) : jQuery.event, + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery._Deferred(), + // Status-dependent callbacks + statusCode = s.statusCode || {}, + // ifModified key + ifModifiedKey, + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + // Response headers + responseHeadersString, + responseHeaders, + // transport + transport, + // timeout handle + timeoutTimer, + // Cross-domain detection vars + parts, + // The jqXHR state + state = 0, + // To know if global events are to be dispatched + fireGlobals, + // Loop variable + i, + // Fake xhr + jqXHR = { + + readyState: 0, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( !state ) { + var lname = name.toLowerCase(); + name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Raw string + getAllResponseHeaders: function() { + return state === 2 ? responseHeadersString : null; + }, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( state === 2 ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[1].toLowerCase() ] = match[ 2 ]; + } + } + match = responseHeaders[ key.toLowerCase() ]; + } + return match === undefined ? null : match; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( !state ) { + s.mimeType = type; + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + statusText = statusText || "abort"; + if ( transport ) { + transport.abort( statusText ); + } + done( 0, statusText ); + return this; + } + }; + + // Callback for when everything is done + // It is defined here because jslint complains if it is declared + // at the end of the function (which would be more logical and readable) + function done( status, statusText, responses, headers ) { + + // Called once + if ( state === 2 ) { + return; + } + + // State is "done" now + state = 2; + + // Clear timeout if it exists + if ( timeoutTimer ) { + clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status ? 4 : 0; + + var isSuccess, + success, + error, + response = responses ? ajaxHandleResponses( s, jqXHR, responses ) : undefined, + lastModified, + etag; + + // If successful, handle type chaining + if ( status >= 200 && status < 300 || status === 304 ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + + if ( ( lastModified = jqXHR.getResponseHeader( "Last-Modified" ) ) ) { + jQuery.lastModified[ ifModifiedKey ] = lastModified; + } + if ( ( etag = jqXHR.getResponseHeader( "Etag" ) ) ) { + jQuery.etag[ ifModifiedKey ] = etag; + } + } + + // If not modified + if ( status === 304 ) { + + statusText = "notmodified"; + isSuccess = true; + + // If we have data + } else { + + try { + success = ajaxConvert( s, response ); + statusText = "success"; + isSuccess = true; + } catch(e) { + // We have a parsererror + statusText = "parsererror"; + error = e; + } + } + } else { + // We extract error from statusText + // then normalize statusText and status for non-aborts + error = statusText; + if( !statusText || status ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = statusText; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ), + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.resolveWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s] ); + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + // Attach deferreds + deferred.promise( jqXHR ); + jqXHR.success = jqXHR.done; + jqXHR.error = jqXHR.fail; + jqXHR.complete = completeDeferred.done; + + // Status-dependent callbacks + jqXHR.statusCode = function( map ) { + if ( map ) { + var tmp; + if ( state < 2 ) { + for( tmp in map ) { + statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ]; + } + } else { + tmp = map[ jqXHR.status ]; + jqXHR.then( tmp, tmp ); + } + } + return this; + }; + + // Remove hash character (#7531: and string promotion) + // Add protocol if not provided (#5866: IE7 issue with protocol-less urls) + // We also use the url parameter if available + s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" ); + + // Extract dataTypes list + s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( rspacesAjax ); + + // Determine if a cross-domain request is in order + if ( s.crossDomain == null ) { + parts = rurl.exec( s.url.toLowerCase() ); + s.crossDomain = !!( parts && + ( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] || + ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) != + ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) ) + ); + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefiler, stop there + if ( state === 2 ) { + return false; + } + + // We can fire global events as of now if asked to + fireGlobals = s.global; + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // If data is available, append data to url + if ( s.data ) { + s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data; + } + + // Get ifModifiedKey before adding the anti-cache parameter + ifModifiedKey = s.url; + + // Add anti-cache in url if needed + if ( s.cache === false ) { + + var ts = jQuery.now(), + // try replacing _= if it is there + ret = s.url.replace( rts, "$1_=" + ts ); + + // if nothing was replaced, add timestamp to the end + s.url = ret + ( (ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + ifModifiedKey = ifModifiedKey || s.url; + if ( jQuery.lastModified[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] ); + } + if ( jQuery.etag[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] ); + } + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ? + s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", */*; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) { + // Abort if not done already + jqXHR.abort(); + return false; + + } + + // Install callbacks on deferreds + for ( i in { success: 1, error: 1, complete: 1 } ) { + jqXHR[ i ]( s[ i ] ); + } + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = setTimeout( function(){ + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + state = 1; + transport.send( requestHeaders, done ); + } catch (e) { + // Propagate exception as error if not done + if ( status < 2 ) { + done( -1, e ); + // Simply rethrow otherwise + } else { + jQuery.error( e ); + } + } + } + + return jqXHR; + }, + + // Serialize an array of form elements or a set of + // key/values into a query string + param: function( a, traditional ) { + var s = [], + add = function( key, value ) { + // If value is a function, invoke it and return its value + value = jQuery.isFunction( value ) ? value() : value; + s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value ); + }; + + // Set traditional to true for jQuery <= 1.3.2 behavior. + if ( traditional === undefined ) { + traditional = jQuery.ajaxSettings.traditional; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + }); + + } else { + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( var prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ).replace( r20, "+" ); + } +}); + +function buildParams( prefix, obj, traditional, add ) { + if ( jQuery.isArray( obj ) ) { + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + // If array item is non-scalar (array or object), encode its + // numeric index to resolve deserialization ambiguity issues. + // Note that rack (as of 1.0.0) can't currently deserialize + // nested arrays properly, and attempting to do so may cause + // a server error. Possible fixes are to modify rack's + // deserialization algorithm or to provide an option or flag + // to force array serialization to be shallow. + buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add ); + } + }); + + } else if ( !traditional && obj != null && typeof obj === "object" ) { + // Serialize object item. + for ( var name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + // Serialize scalar item. + add( prefix, obj ); + } +} + +// This is still on the jQuery object... for now +// Want to move this to jQuery.ajax some day +jQuery.extend({ + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {} + +}); + +/* Handles responses to an ajax request: + * - sets all responseXXX fields accordingly + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var contents = s.contents, + dataTypes = s.dataTypes, + responseFields = s.responseFields, + ct, + type, + finalDataType, + firstDataType; + + // Fill responseXXX fields + for( type in responseFields ) { + if ( type in responses ) { + jqXHR[ responseFields[type] ] = responses[ type ]; + } + } + + // Remove auto dataType and get content-type in the process + while( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "content-type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +// Chain conversions given the request and the original response +function ajaxConvert( s, response ) { + + // Apply the dataFilter if provided + if ( s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + var dataTypes = s.dataTypes, + converters = {}, + i, + key, + length = dataTypes.length, + tmp, + // Current and previous dataTypes + current = dataTypes[ 0 ], + prev, + // Conversion expression + conversion, + // Conversion function + conv, + // Conversion functions (transitive conversion) + conv1, + conv2; + + // For each dataType in the chain + for( i = 1; i < length; i++ ) { + + // Create converters map + // with lowercased keys + if ( i === 1 ) { + for( key in s.converters ) { + if( typeof key === "string" ) { + converters[ key.toLowerCase() ] = s.converters[ key ]; + } + } + } + + // Get the dataTypes + prev = current; + current = dataTypes[ i ]; + + // If current is auto dataType, update it to prev + if( current === "*" ) { + current = prev; + // If no auto and dataTypes are actually different + } else if ( prev !== "*" && prev !== current ) { + + // Get the converter + conversion = prev + " " + current; + conv = converters[ conversion ] || converters[ "* " + current ]; + + // If there is no direct converter, search transitively + if ( !conv ) { + conv2 = undefined; + for( conv1 in converters ) { + tmp = conv1.split( " " ); + if ( tmp[ 0 ] === prev || tmp[ 0 ] === "*" ) { + conv2 = converters[ tmp[1] + " " + current ]; + if ( conv2 ) { + conv1 = converters[ conv1 ]; + if ( conv1 === true ) { + conv = conv2; + } else if ( conv2 === true ) { + conv = conv1; + } + break; + } + } + } + } + // If we found no converter, dispatch an error + if ( !( conv || conv2 ) ) { + jQuery.error( "No conversion from " + conversion.replace(" "," to ") ); + } + // If found converter is not an equivalence + if ( conv !== true ) { + // Convert with 1 or 2 converters accordingly + response = conv ? conv( response ) : conv2( conv1(response) ); + } + } + } + return response; +} + + + + +var jsc = jQuery.now(), + jsre = /(\=)\?(&|$)|\?\?/i; + +// Default jsonp settings +jQuery.ajaxSetup({ + jsonp: "callback", + jsonpCallback: function() { + return jQuery.expando + "_" + ( jsc++ ); + } +}); + +// Detect, normalize options and install callbacks for jsonp requests +jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { + + var inspectData = s.contentType === "application/x-www-form-urlencoded" && + ( typeof s.data === "string" ); + + if ( s.dataTypes[ 0 ] === "jsonp" || + s.jsonp !== false && ( jsre.test( s.url ) || + inspectData && jsre.test( s.data ) ) ) { + + var responseContainer, + jsonpCallback = s.jsonpCallback = + jQuery.isFunction( s.jsonpCallback ) ? s.jsonpCallback() : s.jsonpCallback, + previous = window[ jsonpCallback ], + url = s.url, + data = s.data, + replace = "$1" + jsonpCallback + "$2"; + + if ( s.jsonp !== false ) { + url = url.replace( jsre, replace ); + if ( s.url === url ) { + if ( inspectData ) { + data = data.replace( jsre, replace ); + } + if ( s.data === data ) { + // Add callback manually + url += (/\?/.test( url ) ? "&" : "?") + s.jsonp + "=" + jsonpCallback; + } + } + } + + s.url = url; + s.data = data; + + // Install callback + window[ jsonpCallback ] = function( response ) { + responseContainer = [ response ]; + }; + + // Clean-up function + jqXHR.always(function() { + // Set callback back to previous value + window[ jsonpCallback ] = previous; + // Call if it was a function and we have a response + if ( responseContainer && jQuery.isFunction( previous ) ) { + window[ jsonpCallback ]( responseContainer[ 0 ] ); + } + }); + + // Use data converter to retrieve json after script execution + s.converters["script json"] = function() { + if ( !responseContainer ) { + jQuery.error( jsonpCallback + " was not called" ); + } + return responseContainer[ 0 ]; + }; + + // force json dataType + s.dataTypes[ 0 ] = "json"; + + // Delegate to script + return "script"; + } +}); + + + + +// Install script dataType +jQuery.ajaxSetup({ + accepts: { + script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /javascript|ecmascript/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +}); + +// Handle cache's special case and global +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + s.global = false; + } +}); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function(s) { + + // This transport only deals with cross domain requests + if ( s.crossDomain ) { + + var script, + head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement; + + return { + + send: function( _, callback ) { + + script = document.createElement( "script" ); + + script.async = "async"; + + if ( s.scriptCharset ) { + script.charset = s.scriptCharset; + } + + script.src = s.url; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function( _, isAbort ) { + + if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) { + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + + // Remove the script + if ( head && script.parentNode ) { + head.removeChild( script ); + } + + // Dereference the script + script = undefined; + + // Callback if not abort + if ( !isAbort ) { + callback( 200, "success" ); + } + } + }; + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709 and #4378). + head.insertBefore( script, head.firstChild ); + }, + + abort: function() { + if ( script ) { + script.onload( 0, 1 ); + } + } + }; + } +}); + + + + +var // #5280: Internet Explorer will keep connections alive if we don't abort on unload + xhrOnUnloadAbort = window.ActiveXObject ? function() { + // Abort all pending requests + for ( var key in xhrCallbacks ) { + xhrCallbacks[ key ]( 0, 1 ); + } + } : false, + xhrId = 0, + xhrCallbacks; + +// Functions to create xhrs +function createStandardXHR() { + try { + return new window.XMLHttpRequest(); + } catch( e ) {} +} + +function createActiveXHR() { + try { + return new window.ActiveXObject( "Microsoft.XMLHTTP" ); + } catch( e ) {} +} + +// Create the request object +// (This is still attached to ajaxSettings for backward compatibility) +jQuery.ajaxSettings.xhr = window.ActiveXObject ? + /* Microsoft failed to properly + * implement the XMLHttpRequest in IE7 (can't request local files), + * so we use the ActiveXObject when it is available + * Additionally XMLHttpRequest can be disabled in IE7/IE8 so + * we need a fallback. + */ + function() { + return !this.isLocal && createStandardXHR() || createActiveXHR(); + } : + // For all other browsers, use the standard XMLHttpRequest object + createStandardXHR; + +// Determine support properties +(function( xhr ) { + jQuery.extend( jQuery.support, { + ajax: !!xhr, + cors: !!xhr && ( "withCredentials" in xhr ) + }); +})( jQuery.ajaxSettings.xhr() ); + +// Create transport if the browser can provide an xhr +if ( jQuery.support.ajax ) { + + jQuery.ajaxTransport(function( s ) { + // Cross domain only allowed if supported through XMLHttpRequest + if ( !s.crossDomain || jQuery.support.cors ) { + + var callback; + + return { + send: function( headers, complete ) { + + // Get a new xhr + var xhr = s.xhr(), + handle, + i; + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if ( s.username ) { + xhr.open( s.type, s.url, s.async, s.username, s.password ); + } else { + xhr.open( s.type, s.url, s.async ); + } + + // Apply custom fields if provided + if ( s.xhrFields ) { + for ( i in s.xhrFields ) { + xhr[ i ] = s.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( s.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( s.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !s.crossDomain && !headers["X-Requested-With"] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + } catch( _ ) {} + + // Do send the request + // This may raise an exception which is actually + // handled in jQuery.ajax (so no try/catch here) + xhr.send( ( s.hasContent && s.data ) || null ); + + // Listener + callback = function( _, isAbort ) { + + var status, + statusText, + responseHeaders, + responses, + xml; + + // Firefox throws exceptions when accessing properties + // of an xhr when a network error occured + // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE) + try { + + // Was never called and is aborted or complete + if ( callback && ( isAbort || xhr.readyState === 4 ) ) { + + // Only called once + callback = undefined; + + // Do not keep as active anymore + if ( handle ) { + xhr.onreadystatechange = jQuery.noop; + if ( xhrOnUnloadAbort ) { + delete xhrCallbacks[ handle ]; + } + } + + // If it's an abort + if ( isAbort ) { + // Abort it manually if needed + if ( xhr.readyState !== 4 ) { + xhr.abort(); + } + } else { + status = xhr.status; + responseHeaders = xhr.getAllResponseHeaders(); + responses = {}; + xml = xhr.responseXML; + + // Construct response list + if ( xml && xml.documentElement /* #4958 */ ) { + responses.xml = xml; + } + responses.text = xhr.responseText; + + // Firefox throws an exception when accessing + // statusText for faulty cross-domain requests + try { + statusText = xhr.statusText; + } catch( e ) { + // We normalize with Webkit giving an empty statusText + statusText = ""; + } + + // Filter status for non standard behaviors + + // If the request is local and we have data: assume a success + // (success with no data won't get notified, that's the best we + // can do given current implementations) + if ( !status && s.isLocal && !s.crossDomain ) { + status = responses.text ? 200 : 404; + // IE - #1450: sometimes returns 1223 when it should be 204 + } else if ( status === 1223 ) { + status = 204; + } + } + } + } catch( firefoxAccessException ) { + if ( !isAbort ) { + complete( -1, firefoxAccessException ); + } + } + + // Call complete if needed + if ( responses ) { + complete( status, statusText, responses, responseHeaders ); + } + }; + + // if we're in sync mode or it's in cache + // and has been retrieved directly (IE6 & IE7) + // we need to manually fire the callback + if ( !s.async || xhr.readyState === 4 ) { + callback(); + } else { + handle = ++xhrId; + if ( xhrOnUnloadAbort ) { + // Create the active xhrs callbacks list if needed + // and attach the unload handler + if ( !xhrCallbacks ) { + xhrCallbacks = {}; + jQuery( window ).unload( xhrOnUnloadAbort ); + } + // Add to list of active xhrs callbacks + xhrCallbacks[ handle ] = callback; + } + xhr.onreadystatechange = callback; + } + }, + + abort: function() { + if ( callback ) { + callback(0,1); + } + } + }; + } + }); +} + + + + +var elemdisplay = {}, + iframe, iframeDoc, + rfxtypes = /^(?:toggle|show|hide)$/, + rfxnum = /^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i, + timerId, + fxAttrs = [ + // height animations + [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ], + // width animations + [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ], + // opacity animations + [ "opacity" ] + ], + fxNow, + requestAnimationFrame = window.webkitRequestAnimationFrame || + window.mozRequestAnimationFrame || + window.oRequestAnimationFrame; + +jQuery.fn.extend({ + show: function( speed, easing, callback ) { + var elem, display; + + if ( speed || speed === 0 ) { + return this.animate( genFx("show", 3), speed, easing, callback); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + elem = this[i]; + + if ( elem.style ) { + display = elem.style.display; + + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !jQuery._data(elem, "olddisplay") && display === "none" ) { + display = elem.style.display = ""; + } + + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( display === "" && jQuery.css( elem, "display" ) === "none" ) { + jQuery._data(elem, "olddisplay", defaultDisplay(elem.nodeName)); + } + } + } + + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + elem = this[i]; + + if ( elem.style ) { + display = elem.style.display; + + if ( display === "" || display === "none" ) { + elem.style.display = jQuery._data(elem, "olddisplay") || ""; + } + } + } + + return this; + } + }, + + hide: function( speed, easing, callback ) { + if ( speed || speed === 0 ) { + return this.animate( genFx("hide", 3), speed, easing, callback); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + if ( this[i].style ) { + var display = jQuery.css( this[i], "display" ); + + if ( display !== "none" && !jQuery._data( this[i], "olddisplay" ) ) { + jQuery._data( this[i], "olddisplay", display ); + } + } + } + + // Set the display of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + if ( this[i].style ) { + this[i].style.display = "none"; + } + } + + return this; + } + }, + + // Save the old toggle function + _toggle: jQuery.fn.toggle, + + toggle: function( fn, fn2, callback ) { + var bool = typeof fn === "boolean"; + + if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) { + this._toggle.apply( this, arguments ); + + } else if ( fn == null || bool ) { + this.each(function() { + var state = bool ? fn : jQuery(this).is(":hidden"); + jQuery(this)[ state ? "show" : "hide" ](); + }); + + } else { + this.animate(genFx("toggle", 3), fn, fn2, callback); + } + + return this; + }, + + fadeTo: function( speed, to, easing, callback ) { + return this.filter(":hidden").css("opacity", 0).show().end() + .animate({opacity: to}, speed, easing, callback); + }, + + animate: function( prop, speed, easing, callback ) { + var optall = jQuery.speed(speed, easing, callback); + + if ( jQuery.isEmptyObject( prop ) ) { + return this.each( optall.complete, [ false ] ); + } + + // Do not change referenced properties as per-property easing will be lost + prop = jQuery.extend( {}, prop ); + + return this[ optall.queue === false ? "each" : "queue" ](function() { + // XXX 'this' does not always have a nodeName when running the + // test suite + + if ( optall.queue === false ) { + jQuery._mark( this ); + } + + var opt = jQuery.extend( {}, optall ), + isElement = this.nodeType === 1, + hidden = isElement && jQuery(this).is(":hidden"), + name, val, p, + display, e, + parts, start, end, unit; + + // will store per property easing and be used to determine when an animation is complete + opt.animatedProperties = {}; + + for ( p in prop ) { + + // property name normalization + name = jQuery.camelCase( p ); + if ( p !== name ) { + prop[ name ] = prop[ p ]; + delete prop[ p ]; + } + + val = prop[ name ]; + + // easing resolution: per property > opt.specialEasing > opt.easing > 'swing' (default) + if ( jQuery.isArray( val ) ) { + opt.animatedProperties[ name ] = val[ 1 ]; + val = prop[ name ] = val[ 0 ]; + } else { + opt.animatedProperties[ name ] = opt.specialEasing && opt.specialEasing[ name ] || opt.easing || 'swing'; + } + + if ( val === "hide" && hidden || val === "show" && !hidden ) { + return opt.complete.call( this ); + } + + if ( isElement && ( name === "height" || name === "width" ) ) { + // Make sure that nothing sneaks out + // Record all 3 overflow attributes because IE does not + // change the overflow attribute when overflowX and + // overflowY are set to the same value + opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ]; + + // Set display property to inline-block for height/width + // animations on inline elements that are having width/height + // animated + if ( jQuery.css( this, "display" ) === "inline" && + jQuery.css( this, "float" ) === "none" ) { + if ( !jQuery.support.inlineBlockNeedsLayout ) { + this.style.display = "inline-block"; + + } else { + display = defaultDisplay( this.nodeName ); + + // inline-level elements accept inline-block; + // block-level elements need to be inline with layout + if ( display === "inline" ) { + this.style.display = "inline-block"; + + } else { + this.style.display = "inline"; + this.style.zoom = 1; + } + } + } + } + } + + if ( opt.overflow != null ) { + this.style.overflow = "hidden"; + } + + for ( p in prop ) { + e = new jQuery.fx( this, opt, p ); + val = prop[ p ]; + + if ( rfxtypes.test(val) ) { + e[ val === "toggle" ? hidden ? "show" : "hide" : val ](); + + } else { + parts = rfxnum.exec( val ); + start = e.cur(); + + if ( parts ) { + end = parseFloat( parts[2] ); + unit = parts[3] || ( jQuery.cssNumber[ p ] ? "" : "px" ); + + // We need to compute starting value + if ( unit !== "px" ) { + jQuery.style( this, p, (end || 1) + unit); + start = ((end || 1) / e.cur()) * start; + jQuery.style( this, p, start + unit); + } + + // If a +=/-= token was provided, we're doing a relative animation + if ( parts[1] ) { + end = ( (parts[ 1 ] === "-=" ? -1 : 1) * end ) + start; + } + + e.custom( start, end, unit ); + + } else { + e.custom( start, val, "" ); + } + } + } + + // For JS strict compliance + return true; + }); + }, + + stop: function( clearQueue, gotoEnd ) { + if ( clearQueue ) { + this.queue([]); + } + + this.each(function() { + var timers = jQuery.timers, + i = timers.length; + // clear marker counters if we know they won't be + if ( !gotoEnd ) { + jQuery._unmark( true, this ); + } + while ( i-- ) { + if ( timers[i].elem === this ) { + if (gotoEnd) { + // force the next step to be the last + timers[i](true); + } + + timers.splice(i, 1); + } + } + }); + + // start the next in the queue if the last step wasn't forced + if ( !gotoEnd ) { + this.dequeue(); + } + + return this; + } + +}); + +// Animations created synchronously will run synchronously +function createFxNow() { + setTimeout( clearFxNow, 0 ); + return ( fxNow = jQuery.now() ); +} + +function clearFxNow() { + fxNow = undefined; +} + +// Generate parameters to create a standard animation +function genFx( type, num ) { + var obj = {}; + + jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function() { + obj[ this ] = type; + }); + + return obj; +} + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx("show", 1), + slideUp: genFx("hide", 1), + slideToggle: genFx("toggle", 1), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +}); + +jQuery.extend({ + speed: function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction(easing) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[opt.duration] : jQuery.fx.speeds._default; + + // Queueing + opt.old = opt.complete; + opt.complete = function( noUnmark ) { + if ( jQuery.isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue !== false ) { + jQuery.dequeue( this ); + } else if ( noUnmark !== false ) { + jQuery._unmark( this ); + } + }; + + return opt; + }, + + easing: { + linear: function( p, n, firstNum, diff ) { + return firstNum + diff * p; + }, + swing: function( p, n, firstNum, diff ) { + return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum; + } + }, + + timers: [], + + fx: function( elem, options, prop ) { + this.options = options; + this.elem = elem; + this.prop = prop; + + options.orig = options.orig || {}; + } + +}); + +jQuery.fx.prototype = { + // Simple function for setting a style value + update: function() { + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + (jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this ); + }, + + // Get the current size + cur: function() { + if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) { + return this.elem[ this.prop ]; + } + + var parsed, + r = jQuery.css( this.elem, this.prop ); + // Empty strings, null, undefined and "auto" are converted to 0, + // complex values such as "rotate(1rad)" are returned as is, + // simple values such as "10px" are parsed to Float. + return isNaN( parsed = parseFloat( r ) ) ? !r || r === "auto" ? 0 : r : parsed; + }, + + // Start an animation from one number to another + custom: function( from, to, unit ) { + var self = this, + fx = jQuery.fx, + raf; + + this.startTime = fxNow || createFxNow(); + this.start = from; + this.end = to; + this.unit = unit || this.unit || ( jQuery.cssNumber[ this.prop ] ? "" : "px" ); + this.now = this.start; + this.pos = this.state = 0; + + function t( gotoEnd ) { + return self.step(gotoEnd); + } + + t.elem = this.elem; + + if ( t() && jQuery.timers.push(t) && !timerId ) { + // Use requestAnimationFrame instead of setInterval if available + if ( requestAnimationFrame ) { + timerId = true; + raf = function() { + // When timerId gets set to null at any point, this stops + if ( timerId ) { + requestAnimationFrame( raf ); + fx.tick(); + } + }; + requestAnimationFrame( raf ); + } else { + timerId = setInterval( fx.tick, fx.interval ); + } + } + }, + + // Simple 'show' function + show: function() { + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.style( this.elem, this.prop ); + this.options.show = true; + + // Begin the animation + // Make sure that we start at a small width/height to avoid any + // flash of content + this.custom(this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur()); + + // Start by showing the element + jQuery( this.elem ).show(); + }, + + // Simple 'hide' function + hide: function() { + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.style( this.elem, this.prop ); + this.options.hide = true; + + // Begin the animation + this.custom(this.cur(), 0); + }, + + // Each step of an animation + step: function( gotoEnd ) { + var t = fxNow || createFxNow(), + done = true, + elem = this.elem, + options = this.options, + i, n; + + if ( gotoEnd || t >= options.duration + this.startTime ) { + this.now = this.end; + this.pos = this.state = 1; + this.update(); + + options.animatedProperties[ this.prop ] = true; + + for ( i in options.animatedProperties ) { + if ( options.animatedProperties[i] !== true ) { + done = false; + } + } + + if ( done ) { + // Reset the overflow + if ( options.overflow != null && !jQuery.support.shrinkWrapBlocks ) { + + jQuery.each( [ "", "X", "Y" ], function (index, value) { + elem.style[ "overflow" + value ] = options.overflow[index]; + }); + } + + // Hide the element if the "hide" operation was done + if ( options.hide ) { + jQuery(elem).hide(); + } + + // Reset the properties, if the item has been hidden or shown + if ( options.hide || options.show ) { + for ( var p in options.animatedProperties ) { + jQuery.style( elem, p, options.orig[p] ); + } + } + + // Execute the complete function + options.complete.call( elem ); + } + + return false; + + } else { + // classical easing cannot be used with an Infinity duration + if ( options.duration == Infinity ) { + this.now = t; + } else { + n = t - this.startTime; + this.state = n / options.duration; + + // Perform the easing function, defaults to swing + this.pos = jQuery.easing[ options.animatedProperties[ this.prop ] ]( this.state, n, 0, 1, options.duration ); + this.now = this.start + ((this.end - this.start) * this.pos); + } + // Perform the next step of the animation + this.update(); + } + + return true; + } +}; + +jQuery.extend( jQuery.fx, { + tick: function() { + for ( var timers = jQuery.timers, i = 0 ; i < timers.length ; ++i ) { + if ( !timers[i]() ) { + timers.splice(i--, 1); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + }, + + interval: 13, + + stop: function() { + clearInterval( timerId ); + timerId = null; + }, + + speeds: { + slow: 600, + fast: 200, + // Default speed + _default: 400 + }, + + step: { + opacity: function( fx ) { + jQuery.style( fx.elem, "opacity", fx.now ); + }, + + _default: function( fx ) { + if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) { + fx.elem.style[ fx.prop ] = (fx.prop === "width" || fx.prop === "height" ? Math.max(0, fx.now) : fx.now) + fx.unit; + } else { + fx.elem[ fx.prop ] = fx.now; + } + } + } +}); + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.animated = function( elem ) { + return jQuery.grep(jQuery.timers, function( fn ) { + return elem === fn.elem; + }).length; + }; +} + +// Try to restore the default display value of an element +function defaultDisplay( nodeName ) { + + if ( !elemdisplay[ nodeName ] ) { + + var body = document.body, + elem = jQuery( "<" + nodeName + ">" ).appendTo( body ), + display = elem.css( "display" ); + + elem.remove(); + + // If the simple way fails, + // get element's real default display by attaching it to a temp iframe + if ( display === "none" || display === "" ) { + // No iframe to use yet, so create it + if ( !iframe ) { + iframe = document.createElement( "iframe" ); + iframe.frameBorder = iframe.width = iframe.height = 0; + } + + body.appendChild( iframe ); + + // Create a cacheable copy of the iframe document on first call. + // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML + // document to it; WebKit & Firefox won't allow reusing the iframe document. + if ( !iframeDoc || !iframe.createElement ) { + iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document; + iframeDoc.write( ( document.compatMode === "CSS1Compat" ? "<!doctype html>" : "" ) + "<html><body>" ); + iframeDoc.close(); + } + + elem = iframeDoc.createElement( nodeName ); + + iframeDoc.body.appendChild( elem ); + + display = jQuery.css( elem, "display" ); + + body.removeChild( iframe ); + } + + // Store the correct default display + elemdisplay[ nodeName ] = display; + } + + return elemdisplay[ nodeName ]; +} + + + + +var rtable = /^t(?:able|d|h)$/i, + rroot = /^(?:body|html)$/i; + +if ( "getBoundingClientRect" in document.documentElement ) { + jQuery.fn.offset = function( options ) { + var elem = this[0], box; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + try { + box = elem.getBoundingClientRect(); + } catch(e) {} + + var doc = elem.ownerDocument, + docElem = doc.documentElement; + + // Make sure we're not dealing with a disconnected DOM node + if ( !box || !jQuery.contains( docElem, elem ) ) { + return box ? { top: box.top, left: box.left } : { top: 0, left: 0 }; + } + + var body = doc.body, + win = getWindow(doc), + clientTop = docElem.clientTop || body.clientTop || 0, + clientLeft = docElem.clientLeft || body.clientLeft || 0, + scrollTop = win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop, + scrollLeft = win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft, + top = box.top + scrollTop - clientTop, + left = box.left + scrollLeft - clientLeft; + + return { top: top, left: left }; + }; + +} else { + jQuery.fn.offset = function( options ) { + var elem = this[0]; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + jQuery.offset.initialize(); + + var computedStyle, + offsetParent = elem.offsetParent, + prevOffsetParent = elem, + doc = elem.ownerDocument, + docElem = doc.documentElement, + body = doc.body, + defaultView = doc.defaultView, + prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle, + top = elem.offsetTop, + left = elem.offsetLeft; + + while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) { + if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) { + break; + } + + computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle; + top -= elem.scrollTop; + left -= elem.scrollLeft; + + if ( elem === offsetParent ) { + top += elem.offsetTop; + left += elem.offsetLeft; + + if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevOffsetParent = offsetParent; + offsetParent = elem.offsetParent; + } + + if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevComputedStyle = computedStyle; + } + + if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) { + top += body.offsetTop; + left += body.offsetLeft; + } + + if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) { + top += Math.max( docElem.scrollTop, body.scrollTop ); + left += Math.max( docElem.scrollLeft, body.scrollLeft ); + } + + return { top: top, left: left }; + }; +} + +jQuery.offset = { + initialize: function() { + var body = document.body, container = document.createElement("div"), innerDiv, checkDiv, table, td, bodyMarginTop = parseFloat( jQuery.css(body, "marginTop") ) || 0, + html = "<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>"; + + jQuery.extend( container.style, { position: "absolute", top: 0, left: 0, margin: 0, border: 0, width: "1px", height: "1px", visibility: "hidden" } ); + + container.innerHTML = html; + body.insertBefore( container, body.firstChild ); + innerDiv = container.firstChild; + checkDiv = innerDiv.firstChild; + td = innerDiv.nextSibling.firstChild.firstChild; + + this.doesNotAddBorder = (checkDiv.offsetTop !== 5); + this.doesAddBorderForTableAndCells = (td.offsetTop === 5); + + checkDiv.style.position = "fixed"; + checkDiv.style.top = "20px"; + + // safari subtracts parent border width here which is 5px + this.supportsFixedPosition = (checkDiv.offsetTop === 20 || checkDiv.offsetTop === 15); + checkDiv.style.position = checkDiv.style.top = ""; + + innerDiv.style.overflow = "hidden"; + innerDiv.style.position = "relative"; + + this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5); + + this.doesNotIncludeMarginInBodyOffset = (body.offsetTop !== bodyMarginTop); + + body.removeChild( container ); + jQuery.offset.initialize = jQuery.noop; + }, + + bodyOffset: function( body ) { + var top = body.offsetTop, + left = body.offsetLeft; + + jQuery.offset.initialize(); + + if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) { + top += parseFloat( jQuery.css(body, "marginTop") ) || 0; + left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; + } + + return { top: top, left: left }; + }, + + setOffset: function( elem, options, i ) { + var position = jQuery.css( elem, "position" ); + + // set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + var curElem = jQuery( elem ), + curOffset = curElem.offset(), + curCSSTop = jQuery.css( elem, "top" ), + curCSSLeft = jQuery.css( elem, "left" ), + calculatePosition = (position === "absolute" || position === "fixed") && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1, + props = {}, curPosition = {}, curTop, curLeft; + + // need to be able to calculate position if either top or left is auto and position is either absolute or fixed + if ( calculatePosition ) { + curPosition = curElem.position(); + curTop = curPosition.top; + curLeft = curPosition.left; + } else { + curTop = parseFloat( curCSSTop ) || 0; + curLeft = parseFloat( curCSSLeft ) || 0; + } + + if ( jQuery.isFunction( options ) ) { + options = options.call( elem, i, curOffset ); + } + + if (options.top != null) { + props.top = (options.top - curOffset.top) + curTop; + } + if (options.left != null) { + props.left = (options.left - curOffset.left) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + } +}; + + +jQuery.fn.extend({ + position: function() { + if ( !this[0] ) { + return null; + } + + var elem = this[0], + + // Get *real* offsetParent + offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; + offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; + + // Add offsetParent borders + parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; + parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; + + // Subtract the two offsets + return { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + }, + + offsetParent: function() { + return this.map(function() { + var offsetParent = this.offsetParent || document.body; + while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { + offsetParent = offsetParent.offsetParent; + } + return offsetParent; + }); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( ["Left", "Top"], function( i, name ) { + var method = "scroll" + name; + + jQuery.fn[ method ] = function( val ) { + var elem, win; + + if ( val === undefined ) { + elem = this[ 0 ]; + + if ( !elem ) { + return null; + } + + win = getWindow( elem ); + + // Return the scroll offset + return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] : + jQuery.support.boxModel && win.document.documentElement[ method ] || + win.document.body[ method ] : + elem[ method ]; + } + + // Set the scroll offset + return this.each(function() { + win = getWindow( this ); + + if ( win ) { + win.scrollTo( + !i ? val : jQuery( win ).scrollLeft(), + i ? val : jQuery( win ).scrollTop() + ); + + } else { + this[ method ] = val; + } + }); + }; +}); + +function getWindow( elem ) { + return jQuery.isWindow( elem ) ? + elem : + elem.nodeType === 9 ? + elem.defaultView || elem.parentWindow : + false; +} + + + + +// Create width, height, innerHeight, innerWidth, outerHeight and outerWidth methods +jQuery.each([ "Height", "Width" ], function( i, name ) { + + var type = name.toLowerCase(); + + // innerHeight and innerWidth + jQuery.fn[ "inner" + name ] = function() { + var elem = this[0]; + return elem && elem.style ? + parseFloat( jQuery.css( elem, type, "padding" ) ) : + null; + }; + + // outerHeight and outerWidth + jQuery.fn[ "outer" + name ] = function( margin ) { + var elem = this[0]; + return elem && elem.style ? + parseFloat( jQuery.css( elem, type, margin ? "margin" : "border" ) ) : + null; + }; + + jQuery.fn[ type ] = function( size ) { + // Get window width or height + var elem = this[0]; + if ( !elem ) { + return size == null ? null : this; + } + + if ( jQuery.isFunction( size ) ) { + return this.each(function( i ) { + var self = jQuery( this ); + self[ type ]( size.call( this, i, self[ type ]() ) ); + }); + } + + if ( jQuery.isWindow( elem ) ) { + // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode + // 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat + var docElemProp = elem.document.documentElement[ "client" + name ]; + return elem.document.compatMode === "CSS1Compat" && docElemProp || + elem.document.body[ "client" + name ] || docElemProp; + + // Get document width or height + } else if ( elem.nodeType === 9 ) { + // Either scroll[Width/Height] or offset[Width/Height], whichever is greater + return Math.max( + elem.documentElement["client" + name], + elem.body["scroll" + name], elem.documentElement["scroll" + name], + elem.body["offset" + name], elem.documentElement["offset" + name] + ); + + // Get or set width or height on the element + } else if ( size === undefined ) { + var orig = jQuery.css( elem, type ), + ret = parseFloat( orig ); + + return jQuery.isNaN( ret ) ? orig : ret; + + // Set the width or height on the element (default to pixels if value is unitless) + } else { + return this.css( type, typeof size === "string" ? size : size + "px" ); + } + }; + +}); + + +// Expose jQuery to the global object +window.jQuery = window.$ = jQuery; +})(window); diff --git a/ebus-datastore/ebus/web_static/lib/jquery-1.6.2/jquery-1.6.2.min.js b/ebus-datastore/ebus/web_static/lib/jquery-1.6.2/jquery-1.6.2.min.js new file mode 100644 index 0000000..48590ec --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-1.6.2/jquery-1.6.2.min.js @@ -0,0 +1,18 @@ +/*! + * jQuery JavaScript Library v1.6.2 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Thu Jun 30 14:16:56 2011 -0400 + */ +(function(a,b){function cv(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cs(a){if(!cg[a]){var b=c.body,d=f("<"+a+">").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){ch||(ch=c.createElement("iframe"),ch.frameBorder=ch.width=ch.height=0),b.appendChild(ch);if(!ci||!ch.createElement)ci=(ch.contentWindow||ch.contentDocument).document,ci.write((c.compatMode==="CSS1Compat"?"<!doctype html>":"")+"<html><body>"),ci.close();d=ci.createElement(a),ci.body.appendChild(d),e=f.css(d,"display"),b.removeChild(ch)}cg[a]=e}return cg[a]}function cr(a,b){var c={};f.each(cm.concat.apply([],cm.slice(0,b)),function(){c[this]=a});return c}function cq(){cn=b}function cp(){setTimeout(cq,0);return cn=f.now()}function cf(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ce(){try{return new a.XMLHttpRequest}catch(b){}}function b$(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function bZ(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function bY(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bC.test(a)?d(a,e):bY(a+"["+(typeof e=="object"||f.isArray(e)?b:"")+"]",e,c,d)});else if(!c&&b!=null&&typeof b=="object")for(var e in b)bY(a+"["+e+"]",b[e],c,d);else d(a,b)}function bX(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bR,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=bX(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=bX(a,c,d,e,"*",g));return l}function bW(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bN),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bA(a,b,c){var d=b==="width"?a.offsetWidth:a.offsetHeight,e=b==="width"?bv:bw;if(d>0){c!=="border"&&f.each(e,function(){c||(d-=parseFloat(f.css(a,"padding"+this))||0),c==="margin"?d+=parseFloat(f.css(a,c+this))||0:d-=parseFloat(f.css(a,"border"+this+"Width"))||0});return d+"px"}d=bx(a,b,b);if(d<0||d==null)d=a.style[b]||0;d=parseFloat(d)||0,c&&f.each(e,function(){d+=parseFloat(f.css(a,"padding"+this))||0,c!=="padding"&&(d+=parseFloat(f.css(a,"border"+this+"Width"))||0),c==="margin"&&(d+=parseFloat(f.css(a,c+this))||0)});return d+"px"}function bm(a,b){b.src?f.ajax({url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(be,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)}function bl(a){f.nodeName(a,"input")?bk(a):"getElementsByTagName"in a&&f.grep(a.getElementsByTagName("input"),bk)}function bk(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bj(a){return"getElementsByTagName"in a?a.getElementsByTagName("*"):"querySelectorAll"in a?a.querySelectorAll("*"):[]}function bi(a,b){var c;if(b.nodeType===1){b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase();if(c==="object")b.outerHTML=a.outerHTML;else if(c!=="input"||a.type!=="checkbox"&&a.type!=="radio"){if(c==="option")b.selected=a.defaultSelected;else if(c==="input"||c==="textarea")b.defaultValue=a.defaultValue}else a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value);b.removeAttribute(f.expando)}}function bh(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c=f.expando,d=f.data(a),e=f.data(b,d);if(d=d[c]){var g=d.events;e=e[c]=f.extend({},d);if(g){delete e.handle,e.events={};for(var h in g)for(var i=0,j=g[h].length;i<j;i++)f.event.add(b,h+(g[h][i].namespace?".":"")+g[h][i].namespace,g[h][i],g[h][i].data)}}}}function bg(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function W(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(R.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function V(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function N(a,b){return(a&&a!=="*"?a+".":"")+b.replace(z,"`").replace(A,"&")}function M(a){var b,c,d,e,g,h,i,j,k,l,m,n,o,p=[],q=[],r=f._data(this,"events");if(!(a.liveFired===this||!r||!r.live||a.target.disabled||a.button&&a.type==="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var s=r.live.slice(0);for(i=0;i<s.length;i++)g=s[i],g.origType.replace(x,"")===a.type?q.push(g.selector):s.splice(i--,1);e=f(a.target).closest(q,a.currentTarget);for(j=0,k=e.length;j<k;j++){m=e[j];for(i=0;i<s.length;i++){g=s[i];if(m.selector===g.selector&&(!n||n.test(g.namespace))&&!m.elem.disabled){h=m.elem,d=null;if(g.preType==="mouseenter"||g.preType==="mouseleave")a.type=g.preType,d=f(a.relatedTarget).closest(g.selector)[0],d&&f.contains(h,d)&&(d=h);(!d||d!==h)&&p.push({elem:h,handleObj:g,level:m.level})}}}for(j=0,k=p.length;j<k;j++){e=p[j];if(c&&e.level>c)break;a.currentTarget=e.elem,a.data=e.handleObj.data,a.handleObj=e.handleObj,o=e.handleObj.origHandler.apply(e.elem,arguments);if(o===!1||a.isPropagationStopped()){c=e.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function K(a,c,d){var e=f.extend({},d[0]);e.type=a,e.originalEvent={},e.liveFired=b,f.event.handle.call(c,e),e.isDefaultPrevented()&&d[0].preventDefault()}function E(){return!0}function D(){return!1}function m(a,c,d){var e=c+"defer",g=c+"queue",h=c+"mark",i=f.data(a,e,b,!0);i&&(d==="queue"||!f.data(a,g,b,!0))&&(d==="mark"||!f.data(a,h,b,!0))&&setTimeout(function(){!f.data(a,g,b,!0)&&!f.data(a,h,b,!0)&&(f.removeData(a,e,!0),i.resolve())},0)}function l(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function k(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(j,"$1-$2").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNaN(d)?i.test(d)?f.parseJSON(d):d:parseFloat(d)}catch(g){}f.data(a,c,d)}else d=b}return d}var c=a.document,d=a.navigator,e=a.location,f=function(){function J(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(J,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/\d/,n=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,o=/^[\],:{}\s]*$/,p=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,q=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,r=/(?:^|:|,)(?:\s*\[)+/g,s=/(webkit)[ \/]([\w.]+)/,t=/(opera)(?:.*version)?[ \/]([\w.]+)/,u=/(msie) ([\w.]+)/,v=/(mozilla)(?:.*? rv:([\w.]+))?/,w=/-([a-z])/ig,x=function(a,b){return b.toUpperCase()},y=d.userAgent,z,A,B,C=Object.prototype.toString,D=Object.prototype.hasOwnProperty,E=Array.prototype.push,F=Array.prototype.slice,G=String.prototype.trim,H=Array.prototype.indexOf,I={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=n.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.6.2",length:0,size:function(){return this.length},toArray:function(){return F.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?E.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),A.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(F.apply(this,arguments),"slice",F.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:E,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;A.resolveWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!A){A=e._Deferred();if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",B,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",B),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&J()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNaN:function(a){return a==null||!m.test(a)||isNaN(a)},type:function(a){return a==null?String(a):I[C.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;if(a.constructor&&!D.call(a,"constructor")&&!D.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a);return c===b||D.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(o.test(b.replace(p,"@").replace(q,"]").replace(r,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(b,c,d){a.DOMParser?(d=new DOMParser,c=d.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),d=c.documentElement,(!d||!d.nodeName||d.nodeName==="parsererror")&&e.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(w,x)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:G?function(a){return a==null?"":G.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?E.call(c,a):e.merge(c,a)}return c},inArray:function(a,b){if(H)return H.call(b,a);for(var c=0,d=b.length;c<d;c++)if(b[c]===a)return c;return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=F.call(arguments,2),g=function(){return a.apply(c,f.concat(F.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h){var i=a.length;if(typeof c=="object"){for(var j in c)e.access(a,j,c[j],f,g,d);return a}if(d!==b){f=!h&&f&&e.isFunction(d);for(var k=0;k<i;k++)g(a[k],c,f?d.call(a[k],k,g(a[k],c)):d,h);return a}return i?g(a[0],c):b},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=s.exec(a)||t.exec(a)||u.exec(a)||a.indexOf("compatible")<0&&v.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){I["[object "+b+"]"]=b.toLowerCase()}),z=e.uaMatch(y),z.browser&&(e.browser[z.browser]=!0,e.browser.version=z.version),e.browser.webkit&&(e.browser.safari=!0),j.test("Â ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?B=function(){c.removeEventListener("DOMContentLoaded",B,!1),e.ready()}:c.attachEvent&&(B=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",B),e.ready())});return e}(),g="done fail isResolved isRejected promise then always pipe".split(" "),h=[].slice;f.extend({_Deferred:function(){var a=[],b,c,d,e={done:function(){if(!d){var c=arguments,g,h,i,j,k;b&&(k=b,b=0);for(g=0,h=c.length;g<h;g++)i=c[g],j=f.type(i),j==="array"?e.done.apply(e,i):j==="function"&&a.push(i);k&&e.resolveWith(k[0],k[1])}return this},resolveWith:function(e,f){if(!d&&!b&&!c){f=f||[],c=1;try{while(a[0])a.shift().apply(e,f)}finally{b=[e,f],c=0}}return this},resolve:function(){e.resolveWith(this,arguments);return this},isResolved:function(){return!!c||!!b},cancel:function(){d=1,a=[];return this}};return e},Deferred:function(a){var b=f._Deferred(),c=f._Deferred(),d;f.extend(b,{then:function(a,c){b.done(a).fail(c);return this},always:function(){return b.done.apply(b,arguments).fail.apply(this,arguments)},fail:c.done,rejectWith:c.resolveWith,reject:c.resolve,isRejected:c.isResolved,pipe:function(a,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[c,"reject"]},function(a,c){var e=c[0],g=c[1],h;f.isFunction(e)?b[a](function(){h=e.apply(this,arguments),h&&f.isFunction(h.promise)?h.promise().then(d.resolve,d.reject):d[g](h)}):b[a](d[g])})}).promise()},promise:function(a){if(a==null){if(d)return d;d=a={}}var c=g.length;while(c--)a[g[c]]=b[g[c]];return a}}),b.done(c.cancel).fail(b.cancel),delete b.cancel,a&&a.call(b,b);return b},when:function(a){function i(a){return function(c){b[a]=arguments.length>1?h.call(arguments,0):c,--e||g.resolveWith(g,h.call(b,0))}}var b=arguments,c=0,d=b.length,e=d,g=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred();if(d>1){for(;c<d;c++)b[c]&&f.isFunction(b[c].promise)?b[c].promise().then(i(c),g.reject):--e;e||g.resolveWith(g,b)}else g!==a&&g.resolveWith(g,d?[a]:[]);return g.promise()}}),f.support=function(){var a=c.createElement("div"),b=c.documentElement,d,e,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u;a.setAttribute("className","t"),a.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=a.getElementsByTagName("*"),e=a.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=a.getElementsByTagName("input")[0],k={leadingWhitespace:a.firstChild.nodeType===3,tbody:!a.getElementsByTagName("tbody").length,htmlSerialize:!!a.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55$/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:a.className!=="t",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},i.checked=!0,k.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,k.optDisabled=!h.disabled;try{delete a.test}catch(v){k.deleteExpando=!1}!a.addEventListener&&a.attachEvent&&a.fireEvent&&(a.attachEvent("onclick",function(){k.noCloneEvent=!1}),a.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),k.radioValue=i.value==="t",i.setAttribute("checked","checked"),a.appendChild(i),l=c.createDocumentFragment(),l.appendChild(a.firstChild),k.checkClone=l.cloneNode(!0).cloneNode(!0).lastChild.checked,a.innerHTML="",a.style.width=a.style.paddingLeft="1px",m=c.getElementsByTagName("body")[0],o=c.createElement(m?"div":"body"),p={visibility:"hidden",width:0,height:0,border:0,margin:0},m&&f.extend(p,{position:"absolute",left:-1e3,top:-1e3});for(t in p)o.style[t]=p[t];o.appendChild(a),n=m||b,n.insertBefore(o,n.firstChild),k.appendChecked=i.checked,k.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,k.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="<div style='width:4px;'></div>",k.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>",q=a.getElementsByTagName("td"),u=q[0].offsetHeight===0,q[0].style.display="",q[1].style.display="none",k.reliableHiddenOffsets=u&&q[0].offsetHeight===0,a.innerHTML="",c.defaultView&&c.defaultView.getComputedStyle&&(j=c.createElement("div"),j.style.width="0",j.style.marginRight="0",a.appendChild(j),k.reliableMarginRight=(parseInt((c.defaultView.getComputedStyle(j,null)||{marginRight:0}).marginRight,10)||0)===0),o.innerHTML="",n.removeChild(o);if(a.attachEvent)for(t in{submit:1,change:1,focusin:1})s="on"+t,u=s in a,u||(a.setAttribute(s,"return;"),u=typeof a[s]=="function"),k[t+"Bubbles"]=u;o=l=g=h=m=j=a=i=null;return k}(),f.boxModel=f.support.boxModel;var i=/^(?:\{.*\}|\[.*\])$/,j=/([a-z])([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!l(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g=f.expando,h=typeof c=="string",i,j=a.nodeType,k=j?f.cache:a,l=j?a[f.expando]:a[f.expando]&&f.expando;if((!l||e&&l&&!k[l][g])&&h&&d===b)return;l||(j?a[f.expando]=l=++f.uuid:l=f.expando),k[l]||(k[l]={},j||(k[l].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?k[l][g]=f.extend(k[l][g],c):k[l]=f.extend(k[l],c);i=k[l],e&&(i[g]||(i[g]={}),i=i[g]),d!==b&&(i[f.camelCase(c)]=d);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[f.camelCase(c)]||i[c]:i}},removeData:function(b,c,d){if(!!f.acceptData(b)){var e=f.expando,g=b.nodeType,h=g?f.cache:b,i=g?b[f.expando]:f.expando;if(!h[i])return;if(c){var j=d?h[i][e]:h[i];if(j){delete j[c];if(!l(j))return}}if(d){delete h[i][e];if(!l(h[i]))return}var k=h[i][e];f.support.deleteExpando||h!=a?delete h[i]:h[i]=null,k?(h[i]={},g||(h[i].toJSON=f.noop),h[i][e]=k):g&&(f.support.deleteExpando?delete b[f.expando]:b.removeAttribute?b.removeAttribute(f.expando):b[f.expando]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d=null;if(typeof a=="undefined"){if(this.length){d=f.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,g;for(var h=0,i=e.length;h<i;h++)g=e[h].name,g.indexOf("data-")===0&&(g=f.camelCase(g.substring(5)),k(this[0],g,d[g]))}}return d}if(typeof a=="object")return this.each(function(){f.data(this,a)});var j=a.split(".");j[1]=j[1]?"."+j[1]:"";if(c===b){d=this.triggerHandler("getData"+j[1]+"!",[j[0]]),d===b&&this.length&&(d=f.data(this[0],a),d=k(this[0],a,d));return d===b&&j[1]?this.data(j[0]):d}return this.each(function(){var b=f(this),d=[j[0],c];b.triggerHandler("setData"+j[1]+"!",d),f.data(this,a,c),b.triggerHandler("changeData"+j[1]+"!",d)})},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,c){a&&(c=(c||"fx")+"mark",f.data(a,c,(f.data(a,c,b,!0)||0)+1,!0))},_unmark:function(a,c,d){a!==!0&&(d=c,c=a,a=!1);if(c){d=d||"fx";var e=d+"mark",g=a?0:(f.data(c,e,b,!0)||1)-1;g?f.data(c,e,g,!0):(f.removeData(c,e,!0),m(c,d,"mark"))}},queue:function(a,c,d){if(a){c=(c||"fx")+"queue";var e=f.data(a,c,b,!0);d&&(!e||f.isArray(d)?e=f.data(a,c,f.makeArray(d),!0):e.push(d));return e||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e;d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),d.call(a,function(){f.dequeue(a,b)})),c.length||(f.removeData(a,b+"queue",!0),m(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){typeof a!="string"&&(c=a,a="fx");if(c===b)return f.queue(this[0],a);return this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(){var c=this;setTimeout(function(){f.dequeue(c,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f._Deferred(),!0))h++,l.done(m);m();return d.promise()}});var n=/[\n\t\r]/g,o=/\s+/,p=/\r/g,q=/^(?:button|input)$/i,r=/^(?:button|input|object|select|textarea)$/i,s=/^a(?:rea)?$/i,t=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,u=/\:|^on/,v,w;f.fn.extend({attr:function(a,b){return f.access(this,a,b,!0,f.attr)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,a,b,!0,f.prop)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){var b,c,d,e,g,h,i;if(f.isFunction(a))return this.each(function(b){f(this).addClass(a.call(this,b,this.className))});if(a&&typeof a=="string"){b=a.split(o);for(c=0,d=this.length;c<d;c++){e=this[c];if(e.nodeType===1)if(!e.className&&b.length===1)e.className=a;else{g=" "+e.className+" ";for(h=0,i=b.length;h<i;h++)~g.indexOf(" "+b[h]+" ")||(g+=b[h]+" ");e.className=f.trim(g)}}}return this},removeClass:function(a){var c,d,e,g,h,i,j;if(f.isFunction(a))return this.each(function(b){f(this).removeClass(a.call(this,b,this.className))});if(a&&typeof a=="string"||a===b){c=(a||"").split(o);for(d=0,e=this.length;d<e;d++){g=this[d];if(g.nodeType===1&&g.className)if(a){h=(" "+g.className+" ").replace(n," ");for(i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){f(this).toggleClass(a.call(this,c,this.className,b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(o);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ";for(var c=0,d=this.length;c<d;c++)if((" "+this[c].className+" ").replace(n," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e=this[0];if(!arguments.length){if(e){c=f.valHooks[e.nodeName.toLowerCase()]||f.valHooks[e.type];if(c&&"get"in c&&(d=c.get(e,"value"))!==b)return d;d=e.value;return typeof d=="string"?d.replace(p,""):d==null?"":d}return b}var g=f.isFunction(a);return this.each(function(d){var e=f(this),h;if(this.nodeType===1){g?h=a.call(this,d,e.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c=a.selectedIndex,d=[],e=a.options,g=a.type==="select-one";if(c<0)return null;for(var h=g?c:0,i=g?c+1:e.length;h<i;h++){var j=e[h];if(j.selected&&(f.support.optDisabled?!j.disabled:j.getAttribute("disabled")===null)&&(!j.parentNode.disabled||!f.nodeName(j.parentNode,"optgroup"))){b=f(j).val();if(g)return b;d.push(b)}}if(g&&!d.length&&e.length)return f(e[c]).val();return d},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attrFix:{tabindex:"tabIndex"},attr:function(a,c,d,e){var g=a.nodeType;if(!a||g===3||g===8||g===2)return b;if(e&&c in f.attrFn)return f(a)[c](d);if(!("getAttribute"in a))return f.prop(a,c,d);var h,i,j=g!==1||!f.isXMLDoc(a);j&&(c=f.attrFix[c]||c,i=f.attrHooks[c],i||(t.test(c)?i=w:v&&c!=="className"&&(f.nodeName(a,"form")||u.test(c))&&(i=v)));if(d!==b){if(d===null){f.removeAttr(a,c);return b}if(i&&"set"in i&&j&&(h=i.set(a,d,c))!==b)return h;a.setAttribute(c,""+d);return d}if(i&&"get"in i&&j&&(h=i.get(a,c))!==null)return h;h=a.getAttribute(c);return h===null?b:h},removeAttr:function(a,b){var c;a.nodeType===1&&(b=f.attrFix[b]||b,f.support.getSetAttribute?a.removeAttribute(b):(f.attr(a,b,""),a.removeAttributeNode(a.getAttributeNode(b))),t.test(b)&&(c=f.propFix[b]||b)in a&&(a[c]=!1))},attrHooks:{type:{set:function(a,b){if(q.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},tabIndex:{get:function(a){var c=a.getAttributeNode("tabIndex");return c&&c.specified?parseInt(c.value,10):r.test(a.nodeName)||s.test(a.nodeName)&&a.href?0:b}},value:{get:function(a,b){if(v&&f.nodeName(a,"button"))return v.get(a,b);return b in a?a.value:null},set:function(a,b,c){if(v&&f.nodeName(a,"button"))return v.set(a,b,c);a.value=b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e=a.nodeType;if(!a||e===3||e===8||e===2)return b;var g,h,i=e!==1||!f.isXMLDoc(a);i&&(c=f.propFix[c]||c,h=f.propHooks[c]);return d!==b?h&&"set"in h&&(g=h.set(a,d,c))!==b?g:a[c]=d:h&&"get"in h&&(g=h.get(a,c))!==b?g:a[c]},propHooks:{}}),w={get:function(a,c){return f.prop(a,c)?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=!0),a.setAttribute(c,c.toLowerCase()));return c}},f.support.getSetAttribute||(f.attrFix=f.propFix,v=f.attrHooks.name=f.attrHooks.title=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&d.nodeValue!==""?d.nodeValue:b},set:function(a,b,c){var d=a.getAttributeNode(c);if(d){d.nodeValue=b;return b}}},f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})})),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}})),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var x=/\.(.*)$/,y=/^(?:textarea|input|select)$/i,z=/\./g,A=/ /g,B=/[^\w\s.|`]/g,C=function(a){return a.replace(B,"\\$&")};f.event={add:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){if(d===!1)d=D;else if(!d)return;var g,h;d.handler&&(g=d,d=g.handler),d.guid||(d.guid=f.guid++);var i=f._data(a);if(!i)return;var j=i.events,k=i.handle;j||(i.events=j={}),k||(i.handle=k=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.handle.apply(k.elem,arguments):b}),k.elem=a,c=c.split(" ");var l,m=0,n;while(l=c[m++]){h=g?f.extend({},g):{handler:d,data:e},l.indexOf(".")>-1?(n=l.split("."),l=n.shift(),h.namespace=n.slice(0).sort().join(".")):(n=[],h.namespace=""),h.type=l,h.guid||(h.guid=d.guid);var o=j[l],p=f.event.special[l]||{};if(!o){o=j[l]=[];if(!p.setup||p.setup.call(a,e,n,k)===!1)a.addEventListener?a.addEventListener(l,k,!1):a.attachEvent&&a.attachEvent("on"+l,k)}p.add&&(p.add.call(a,h),h.handler.guid||(h.handler.guid=d.guid)),o.push(h),f.event.global[l]=!0}a=null}},global:{},remove:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){d===!1&&(d=D);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=f.hasData(a)&&f._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(d=c.handler,c=c.type);if(!c||typeof c=="string"&&c.charAt(0)==="."){c=c||"";for(h in t)f.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+f.map(m.slice(0).sort(),C).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!d){for(j=0;j<p.length;j++){q=p[j];if(l||n.test(q.namespace))f.event.remove(a,r,q.handler,j),p.splice(j--,1)}continue}o=f.event.special[h]||{};for(j=e||0;j<p.length;j++){q=p[j];if(d.guid===q.guid){if(l||n.test(q.namespace))e==null&&p.splice(j--,1),o.remove&&o.remove.call(a,q);if(e!=null)break}}if(p.length===0||e!=null&&p.length===1)(!o.teardown||o.teardown.call(a,m)===!1)&&f.removeEvent(a,h,s.handle),g=null,delete t[h]}if(f.isEmptyObject(t)){var u=s.handle;u&&(u.elem=null),delete s.events,delete s.handle,f.isEmptyObject(s)&&f.removeData(a,b,!0)}}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){var h=c.type||c,i=[],j;h.indexOf("!")>=0&&(h=h.slice(0,-1),j=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i. +shift(),i.sort());if(!!e&&!f.event.customEvent[h]||!!f.event.global[h]){c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.exclusive=j,c.namespace=i.join("."),c.namespace_re=new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)");if(g||!e)c.preventDefault(),c.stopPropagation();if(!e){f.each(f.cache,function(){var a=f.expando,b=this[a];b&&b.events&&b.events[h]&&f.event.trigger(c,d,b.handle.elem)});return}if(e.nodeType===3||e.nodeType===8)return;c.result=b,c.target=e,d=d!=null?f.makeArray(d):[],d.unshift(c);var k=e,l=h.indexOf(":")<0?"on"+h:"";do{var m=f._data(k,"handle");c.currentTarget=k,m&&m.apply(k,d),l&&f.acceptData(k)&&k[l]&&k[l].apply(k,d)===!1&&(c.result=!1,c.preventDefault()),k=k.parentNode||k.ownerDocument||k===c.target.ownerDocument&&a}while(k&&!c.isPropagationStopped());if(!c.isDefaultPrevented()){var n,o=f.event.special[h]||{};if((!o._default||o._default.call(e.ownerDocument,c)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)){try{l&&e[h]&&(n=e[l],n&&(e[l]=null),f.event.triggered=h,e[h]())}catch(p){}n&&(e[l]=n),f.event.triggered=b}}return c.result}},handle:function(c){c=f.event.fix(c||a.event);var d=((f._data(this,"events")||{})[c.type]||[]).slice(0),e=!c.exclusive&&!c.namespace,g=Array.prototype.slice.call(arguments,0);g[0]=c,c.currentTarget=this;for(var h=0,i=d.length;h<i;h++){var j=d[h];if(e||c.namespace_re.test(j.namespace)){c.handler=j.handler,c.data=j.data,c.handleObj=j;var k=j.handler.apply(this,g);k!==b&&(c.result=k,k===!1&&(c.preventDefault(),c.stopPropagation()));if(c.isImmediatePropagationStopped())break}}return c.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(a){if(a[f.expando])return a;var d=a;a=f.Event(d);for(var e=this.props.length,g;e;)g=this.props[--e],a[g]=d[g];a.target||(a.target=a.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),!a.relatedTarget&&a.fromElement&&(a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement);if(a.pageX==null&&a.clientX!=null){var h=a.target.ownerDocument||c,i=h.documentElement,j=h.body;a.pageX=a.clientX+(i&&i.scrollLeft||j&&j.scrollLeft||0)-(i&&i.clientLeft||j&&j.clientLeft||0),a.pageY=a.clientY+(i&&i.scrollTop||j&&j.scrollTop||0)-(i&&i.clientTop||j&&j.clientTop||0)}a.which==null&&(a.charCode!=null||a.keyCode!=null)&&(a.which=a.charCode!=null?a.charCode:a.keyCode),!a.metaKey&&a.ctrlKey&&(a.metaKey=a.ctrlKey),!a.which&&a.button!==b&&(a.which=a.button&1?1:a.button&2?3:a.button&4?2:0);return a},guid:1e8,proxy:f.proxy,special:{ready:{setup:f.bindReady,teardown:f.noop},live:{add:function(a){f.event.add(this,N(a.origType,a.selector),f.extend({},a,{handler:M,guid:a.handler.guid}))},remove:function(a){f.event.remove(this,N(a.origType,a.selector),a)}},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}}},f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!this.preventDefault)return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?E:D):this.type=a,b&&f.extend(this,b),this.timeStamp=f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=E;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=E;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=E,this.stopPropagation()},isDefaultPrevented:D,isPropagationStopped:D,isImmediatePropagationStopped:D};var F=function(a){var b=a.relatedTarget,c=!1,d=a.type;a.type=a.data,b!==this&&(b&&(c=f.contains(this,b)),c||(f.event.handle.apply(this,arguments),a.type=d))},G=function(a){a.type=a.data,f.event.handle.apply(this,arguments)};f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={setup:function(c){f.event.add(this,b,c&&c.selector?G:F,a)},teardown:function(a){f.event.remove(this,b,a&&a.selector?G:F)}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(a,b){if(!f.nodeName(this,"form"))f.event.add(this,"click.specialSubmit",function(a){var b=a.target,c=b.type;(c==="submit"||c==="image")&&f(b).closest("form").length&&K("submit",this,arguments)}),f.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,c=b.type;(c==="text"||c==="password")&&f(b).closest("form").length&&a.keyCode===13&&K("submit",this,arguments)});else return!1},teardown:function(a){f.event.remove(this,".specialSubmit")}});if(!f.support.changeBubbles){var H,I=function(a){var b=a.type,c=a.value;b==="radio"||b==="checkbox"?c=a.checked:b==="select-multiple"?c=a.selectedIndex>-1?f.map(a.options,function(a){return a.selected}).join("-"):"":f.nodeName(a,"select")&&(c=a.selectedIndex);return c},J=function(c){var d=c.target,e,g;if(!!y.test(d.nodeName)&&!d.readOnly){e=f._data(d,"_change_data"),g=I(d),(c.type!=="focusout"||d.type!=="radio")&&f._data(d,"_change_data",g);if(e===b||g===e)return;if(e!=null||g)c.type="change",c.liveFired=b,f.event.trigger(c,arguments[1],d)}};f.event.special.change={filters:{focusout:J,beforedeactivate:J,click:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(c==="radio"||c==="checkbox"||f.nodeName(b,"select"))&&J.call(this,a)},keydown:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(a.keyCode===13&&!f.nodeName(b,"textarea")||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&J.call(this,a)},beforeactivate:function(a){var b=a.target;f._data(b,"_change_data",I(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in H)f.event.add(this,c+".specialChange",H[c]);return y.test(this.nodeName)},teardown:function(a){f.event.remove(this,".specialChange");return y.test(this.nodeName)}},H=f.event.special.change.filters,H.focus=H.beforeactivate}f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){function e(a){var c=f.event.fix(a);c.type=b,c.originalEvent={},f.event.trigger(c,null,c.target),c.isDefaultPrevented()&&a.preventDefault()}var d=0;f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.each(["bind","one"],function(a,c){f.fn[c]=function(a,d,e){var g;if(typeof a=="object"){for(var h in a)this[c](h,d,a[h],e);return this}if(arguments.length===2||d===!1)e=d,d=b;c==="one"?(g=function(a){f(this).unbind(a,g);return e.apply(this,arguments)},g.guid=e.guid||f.guid++):g=e;if(a==="unload"&&c!=="one")this.one(a,d,e);else for(var i=0,j=this.length;i<j;i++)f.event.add(this[i],a,g,d);return this}}),f.fn.extend({unbind:function(a,b){if(typeof a=="object"&&!a.preventDefault)for(var c in a)this.unbind(c,a[c]);else for(var d=0,e=this.length;d<e;d++)f.event.remove(this[d],a,b);return this},delegate:function(a,b,c,d){return this.live(b,c,d,a)},undelegate:function(a,b,c){return arguments.length===0?this.unbind("live"):this.die(b,null,c,a)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f.data(this,"lastToggle"+a.guid)||0)%d;f.data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var L={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};f.each(["live","die"],function(a,c){f.fn[c]=function(a,d,e,g){var h,i=0,j,k,l,m=g||this.selector,n=g?this:f(this.context);if(typeof a=="object"&&!a.preventDefault){for(var o in a)n[c](o,d,a[o],m);return this}if(c==="die"&&!a&&g&&g.charAt(0)==="."){n.unbind(g);return this}if(d===!1||f.isFunction(d))e=d||D,d=b;a=(a||"").split(" ");while((h=a[i++])!=null){j=x.exec(h),k="",j&&(k=j[0],h=h.replace(x,""));if(h==="hover"){a.push("mouseenter"+k,"mouseleave"+k);continue}l=h,L[h]?(a.push(L[h]+k),h=h+k):h=(L[h]||h)+k;if(c==="live")for(var p=0,q=n.length;p<q;p++)f.event.add(n[p],"live."+N(h,m),{data:d,selector:m,handler:e,origType:h,origHandler:e,preType:l});else n.unbind("live."+N(h,m),e)}return this}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.bind(b,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}if(i.nodeType===1){f||(i.sizcache=c,i.sizset=g);if(typeof b!="string"){if(i===b){j=!0;break}}else if(k.filter(b,[i]).length>0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}i.nodeType===1&&!f&&(i.sizcache=c,i.sizset=g);if(i.nodeName.toLowerCase()===b){j=i;break}i=i[a]}d[g]=j}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d=0,e=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,f,g){f=f||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return f;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(e.call(n)==="[object Array]")if(!u)f.push.apply(f,n);else if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&f.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&f.push(j[t]);else p(n,f);o&&(k(o,h,f,g),k.uniqueSort(f));return f};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},k.matches=function(a,b){return k(a,null,null,b)},k.matchesSelector=function(a,b){return k(b,null,null,[a]).length>0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e<f;e++){var g,h=l.order[e];if(g=l.leftMatch[h].exec(a)){var j=g[1];g.splice(1,1);if(j.substr(j.length-1)!=="\\"){g[1]=(g[1]||"").replace(i,""),d=l.find[h](g,b,c);if(d!=null){a=a.replace(l.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},k.filter=function(a,c,d,e){var f,g,h=a,i=[],j=c,m=c&&c[0]&&k.isXML(c[0]);while(a&&c.length){for(var n in l.filter)if((f=l.leftMatch[n].exec(a))!=null&&f[2]){var o,p,q=l.filter[n],r=f[1];g=!1,f.splice(1,1);if(r.substr(r.length-1)==="\\")continue;j===i&&(i=[]);if(l.preFilter[n]){f=l.preFilter[n](f,j,d,i,e,m);if(!f)g=o=!0;else if(f===!0)continue}if(f)for(var s=0;(p=j[s])!=null;s++)if(p){o=q(p,f,s,j);var t=e^!!o;d&&o!=null?t?g=!0:j[s]=!1:t&&(i.push(p),g=!0)}if(o!==b){d||(j=i),a=a.replace(l.match[n],"");if(!g)return[];break}}if(a===h)if(g==null)k.error(a);else break;h=a}return j},k.error=function(a){throw"Syntax error, unrecognized expression: "+a};var l=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!j.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&k.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&k.filter(b,a,!0)}},"":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("parentNode",b,f,a,e,c)},"~":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("previousSibling",b,f,a,e,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(i,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=d++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}k.error(e)},CHILD:function(a,b){var c=b[1],d=a;switch(c){case"only":case"first":while(d=d.previousSibling)if(d.nodeType===1)return!1;if(c==="first")return!0;d=a;case"last":while(d=d.nextSibling)if(d.nodeType===1)return!1;return!0;case"nth":var e=b[2],f=b[3];if(e===1&&f===0)return!0;var g=b[0],h=a.parentNode;if(h&&(h.sizcache!==g||!a.nodeIndex)){var i=0;for(d=h.firstChild;d;d=d.nextSibling)d.nodeType===1&&(d.nodeIndex=++i);h.sizcache=g}var j=a.nodeIndex-f;return e===0?j===0:j%e===0&&j/e>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(e.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var f=a.length;c<f;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var r,s;c.documentElement.compareDocumentPosition?r=function(a,b){if(a===b){g=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(r=function(a,b){if(a===b){g=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],h=a.parentNode,i=b.parentNode,j=h;if(h===i)return s(a,b);if(!h)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return s(e[k],f[k]);return k===c?s(a,f[k],-1):s(e[k],b,1)},s=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),k.getText=function(a){var b="",c;for(var d=0;a[d];d++)c=a[d],c.nodeType===3||c.nodeType===4?b+=c.nodeValue:c.nodeType!==8&&(b+=k.getText(c.childNodes));return b},function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(e||!l.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return k(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g<h;g++)k(a,f[g],d);return k.filter(e,d)};f.find=k,f.expr=k.selectors,f.expr[":"]=f.expr.filters,f.unique=k.uniqueSort,f.text=k.getText,f.isXMLDoc=k.isXML,f.contains=k.contains}();var O=/Until$/,P=/^(?:parents|prevUntil|prevAll)/,Q=/,/,R=/^.[^:#\[\.,]*$/,S=Array.prototype.slice,T=f.expr.match.POS,U={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(W(this,a,!1),"not",a)},filter:function(a){return this.pushStack(W(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(d=0,e=a.length;d<e;d++)i=a[d],j[i]||(j[i]=T.test(i)?f(i,b||this.context):i);while(g&&g.ownerDocument&&g!==b){for(i in j)h=j[i],(h.jquery?h.index(g)>-1:f(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=T.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(l?l.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a=="string")return f.inArray(this[0],a?f(a):this.parent().children());return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(V(c[0])||V(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c),g=S.call(arguments);O.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!U[a]?f.unique(e):e,(this.length>1||Q.test(d))&&P.test(a)&&(e=e.reverse());return this.pushStack(e,a,g.join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var X=/ jQuery\d+="(?:\d+|null)"/g,Y=/^\s+/,Z=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,$=/<([\w:]+)/,_=/<tbody/i,ba=/<|&#?\w+;/,bb=/<(?:script|object|embed|option|style)/i,bc=/checked\s*(?:[^=]|=\s*.checked.)/i,bd=/\/(java|ecma)script/i,be=/^\s*<!(?:\[CDATA\[|\-\-)/,bf={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};bf.optgroup=bf.option,bf.tbody=bf.tfoot=bf.colgroup=bf.caption=bf.thead,bf.th=bf.td,f.support.htmlSerialize||(bf._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){f(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(X,""):null;if(typeof a=="string"&&!bb.test(a)&&(f.support.leadingWhitespace||!Y.test(a))&&!bf[($.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Z,"<$1></$2>");try{for(var c=0,d=this.length;c<d;c++)this[c].nodeType===1&&(f.cleanData(this[c].getElementsByTagName("*")),this[c].innerHTML=a)}catch(e){this.empty().append(a)}}else f.isFunction(a)?this.each(function(b){var c=f(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bc.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bg(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,bm)}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i;b&&b[0]&&(i=b[0].ownerDocument||b[0]),i.createDocumentFragment||(i=c),a.length===1&&typeof a[0]=="string"&&a[0].length<512&&i===c&&a[0].charAt(0)==="<"&&!bb.test(a[0])&&(f.support.checkClone||!bc.test(a[0]))&&(g=!0,h=f.fragments[a[0]],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean(a,i,e,d)),g&&(f.fragments[a[0]]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j +)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d=a.cloneNode(!0),e,g,h;if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bi(a,d),e=bj(a),g=bj(d);for(h=0;e[h];++h)bi(e[h],g[h])}if(b){bh(a,d);if(c){e=bj(a),g=bj(d);for(h=0;e[h];++h)bh(e[h],g[h])}}e=g=null;return d},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!ba.test(k))k=b.createTextNode(k);else{k=k.replace(Z,"<$1></$2>");var l=($.exec(k)||["",""])[1].toLowerCase(),m=bf[l]||bf._default,n=m[0],o=b.createElement("div");o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=_.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]==="<table>"&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&Y.test(k)&&o.insertBefore(b.createTextNode(Y.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i<r;i++)bl(k[i]);else bl(k);k.nodeType?h.push(k):h=f.merge(h,k)}if(d){g=function(a){return!a.type||bd.test(a.type)};for(j=0;h[j];j++)if(e&&f.nodeName(h[j],"script")&&(!h[j].type||h[j].type.toLowerCase()==="text/javascript"))e.push(h[j].parentNode?h[j].parentNode.removeChild(h[j]):h[j]);else{if(h[j].nodeType===1){var s=f.grep(h[j].getElementsByTagName("script"),g);h.splice.apply(h,[j+1,0].concat(s))}d.appendChild(h[j])}}return h},cleanData:function(a){var b,c,d=f.cache,e=f.expando,g=f.event.special,h=f.support.deleteExpando;for(var i=0,j;(j=a[i])!=null;i++){if(j.nodeName&&f.noData[j.nodeName.toLowerCase()])continue;c=j[f.expando];if(c){b=d[c]&&d[c][e];if(b&&b.events){for(var k in b.events)g[k]?f.event.remove(j,k):f.removeEvent(j,k,b.handle);b.handle&&(b.handle.elem=null)}h?delete j[f.expando]:j.removeAttribute&&j.removeAttribute(f.expando),delete d[c]}}}});var bn=/alpha\([^)]*\)/i,bo=/opacity=([^)]*)/,bp=/([A-Z]|^ms)/g,bq=/^-?\d+(?:px)?$/i,br=/^-?\d/,bs=/^[+\-]=/,bt=/[^+\-\.\de]+/g,bu={position:"absolute",visibility:"hidden",display:"block"},bv=["Left","Right"],bw=["Top","Bottom"],bx,by,bz;f.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return f.access(this,a,c,!0,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)})},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bx(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d;if(h==="number"&&isNaN(d)||d==null)return;h==="string"&&bs.test(d)&&(d=+d.replace(bt,"")+parseFloat(f.css(a,c)),h="number"),h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(bx)return bx(a,c)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]}}),f.curCSS=f.css,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){var e;if(c){if(a.offsetWidth!==0)return bA(a,b,d);f.swap(a,bu,function(){e=bA(a,b,d)});return e}},set:function(a,b){if(!bq.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bo.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle;c.zoom=1;var e=f.isNaN(b)?"":"alpha(opacity="+b*100+")",g=d&&d.filter||c.filter||"";c.filter=bn.test(g)?g.replace(bn,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bx(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(by=function(a,c){var d,e,g;c=c.replace(bp,"-$1").toLowerCase();if(!(e=a.ownerDocument.defaultView))return b;if(g=e.getComputedStyle(a,null))d=g.getPropertyValue(c),d===""&&!f.contains(a.ownerDocument.documentElement,a)&&(d=f.style(a,c));return d}),c.documentElement.currentStyle&&(bz=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bq.test(d)&&br.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bx=by||bz,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bB=/%20/g,bC=/\[\]$/,bD=/\r?\n/g,bE=/#.*$/,bF=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bG=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bH=/^(?:about|app|app\-storage|.+\-extension|file|widget):$/,bI=/^(?:GET|HEAD)$/,bJ=/^\/\//,bK=/\?/,bL=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bM=/^(?:select|textarea)/i,bN=/\s+/,bO=/([?&])_=[^&]*/,bP=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bQ=f.fn.load,bR={},bS={},bT,bU;try{bT=e.href}catch(bV){bT=c.createElement("a"),bT.href="",bT=bT.href}bU=bP.exec(bT.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bQ)return bQ.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bL,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bM.test(this.nodeName)||bG.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bD,"\r\n")}}):{name:b.name,value:c.replace(bD,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.bind(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?f.extend(!0,a,f.ajaxSettings,b):(b=a,a=f.extend(!0,f.ajaxSettings,b));for(var c in{context:1,url:1})c in b?a[c]=b[c]:c in f.ajaxSettings&&(a[c]=f.ajaxSettings[c]);return a},ajaxSettings:{url:bT,isLocal:bH.test(bU[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML}},ajaxPrefilter:bW(bR),ajaxTransport:bW(bS),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a?4:0;var o,r,u,w=l?bZ(d,v,l):b,x,y;if(a>=200&&a<300||a===304){if(d.ifModified){if(x=v.getResponseHeader("Last-Modified"))f.lastModified[k]=x;if(y=v.getResponseHeader("Etag"))f.etag[k]=y}if(a===304)c="notmodified",o=!0;else try{r=b$(d,w),c="success",o=!0}catch(z){c="parsererror",u=z}}else{u=c;if(!c||a)c="error",a<0&&(a=0)}v.status=a,v.statusText=c,o?h.resolveWith(e,[r,c,v]):h.rejectWith(e,[v,c,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.resolveWith(e,[v,c]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f._Deferred(),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bF.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.done,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bE,"").replace(bJ,bU[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bN),d.crossDomain==null&&(r=bP.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bU[1]&&r[2]==bU[2]&&(r[3]||(r[1]==="http:"?80:443))==(bU[3]||(bU[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),bX(bR,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bI.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bK.test(d.url)?"&":"?")+d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bO,"$1_="+x);d.url=y+(y===d.url?(bK.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", */*; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=bX(bS,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){status<2?w(-1,z):f.error(z)}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)bY(g,a[g],c,e);return d.join("&").replace(bB,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var b_=f.now(),ca=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+b_++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(ca.test(b.url)||e&&ca.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(ca,l),b.url===j&&(e&&(k=k.replace(ca,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var cb=a.ActiveXObject?function(){for(var a in cd)cd[a](0,1)}:!1,cc=0,cd;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ce()||cf()}:ce,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,cb&&delete cd[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cc,cb&&(cd||(cd={},f(a).unload(cb)),cd[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cg={},ch,ci,cj=/^(?:toggle|show|hide)$/,ck=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,cl,cm=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cn,co=a.webkitRequestAnimationFrame||a.mozRequestAnimationFrame||a.oRequestAnimationFrame;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cr("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),e===""&&f.css(d,"display")==="none"&&f._data(d,"olddisplay",cs(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(cr("hide",3),a,b,c);for(var d=0,e=this.length;d<e;d++)if(this[d].style){var g=f.css(this[d],"display");g!=="none"&&!f._data(this[d],"olddisplay")&&f._data(this[d],"olddisplay",g)}for(d=0;d<e;d++)this[d].style&&(this[d].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(cr("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return this[e.queue===!1?"each":"queue"](function(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]),h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(f.support.inlineBlockNeedsLayout?(j=cs(this.nodeName),j==="inline"?this.style.display="inline-block":(this.style.display="inline",this.style.zoom=1)):this.style.display="inline-block"))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)k=new f.fx(this,b,i),h=a[i],cj.test(h)?k[h==="toggle"?d?"show":"hide":h]():(l=ck.exec(h),m=k.cur(),l?(n=parseFloat(l[2]),o=l[3]||(f.cssNumber[i]?"":"px"),o!=="px"&&(f.style(this,i,(n||1)+o),m=(n||1)/k.cur()*m,f.style(this,i,m+o)),l[1]&&(n=(l[1]==="-="?-1:1)*n+m),k.custom(m,n,o)):k.custom(m,h,""));return!0})},stop:function(a,b){a&&this.queue([]),this.each(function(){var a=f.timers,c=a.length;b||f._unmark(!0,this);while(c--)a[c].elem===this&&(b&&a[c](!0),a.splice(c,1))}),b||this.dequeue();return this}}),f.each({slideDown:cr("show",1),slideUp:cr("hide",1),slideToggle:cr("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default,d.old=d.complete,d.complete=function(a){f.isFunction(d.old)&&d.old.call(this),d.queue!==!1?f.dequeue(this):a!==!1&&f._unmark(this)};return d},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,b,c){function h(a){return d.step(a)}var d=this,e=f.fx,g;this.startTime=cn||cp(),this.start=a,this.end=b,this.unit=c||this.unit||(f.cssNumber[this.prop]?"":"px"),this.now=this.start,this.pos=this.state=0,h.elem=this.elem,h()&&f.timers.push(h)&&!cl&&(co?(cl=!0,g=function(){cl&&(co(g),e.tick())},co(g)):cl=setInterval(e.tick,e.interval))},show:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.show=!0,this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b=cn||cp(),c=!0,d=this.elem,e=this.options,g,h;if(a||b>=e.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),e.animatedProperties[this.prop]=!0;for(g in e.animatedProperties)e.animatedProperties[g]!==!0&&(c=!1);if(c){e.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){d.style["overflow"+b]=e.overflow[a]}),e.hide&&f(d).hide();if(e.hide||e.show)for(var i in e.animatedProperties)f.style(d,i,e.orig[i]);e.complete.call(d)}return!1}e.duration==Infinity?this.now=b:(h=b-this.startTime,this.state=h/e.duration,this.pos=f.easing[e.animatedProperties[this.prop]](this.state,h,0,1,e.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){for(var a=f.timers,b=0;b<a.length;++b)a[b]()||a.splice(b--,1);a.length||f.fx.stop()},interval:13,stop:function(){clearInterval(cl),cl=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit:a.elem[a.prop]=a.now}}}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var ct=/^t(?:able|d|h)$/i,cu=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?f.fn.offset=function(a){var b=this[0],c;if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);try{c=b.getBoundingClientRect()}catch(d){}var e=b.ownerDocument,g=e.documentElement;if(!c||!f.contains(g,b))return c?{top:c.top,left:c.left}:{top:0,left:0};var h=e.body,i=cv(e),j=g.clientTop||h.clientTop||0,k=g.clientLeft||h.clientLeft||0,l=i.pageYOffset||f.support.boxModel&&g.scrollTop||h.scrollTop,m=i.pageXOffset||f.support.boxModel&&g.scrollLeft||h.scrollLeft,n=c.top+l-j,o=c.left+m-k;return{top:n,left:o}}:f.fn.offset=function(a){var b=this[0];if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);f.offset.initialize();var c,d=b.offsetParent,e=b,g=b.ownerDocument,h=g.documentElement,i=g.body,j=g.defaultView,k=j?j.getComputedStyle(b,null):b.currentStyle,l=b.offsetTop,m=b.offsetLeft;while((b=b.parentNode)&&b!==i&&b!==h){if(f.offset.supportsFixedPosition&&k.position==="fixed")break;c=j?j.getComputedStyle(b,null):b.currentStyle,l-=b.scrollTop,m-=b.scrollLeft,b===d&&(l+=b.offsetTop,m+=b.offsetLeft,f.offset.doesNotAddBorder&&(!f.offset.doesAddBorderForTableAndCells||!ct.test(b.nodeName))&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),e=d,d=b.offsetParent),f.offset.subtractsBorderForOverflowNotVisible&&c.overflow!=="visible"&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),k=c}if(k.position==="relative"||k.position==="static")l+=i.offsetTop,m+=i.offsetLeft;f.offset.supportsFixedPosition&&k.position==="fixed"&&(l+=Math.max(h.scrollTop,i.scrollTop),m+=Math.max(h.scrollLeft,i.scrollLeft));return{top:l,left:m}},f.offset={initialize:function(){var a=c.body,b=c.createElement("div"),d,e,g,h,i=parseFloat(f.css(a,"marginTop"))||0,j="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";f.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"}),b.innerHTML=j,a.insertBefore(b,a.firstChild),d=b.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,this.doesNotAddBorder=e.offsetTop!==5,this.doesAddBorderForTableAndCells=h.offsetTop===5,e.style.position="fixed",e.style.top="20px",this.supportsFixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",this.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i,a.removeChild(b),f.offset.initialize=f.noop},bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.offset.initialize(),f.offset.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cu.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cu.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cv(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cv(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){var a=this[0];return a&&a.style?parseFloat(f.css(a,d,"padding")):null},f.fn["outer"+c]=function(a){var b=this[0];return b&&b.style?parseFloat(f.css(b,d,a?"margin":"border")):null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c];return e.document.compatMode==="CSS1Compat"&&g||e.document.body["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var h=f.css(e,d),i=parseFloat(h);return f.isNaN(i)?h:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f})(window);
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_flat_0_aaaaaa_40x100.png b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_flat_0_aaaaaa_40x100.png Binary files differnew file mode 100644 index 0000000..5b5dab2 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_flat_0_aaaaaa_40x100.png diff --git a/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_flat_75_ffffff_40x100.png b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_flat_75_ffffff_40x100.png Binary files differnew file mode 100644 index 0000000..ac8b229 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_flat_75_ffffff_40x100.png diff --git a/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_glass_55_fbf9ee_1x400.png b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_glass_55_fbf9ee_1x400.png Binary files differnew file mode 100644 index 0000000..ad3d634 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_glass_55_fbf9ee_1x400.png diff --git a/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_glass_65_ffffff_1x400.png b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_glass_65_ffffff_1x400.png Binary files differnew file mode 100644 index 0000000..42ccba2 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_glass_65_ffffff_1x400.png diff --git a/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_glass_75_dadada_1x400.png b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_glass_75_dadada_1x400.png Binary files differnew file mode 100644 index 0000000..5a46b47 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_glass_75_dadada_1x400.png diff --git a/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_glass_75_e6e6e6_1x400.png b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_glass_75_e6e6e6_1x400.png Binary files differnew file mode 100644 index 0000000..86c2baa --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_glass_75_e6e6e6_1x400.png diff --git a/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_glass_95_fef1ec_1x400.png b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_glass_95_fef1ec_1x400.png Binary files differnew file mode 100644 index 0000000..4443fdc --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_glass_95_fef1ec_1x400.png diff --git a/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_highlight-soft_75_cccccc_1x100.png Binary files differnew file mode 100644 index 0000000..7c9fa6c --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-bg_highlight-soft_75_cccccc_1x100.png diff --git a/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-icons_222222_256x240.png b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-icons_222222_256x240.png Binary files differnew file mode 100644 index 0000000..b273ff1 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-icons_222222_256x240.png diff --git a/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-icons_2e83ff_256x240.png b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-icons_2e83ff_256x240.png Binary files differnew file mode 100644 index 0000000..09d1cdc --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-icons_2e83ff_256x240.png diff --git a/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-icons_454545_256x240.png b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-icons_454545_256x240.png Binary files differnew file mode 100644 index 0000000..59bd45b --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-icons_454545_256x240.png diff --git a/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-icons_888888_256x240.png b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-icons_888888_256x240.png Binary files differnew file mode 100644 index 0000000..6d02426 --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-icons_888888_256x240.png diff --git a/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-icons_cd0a0a_256x240.png b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-icons_cd0a0a_256x240.png Binary files differnew file mode 100644 index 0000000..2ab019b --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/images/ui-icons_cd0a0a_256x240.png diff --git a/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/jquery-ui-1.8.14.custom.css b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/jquery-ui-1.8.14.custom.css new file mode 100644 index 0000000..ad212da --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/jquery-ui-1.8.14.custom.css @@ -0,0 +1,568 @@ +/* + * jQuery UI CSS Framework 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + +/* + * jQuery UI CSS Framework 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; } +.ui-widget-content a { color: #222222; } +.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; } +.ui-widget-header a { color: #222222; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -khtml-border-top-left-radius: 4px; border-top-left-radius: 4px; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -khtml-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -khtml-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; -khtml-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); } +.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -khtml-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/* + * jQuery UI Resizable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* + * jQuery UI Selectable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/* + * jQuery UI Accordion 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } +/* + * jQuery UI Autocomplete 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.14 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} +/* + * jQuery UI Button 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/* + * jQuery UI Dialog 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* + * jQuery UI Slider 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* + * jQuery UI Tabs 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +/* + * jQuery UI Datepicker 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* + * jQuery UI Progressbar 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/jquery-ui-1.8.14.custom.min.js b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/jquery-ui-1.8.14.custom.min.js new file mode 100644 index 0000000..f9e4f1e --- /dev/null +++ b/ebus-datastore/ebus/web_static/lib/jquery-ui-1.8.14/jquery-ui-1.8.14.custom.min.js @@ -0,0 +1,789 @@ +/*! + * jQuery UI 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.14", +keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus(); +b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this, +"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection", +function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth, +outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a,"tabindex"),d=isNaN(b); +return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e= +0;e<b.length;e++)a.options[b[e][0]]&&b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery); +;/*! + * jQuery UI Widget 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h, +a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h; +e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options, +this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")}, +widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this}, +enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery); +;/*! + * jQuery UI Mouse 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function(b){var d=false;b(document).mousedown(function(){d=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+ +this.widgetName)},_mouseDown:function(a){if(!d){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,f=a.which==1,g=typeof this.options.cancel=="string"?b(a.target).closest(this.options.cancel).length:false;if(!f||g||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=this._mouseStart(a)!== +false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(e){return c._mouseMove(e)};this._mouseUpDelegate=function(e){return c._mouseUp(e)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return d=true}},_mouseMove:function(a){if(b.browser.msie&& +!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= +false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +;/* + * jQuery UI Position 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, +left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= +k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= +m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= +d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= +a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), +g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); +;/* + * jQuery UI Draggable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= +this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options;this.helper= +this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); +this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true}, +_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b= +false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration, +10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle|| +!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&& +a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= +this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"), +10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"), +10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top, +(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!= +"hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"), +10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+ +this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&& +!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.left<g[0])e=g[0]+this.offset.click.left; +if(a.pageY-this.offset.click.top<g[1])h=g[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>g[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=b.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1]:this.originalPageY;h=g?!(h-this.offset.click.top<g[1]||h-this.offset.click.top>g[3])?h:!(h-this.offset.click.top<g[1])?h-b.grid[1]:h+b.grid[1]:h;e=b.grid[0]?this.originalPageX+Math.round((e-this.originalPageX)/ +b.grid[0])*b.grid[0]:this.originalPageX;e=g?!(e-this.offset.click.left<g[0]||e-this.offset.click.left>g[2])?e:!(e-this.offset.click.left<g[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:h-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version< +526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b, +c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.14"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var h=d.data(this,"sortable");if(h&&!h.options.disabled){c.sortables.push({instance:h,shouldRevert:h.options.revert}); +h.refreshPositions();h._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval= +false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",true); +this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top; +c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&& +this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity= +a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!= +"x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left< +c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()- +c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this, +width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,h=b.offset.left,g=h+c.helperProportions.width,n=b.offset.top,o=n+c.helperProportions.height,i=c.snapElements.length-1;i>=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e<h&&h<l+e&&k-e<n&&n<m+e||j-e<h&&h<l+e&&k-e<o&&o<m+e||j-e<g&&g<l+e&&k-e<n&&n<m+e||j-e<g&&g<l+e&&k-e<o&& +o<m+e){if(f.snapMode!="inner"){var p=Math.abs(k-o)<=e,q=Math.abs(m-n)<=e,r=Math.abs(j-g)<=e,s=Math.abs(l-h)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l}).left-c.margins.left}var t= +p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(k-n)<=e;q=Math.abs(m-o)<=e;r=Math.abs(j-h)<=e;s=Math.abs(l-g)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m-c.helperProportions.height,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[i].snapping&& +(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=p||q||r||s||t}else{c.snapElements[i].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"), +10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery); +;/* + * jQuery UI Droppable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.mouse.js + * jquery.ui.draggable.js + */ +(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this); +a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&& +this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass); +this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g= +d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop", +a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.14"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height; +switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>= +i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!= +"none";if(c[f].visible){e=="mousedown"&&c[f]._activate.call(c[f],b);c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight}}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem|| +a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},dragStart:function(a,b){a.element.parentsUntil("body").bind("scroll.droppable",function(){a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)})},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c= +!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})},dragStop:function(a,b){a.element.parentsUntil("body").unbind("scroll.droppable"); +a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)}}})(jQuery); +;/* + * jQuery UI Resizable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element, +_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== +String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); +this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); +var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a= +false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"}); +this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff= +{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis]; +if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false}, +_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f, +{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight: +Infinity};if(this._aspectRatio||b){b=a.minHeight*this.aspectRatio;d=a.minWidth/this.aspectRatio;c=a.maxHeight*this.aspectRatio;f=a.maxWidth/this.aspectRatio;if(b>a.minWidth)a.minWidth=b;if(d>a.minHeight)a.minHeight=d;if(c<a.maxWidth)a.maxWidth=c;if(f<a.maxHeight)a.maxHeight=f}this._vBoundaries=a},_updateCache:function(b){this.offset=this.helper.offset();if(k(b.left))this.position.left=b.left;if(k(b.top))this.position.top=b.top;if(k(b.height))this.size.height=b.height;if(k(b.width))this.size.width= +b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(k(b.height))b.width=b.height*this.aspectRatio;else if(k(b.width))b.height=b.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this._vBoundaries,c=this.axis,d=k(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=k(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=k(b.width)&&a.minWidth&& +a.minWidth>b.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left= +null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=[c.css("borderTopWidth"),c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)|| +0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+ +a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+ +c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]); +b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.14"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(), +10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top- +f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType? +e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a= +e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing, +step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement= +e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset; +var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left: +a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top- +d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition, +f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25, +display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b= +e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height= +d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery); +;/* + * jQuery UI Selectable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), +selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, +c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", +c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= +this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting"); +a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&& +!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d= +e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.14"})})(jQuery); +;/* + * jQuery UI Sortable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable"); +this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a=== +"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&& +!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top, +left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; +this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!= +document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a); +return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top< +b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()- +b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this, +a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0], +e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset(); +c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): +this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null, +dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")}, +toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers|| +this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection(); +var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)}, +_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith(); +if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), +this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element), +this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&& +this.helper)this.offset.parent=this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b= +this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f= +d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")|| +0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out", +a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h- +f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b= +this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width== +""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top= +this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a= +{top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"), +10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"? +document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"), +10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b= +this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&& +this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset(); +var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g- +this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g- +this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0], +this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem.parent().length&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]= +"";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove", +f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this, +this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop", +a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()}, +_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.14"})})(jQuery); +;/* + * jQuery UI Accordion 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); +a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); +if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", +function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a= +this.options;if(a.icons){c("<span></span>").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); +b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); +a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ +c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; +if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); +if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(), +e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight|| +e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false", +"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.14", +animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/); +f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide", +paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); +;/* + * jQuery UI Autocomplete 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g= +false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!= +a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)}; +this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&& +a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); +d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&& +b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source= +this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close(); +this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label|| +b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new d.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this; +d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, +"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); +(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", +-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id"); +this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b, +this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| +this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| +this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element[d.fn.prop?"prop":"attr"]("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery); +;/* + * jQuery UI Button 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(b){var h,i,j,g,l=function(){var a=b(this).find(":ui-button");setTimeout(function(){a.button("refresh")},1)},k=function(a){var c=a.name,e=a.form,f=b([]);if(c)f=e?b(e).find("[name='"+c+"']"):b("[name='"+c+"']",a.ownerDocument).filter(function(){return!this.form});return f};b.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",l);if(typeof this.options.disabled!== +"boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var a=this,c=this.options,e=this.type==="checkbox"||this.type==="radio",f="ui-state-hover"+(!e?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",function(){if(!c.disabled){b(this).addClass("ui-state-hover"); +this===h&&b(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled||b(this).removeClass(f)}).bind("click.button",function(d){if(c.disabled){d.preventDefault();d.stopImmediatePropagation()}});this.element.bind("focus.button",function(){a.buttonElement.addClass("ui-state-focus")}).bind("blur.button",function(){a.buttonElement.removeClass("ui-state-focus")});if(e){this.element.bind("change.button",function(){g||a.refresh()});this.buttonElement.bind("mousedown.button",function(d){if(!c.disabled){g= +false;i=d.pageX;j=d.pageY}}).bind("mouseup.button",function(d){if(!c.disabled)if(i!==d.pageX||j!==d.pageY)g=true})}if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled||g)return false;b(this).toggleClass("ui-state-active");a.buttonElement.attr("aria-pressed",a.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled||g)return false;b(this).addClass("ui-state-active");a.buttonElement.attr("aria-pressed",true); +var d=a.element[0];k(d).not(d).map(function(){return b(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;b(this).addClass("ui-state-active");h=this;b(document).one("mouseup",function(){h=null})}).bind("mouseup.button",function(){if(c.disabled)return false;b(this).removeClass("ui-state-active")}).bind("keydown.button",function(d){if(c.disabled)return false;if(d.keyCode==b.ui.keyCode.SPACE|| +d.keyCode==b.ui.keyCode.ENTER)b(this).addClass("ui-state-active")}).bind("keyup.button",function(){b(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(d){d.keyCode===b.ui.keyCode.SPACE&&b(this).click()})}this._setOption("disabled",c.disabled);this._resetButton()},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type=== +"radio"){var a=this.element.parents().filter(":last"),c="label[for="+this.element.attr("id")+"]";this.buttonElement=a.find(c);if(!this.buttonElement.length){a=a.length?a.siblings():this.element.siblings();this.buttonElement=a.filter(c);if(!this.buttonElement.length)this.buttonElement=a.find(c)}this.element.addClass("ui-helper-hidden-accessible");(a=this.element.is(":checked"))&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",a)}else this.buttonElement=this.element}, +widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle||this.buttonElement.removeAttr("title"); +b.Widget.prototype.destroy.call(this)},_setOption:function(a,c){b.Widget.prototype._setOption.apply(this,arguments);if(a==="disabled")c?this.element.attr("disabled",true):this.element.removeAttr("disabled");else this._resetButton()},refresh:function(){var a=this.element.is(":disabled");a!==this.options.disabled&&this._setOption("disabled",a);if(this.type==="radio")k(this.element[0]).each(function(){b(this).is(":checked")?b(this).button("widget").addClass("ui-state-active").attr("aria-pressed",true): +b(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var a=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"), +c=b("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(a.empty()).text(),e=this.options.icons,f=e.primary&&e.secondary,d=[];if(e.primary||e.secondary){if(this.options.text)d.push("ui-button-text-icon"+(f?"s":e.primary?"-primary":"-secondary"));e.primary&&a.prepend("<span class='ui-button-icon-primary ui-icon "+e.primary+"'></span>");e.secondary&&a.append("<span class='ui-button-icon-secondary ui-icon "+e.secondary+"'></span>");if(!this.options.text){d.push(f?"ui-button-icons-only": +"ui-button-icon-only");this.hasTitle||a.attr("title",c)}}else d.push("ui-button-text-only");a.addClass(d.join(" "))}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(a,c){a==="disabled"&&this.buttons.button("option",a,c);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var a=this.element.css("direction")=== +"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(a?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(a?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"); +b.Widget.prototype.destroy.call(this)}})})(jQuery); +;/* + * jQuery UI Dialog 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, +position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ +b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g), +h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id", +e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); +a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!== +b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+= +1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target=== +f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a, +function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('<button type="button"></button>').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", +handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition, +originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize", +f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "): +[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f); +if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"): +e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a= +this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height- +b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.14",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), +create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), +height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); +b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,function(){a= +a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery); +;/* + * jQuery UI Slider 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var b=this,a=this.options,c=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),f=a.values&&a.values.length||1,e=[];this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+ +this.orientation+" ui-widget ui-widget-content ui-corner-all"+(a.disabled?" ui-slider-disabled ui-disabled":""));this.range=d([]);if(a.range){if(a.range===true){if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}this.range=d("<div></div>").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(a.range==="min"||a.range==="max"?" ui-slider-range-"+a.range:""))}for(var j=c.length;j<f;j+=1)e.push("<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>"); +this.handles=c.add(d(e.join("")).appendTo(b.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle", +g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!b.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");i=b._start(g,l);if(i===false)return}break}m=b.options.step;i=b.options.values&&b.options.values.length? +(h=b.values(l)):(h=b.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=b._valueMin();break;case d.ui.keyCode.END:h=b._valueMax();break;case d.ui.keyCode.PAGE_UP:h=b._trimAlignValue(i+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=b._trimAlignValue(i-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===b._valueMax())return;h=b._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===b._valueMin())return;h=b._trimAlignValue(i- +m);break}b._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(g,k);b._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); +return this},_mouseCapture:function(b){var a=this.options,c,f,e,j,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(a.range===true&&this.values(1)===a.min){g+=1;e=d(this.handles[g])}if(this._start(b,g)===false)return false; +this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();a=e.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-e.width()/2,top:b.pageY-a.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(b){var a= +this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;if(this.orientation==="horizontal"){a= +this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a); +c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var f;if(this.options.values&&this.options.values.length){f=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>f||a===1&&c<f))c=f;if(c!==this.values(a)){f=this.values();f[a]=c;b=this._trigger("slide",b,{handle:this.handles[a],value:c,values:f});this.values(a?0:1);b!==false&&this.values(a,c,true)}}else if(c!==this.value()){b=this._trigger("slide",b,{handle:this.handles[a],value:c}); +b!==false&&this.value(c)}},_stop:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("stop",b,c)},_change:function(b,a){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("change",b,c)}},value:function(b){if(arguments.length){this.options.value= +this._trimAlignValue(b);this._refreshValue();this._change(null,0)}else return this._value()},values:function(b,a){var c,f,e;if(arguments.length>1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e<c.length;e+=1){c[e]=this._trimAlignValue(f[e]);this._change(null,e)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(b): +this.value();else return this._values()},_setOption:function(b,a){var c,f=0;if(d.isArray(this.options.values))f=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(b){case "disabled":if(a){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation(); +this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<f;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var b=this.options.value;return b=this._trimAlignValue(b)},_values:function(b){var a,c;if(arguments.length){a=this.options.values[b]; +return a=this._trimAlignValue(a)}else{a=this.options.values.slice();for(c=0;c<a.length;c+=1)a[c]=this._trimAlignValue(a[c]);return a}},_trimAlignValue:function(b){if(b<=this._valueMin())return this._valueMin();if(b>=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, +_refreshValue:function(){var b=this.options.range,a=this.options,c=this,f=!this._animateOff?a.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},a.animate); +if(h===1)c.range[f?"animate":"css"]({width:e-g+"%"},{queue:false,duration:a.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},a.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:a.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1, +1)[f?"animate":"css"]({width:e+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.14"})})(jQuery); +;/* + * jQuery UI Tabs 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& +e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= +d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| +(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ +g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", +function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; +this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= +-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= +d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, +e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); +j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); +if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, +this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, +load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, +"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.14"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&& +a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery); +;/* + * jQuery UI Datepicker 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * jquery.ui.core.js + */ +(function(d,C){function M(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass= +"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su", +"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10", +minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=N(d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}function N(a){return a.bind("mouseout",function(b){b= +d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");b.length&&b.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])||!b.length)){b.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");b.addClass("ui-state-hover"); +b.hasClass("ui-datepicker-prev")&&b.addClass("ui-datepicker-prev-hover");b.hasClass("ui-datepicker-next")&&b.addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==C)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.14"}});var A=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){H(this._defaults, +a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0, +selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]= +h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c= +this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f==""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a, +"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker", +function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput); +a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left", +this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus", +this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b= +b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5", +cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false}, +_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"?d.extend({},e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&this._hideDatepicker();var h=this._getDateDatepicker(a,true),i=this._getMinMaxDate(e,"min"),g=this._getMinMaxDate(e, +"max");H(e.settings,f);if(i!==null&&f.dateFormat!==C&&f.minDate===C)e.settings.minDate=this._formatDate(e,i);if(g!==null&&f.dateFormat!==C&&f.maxDate===C)e.settings.maxDate=this._formatDate(e,g);this._attachments(d(a),e);this._autoSize(e);this._setDate(e,h);this._updateAlternate(e);this._updateDatepicker(e)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a, +b);this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl");b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass+":not(."+d.datepicker._currentClass+")",b.dpDiv); +c[0]?d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]):d.datepicker._hideDatepicker();return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target); +c=a.ctrlKey||a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey|| +a.metaKey)d.datepicker._adjustDate(a.target,e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,+7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b= +d.datepicker._getInst(a.target);if(d.datepicker._get(b,"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));var c=String.fromCharCode(a.charCode==C?a.keyCode:a.charCode);return a.ctrlKey||a.metaKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a); +d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);if(d.datepicker._curInst&&d.datepicker._curInst!=b){d.datepicker._datepickerShowing&&d.datepicker._triggerOnClose(d.datepicker._curInst);d.datepicker._curInst.dpDiv.stop(true,true)}var c= +d.datepicker._get(b,"beforeShow");H(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c= +{left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover"); +if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing=true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){this.maxRows=4;var b=d.datepicker._getBorders(a.dpDiv); +J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi"); +a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]|| +c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+ +i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_triggerOnClose:function(a){var b=this._get(a,"onClose");if(b)b.apply(a.input?a.input[0]:null,[a.input?a.input.val():"",a])},_hideDatepicker:function(a){var b= +this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();d.datepicker._triggerOnClose(b);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute", +left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&& +d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth= +b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear= +!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a); +a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a)); +d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()% +100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=B+1<a.length&&a.charAt(B+1)==p)&&B++;return p},m=function(p){var D=o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"&&D?4:p=="o"?3:2)+"}");p=b.substring(q).match(p);if(!p)throw"Missing number at position "+q;q+= +p[0].length;return parseInt(p[0],10)},n=function(p,D,K){p=d.map(o(p)?K:D,function(w,x){return[[x,w]]}).sort(function(w,x){return-(w[1].length-x[1].length)});var E=-1;d.each(p,function(w,x){w=x[1];if(b.substr(q,w.length).toLowerCase()==w.toLowerCase()){E=x[0];q+=w.length;return false}});if(E!=-1)return E+1;else throw"Unknown name at position "+q;},s=function(){if(b.charAt(q)!=a.charAt(B))throw"Unexpected literal at position "+q;q++},q=0,B=0;B<a.length;B++)if(k)if(a.charAt(B)=="'"&&!o("'"))k=false; +else s();else switch(a.charAt(B)){case "d":l=m("d");break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":j=m("m");break;case "M":j=n("M",i,g);break;case "y":c=m("y");break;case "@":var v=new Date(m("@"));c=v.getFullYear();j=v.getMonth()+1;l=v.getDate();break;case "!":v=new Date((m("!")-this._ticksTo1970)/1E4);c=v.getFullYear();j=v.getMonth()+1;l=v.getDate();break;case "'":if(o("'"))s();else k=true;break;default:s()}if(q<b.length)throw"Extra/unparsed characters found in date: "+b.substring(q); +if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y", +TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+1<a.length&&a.charAt(k+1)==o)&&k++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length< +n;)m="0"+m;return m},j=function(o,m,n,s){return i(o)?s[m]:n[m]},l="",u=false;if(b)for(var k=0;k<a.length;k++)if(u)if(a.charAt(k)=="'"&&!i("'"))u=false;else l+=a.charAt(k);else switch(a.charAt(k)){case "d":l+=g("d",b.getDate(),2);break;case "D":l+=j("D",b.getDay(),e,f);break;case "o":l+=g("o",Math.round(((new Date(b.getFullYear(),b.getMonth(),b.getDate())).getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864E5),3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=j("M",b.getMonth(),h, +c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+="'";else u=true;break;default:l+=a.charAt(k)}return l},_possibleChars:function(a){for(var b="",c=false,e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f=0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+= +"0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==C?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a);var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth= +f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var e=function(h){var i=new Date;i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g= +(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,j=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,k=u.exec(h);k;){switch(k[2]||"d"){case "d":case "D":g+=parseInt(k[1],10);break;case "w":case "W":g+=parseInt(k[1],10)*7;break;case "m":case "M":l+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break;case "y":case "Y":j+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break}k=u.exec(h)}return new Date(j, +l,g)};if(b=(b=b==null||b===""?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):new Date(b.getTime()))&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay= +a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(), +b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n= +this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&n<k?k:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+A+".datepicker._adjustDate('#"+a.id+"', -"+j+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+ +(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>";var s=this._get(a,"nextText");s=!h?s:this.formatDate(s,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+A+".datepicker._adjustDate('#"+a.id+"', +"+j+", 'M');\" title=\""+s+'"><span class="ui-icon ui-icon-circle-triangle-'+ +(c?"w":"e")+'">'+s+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+s+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+s+"</span></a>";j=this._get(a,"currentText");s=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,s,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+A+'.datepicker._hideDatepicker();">'+this._get(a, +"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,s)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+A+".datepicker._gotoToday('#"+a.id+"');\">"+j+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),B= +this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x<i[0];x++){var O="";this.maxRows=4;for(var G=0;G<i[1];G++){var P=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",y="";if(l){y+='<div class="ui-datepicker-group';if(i[1]>1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right": +"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&&x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,B,v)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var z=j?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>": +"";for(t=0;t<7;t++){var r=(t+h)%7;z+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+s[r]+'">'+q[r]+"</span></th>"}y+=z+"</tr></thead><tbody>";z=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,z);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;z=Math.ceil((t+z)/7);this.maxRows=z=l?this.maxRows>z?this.maxRows:z:z;r=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q<z;Q++){y+="<tr>";var R=!j?"":'<td class="ui-datepicker-week-col">'+ +this._get(a,"calculateWeek")(r)+"</td>";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&r<k||o&&r>o;R+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(F?" ui-datepicker-other-month":"")+(r.getTime()==P.getTime()&&g==a.selectedMonth&&a._keyEvent||E.getTime()==r.getTime()&&E.getTime()==P.getTime()?" "+this._dayOverClass:"")+(L?" "+this._unselectableClass+" ui-state-disabled":"")+(F&&!D?"":" "+I[1]+(r.getTime()==u.getTime()?" "+ +this._currentClass:"")+(r.getTime()==b.getTime()?" ui-datepicker-today":""))+'"'+((!F||D)&&I[2]?' title="'+I[2]+'"':"")+(L?"":' onclick="DP_jQuery_'+A+".datepicker._selectDay('#"+a.id+"',"+r.getMonth()+","+r.getFullYear()+', this);return false;"')+">"+(F&&!D?" ":L?'<span class="ui-state-default">'+r.getDate()+"</span>":'<a class="ui-state-default'+(r.getTime()==b.getTime()?" ui-state-highlight":"")+(r.getTime()==u.getTime()?" ui-state-active":"")+(F?" ui-priority-secondary":"")+'" href="#">'+ +r.getDate()+"</a>")+"</td>";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+"</tr>"}g++;if(g>11){g=0;m++}y+="</tbody></table>"+(l?"</div>"+(i[0]>0&&G==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"), +l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='<div class="ui-datepicker-title">',o="";if(h||!j)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+A+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+A+".datepicker._clickMonthYear('#"+a.id+"');\">";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&&(!m||n<=f.getMonth()))o+='<option value="'+ +n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()): +g;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+A+".datepicker._selectMonthYear('#"+a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+A+".datepicker._clickMonthYear('#"+a.id+"');\">";b<=g;b++)a.yearshtml+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";a.yearshtml+="</select>";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="</div>";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c== +"Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear"); +if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a); +c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a, +"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker= +function(a){if(!this.length)return this;if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker, +[this[0]].concat(b));return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.14";window["DP_jQuery_"+A]=d})(jQuery); +;/* + * jQuery UI Progressbar 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); +this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* +this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.14"})})(jQuery); +;/* + * jQuery UI Effects 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], +16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, +a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= +a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", +"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, +0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, +211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, +d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easing:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})}; +f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this, +[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.14",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c,a){var b;switch(c[0]){case "top":b= +0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}); +c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);return c},setTransition:function(c, +a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments); +a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%", +"pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d* +((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/= +e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/= +e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/ +h);return-(h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*a)*Math.sin((a*e-c)*2*Math.PI/g)+d+b},easeInOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g||(g=e*0.3*1.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);if(a<1)return-0.5* +h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)+b;return h*Math.pow(2,-10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)*0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*(a/=e)*a*((g+1)*a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*((a=a/e-1)*a*((g+1)*a+g)+1)+b},easeInOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;if((a/=e/2)<1)return d/2*a*a*(((g*=1.525)+1)*a-g)+b;return d/2*((a-=2)*a*(((g*=1.525)+1)*a+g)+2)+b},easeInBounce:function(c,a,b,d,e){return d-f.easing.easeOutBounce(c, +e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d*7.5625*a*a+b:a<2/2.75?d*(7.5625*(a-=1.5/2.75)*a+0.75)+b:a<2.5/2.75?d*(7.5625*(a-=2.25/2.75)*a+0.9375)+b:d*(7.5625*(a-=2.625/2.75)*a+0.984375)+b},easeInOutBounce:function(c,a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a*2,0,d,e)*0.5+b;return f.easing.easeOutBounce(c,a*2-e,0,d,e)*0.5+d*0.5+b}})}(jQuery); +;/* + * jQuery UI Effects Blind 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","bottom","left","right"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a, +g);b.effects.removeWrapper(a);c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery); +;/* + * jQuery UI Effects Bounce 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * jquery.effects.core.js + */ +(function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","bottom","left","right"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/ +3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c*2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a); +b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery); +;/* + * jQuery UI Effects Clip 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","bottom","left","right","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position, +c/2)}var h={};h[g.size]=f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Drop 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e== +"show"?1:0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Explode 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * jquery.effects.core.js + */ +(function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f= +0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ +e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); +;/* + * jQuery UI Effects Fade 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Fold 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], +10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); +;/* + * jQuery UI Effects Highlight 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& +this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Pulsate 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration, +a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery); +;/* + * jQuery UI Effects Scale 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a, +b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity= +1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","bottom","left","right","width","height","overflow","opacity"],g=["position","top","bottom","left","right","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"], +p=c.effects.setMode(a,b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}}; +if(m=="box"||m=="both"){if(d.from.y!=d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a); +a.css("overflow","hidden").css(a.from);if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from); +child.to=c.effects.setTransition(child,f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a, +n?e:g);c.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Shake 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * jquery.effects.core.js + */ +(function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","bottom","left","right"];d.effects.setMode(b,a.options.mode||"effect");var c=a.options.direction||"left",e=a.options.distance||20,l=a.options.times||3,f=a.duration||a.options.duration||140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"||c=="down"?"top":"left",h=c=="up"||c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]= +(h=="pos"?"-=":"+=")+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery); +;/* + * jQuery UI Effects Slide 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right"],f=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var g=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var e=d.options.distance||(g=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(f=="show")a.css(g,b=="pos"?isNaN(e)?"-"+e:-e:e); +var i={};i[g]=(f=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+e;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){f=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Transfer 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * jquery.effects.core.js + */ +(function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); +b.dequeue()})})}})(jQuery); +;
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/src/d3.control.js b/ebus-datastore/ebus/web_static/src/d3.control.js new file mode 100644 index 0000000..489edea --- /dev/null +++ b/ebus-datastore/ebus/web_static/src/d3.control.js @@ -0,0 +1,120 @@ +var d3_control = function(element, svgurl, mapping) { + this.mapping = mapping; + this.element = element; + var control = this; + d3.xml(svgurl, "image/svg+xml", function(xml) { + element[0][0].appendChild(xml.documentElement); + element.select("svg") + .style("width","100%").style("height", "100%"); + + // Setup mapping + for (var element_id in this.mapping) { + control.initElement(element_id); + } + d3.json("../all_values", function(response) { + control.process(response.data); + control.reload(response.time_stop); + }); + }); +}; + +d3_control.prototype = { + initElement:function(element_id) { + var options = this.mapping[element_id]; + d3.select(document.getElementById(element_id)) + .on("mouseover", + function() { + if( typeof(options._plot) == "undefined") { + options._plot = d3.select(this.ownerSVGElement) + .append("svg:g") + .classed("d3.control_popup", true); + + var startdate = (new Date().getTime()/1000) - 7*60*60*24; + var enddate = (new Date().getTime()/1000); + var plot = d3.plot(options._plot); + d3.json("../sensor/"+options.sensor+"/" + startdate + "/" + enddate, + function(resp) { + var data = resp.data.map(function(d) { + return [new Date(d[0]), d[1]]; + }); + plot.draw(data); + }); + + options._plot.on("mouseout", + function() { + if (options._plot.node().contains(d3.event.relatedTarget)) + return; + options._plot + .transition() + .duration(1000) + .style("opacity", 0.0) + .remove(); + }); + + var drag = d3.behavior.drag() + .on("dragstart", function() { + options._plot.on("mouseout", null); + options._plot.transition().duration(1000).style("opacity", 1.0); + + delete options._plot; + d3.select(this).select("rect") + .style("stroke", "gray") + .style("stroke-width", "3px"); + }) + .on("drag", function(d,i){ + d=[]; + d.x = d3.event.x; + d.y = d3.event.y; + d3.select(this).attr("transform", "translate("+d.x+","+d.y+")"); + }) + .on("dragend", function() { + d3.select(this).on("mousedown.drag", null); + d3.select(this).on("click", function() { d3.select(this).remove(); }); + }); + + options._plot.call(drag); + } else { + this.ownerSVGElement + .appendChild(options._plot.node()); + + options._plot.style("opacity", 1); + } + + var xy = d3.svg.mouse(this.ownerSVGElement); + options._plot.attr("transform", "translate("+xy[0]+","+xy[1]+")"); + }); + }, + process:function(data) { + for (var i in data) { + var row = data[i]; + + if (typeof(console) != "undefined") { + console.log("[" + d3.format("02d")(row.timestamp) + "] " + + row.name + " Value: " + row.value_real + " - " + + row.value_string); + } + + for (var element_id in this.mapping) { + var options = this.mapping[element_id]; + if (row.name == options.sensor){ + d3.select(document.getElementById(element_id)) + .text(""+row.value_real); + } + } + } + }, + reload:function(time_stop) { + var url = "../stream"; + if (time_stop != null) + url += "/" + time_stop; + var control = this; + d3.json(url, function(response) { + control.process(response.data); + control.reload(response.time_stop); + }); + } +}; + +d3.control = function(element, svgurl, mapping) { + return new d3_control(element,svgurl,mapping); +}; diff --git a/ebus-datastore/ebus/web_static/src/d3.plot.js b/ebus-datastore/ebus/web_static/src/d3.plot.js new file mode 100644 index 0000000..d9a7d04 --- /dev/null +++ b/ebus-datastore/ebus/web_static/src/d3.plot.js @@ -0,0 +1,99 @@ +(function(){ + +function d3_plot(container) { + this.opt = { + w:550, h:200, margin:30 + }; + this.element = container.append("svg:g") + .classed("d3.plot_plot",true) + .attr("width", this.opt.w) + .attr("height", this.opt.h); + + this.element.append("svg:rect") + .attr("width", this.opt.w) + .attr("height", this.opt.h) + .style("fill", "white"); + + this.element.append("svg:text") + .classed("d3-plot_wait", true) + .attr("x", this.opt.w/2) + .attr("y", this.opt.h/2) + .attr("text-anchor", "center") + .text("Bitte warten"); +}; + +d3_plot.prototype = { + draw: function(data) { + var x_min = d3.min(data, function(d){return d[0];}), + x_max = d3.max(data, function(d){return d[0];}), + y_min = d3.min(data, function(d){return d[1];}), + y_max = d3.max(data, function(d){return d[1];}); + + var x = d3.time.scale() + .domain([x_min, x_max]) + .range([0+this.opt.margin, this.opt.w-this.opt.margin]); + + var y = d3.scale.linear() + .domain([y_min, y_max]) + .range([0+this.opt.margin, this.opt.h-(this.opt.margin/2)]); + + + var g = this.element.append("svg:g") + .attr("transform", "translate(0, "+this.opt.h+")"); + + var line = d3.svg.line() + .x(function(d,i){ return x(d[0]); }) + .y(function(d) {return -1*y(d[1]);}); + + g.append("svg:path") + .attr("d", line(data)); + + // Axes X-Line + g.append("svg:line") + .attr("x1", 0) + .attr("y1", -1*y(y_min)) + .attr("x2", x(x_max)) + .attr("y2", -1 * y(y_min)); + + + // Tick Labels + var tick_format = d3.time.format("%d.%m"); + g.selectAll(".xlabel") + .data(x.ticks(5)).enter() + .append("svg:text") + .text(function(d){return tick_format(d);}) + .attr("x", function(d) {return x(d);}) + .attr("y", -5) + .attr("text-anchor", "center"); + + g.selectAll(".ylabel") + .data(y.ticks(5)).enter() + .append("svg:text") + .text(String) + .attr("x", 0) + .attr("y", function(d) {return -1*y(d);}) + .attr("text-anchor", "right"); + + // X-Lines + g.selectAll(".xlines") + .data(x.ticks(5)).enter() + .append("svg:line") + .style("fill", "none") + .style("stroke", "#000000") + .style("stroke-width", 0.5) + .style("stroke-dasharray", "6,1") + .attr("x1", function(d){return x(d);}) + .attr("y1", -1*y(y_min)+(this.opt.margin/3)) + .attr("x2", function(d){return x(d);}) + .attr("y2", -1*y(y_max)); + + // + this.element.select(".d3-plot_wait").style("display","none"); + } +}; + +d3.plot = function(container) { + return new d3_plot(container); +}; + +})();
\ No newline at end of file diff --git a/ebus-datastore/ebus/web_static/src/ebus.js b/ebus-datastore/ebus/web_static/src/ebus.js new file mode 100644 index 0000000..27802a9 --- /dev/null +++ b/ebus-datastore/ebus/web_static/src/ebus.js @@ -0,0 +1,231 @@ +// vim: autoindent tabstop=4 shiftwidth=4 expandtab softtabstop=4 filetype=javascript +var d = new Object(); +d.ms = 1; +d.sec = 1000*d.ms; +d.min = 60 * d.sec; +d.hour = 60 * d.min; +d.day = 24 * d.hour; +d.week = 7 * d.day; +d.month = 30.5 * d.day; +d.now = new Date().getTime(); + +var timeToUTC = function(d) { return d - new Date().getTimezoneOffset() * 60 * 1000; } +var timeToLocal = function(d) { return d + new Date().getTimezoneOffset() * 60 * 1000; } + +$(document).ready(function(){ + var from = d.now - 1*d.day; + var to = d.now; + var fromOverview = d.now - 30*d.day; + var toOverview = d.now; + var datasetDetail = [] + var datasetOverview = []; + var plotOverview = null; + var plotDetail = null; + var indexFound = null; + var sensorConfigList = [ + {"sensorname":"heizkreisregler9.solarDaten.tempKollektor", + "description":"Kollektortemperatur", + "show":true, + "color":"#f30000"}, + {"sensorname":"heizkreisregler10.betriebsdatenRegler1.kesselTemperatur", + "description":"Kessel Temperatur", + "show":true, + "color":"#283074"}, + {"sensorname":"heizkreisregler9.solarDaten.tempWarmwasserSolar", + "description":"Warmwasser Solar", + "show":false, + "color":"#f0ff4c"}, + {"sensorname":"feuerungsautomat1.betriebsdatenRegler1.aussenTemperatur", + "description":"Aussentemperatur", + "show":false, + "color":"#84b500"}, + {"sensorname":"dockstar.load1", + "description":"System Load (1m, *10)", + "show":false, + "color":"blue", + "mapFunc":function(d){return [d[0],d[1]*10]}}, + {"sensorname":"dockstar.load5", + "description":"System Load (5m, *10)", + "show":false, + "color":"blue", + "mapFunc":function(d){return [d[0],d[1]*10]}}, + {"sensorname":"dockstar.diskfree.rootfs", + "description":"Rootfs free percent", + "show":false, + "color":"red"}, + {"sensorname":"heizkreisregler10.betriebsdatenRegler1.boilerTemperatur", + "description":"Boilertemperatur", + "show":true, + "color":"#48b4ff"}, + {"sensorname":"feuerungsautomat1.betriebsdatenRegler1.kesselTemperatur", + "description":"Kesseltemperatur", + "show":false, + "color":"blue"}, + {"sensorname":"de.wettermichel.temperature", + "description":"Aussentemperatur", + "show":true, + "color":"yellow"}, + {"sensorname":"yves.laserjet.tonerstatus", + "description":"Fuellstand Toner %", + "show":true, + "color":"black"} + ]; + + var pickSensorConfig = function(sensorname) { + var sensorConfigFound; + $.each(sensorConfigList, function(i,sensorConfig) { + if (sensorConfig.sensorname == sensorname) { + sensorConfigFound = sensorConfig; + return false; + } + }); + return sensorConfigFound; + } + var replot = function() { + plotDetail = $.plot($("#ebusgraph"), + datasetDetail, + { + xaxis: { mode: "time", min: timeToUTC(from), max:timeToUTC(to) }, + yaxis: { min: -16, max: 100 }, + legend: { show : true} + }); + }; + var replotOverview = function() { + if (plotOverview == null) { + plotOverview = $.plot($("#overview"), + datasetOverview, + { // options + series: { + lines: { show: true, lineWidth: 1 }, + shadowSize: 0 + }, + xaxis: { mode: "time", min: timeToUTC(fromOverview), max:timeToUTC(toOverview) }, + yaxis: { ticks: [], min: -26, max: 100, autoscaleMargin: 0.1 }, + legend: { show: false }, + selection: { mode: "x" } + }); + } else { + plotOverview.setData(datasetOverview); + plotOverview.draw(); + } + plotOverview.setSelection({xaxis: {'from': from, 'to': to}}, true); + }; + var plotSensor = function(sensorConfig) { + plotSensorDetail(sensorConfig); + plotSensorOverview(sensorConfig); + }; + var unplotSensor = function(sensorname) { + unplotSensorDetail(sensorname); + unplotSensorOverview(sensorname); + }; + var plotSensorDetail = function(sensorConfig) { + $.getJSON("sensor/"+escape(sensorConfig.sensorname)+"/"+timeToLocal(from)+"/"+timeToLocal(to), + function(response) { + if (!response.error) { + response.data = response.data.map(function(d) { + return [ timeToUTC(d[0]), d[1] ]; + }); + if (sensorConfig.mapFunc) { + response.data = response.data.map( sensorConfig.mapFunc ) + } + datasetDetail.push({'data':response['data'], + 'userData':sensorConfig.sensorname, + 'label':sensorConfig.description, + 'color':sensorConfig.color}); + replot(); + } else { + alert("Fehler: " + response["error"]); + } + }); + }; + + var unplotSensorDetail = function(sensorname) { + $.each(datasetDetail, function(i, sensor) { + if (sensor.userData == sensorname) { + datasetDetail.splice(i,1); + replot(); + return false; + } + }); + }; + + var plotSensorOverview = function(sensorConfig) { + $.getJSON("avg/"+escape(sensorConfig.sensorname)+"/"+timeToLocal(fromOverview)+"/"+timeToLocal(toOverview), + function(response) { + if (!response.error) { + response.data = response.data.map(function(d) { + return [ timeToUTC(d[0]), d[1] ]; + }); + if (sensorConfig.mapFunc) { + response.data = response.data.map( sensorConfig.mapFunc) + } + datasetOverview.push({'data':response['data'], + 'label':sensorConfig.sensorname, + 'color':sensorConfig.color}); + replotOverview(); + } else { + alert("Overview Fehler: " + response["error"]); + } + }); + + }; + var unplotSensorOverview = function(sensorname) { + $.each(datasetOverview, function(i, sensor) { + if (sensor.label == sensorname) { + datasetOverview.splice(i,1); + replotOverview(); + return false; + } + }); + } + + $("#overview").bind("plotselected", function (event, ranges) { + range_from = Math.round(ranges.xaxis.from); + range_to = Math.round(ranges.xaxis.to); + // max selection range + if (range_to - range_from > d.month) { + // reset selection + plotOverview.setSelection({xaxis: {'from': from, 'to': to}}, true); + return; + } else { + from = timeToLocal( range_from ); + to = timeToLocal( range_to ); + } + sensors = []; + for (elem in datasetOverview) { + sensor = datasetDetail[elem]["userData"]; + sensors.push(sensor); + } + datasetDetail =[]; + for (i in sensors) { + plotSensorDetail(pickSensorConfig(sensors[i])); + } + }); + + $.each(sensorConfigList, function(i,sensorConfig) { + var pickerDiv = $("<div>").attr("id","pick_"+sensorConfig.sensorname.replace(/\./g,"_")) + .addClass("picker") + .appendTo("#sensorpicker"); + + var pickerCheckbox = $("<input>").attr("type","checkbox") + .appendTo(pickerDiv); + pickerDiv.append($("<span>").text( sensorConfig.description + " (" + sensorConfig.sensorname + ")") ); + if (sensorConfig.show) { + //Plot + plotSensor(sensorConfig); + $(pickerCheckbox).attr("checked","checked"); + } + }); + // TODO http://people.iola.dk/olau/flot/examples/annotating.html + + + $('.picker input').click( function() { + var sensorname = $(this).parent().attr("id").replace("pick_","").replace(/_/g,"."); + if ($(this).is(":checked")) { + if (typeof console != "undefined") console.log(sensorname); + plotSensor(pickSensorConfig(sensorname)); + } else { + unplotSensor(sensorname); + } + }); +}); |